|   | 
                  
                       | 
                      | 
                    
                        
                            
                                | 
                                  
                                 | 
                             
                             |  
                            
                                
                                    
                                        
  
    
	  | 
   
  
    
        
          |   | 
          
              
                | 
                    Æ®·ÎÆÄ¹Ìµå1%Æ÷¸£Å×Á¡¾È¾×(Æ®·ÎÇȾƹ̵å)  TROPAMID FORTE EYE DROP[Tropicamide]  
                    
                 | 
               
              
                | 
                     Àü¹®ÀǾàǰ | »èÁ¦  
                        
                    	
                    
                 | 
               
              
                | 
					
                     
                     ¼öÀÔÀǾàǰ
	                
                  
				  
                 | 
               
              
              
              
              
              |   |  
              
                
                    
                        | 
                      ¾Ë¸²:  | 
                      µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. | 
                     
                    | 
               
            
              
                
                   
                   
                   
                   
		   
                 | 
               
              
                | 
                  
                  
                 | 
               
              | 
            | 
         
       
       | 
   
    |  
  
    | 
      
     | 
     
  |                   
                                        | 
                                             | 
                                         
                            
                                
                            
                            
                              
                                                        
                              
                                                
                            
 |   
    | 
      
     | 
 
 |  
    
   
    | 
       
        À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
        ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
        À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
        ·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
       
     | 
   
  
     | 
   
  
  
    
      
  
    
       |  
      
        
          
            
                | Çã°¡Á¤º¸ | 
             
           
         | 
       
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
  
  
  
   
    û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå  »óÇÑ±Ý¾× | 
    
      
      
        
        654002640[W23060091]  
	    
	    
            [º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸] 
          
        
        
        
          
          
            \0 ¿ø/1ml(2007.03.01)(ÇöÀç¾à°¡)
            \435 ¿ø/1ml(2004.09.10)(º¯°æÀü¾à°¡)
        
          
            
	 
  	   
  	   
       
      
       
       
     
      
      
     
      
    
    
    
      
     [»óº´ÄÚµåÁ¶È¸]
      
      [Áúº´ÄÚµåÁ¶È¸]
     
     | 
   
   
    | ºü¸¥Á¶È¸ | 
    
      
     |   
   
  
  
  
   
    | Á¦Ç°¼º»ó | 
    ¹«»öÅõ¸íÇÑ ¿ë¾×  [Á¦ÇüÁ¤º¸ È®ÀÎ] |   
   
  
  
  
  
  
   
    | Æ÷À塤À¯Åë´ÜÀ§ | 
    5ml, 1's | 
   
  
  
  
  
  
  
  
 
  
  
    
  
  
  
  
  
  
  
  
  
  
 
  
  
  
 
  
  
  
  
  
  
   
    | Çã°¡»çÇ× ¿ø¹®Á¶È¸ | 
    
      
	    [Çã°¡»çÇ× ¿ø¹®Á¶È¸] 
     | 
   
  
  
  
  
     
  
  
  
   
    | È¿´ÉÈ¿°ú | 
    
    [ÀûÀÀÁõ º° °Ë»ö] 
      
    
     
	 
      ¾È°úÁø´Ü¿ë »êµ¿, Á¶Àý¸¶ºñ
      
     | 
   
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
    
  
  
  
  
  
   
    | ¿ë¹ý¿ë·® | 
    
      * Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù. 
    
     
      
      
      [󹿾à¾î] 
      [ÁÖ¼ººÐÄÚµå:245301COS ¿¡ µû¸¥ ½É»çÁöħ¿¶÷] 
Á¶Àý ¸¶ºñ¼º ±¼Àý: 1ȸ 1-2¹æ¿ïÀ» 5ºÐ °£°Ý ¹Ýº¹ Åõ¿© ÈÄ 20-30ºÐ³» Àߺ¼¼ö ¾ø´Â ȯÀÚ´Â »êµ¿È¿°ú¸¦ Áö¼ÓÇϱâ À§ÇÏ¿© Ãß°¡·Î Á¡¾ÈÇÒ ¼ö ÀÖ´Ù. 
¾ÈÀú°Ë»ç: °Ë»ç 15-20ºÐÀü¿¡ 1¹æ¿ï Á¡¾ÈÇÑ´Ù. 
Áõ»ó¿¡ µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù. 
[Á¦Çüº°º¹¾àÁöµµ]     
      	
     | 
   
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
   
    | ±Ý±â | 
    ³ì³»Àå ¶Ç´Â Æó¼â°¢ µî ³ì³»Àå ¼ÒÀÎÀÌ Àִ ȯÀÚ, º»Á¦¿¡ °ú¹ÎÁõ ȯÀÚ | 
   
  
  
  
  
   
    | ½ÅÁßÅõ¿© | 
    ¼Ò¾Æ ¹× º§¶óµ·³ª ¾Ëų·ÎÀ̵忡 °¨¼ö¼º ȯÀÚ(Àü½Åµ¶¼ºÀÇ À§ÇèÀÌ ÀÖ´Ù). | 
   
  
    
  
  
  
  
  
   
    | ÀÌ»ó¹ÝÀÀ | 
    
      -  ¼Ò¾Æ¿Í ¼ºÀο¡¼ ¾È¾Ð»ó½Â, Á¤½Å¹ÝÀÀ, ÇൿÀå¾Ö, ½ÉÆó ÇãÅ», ¹ßÁø, º¹ºÎÆØ¸¸ µîÀÌ ¹ß»ýÇÑ º¸°í°¡ ÀÖ´Ù. ÀϽÃÀûÀÎ ÀÚÅë, ±¸°°ÇÁ¶Áõ, ½Ã¾ßÈ帲, ´«ºÎ½É, ºó¸Æ, ºÎ±³°¨½Å°æÈïºÐ ¶Ç´Â ¾Ë·¯Áö ¹ÝÀÀ µîÀÌ ÀϾ ¼ö ÀÖ´Ù.
 -  Àå±âÅõ¿©½Ã ±¹¼ÒÀÚ±Ø, ÃæÇ÷, ºÎÁ¾, °á¸·¿°ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
 -  Àü½ÅÀûÀÎ Ç×Äݸ° µ¶¼ºÀ¸·Î È«Á¶, ÇǺΰÇÁ¶°¨, ¼¸Æ¿¡ ÀÌÀº ½É°èÇ×Áø°ú ºÎÁ¤¸Æ, ºó¸Æ, ±Þ´¢, ¹è´¢Àå¾Ö, º¯ºñ µî À§Àå°ü ¿îµ¿¼ºÀÇ °¨¼Ò°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ±¸Åä, ¾îÁö·¯¿òÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
À¯¡¤¼Ò¾Æ¿¡°Ô´Â ½É°¢ÇÑ ÁßÃ߽ŰæÀå¾Ö°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
      
    
 
  | 
   
        
  
  
    
   
    | »óÈ£ÀÛ¿ë | 
    Ç×¹«½ºÄ«¸° ¾à¹°Àº ¾Æ¹ÎŸµò, ¸î¸î Ç×È÷½ºÅ¸¹ÎÁ¦, ºäƼ·ÎÆä³í, Æä³ëÄ¡¾ÆÁø, »ïȯ°è Ç׿ï¾à µî°ú º´¿ë½Ã ÀÛ¿ëÀÌ Áõ°µÉ ¼ö ÀÖ´Ù. | 
   
  
    
  
  
       	
  
     
  
  
  
  
  
   
    | Related FDA Approved Drug | 
    
       
     | 
      
  
  
  |  
     
   
  
    
       |  
      
        
          
            
                | Á¤º¸¿ä¾à |         
             
           
         | 
             	    
       |  
      | 
  
    µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
    
  
  
    
  
   |  
     
   
  
    
       |  
      
        
          
            
                | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |         
             
           
         | 
             	    
       |  
      | 	 |  
     
   
  
    
       |  
      
        
          
            
                | Á¦Ç°Á¤º¸ |            
             
           
         | 
             	  
       |  
       |  
     
   
  
    
       |  
      
        
          
            
                | º¹¾àÁ¤º¸ |            
             
           
         | 
             	  
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
   
    | LACTmed ¹Ù·Î°¡±â | 
    
      
        [¹Ù·Î°¡±â]
     | 
     
  
  
   
    | ¾à¸®ÀÛ¿ë | 
    
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
       
     | 
     
  
  
  
   
    | Ãà¾àº¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
       
  
  
   
    | º¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
                                                          															
  
   
  
  
   
    | ÀӺο¡´ëÇÑÅõ¿© | 
    
      
      
        
	      
	      
	        | *  | 
	        
	          ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù. 
	         | 
	         
	       
	       | 
	   
	  
	    |   | 
	   
	  
	    
	      FDA : Cµî±Þ 
				        	
					  
					
	   | 
	  
	  
	  
	     
	     
	     
	     
	     
	     
	   | 
	 
	
	  
	      
	      
	        | *  | 
	        
	          »ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
	         | 
	         
	      
	        | *  | 
	        
	          ¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
	         | 
	         
	       
	   | 
	 
       
     | 
   
  
  
  	   
  
  	   
  
  	   
  
  
     
      | Pharmacokinetics | 
      
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
      
       |   
     
  
  
  
  
  
  
  
   
    | º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ | 
    
      [º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
     | 
   
  	
  
  
  
   
    | º¹¾à¶óº§ | 
    
    
    
      | À̹ÌÁö | 
      º¹¾à¼³¸í | 
     
    
    
        | 
      º¯ºñ°¡ »ý±æ¼ö ÀÖ½À´Ï´Ù. | 
     
    
       | 
     
    
    
        | 
      ¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. | 
     
    
       | 
     
    
     |  
    
      
	
	  
            | *  | 
	    º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. | 
	   
	  
            | *  | 
	    º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. | 
	   
	  
            | *  | 
	    ±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. | 
	   
	   
     |   
     | 
   
  	
  
  
   
    | Á¦Çüº° º¹¾àÁöµµ | 
    [Á¡¾È¾×] | 
   
  
  
   
    | º¸°ü»ó ÁÖÀÇ | 
    
      
    	
     | 
   
  
  
   
    | Á¶Á¦½Ã ÁÖÀÇ | 
    
      
    	
     | 
      
 
 |  
     
   
  
    
       |  
      
        
          
            
                | ½É»çÁ¤º¸ |            
             
           
         | 
             	  
       |  
       |  
     
     
  
    
       |  
      
        
          
            
                | ÇмúÁ¤º¸ |          
             
           
         | 
             	  
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
    | DUR (ÀǾàǰ»ç¿ëÆò°¡) | 
    º´¿ë±Ý±â :
     
	 °í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
	 
	  [»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]										
	  ¿¬·É´ë±Ý±â :
      °í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
      
       [¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
       
       
        
        
     | 
   
  
   
    | Mechanism of Action | 
    
       Tropicamide¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Tropicamide binds to and blocks the receptors in the muscles of the eye (muscarinic receptor M4). Tropicamide acts by blocking the responses of the iris sphincter muscle to the iris and ciliary muscles to cholinergic stimulation, producing dilation of the pupil and paralysis of the ciliary muscle. 
     | 
   
  
   
    | Pharmacology | 
     
       Tropicamide¿¡ ´ëÇÑ Pharmacology Á¤º¸ Tropicamide belongs to the group of medicines called anti-muscarinics. Tropicamide blocks the receptors in the muscles of the eye (muscarinic receptors). These receptors are involved controlling the pupil size and the shape of the lens. By blocking these receptors, tropicamide produces dilatation of the pupil (mydriasis) and prevents the eye from accommodating for near vision (cycloplegia). Tropicamide is given as eye drops to dilate the pupil and relax the lens so that eye examinations can be carried out thoroughly. 
     | 
   
  
   
    | Protein Binding | 
    
       Tropicamide¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 45% 
     | 
   
  
   
    | Half-life | 
    
       Tropicamide¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ Not Available 
     | 
   
  
   
    | Absorption | 
    
       Tropicamide¿¡ ´ëÇÑ Absorption Á¤º¸ Not Available 
     | 
   
  
   
    | Pharmacokinetics | 
    
       TropicamideÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á 
-  ÃÖ°í È¿°ú ¹ßÇö 
	-  »êµ¿ : 20-40 ºÐ
 
	 -  Á¶Àý±Ù¸¶ºñ : 20-35 ºÐ
   
 -  ȸº¹½Ã±â
	-  »êµ¿ : 6½Ã°£
 
	 -  Á¶Àý±Ù¸¶ºñ : 6½Ã°£ À̳»
  
  
     | 
   
  
   
    | Biotransformation | 
    
       Tropicamide¿¡ ´ëÇÑ Biotransformation Á¤º¸ Not Available 
     | 
   
  
   
    | Toxicity | 
    
       Tropicamide¿¡ ´ëÇÑ Toxicity Á¤º¸ Overdose can casue dry mouth, blurred vision, photophobia, hallucinations and rapid/irregular pulse. 
     | 
   
  
   
    | Drug Interactions | 
    
       Tropicamide¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available 
     | 
   
  
   
    CYP450  Drug Interaction | 
    
      [CYP450 TableÁ÷Á¢Á¶È¸] 
     | 
   
  
   
    | Food Interaction | 
    
       Tropicamide¿¡ ´ëÇÑ Food Interaction Á¤º¸ Not Available 
     | 
   
  
   
    | Drug Target | 
    
      
      [Drug Target]
     | 
   
  
   
    | Description | 
    
       Tropicamide¿¡ ´ëÇÑ Description Á¤º¸ One of the muscarinic antagonists with pharmacologic action similar to atropine and used mainly as an ophthalmic parasympatholytic or mydriatic. [PubChem] 
     | 
   
  
   
    | Dosage Form | 
    
       Tropicamide¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Liquid	OphthalmicSolution	OphthalmicSolution / drops	Ophthalmic 
     | 
   
  
   
    | Drug Category | 
    
       Tropicamide¿¡ ´ëÇÑ Drug_Category Á¤º¸ Diagnostic aid, cycloplegicDiagnostic aid, mydriaticMuscarinic AntagonistsMydriatics 
     | 
   
  
   
    | Smiles String Canonical | 
    
       Tropicamide¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CCN(CC1=CC=NC=C1)C(=O)C(CO)C1=CC=CC=C1 
     | 
   
  
   
    | Smiles String Isomeric | 
    
       Tropicamide¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CCN(CC1=CC=NC=C1)C(=O)[C@@H](CO)C1=CC=CC=C1 
     | 
   
  
   
    | InChI Identifier | 
    
       Tropicamide¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C17H20N2O2/c1-2-19(12-14-8-10-18-11-9-14)17(21)16(13-20)15-6-4-3-5-7-15/h3-11,16,20H,2,12-13H2,1H3 
     | 
   
  
   
    | Chemical IUPAC Name | 
    
       Tropicamide¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ N-ethyl-3-hydroxy-2-phenyl-N-(pyridin-4-ylmethyl)propanamide 
     | 
   
    
  |  
     
     
  
    
       |  
      
        
          
            
                | »ç¿ëÀÚÄÁÅÙÃ÷ |           
             
           
         | 
             	  
       |  
       |  
     
         
 
     | 
   
   
     | 
   
  
    
      
        
          
            
              - 
                ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2021-12-09
              
 
              - 
                
                 º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
                
              
     
             
         |                 
       
     |       
          
                
                    
                       ¾Ë¸² | 
                       
                      »ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù.  | 
                    
                    | 
               
      
      
                
                    
                       °æ°í | 
                     
                      µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù. 
                          Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â 
                          Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
                            ¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
                          ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
 | 
  
                    | 
               
  
 
  
    ¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é 
    ¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
   
  
 
  º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
 
  [ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â]       Á¦¸ñ ¾øÀ½ 
 
    
    2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
    
    1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ  º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
    ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
          
    
    
    
    2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
    ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
 
 
 
   
  |  
                           
                         | 
                       
                      | 
                   |