| |
|
|
|
|
|
 |
| |
|
¿Ãºê·º½ºÄ°¼¿250mg ORBREX CAPS.[Cloxacillin Sodium]
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
[A06901171]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1ݼ¿(2005.04.01)(ÇöÀç¾à°¡)
\70 ¿ø/1ݼ¿(2002.04.09)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»ö °ú¸³»ó ºÐ¸»À» ÇÔÀ¯ÇÏ´Â °æÁú ݼ¿ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
100CAPS |
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
[À¯È¿±ÕÁ¾]
Æä´Ï½Ç¸®³×À̽º»ý¼º Æ÷µµ±¸±Õ, ¿¬¼â±¸±Õ(Àå³»±¸±Õ Á¦¿Ü), Æó·Å±¸±Õ, ÀÓ±Õ, Æä´Ï½Ç¸°°¨¼ö¼º Æ÷µµ±¸±Õ
[ÀûÀÀÁõ]
1. ÁÖÈ¿´É È¿°ú
Æíµµ¿°, ÀÎÈĵο°, ºÎºñ°¿°, ÁßÀÌ¿°, ºÎ½º·³, ¿ËÁ¾, ºÀ¼Ò¿°, â»ó . È»ó ¹× ¼ö¼úÈÄ 2Â÷°¨¿°, °ñ¼ö¿°, Æó·Å, ÆóȳóÁõ, ³óÈä, ½Å¿ì½Å¿°, ÀÓ±Õ¼º¿äµµ¿°, ÆÐÇ÷Áõ, ¼¼±Õ¼º½É³»¸·¿°, ¼ö¸·¿°
2. ´ÙÀ½ Áúȯ¿¡µµ »ç¿ëÇÒ ¼ö ÀÖ´Ù.
³ó°¡Áø, À¯¼±¿°, ¸²ÇÁÀý¿°, °üÀý¿°, ±â°üÁö¿°, ¼ºÈ«¿, ÁßÁõÈ»óÀÇ 2Â÷°¨¿°¿¹¹æ
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
[ÁÖ¼ººÐÄÚµå:376002ACH ¿¡ µû¸¥ ½É»çÁöħ¿¶÷]
¼ºÀÎ : Ŭ·Ï»ç½Ç¸°À¸·Î¼ 1ȸ 250-500mg(¿ª°¡) 1ÀÏ 4ȸ °æ±¸Åõ¿©ÇÑ´Ù.
¿¬·É, Áõ»ó¿¡ µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù.
|
| ±Ý±â |
- ÀÌ ¾à¿¡ ÀÇÇÏ¿© ¼ïÀÇ º´·ÂÀÌ Àִ ȯÀÚ
- ÀÌ ¾à ¶Ç´Â Æä´Ï½Ç¸°°è Ç×»ý¹°Áú¿¡ °ú¹ÎÁõÀÇ º´·ÂÀÌ Àִ ȯÀÚ
|
| ½ÅÁßÅõ¿© |
- ¼¼Æè°è Ç×»ý¹°Áú¿¡ °ú¹ÎÁõÀÇ º´·ÂÀÌ Àִ ȯÀÚ
- º»ÀÎ ¶Ç´Â ºÎ¸ð, ÇüÁ¦°¡ ±â°üÁöõ½Ä, ¹ßÁø, µÎµå·¯±â µîÀÇ ¾Ë·¹¸£±âÁõ»óÀ»
ÀÏÀ¸Å°±â ½¬¿î üÁúÀΠȯÀÚ
- ½ÉÇÑ ½ÅÀå¾Ö ȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
- ¼ï :
µå¹°°Ô ¼ïÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î ÃæºÐÈ÷ °üÂûÇÏ°í ºÒÄè°¨, ±¸³»ÀÌ»ó°¨, õ¸í, Çö±â, º¯ÀÇ, À̸íµîÀÇ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
°ú¹ÎÁõ : ¹ß¿, ¹ßÁø, µÎµå·¯±âµîÀÇ ¾Ë·¹¸£±â Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
Ç÷¾× : µå¹°°Ô È£»ê±¸Áõ°¡, °ú¸³±¸°¨¼Ò, ºóÇ÷, Ç÷¼ÒÆÇ°¨¼Ò, ¹éÇ÷±¸°¨¼Ò°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
°£Àå : µå¹°°Ô GOTÀÇ »ó½Â, Ȳ´Þ¼º °£¿°ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
½ÅÀå : µå¹°°Ô ±Þ¼º½ÅºÎÀüµîÀÇ ½ÉÇÑ ½ÅÀå¾Ö°¡ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î Á¤±âÀûÀ¸·Î °Ë»ç¸¦ ÇÏ´Â µî ÃæºÐÈ÷ °üÂûÇϰí ÀÌ»óÀÌ ÀÎÁ¤µÇ´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù.
¼Òȱâ : µå¹°°Ô À§¸·¼º´ëÀå¿°µîÀÇ Ç÷º¯À» ¼ö¹ÝÇÏ´Â ½ÉÇÑ ´ëÀå¿°ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. º¹Åë, ÀæÀº ¼³»ç°¡ ³ªÅ¸³ª´Â °æ¿ì¿¡´Â Áï½Ã Åõ¿©¸¦ ÁßÁöÇϴµî ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù. ¶ÇÇÑ ¶§¶§·Î ±¸¿ª, °íâµîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
Áߺ¹°¨¿°ÀÌ ÀϾ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇÑ °æ¿ì¿¡´Â ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù.
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Bµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Cloxacillin¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ By binding to specific penicillin-binding proteins (PBPs) located inside the bacterial cell wall, cloxacillin inhibits the third and last stage of bacterial cell wall synthesis. Cell lysis is then mediated by bacterial cell wall autolytic enzymes such as autolysins; it is possible that cloxacillin interferes with an autolysin inhibitor.
|
| Pharmacology |
Cloxacillin¿¡ ´ëÇÑ Pharmacology Á¤º¸ Cloxacillin is a semisynthetic antibiotic in the same class as penicillin. Cloxacillin is for use against staphylococci that produce beta-lactamase.
|
| Protein Binding |
Cloxacillin¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 95%
|
| Absorption |
Cloxacillin¿¡ ´ëÇÑ Absorption Á¤º¸ Well absorbed from the gastrointestinal tract.
|
| Pharmacokinetics |
Cloxacillin SodiumÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- »ýü³»ÀÌ¿ë·ü : °æ±¸ : 50%±îÁö
- ºÐÆ÷ :
- ÅÂ¹Ý Åë°ú, À¯Áó ºÐºñ
- ´ëºÎºÐÀÇ Ã¼¾×°ú »À¿¡ ³Î¸® ºÐÆ÷µÈ´Ù.
- ¼¼Æ÷¿Í ¾È±¸³»·Îµµ Åõ°úµÈ´Ù.
- Á¤»ó ³ú¸·¿¡¼´Â Àß Åõ°úÇÏÁö ¸øÇÏÁö¸¸ ¿°ÁõÀÌ »ý±â¸é Åõ°ú·®ÀÌ Áõ°¡µÈ´Ù.
- ´Ü¹é°áÇÕ : 90-98%
- ´ë»ç : ÁÖ·Î °£¿¡¼ Ȱ¼ºÇü ´ë»çü¿Í ºñȰ¼ºÇü ´ë»çü·Î ´ë»çµÈ´Ù.
- ¹Ý°¨±â : 0.5-1.5 ½Ã°£ (½ÅÀå¾Ö½Ã³ª ½Å»ý¾Æ¿¡¼´Â ¿¬Àå)
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : °æ±¸ : 0.5-2 ½Ã°£ À̳»
- ¼Ò½Ç : ½Å¹è¼³ ¹× ´ãÁó¹è¼³
|
| Biotransformation |
Cloxacillin¿¡ ´ëÇÑ Biotransformation Á¤º¸ Not Available
|
| Toxicity |
Cloxacillin¿¡ ´ëÇÑ Toxicity Á¤º¸ Oral LD50 in rat and mouse is 5000 mg/kg. Intravenous LD50 in rat is 1660 mg/kg. Symptoms of overdose include wheezing, tightness in the chest, fever, itching, bad cough, blue skin color, fits, and swelling of face, lips, tongue, or throat.
|
| Drug Interactions |
Cloxacillin¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Methotrexate The penicillin increases the effect and toxicity of methotrexateAnisindione The IV penicillin increases the anticoagulant effectDicumarol The IV penicillin increases the anticoagulant effectAcenocoumarol The IV penicillin increases the anticoagulant effectWarfarin The IV penicillin increases the anticoagulant effectDemeclocycline Possible antagonism of actionDoxycycline Possible antagonism of actionEthinyl Estradiol This anti-infectious agent could decrease the effect of the oral contraceptiveMestranol This anti-infectious agent could decrease the effect of the oral contraceptiveMethacycline Possible antagonism of actionMinocycline Possible antagonism of actionOxytetracycline Possible antagonism of actionRolitetracycline Possible antagonism of actionTetracycline Possible antagonism of action
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Cloxacillin¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take on an empty stomach.
|
| Drug Target |
[Drug Target]
|
| Description |
Cloxacillin¿¡ ´ëÇÑ Description Á¤º¸ A semi-synthetic antibiotic that is a chlorinated derivative of oxacillin. [PubChem]
|
| Dosage Form |
Cloxacillin¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Capsule OralPowder, for solution IntramuscularPowder, for solution IntravenousPowder, for solution Oral
|
| Drug Category |
Cloxacillin¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Bacterial Agents
|
| Smiles String Canonical |
Cloxacillin¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC1=C(C(=O)NC2C3SC(C)(C)C(N3C2=O)C(O)=O)C(=NO1)C1=CC=CC=C1Cl
|
| Smiles String Isomeric |
Cloxacillin¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CC1=C(C(=O)N[C@H]2[C@H]3SC(C)(C)[C@@H](N3C2=O)C(O)=O)C(=NO1)C1=CC=CC=C1Cl
|
| InChI Identifier |
Cloxacillin¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C19H18ClN3O5S/c1-8-11(12(22-28-8)9-6-4-5-7-10(9)20)15(24)21-13-16(25)23-14(18(26)27)19(2,3)29-17(13)23/h4-7,13-14,17H,1-3H3,(H,21,24)(H,26,27)/t13-,14+,17-/m1/s1/f/h21,26H
|
| Chemical IUPAC Name |
Cloxacillin¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (2S,5R,6R)-6-[[3-(2-chlorophenyl)-5-methyl1,2-oxazole-4-carbonyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2016-04-15
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|