| |
|
|
|
|
|
 |
| |
|
Ç÷ϽÅݼ¿500mg FLOXIN TAB.[Flucloxacillin Sodium]
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
655603950[A03502931]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1ݼ¿(2004.08.01)(ÇöÀç¾à°¡)
\249 ¿ø/1ݼ¿(2002.07.27)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»ö-¿¯Àº Ȳ¹é»öÀÇ °áÁ¤¼º °¡·ç ¶Ç´Â °ú¸³ÀÌµç »óÀÇÀû»ö, ÇÏÀǹé»öÀÇ °æÁúݼ¿Á¦ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
[À¯È¿±ÕÁ¾]
Ȳ»öÆ÷µµ±¸±Õ, ¿ëÇ÷¼º¿¬¼â±¸±Õ, Æó·Å±¸±Õ
[ÀûÀÀÁõ]
1. ÁÖÈ¿´É È¿°ú Æíµµ¿°, ÀÎÈĵο°, Æó·Å, ÆóȳóÁõ, ³óÈä, ÁßÀÌ¿°, ¿ÜÀ̵µ¿°, Äںνº·³, ºÎ½º·³, ºÀ¼Ò¿°, ºÎ½º·³Áõ, ¿©µå¸§, ³ó¾ç, â»ó . ¿Ü»ó ¹× ¼ö¼úÈÄ 2Â÷°¨¿°, ¿äµµ¿°, ÆÐÇ÷Áõ
2. ´ÙÀ½ Áúȯ¿¡µµ »ç¿ëÇÒ ¼ö ÀÖ´Ù.
±â°üÁö¿°, Á¶À§¿°, Á¶°û¿°, ¸ð³¶¿°, ³ó°¡Áø, ´Ù·¡³¢, ±ÍºÎ½º·³, À̰³ÁÖÀ§¿°, ´©³¶¿°, Ç¥Àú, ȳó¼ºÇѼ±¿°, Ä¡À°¿°, À¯¼±¿°, °ñ¼ö¿°, ¸²ÇÁÀý¿°, °üÀý¿°
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
[ÁÖ¼ººÐÄÚµå:159803ACH ¿¡ µû¸¥ ½É»çÁöħ¿¶÷]
¼ºÀÎ : Ç÷çŬ·Ï»ç½Ç¸°³ªÆ®·ýÀ¸·Î¼ 1ȸ 250-500mg(¿ª°¡)À» 6-8½Ã°£¸¶´Ù ½ÄÀü °æ±¸Åõ¿©ÇÑ´Ù.
¾î¸°ÀÌ : 2-10¼¼´Â ¼ºÀο뷮ÀÇ 1/2, 2¼¼¹Ì¸¸Àº ¼ºÀο뷮ÀÇ 1/4À» °æ±¸Åõ¿©ÇÑ´Ù.
¿¬·É, Áõ»ó¿¡ µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù.
|
| ±Ý±â |
- ÀÌ ¾à¿¡ ÀÇÇÏ¿© ¼ïÀÇ º´·ÂÀÌ Àִ ȯÀÚ
- ÀÌ ¾à ¶Ç´Â Æä´Ï½Ç¸°°è Ç×»ý¹°Áú¿¡ °ú¹ÎÁõÀÇ º´·ÂÀÌ Àִ ȯÀÚ
|
| ½ÅÁßÅõ¿© |
- ¼¼Æè°è Ç×»ý¹°Áú¿¡ °ú¹ÎÁõÀÇ º´·ÂÀÌ Àִ ȯÀÚ
- º»ÀÎ ¶Ç´Â ºÎ¸ð, ÇüÁ¦°¡ ±â°üÁöõ½Ä, ¹ßÁø, µÎµå·¯±â µîÀÇ ¾Ë·¹¸£±âÁõ»óÀ» ÀÏÀ¸Å°±â ½¬¿î üÁúÀΠȯÀÚ
- ½ÉÇÑ ½ÅÀå¾Ö ȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
- ¼ï :
µå¹°°Ô ¼ïÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î ÃæºÐÈ÷ °üÂûÇÏ°í ºÒÄè°¨, ±¸³»ÀÌ»ó°¨, õ¸í, Çö±â, º¯ÀÇ, À̸íµîÀÇ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
°ú¹ÎÁõ : ¹ß¿, ¹ßÁø, µÎµå·¯±âµîÀÇ ¾Ë·¹¸£±â Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
Ç÷¾× : µå¹°°Ô È£»ê±¸Áõ°¡, ¹«°ú¸³±¸ÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ»óÀÌ ÀÎÁ¤µÇ´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
°£Àå : µå¹°°Ô °£¿°, ´ãÁóºÐºñ Á¤Áö¼º Ȳ´Þ, GOT, GPT, AL-P»ó½ÂµîÀÇ °£±â´É Àå¾Ö°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
½ÅÀå : µå¹°°Ô ±Þ¼º½ÅºÎÀüµîÀÇ ½ÉÇÑ ½ÅÀå¾Ö°¡ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î Á¤±âÀûÀ¸·Î °Ë»ç¸¦ ÇÏ´Â µî ÃæºÐÈ÷ °üÂûÇϰí ÀÌ»óÀÌ ÀÎÁ¤µÇ´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù.
¼Òȱâ : µå¹°°Ô À§¸·¼º´ëÀå¿°µîÀÇ Ç÷º¯À» ¼ö¹ÝÇÏ´Â ½ÉÇÑ ´ëÀå¿°ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. º¹Åë, ºó¹øÇÑ ¼³»ç°¡ ³ªÅ¸³¯ °æ¿ì¿¡´Â Áï½Ã Åõ¿©¸¦ ÁßÁöÇϴµî ÀûÀýÇÑ
óġ¸¦ ÇÑ´Ù. ¶ÇÇÑ ¶§¶§·Î ¼³»ç, ±¸¿ª, ½Ä¿åºÎÁøµîÀÇ Áõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Bµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Flucloxacillin¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ By binding to specific penicillin-binding proteins (PBPs) located inside the bacterial cell wall, flucloxacillin inhibits the third and last stage of bacterial cell wall synthesis. Cell lysis is then mediated by bacterial cell wall autolytic enzymes such as autolysins; it is possible that flucloxacillin interferes with an autolysin inhibitor.
|
| Pharmacology |
Flucloxacillin¿¡ ´ëÇÑ Pharmacology Á¤º¸ Flucloxacillin is a penicillin beta-lactam antibiotic used in the treatment of bacterial infections caused by susceptible, usually gram-positive, organisms. The name "penicillin" can either refer to several variants of penicillin available, or to the group of antibiotics derived from the penicillins. Flucloxacillin has in vitro activity against gram-positive and gram-negative aerobic and anaerobic bacteria. The bactericidal activity of Flucloxacillin results from the inhibition of cell wall synthesis and is mediated through flucloxacillin binding to penicillin binding proteins (PBPs). Flucloxacillin is stable against hydrolysis by a variety of beta-lactamases, including penicillinases, and cephalosporinases and extended spectrum beta-lactamases.
|
| Protein Binding |
Flucloxacillin¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Not Available
|
| Half-life |
Flucloxacillin¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 0.75?? hour
|
| Absorption |
Flucloxacillin¿¡ ´ëÇÑ Absorption Á¤º¸ Bioavailability is 50??0% following oral administration.
|
| Pharmacokinetics |
Flucloxacillin SodiumÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : À½½Ä¹° Á¸Àç½Ã Èí¼ö°¡ Áö¿¬µÈ´Ù.
- »ýü³»ÀÌ¿ë·ü : °æ±¸ : 80% ÀÌ»ó
- ºÐÆ÷ : Vd : 8-21 L
- ´Ü¹é°áÇÕ : 94.7%
- ´ë»ç : ºÎºÐÀûÀ¸·Î °£´ë»ç
- ¹Ý°¨±â :
- ½Å»ý¾Æ : 278ºÐ
- ¼ºÀÎ : 43-78 ºÐ (½ÅÀå¾Ö½Ã ¿¬Àå)
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : °æ±¸ : 0.5-1 ½Ã°£ À̳»
- ¼Ò½Ç : 40-70%°¡ ¹Ì´ë»çü·Î ½Å¹è¼³µÈ´Ù.
|
| Biotransformation |
Flucloxacillin¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic.
|
| Toxicity |
Flucloxacillin¿¡ ´ëÇÑ Toxicity Á¤º¸ Not Available
|
| Drug Interactions |
Flucloxacillin¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Methotrexate The penicillin increases the effect and toxicity of methotrexateDemeclocycline Possible antagonism of actionDoxycycline Possible antagonism of actionEthinyl Estradiol This anti-infectious agent could decrease the effect of the oral contraceptiveMestranol This anti-infectious agent could decrease the effect of the oral contraceptiveMethacycline Possible antagonism of actionMinocycline Possible antagonism of actionOxytetracycline Possible antagonism of actionRolitetracycline Possible antagonism of actionTetracycline Possible antagonism of action
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Flucloxacillin¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take on an empty stomach.
|
| Drug Target |
[Drug Target]
|
| Description |
Flucloxacillin¿¡ ´ëÇÑ Description Á¤º¸ Antibiotic analog of cloxacillin. [PubChem]
|
| Dosage Form |
Flucloxacillin¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Not Available
|
| Drug Category |
Flucloxacillin¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Bacterial AgentsPenicillins
|
| Smiles String Canonical |
Flucloxacillin¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC1=C(C(=O)NC2C3SC(C)(C)C(N3C2=O)C(O)=O)C(=NO1)C1=C(F)C=CC=C1Cl
|
| Smiles String Isomeric |
Flucloxacillin¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CC1=C(C(=O)N[C@H]2[C@H]3SC(C)(C)[C@@H](N3C2=O)C(O)=O)C(=NO1)C1=C(F)C=CC=C1Cl
|
| InChI Identifier |
Flucloxacillin¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C19H17ClFN3O5S/c1-7-10(12(23-29-7)11-8(20)5-4-6-9(11)21)15(25)22-13-16(26)24-14(18(27)28)19(2,3)30-17(13)24/h4-6,13-14,17H,1-3H3,(H,22,25)(H,27,28)/t13-,14+,17-/m1/s1/f/h22,27H
|
| Chemical IUPAC Name |
Flucloxacillin¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (2S,5R,6R)-6-[[3-(2-chloro-6-fluorophenyl)-5-methyl1,2-oxazole-4-carbonyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2015-02-03
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|