| |
|
|
|
|
|
 |
| |
|
¶óÀÌÆ®¿ÀÇÃÁ¡À̾×(¿ÀÇ÷ϻç½Å) 5mL Lite Ofl Ear Soln.
|
Àü¹®ÀǾàǰ | ±Þ¿©
|
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
690303711
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\2,525 ¿ø/5mL/º´(2025.10.01)(ÇöÀç¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹ÌȲ»ö ³»Áö ´ãȲ»öÀÇ µî¸íÇÑ ¾× [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
5¹Ð¸®¸®ÅÍ/º´ |
| ÁÖ¼ººÐÄÚµå |
203936CLQ
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
Æ÷µµ»ó±¸±Õ¼Ó, ¿¬¼â»ó±¸±Õ¼Ó, ÇÁ·ÎÅ׿콺¼Ó, ³ì³ó±Õ, ÀÎÇ÷翣ÀÚ±Õ°ú °°Àº ÀÌ ¾à °¨¼º±Õ¿¡ ÀÇÇÑ ´ÙÀ½ °¨¿°Áõ : ÁßÀÌ¿°, ¿ÜÀÌ¿°
|
| ¾à¹°À½½Ä°£ »óÈ£ÀÛ¿ë |
[Á¶È¸]
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¼ºÀÎ : 1ȸ 6 - 10¹æ¿ï 1ÀÏ 2ȸ Á¡ÀÌÇÑ´Ù. Á¡ÀÌÈÄ ¾à 10ºÐ°£ ÀÌ¿åÀ» ÇÑ´Ù.
¿¬·É, Áõ»ó¿¡ µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù.
|
| ÁÖ¿ä¾à¹° »óÈ£ÀÛ¿ë |
[Á¶È¸]
|
| ±Ý±â |
ÀÌ ¾à ¹× ±âŸ Äû³î·Ð°è ¾à¹°¿¡ °ú¹ÎÁõ ¹× ±× º´·ÂÀÌ Àִ ȯÀÚ |
| ÀÌ»ó¹ÝÀÀ |
1) °ú¹ÎÁõ : ½ÉÇ÷°ü°è ÇãÅ», ÀǽļҽÇ, Ç÷°üºÎÁ¾(ÈĵÎ, ÀεÎ, ¾ó±¼), ±âµµÆó¼â, È£Èí°ï¶õ, µÎµå·¯±â, °¡·Á¿òÁõ µîÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
2) ¿ÜÀÌ¿°ÀÎ °æ¿ì : °¡·Á¿ò, ¾îÁö·¯¿ò, ÀÌÅëÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
3) ¿ÜÀÌ¿°ÀÌ¿ÜÀÇ ÁúȯÀÎ °æ¿ì : ¹Ì°¢ÀÌ»ó, ÀÌÅë, °¡·Á¿ò, Áö°¢ÀÌ»ó, ¹ßÁø, ¾îÁö·¯¿ò, Àڱذ¨. ±¸¿ª, ±¸Åä, ±¸°¥, µÎÅë, ÀÌ·ç, À̸í, ¹ß¿ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
4) û°¢․ÀüÁ¤Àå¾Ö, û·ÂÀúÇÏ, ±Õ±³´ëÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
(ofloxacin; )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Á¦Çüº° º¹¾àÁöµµ |
[Á¡ÀÌ] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Ofloxacin¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Ofloxacin acts on DNA gyrase, an enzyme which, like human topoisomerase, prevents the excessive supercoiling of DNA during replication or transcription.
|
| Pharmacology |
Ofloxacin¿¡ ´ëÇÑ Pharmacology Á¤º¸ Ofloxacin is a quinolone/fluoroquinolone antibiotic. Ofloxacin is bactericidal and its mode of action depends on blocking of bacterial DNA replication by binding itself to an enzyme called DNA gyrase, which allows the untwisting required to replicate one DNA double helix into two. Notably the drug has 100 times higher affinity for bacterial DNA gyrase than for mammalian. Ofloxacin is a broad-spectrum antibiotic that is active against both Gram-positive and Gram-negative bacteria.
|
| Metabolism |
Ofloxacin¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 1A2 (CYP1A2)
|
| Protein Binding |
Ofloxacin¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 32%
|
| Half-life |
Ofloxacin¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 9 hours
|
| Absorption |
Ofloxacin¿¡ ´ëÇÑ Absorption Á¤º¸ Bioavailability of ofloxacin in the tablet formulation is approximately 98%
|
| Pharmacokinetics |
OfloxacinÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : Àß Èí¼öµÈ´Ù. À½½Ä¹°¿¡ ÀÇÇÑ ¿µÇâÀº ¹Ì¹ÌÇÏ´Ù.
- ºÐÆ÷ : ºÐÆ÷¿ëÀû : 2.4-3.5 L/kg
- ´Ü¹é°áÇÕ : 20%
- ¹Ý°¨±â : 5-7.5 ½Ã°£
- ¼Ò½Ç : ÁÖ·Î ¹Ìº¯Èü·Î ½Å¹è¼³
|
| Biotransformation |
Ofloxacin¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic
|
| Toxicity |
Ofloxacin¿¡ ´ëÇÑ Toxicity Á¤º¸ LD50=5450 mg/kg (orally in mice)
|
| Drug Interactions |
Ofloxacin¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Aluminium Formation of non-absorbable complexesBismuth Formation of non-absorbable complexesCalcium Formation of non-absorbable complexesIron Formation of non-absorbable complexesMagnesium oxide Formation of non-absorbable complexesMagnesium Formation of non-absorbable complexesSucralfate Formation of non-absorbable complexesZinc Formation of non-absorbable complexesWarfarin The quinolone increases the anticoagulant effectAcenocoumarol The quinolone increases the anticoagulant effectDicumarol The quinolone increases the anticoagulant effectAnisindione The quinolone increases the anticoagulant effectDihydroquinidine barbiturate Increased risk of cardiotoxicity and arrhythmiasQuinidine Increased risk of cardiotoxicity and arrhythmiasQuinidine barbiturate Increased risk of cardiotoxicity and arrhythmiasFoscarnet Increased risk of convulsionsProcainamide The quinolone increases the effect of procainamide
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Ofloxacin¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take without regard to meals.Avoid high doses of caffeine.
|
| Drug Target |
[Drug Target]
|
| Description |
Ofloxacin¿¡ ´ëÇÑ Description Á¤º¸ A synthetic fluoroquinolone (fluoroquinolones) antibacterial agent that inhibits the supercoiling activity of bacterial DNA gyrase, halting DNA replication. [PubChem]
|
| Dosage Form |
Ofloxacin¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Liquid OphthalmicSolution OphthalmicTablet Oral
|
| Drug Category |
Ofloxacin¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Bacterial AgentsAnti-Infective Agents, UrinaryAnti-InfectivesNucleic Acid Synthesis InhibitorsQuinolones
|
| Smiles String Canonical |
Ofloxacin¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC1COC2=C3N1C=C(C(O)=O)C(=O)C3=CC(F)=C2N1CCN(C)CC1
|
| Smiles String Isomeric |
Ofloxacin¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@H]1COC2=C3N1C=C(C(O)=O)C(=O)C3=CC(F)=C2N1CCN(C)CC1
|
| InChI Identifier |
Ofloxacin¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C18H20FN3O4/c1-10-9-26-17-14-11(16(23)12(18(24)25)8-22(10)14)7-13(19)15(17)21-5-3-20(2)4-6-21/h7-8,10H,3-6,9H2,1-2H3,(H,24,25)/f/h24H
|
| Chemical IUPAC Name |
Ofloxacin¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (+/-)-9-fluoro-2, 3-dihydro-3-methyl-10-(4-methyl-1-piperazinyl)-7-oxo-7H-pyrido[1, 2, 3-de]-1, 4-benzoxazine-6-carboxylic acid
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-10-13
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|