| |
|
|
|
|
|
 |
| |
|
뮤코코푸시럽 15mL Mucocough Syrup.
|
|
일반의약품 | 삭제
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
649105061
[보험코드에 따른 약품기본정보 직접조회]
\0 원/15mL/포(2025.11.01)(현재약가)
\188 원/15mL/포(2021.02.01)(변경전약가)
[상병코드조회]
[질병코드조회]
|
| 빠른조회 |
|
| 제품성상 |
알루미늄 호일 파우치에 든 딸기향이 나는 무색 또는 미황색의 시럽 [제형정보 확인] |
| 포장·유통단위 |
15mL/포X100포 |
| 포장·코드단위 |
| 약품규격 |
단위 |
포장형태 |
대표코드 |
표준코드 |
비고 |
| 15밀리리터 |
100 포 |
포 |
8806491050607 |
8806491050621 |
|
| 15밀리리터 |
1 포 |
포 |
8806491050607 |
8806491050614 |
|
|
| 주성분코드 |
684000ASY
[동일한 주성분코드를 가진 오리지날 또는 제네릭 의약품 조회]
|
| 허가사항 원문조회 |
[허가사항 원문조회]
|
| 효능효과 |
[적응증 별 검색]
1. 다음 질환에서의 기침, 가래 : 급만성 호흡기 질환(기관지염, 인후두염, 비인두염등)
2. 소아의 유행성 감기, 감기시 기침
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
소아(3∼12세) : 1회 5ml 통상 1일 3회
성인 및 12세 이상 : 1회 10ml 통상 1일 3회
연령, 증상에 따라 적절히 증감하십시오
|
| 금기 |
1) 이 약에 과민증 환자
2) 위·십이지장궤양 환자
3) 이 약 또는 유사 화합물에 과민증의 병력이 있는 환자
4) 녹내장 환자(항콜린 작용에 의해 안압이 상승되어 녹내장이 악화될 수 있다.)
5) 전립선비대 등 하부요로폐색성 질환 환자
6) 미숙아 및 신생아
|
| 신중투여 |
1) 안내압상승 환자
2) 갑상선기능항진 환자
3) 협착성소화성궤양 또는 유문십이지장 폐색 환자(항콜린 작용에 의해 평활근의 운동억제, 긴자 저하가 일어나 증상이 악회될 수 있다.)
4) 순환기계질환 환자
5) 고혈압 등 심혈관계 질환 환자
6) 간질 환자
7) 기관지염, 기관지확장증 및 천식환자
8) 간질환 환자
9) 신생아(중증 질환이 아닌 경우 신생아에게 투여하지 않는다.)
|
| 이상반응 |
1) 소화기계 : 드물게 구역, 구토, 구내염, 가슴쓰림, 설사 등이 나타날 수 있다.
2) 과민증 : 드물게 두드러기, 가려움, 발진, 두통, 이명, 기관지 경련(특히 천식 환자) 등이 나타날 수 있다.
3) 드물게 빈맥, 고혈압이 나타날 수 있다.
4) 쇽이 나타날 수 있으므로 충분히 관찰을 하고 청색증, 호흡곤란, 흉부불쾌감, 혈압저하 등이 나타나는 경우에는 투여를 중지하고 적절한 처치를 한다.
5) 경련, 착란이 나타날 수 있으므로 관찰을 충분히 하고 이상이 나타나면 감량 또는 휴약 등 적절한 처치를 한다.
6) 재생불량성빈혈, 무과립구증이 나타날 수 있으므로 혈액검사를 하여 충분히 관찰하고 이상이 인정되는 경우에는 투여를 중지한다.
7) 과민증 : 발진, 광선과민증, 박리성 피부염, 두드러기, 연축, 근허약, 협조불능이 나타날 수 있다.
8) 정신신경계 : 진정, 졸음, 신경과민, 두통, 초조감, 복시, 불면, 어지러움, 이명, 전정장애, 다행 증, 정서불안, 히스테리, 진전, 신경염, 협조이상, 감각이상, 무시, 집중력감소, 권태감이 나타날 수 있다.
9) 소화기계 : 구갈, 가슴쓰림, 식욕부진, 소화불량, 구역, 구토, 복통, 변비, 설사 등이 나타날 수 있다.
10) 비뇨기계 : 빈뇨, 배뇨곤란, 요폐, 요저류 등이 나타날 수 있다.
11) 호흡기계 : 코 또는 기도의 건조, 기관분비액의 점성화, 천명, 코막힘이 나타날 수 있다.
12) 혈액 : 용혈성빈혈, 혈소판감소가 나타날 수 있다.
13) 기타 : 오한, 발한이상, 흉통, 피로감, 월경이상이 나타날 수 있다.
|
| 상호작용 |
1) 경구용 항생물질(아목시실린, 세푸록심, 독시사이클린, 에리스로마이신, 치암페니콜)과 병용투 여시 항생물질의 약효를 감소시킬 수 있다(적어도 2시간의 간격을 두고 투여한다.)
2) 알코올, 중추신경억제제 병용시 졸음을 유발할 수 있다.
3) 클로르페니라민은 페니토인 대사를 억제하여 페니토인 독성을 유발할 수 있다.
|
| Off-label Usage |
[조회]
|
| Related FDA Approved Drug |
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| |
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 축약복약지도 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : B등급
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
| Pharmacokinetics |
유료정보입니다.
|
| 복약라벨 |
| 이미지 |
복약설명 |
 |
변비가 생길수 있습니다. |
|
 |
어지러움이 있을수 있습니다. |
|
|
| * |
복약이미지는 모든 복약지도 사항을 표시한것은 아니며, 추가적으로 업데이트되거나 수정될 수 있습니다. |
| * |
복약이미지의 표시여부는 실제 약물복용시 중요도에 따른것은 아니며 단순히 허가정보상 키워드를 기준으로 등록되었습니다. |
| * |
귀하가 복약이미지 정보를 신뢰함은 전적으로 귀하의 책임입니다. 드럭인포는 이에 대한 어떠한 보증도 하지 않습니다. |
|
|
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| 독성정보 |
Acetylcysteine에 대한 독성정보 : 정보보기
Chlorpheniramine에 대한 독성정보 : 정보보기
출처: 국립독성과학원 독성물질정보DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Acetylcysteine에 대한 Mechanism_Of_Action 정보
Acetylcysteine may protect against acetaminophen overdose-induced hepatotoxicity by maintaining or restoring hepatic concentrations of glutathione. Glutathione is required to inactivate an intermediate metabolite of acetaminophen that is thought to be hepatotoxic. In acetaminophen overdose, excessive quantities of this metabolite are formed because the primary metabolic (glucuronide and sulfate conjugation) pathways become saturated. Acetylcysteine may act by reducing the metabolite to the parent compound and/or by providing sulfhydryl for conjugation of the metabolite. Experimental evidence also suggests that a sulfhydryl-containing compound such as acetylcysteine may also directly inactivate the metabolite. Inhalation - Acetylcysteine exerts its mucolytic action through its free sulfhydryl group, which opens the disulfide bonds and lowers mucus viscosity. This action increases with increasing pH and is most significant at pH 7 to 9. The mucolytic action of acetylcysteine is not affected by the presence of DNA.
Chlorpheniramine에 대한 Mechanism_Of_Action 정보
Chlorpheniramine binds to the histamine H1 receptor. This blocks the action of endogenous histamine, which subsequently leads to temporary relief of the negative symptoms brought on by histamine.
|
| Pharmacology |
Acetylcysteine에 대한 Pharmacology 정보
Acetylcysteine has been shown to reduce the extent of liver injury following acetaminophen overdose. It is most effective when given early, with benefit seen principally in patients treated within 8-10 hours of the overdose. Acetylcysteine likely protects the liver by maintaining or restoring the glutathione levels, or by acting as an alternate substrate for conjugation with, and thus detoxification of, the reactive metabolite.
Chlorpheniramine에 대한 Pharmacology 정보
In allergic reactions an allergen interacts with and cross-links surface IgE antibodies on mast cells and basophils. Once the mast cell-antibody-antigen complex is formed, a complex series of events occurs that eventually leads to cell-degranulation and the release of histamine (and other chemical mediators) from the mast cell or basophil. Once released, histamine can react with local or widespread tissues through histamine receptors. Histamine, acting on H1-receptors, produces pruritis, vasodilatation, hypotension, flushing, headache, tachycardia, and bronchoconstriction. Histamine also increases vascular permeability and potentiates pain. Chlorpheniramine, is a histamine H1 antagonist (or more correctly, an inverse histamine agonist) of the alkylamine class. It competes with histamine for the normal H1-receptor sites on effector cells of the gastrointestinal tract, blood vessels and respiratory tract. It provides effective, temporary relief of sneezing, watery and itchy eyes, and runny nose due to hay fever and other upper respiratory allergies.
|
| Protein Binding |
Acetylcysteine에 대한 단백결합 정보
83%
Chlorpheniramine에 대한 단백결합 정보
72%
|
| Half-life |
Acetylcysteine에 대한 반감기 정보
5.6 hours (adults), 11 hours (neonates)
Chlorpheniramine에 대한 반감기 정보
21-27 hours
|
| Absorption |
Acetylcysteine에 대한 Absorption 정보
Bioavailability is 6??0% following oral administration and less than 3% following topical administration.
Chlorpheniramine에 대한 Absorption 정보
Well absorbed in the gastrointestinal tract.
|
| Pharmacokinetics |
Acetylcysteine의 약물동력학자료
- 최대 점액용해효과 발현시간
- 작용지속시간 : 1시간 이상
- 혈중최고농도 도달시간
- 분포용적
- 단백결합
- 반감기
- 환원형 acetylcysteine : 2시간
- 전체 acetylcysteine으로서 5.5 시간
Chlorpheniramine Maleate의 약물동력학자료
- 단백결합 : 69-72%
- 대사 : 간대사
- 반감기 : 20-24 시간
- 소실 : 대사체, 약물(3-4%)이 신배설되며, 48시간내에 전체의 35%가 소실된다.
|
| Biotransformation |
Acetylcysteine에 대한 Biotransformation 정보
Hepatic. Deacetylated by the liver to cysteine and subsequently metabolized.
Chlorpheniramine에 대한 Biotransformation 정보
Primarily hepatic via Cytochrome P450 (CYP450) enzymes.
|
| Toxicity |
Acetylcysteine에 대한 Toxicity 정보
Single intravenous doses of acetylcysteine at 1000 mg/kg in mice, 2445 mg/kg in rats, 1500 mg/kg in guinea pigs, 1200 mg/kg in rabbits and 500 mg/kg in dogs were lethal. Symptoms of acute toxicity were ataxia, hypoactivity, labored respiration, cyanosis, loss of righting reflex and convulsions.
Chlorpheniramine에 대한 Toxicity 정보
LD50 = 306 mg/kg in humans, mild reproductive toxin to women of childbearing age.
|
| Drug Interactions |
Acetylcysteine에 대한 Drug_Interactions 정보
Not Available
Chlorpheniramine에 대한 Drug_Interactions 정보
Donepezil Possible antagonism of actionGalantamine Possible antagonism of actionRivastigmine Possible antagonism of actionEthotoin The antihistamine increases the effect of hydantoinFosphenytoin The antihistamine increases the effect of hydantoinMephenytoin The antihistamine increases the effect of hydantoinPhenytoin The antihistamine increases the effect of hydantoin
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
Chlorpheniramine에 대한 P450 table
SUBSTRATES
CYP 2D6
Beta Blockers:
S-metoprolol
propafenone
timolol
Antidepressants:
amitriptyline
clomipramine
desipramine
imipramine
paroxetine
Antipsychotics:
haloperidol
risperidone
thioridazine
aripiprazole
codeine
dextromethorphan
duloxetine
flecainide
mexiletine
ondansetron
tamoxifen
tramadol
venlafaxine
INHIBITORS
CYP 2D6
amiodarone
buproprion
**chlorpheniramine**
cimetidine
clomipramine
duloxetine
fluoxetine
haloperidol
methadone
mibefradil
paroxetine
quinidine
ritonavir
INDUCERS
CYP 2D6
N/A
|
| Description |
Acetylcysteine에 대한 Description 정보
The N-acetyl derivative of cysteine. It is used as a mucolytic agent to reduce the viscosity of mucous secretions. It has also been shown to have antiviral effects in patients with HIV due to inhibition of viral stimulation by reactive oxygen intermediates. [PubChem]
Chlorpheniramine에 대한 Description 정보
A histamine H1 antagonist used in allergic reactions, hay fever, rhinitis, urticaria, and asthma. It has also been used in veterinary applications. One of the most widely used of the classical antihistaminics, it generally causes less drowsiness and sedation than promethazine. [PubChem]
|
| Dosage Form |
Acetylcysteine에 대한 Dosage_Form 정보
Liquid Respiratory (inhalation)Solution Respiratory (inhalation)
Chlorpheniramine에 대한 Dosage_Form 정보
Syrup OralTablet OralTablet, extended release Oral
|
| Drug Category |
Acetylcysteine에 대한 Drug_Category 정보
Antiviral AgentsExpectorantsFree Radical Scavengers
Chlorpheniramine에 대한 Drug_Category 정보
Anti-Allergic AgentsAntihistaminesAntipruriticsHistamine H1 Antagonists
|
| Smiles String Canonical |
Acetylcysteine에 대한 Smiles_String_canonical 정보
CC(=O)NC(CS)C(O)=O
Chlorpheniramine에 대한 Smiles_String_canonical 정보
CN(C)CCC(C1=CC=C(Cl)C=C1)C1=CC=CC=N1
|
| Smiles String Isomeric |
Acetylcysteine에 대한 Smiles_String_isomeric 정보
CC(=O)N[C@@H](CS)C(O)=O
Chlorpheniramine에 대한 Smiles_String_isomeric 정보
CN(C)CC[C@H](C1=CC=C(Cl)C=C1)C1=CC=CC=N1
|
| InChI Identifier |
Acetylcysteine에 대한 InChI_Identifier 정보
InChI=1/C5H9NO3S/c1-3(7)6-4(2-10)5(8)9/h4,10H,2H2,1H3,(H,6,7)(H,8,9)/t4-/m0/s1/f/h6,8H
Chlorpheniramine에 대한 InChI_Identifier 정보
InChI=1/C16H19ClN2/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9,11,15H,10,12H2,1-2H3
|
| Chemical IUPAC Name |
Acetylcysteine에 대한 Chemical_IUPAC_Name 정보
(2R)-2-acetamido-3-sulfanylpropanoic acid
Chlorpheniramine에 대한 Chemical_IUPAC_Name 정보
3-(4-chlorophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine
|
| Drug-Induced Toxicity Related Proteins |
MALEATE 의 Drug-Induced Toxicity Related Protein정보
Replated Protein:Intercellular adhesion molecule 1
Drug:maleate
Toxicity:hepatic injury.
[바로가기]
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2025-10-29
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
|
|
|
|
전문/일반
