| |
|
|
|
|
|
 |
| |
|
¾Æ°¡Çª¸°ÁÖ»ç(ÆæÅå½ÃÇʸ°) 5mL Agafurin Injection
|
|
Àü¹®ÀǾàǰ | ºñ±Þ¿©
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
652604571[655901690]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
[ºñ±Þ¿©]
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹«»öÅõ¸íÇÑ ¾×ÀÌ ÃæÁøµÈ ¹«»öÅõ¸íÇÑ ¾ÚÇÃ
[Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
5mL/¾ÚÇÃ X 10 |
| ÁÖ¼ººÐÄÚµå |
210830BIJ
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
¸»Ãʵ¿¸Æ¼øÈ¯Àå¾Ö(°£Ç漺ÆÄÇà) Ãʱâ Ä¡·á ¹× °æ±¸Ä¡·á ½Ã º¸Á¶¿ä¹ý
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
1. Á¤¸ÆÁÖ»ç : ¼ºÀÎ ÆæÅå½ÃÇʸ°À¸·Î¼ 1ÀÏ 100mgÀ» ÁÖ»çÇϸç ȯÀÚ¸¦ ´¯È÷°í Àû¾îµµ 5ºÐ°£ °ÉÃļ õõÈ÷ Á¤¸ÆÁÖ»çÇÑ´Ù. ȯÀÚÀÇ °³º°ÀûÀÎ ¹ÝÀÀÀ» ½ÃÇèÇϱâ À§ÇØ Ã³À½¿¡´Â »ý¸® ½Ä¿°ÁÖ»ç¾×¿¡ Èñ¼®½ÃÄÑÅõ¿©ÇÏ´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù.
2. Á¡Àû Á¤¸ÆÁÖ»ç : óÀ½¿¡´Â 1ÀÏ 100mgÀ» 250~500mlÀÇ ÁÖÀÔ¿ë¾×(»ý¸®½Ä¿°ÁÖ»ç¾×, 5%°ú´çÁÖ»ç¾× µî)¿¡ È¥ÇÕÇÏ¿© 90~180ºÐµ¿¾È Á¡Àû Á¤¸ÆÁÖ»çÇÑ´Ù. ±× ´ÙÀ½³¯ºÎÅÍ 1ÀÏ ¿ë·®ÀÌ 300mgÀÌ µÉ ¶§±îÁö ¸ÅÀÏ 50mg¾¿ Áõ·®ÇÑ´Ù. ½ÉÇÑ ¼øÈ¯Àå¾Ö½Ã¿¡´Â 1ÀÏ 2ȸ ÁÖ»çÇÑ´Ù.
3. Á¤¸ÆÁֻ糪 Á¡Àû Á¤¸ÆÁÖ»çÀÇ º¸Á¶¿ä¹ýÀ¸·Î Á¤Á¦ 100~200mgÀ» Åõ¿©ÇÒ ¼ö ÀÖ´Ù. Áõ»óÀÌ °³¼±µÈ ÈÄ¿¡´Â °æ±¸Åõ¿©·Î Ä¡·á¸¦ °è¼ÓÇÒ ¼ö ÀÖ´Ù.
¿¬·É, Áõ»ó¿¡ µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù.
|
| ±Ý±â |
1) ÀÌ ¾à ¶Ç´Â ´Ù¸¥ ¸Þƿũ»êƾ(Methylxanthine)°è ¾à¹°¿¡ °ú¹Î¹ÝÀÀÀ» ³ªÅ¸³»´Â ȯÀÚ
2) ±Þ¼º ½É±Ù°æ»ö ȯÀÚ
3) ´ë·® ÃâÇ÷ ȯÀÚ(ÃâÇ÷ Áõ°¡ÀÇ À§ÇèÀÌ Àִ ȯÀÚ)
4) ±¤¹üÀ§ÇÑ ¸Á¸· ÃâÇ÷ ȯÀÚ(ÃâÇ÷ Áõ°¡ÀÇ À§ÇèÀÌ Àִ ȯÀÚ)
5) ÄÉÅä·Ñ¶ôÀ» Åõ¿©¹Þ°í Àִ ȯÀÚ
|
| ½ÅÁßÅõ¿© |
1) ÁßÁõÀÇ ½ÉºÎÁ¤¸Æ ȯÀÚ
2) ÀúÇ÷¾Ð ȯÀÚ
3) ½Å±â´ÉÀå¾Ö ȯÀÚ(Creatinine clearance°¡ 30ml/min ÀÌÇÏ)
4) ÁßÁõÀÇ °£±â´ÉÀå¾Ö ȯÀÚ
5) Ç×ÀÀ°íÁ¦ Ä¡·á ¶Ç´Â ÀÀ°íÀå¾Ö µî¿¡ ÀÇÇØ ÃâÇ÷ °æÇâÀÌ Áõ°¡µÈ ȯÀÚ
6) Ç÷¾ÐÀÇ ÀúÇϷΠƯº°È÷ À§ÇèÇÒ ¼ö Àִ ȯÀÚ(¿¹ : ÁßÁõÀÇ °ü»óµ¿¸ÆÁúȯ ¶Ç´Â ³úÇ÷°üÀÇ ÇùÂø Áõ)
|
| ÀÌ»ó¹ÝÀÀ |
1) °ú¹ÎÁõ : ¶§¶§·Î ¼Ò¾ç°¨, ÇǺκӾîÁü, µÎµå·¯±â µîÀÌ ±×¸®°í °³°³¿¡ µû¶ó Ç÷°ü½Å°æ¼º ºÎÁ¾, ±â°üÁö °æ·Ã, ½ÉÁö¾î ¼ï°ú °°Àº ÁßÁõÀÇ ¾Æ³ªÇʶô½Ã¼º/¾Æ³ªÇʶôÅäÀÌµå ¹ÝÀÀÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ¾Æ³ªÇʶô½Ã¼º/¾Æ³ªÇʶôÅäÀÌµå ¹ÝÀÀÀÌ ³ªÅ¸³ª¸é ÀÌ ¾àÀÇ Åõ¿©¸¦ Áï½Ã Áß´ÜÇϰí Àǻ翡°Ô ¾Ë·Á¾ß ÇÑ´Ù.
2) ¼øÈ¯±â°è : ºó¸Æ, µå¹°°Ô Çù½ÉÁõ, Çù½ÉÅë, Ç÷¾Ð°ÇÏ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
3) °£Àå : µå¹°°Ô ALT, AST »ó½ÂÀÌ, °³Àο¡ µû¶ó °£Àå³» ´ãÁó¿ïü, transaminase »ó½ÂÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
4) Ç÷¾× : ƯÈ÷ ÃâÇ÷ °æÇâÀÌ Áõ°¡ÇÑ È¯ÀÚ¿¡¼´Â µå¹°°Ô ÃâÇ÷(ÇǺΠ¹× Á¡¸·, À§Àå°ü¿¡¼)ÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¸ç, °³Àο¡ µû¶ó¼´Â Ç÷¼ÒÆÇ°¨¼Ò°¡ ³ªÅ¸³¯ ¼öµµ ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇÑ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÏ´Â µî ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù.
5) Á¤½Å½Å°æ°è : ¶§·Î´Â ¾îÁö·¯¿ò, µÎÅë, ºÒ¾È, ¼ö¸éÀå¾Ö°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
6) ±âŸ : ¹«±Õ¼º¼ö¸·¿°ÀÌ ÀϾ ¼ö ÀÖ´Ù.
7) ƯÈ÷ ÆæÅå½ÃÇʸ°À» °í¿ë·®À¸·Î ¶Ç´Â ÁÖÀÔ¼Óµµ¸¦ ³ô¿©¼ Åõ¿©ÇßÀ» ¶§, ´ÙÀ½°ú °°Àº ÀÌ»ó¹ÝÀÀÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. : ¹ß¿, À§¾Ð°ú °°Àº À§Àå°ü ºÒÄè°¨, ÆØ¸¸°¨, ±¸¿ª, ±¸Åä, ¼³»ç µîÀÌ ºó¹øÇÏ°Ô ÀϾ¸ç ¶§¶§·Î ºÎÁ¤¸Æ(¿¹ : ºó¸Æ)ÀÌ ÀϾ ¼ö ÀÖ´Ù.
|
| »óÈ£ÀÛ¿ë |
1) Ç×ÀÀ°íÁ¦ ¶Ç´Â Ç÷¼ÒÆÇÀÀÁý¾ïÁ¦Á¦¿Í º´¿ëÅõ¿© ¶Ç´Â ´Üµ¶Åõ¿©½Ã ÃâÇ÷, ÇÁ·ÎÆ®·Òºó½Ã°£ÀÇ ¿¬ÀåÀÌ º¸°íµÇ¾ú´Ù.
2) Àν¶¸° ¶Ç´Â °æ±¸¿ë Ç÷´ç°ÇÏÁ¦ÀÇ Ç÷´ç°ÇÏÀÛ¿ëÀ» Áõ°½Ãų ¼ö ÀÖÀ¸¹Ç·Î ´ç´¢º´ Ä¡·áÁ¦¸¦ Åõ¿©¹Þ°í Àִ ȯÀÚÀÇ °æ¿ì ÁÖÀDZí°Ô ¸ð´ÏÅ͸µÇÑ´Ù.
3) ÀÌ ¾àÀº °íÇ÷¾Ð ¾à¹° ¹× Ç÷¾ÐÀ» ³·Ãß´Â ´Ù¸¥ ¾à¹°µéÀÇ Ç÷¾Ð°ÇÏÀÛ¿ëÀ» Áõ°½Ãų ¼ö ÀÖ´Ù.
4) ÆæÅå½ÃÇʸ°°ú Å׿ÀÇʸ°À» º´¿ëÅõ¿©ÇÒ °æ¿ì ¸î¸î ȯÀÚ¿¡¼ Å׿ÀÇʸ°ÀÇ Ç÷Áß³óµµ°¡ Áõ°¡ÇÒ ¼ö ÀÖÀ¸¸ç µû¶ó¼ Å׿ÀÇʸ°¿¡ ÀÇÇÑ ÀÌ»ó¹ÝÀÀÀÌ Áõ°¡Çϰųª ½ÉÇØÁú ¼ö ÀÖ´Ù.
5) ÆæÅå½ÃÇʸ°Àº ÄÉÅä·Ñ¶ô°ú º´¿ëÅõ¿©½Ã ÃâÇ÷ ¹× ÇÁ·ÎÆ®·Òºó ½Ã°£ ¿¬ÀåÀÇ À§ÇèÀÌ ÀÖÀ¸¹Ç·Î º´¿ëÅõ¿©ÇÏÁö ¾Ê´Â´Ù
|
| Off-label Usage |
[Á¶È¸]
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
(µ¿¹° ½ÇÇè¿¡¼ ÁߵÀÇ À§ÇèÀÌ º¸°íµÇ¾úÀ¸³ª, ÀӺΠ´ë»ó ÀÓ»ó½ÃÇèÀº Á¦ÇÑÀûÀÌ´Ù. )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Pentoxifylline¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Pentoxifylline inhibits erythrocyte phosphodiesterase, resulting in an increase in erythrocyte cAMP activity. Subsequently, the erythrocyte membrane becomes more resistant to deformity. Along with erythrocyte activity, pentoxifylline also decreases blood viscosity by reducing plasma fibrinogen concentrations and increasing fibrinolytic activity.
|
| Pharmacology |
Pentoxifylline¿¡ ´ëÇÑ Pharmacology Á¤º¸ Pentoxifylline, a synthetic dimethylxanthine derivative structurally related to theophylline and caffeine, is used in the treatment of peripheral vascular diseases and in the management of cerebrovascular insufficiency, sickle cell disease, and diabetic neuropathy.
|
| Pharmacokinetics |
PentoxifyllineÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : °æ±¸ : Àß Èí¼öµÊ
- ´ë»ç : °£¿¡¼ ÃÊȸÅë°úÈ¿°ú
- ¹Ý°¨±â : ¹Ìº¯Èü : 24-48ºÐ. ´ë»çü : 60-96ºÐ
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : 2-4 ½Ã°£ À̳»
- ¼Ò½Ç : ÁÖ·Î ½Å¹è¼³
|
| Toxicity |
Pentoxifylline¿¡ ´ëÇÑ Toxicity Á¤º¸ LD50=1385 mg/kg(orally in mice)
|
| Drug Interactions |
Pentoxifylline¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Aminophylline Pentoxifylline increases the effect and toxicity of theophyllineDyphylline Pentoxifylline increases the effect and toxicity of theophyllineTheophylline Pentoxifylline increases the effect and toxicity of theophyllineOxtriphylline Pentoxifylline increases the effect and toxicity of theophyllineAnisindione Pentoxifylline increases the anticoagulant effectDicumarol Pentoxifylline increases the anticoagulant effectAcenocoumarol Pentoxifylline increases the anticoagulant effectWarfarin Pentoxifylline increases the anticoagulant effect
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Pentoxifylline¿¡ ´ëÇÑ Description Á¤º¸ A methylxanthine derivative that inhibits phosphodiesterase and affects blood rheology. It improves blood flow by increasing erythrocyte and leukocyte flexibility. It also inhibits platelet aggregation. Pentoxifylline modulates immunologic activity by stimulating cytokine production. [PubChem]
|
| Dosage Form |
Pentoxifylline¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Tablet, extended release Oral
|
| Drug Category |
Pentoxifylline¿¡ ´ëÇÑ Drug_Category Á¤º¸ Free Radical ScavengersHematologic AgentsHemorrheologic AgentsPhosphodiesterase InhibitorsPlatelet Aggregation InhibitorsRadiation-Protective AgentsVasodilator Agents
|
| Smiles String Canonical |
Pentoxifylline¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CN1C=NC2=C1C(=O)N(CCCCC(C)=O)C(=O)N2C
|
| Smiles String Isomeric |
Pentoxifylline¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CN1C=NC2=C1C(=O)N(CCCCC(C)=O)C(=O)N2C
|
| InChI Identifier |
Pentoxifylline¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C13H18N4O3/c1-9(18)6-4-5-7-17-12(19)10-11(14-8-15(10)2)16(3)13(17)20/h8H,4-7H2,1-3H3
|
| Chemical IUPAC Name |
Pentoxifylline¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 3,7-dimethyl-1-(5-oxohexyl)purine-2,6-dione
|
| Drug-Induced Toxicity Related Proteins |
PENTOXIFYLLINE ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Thrombomodulin Drug:pentoxifylline Toxicity:endothelial injury. [¹Ù·Î°¡±â] Replated Protein:Matrix metalloproteinase Drug:pentoxifylline Toxicity:antifibrogenic action. [¹Ù·Î°¡±â] Replated Protein:Granzyme B Drug:pentoxifylline Toxicity:profound inhibitory effect. [¹Ù·Î°¡±â] Replated Protein:Perforin Drug:pentoxifylline Toxicity:profound inhibitory effect. [¹Ù·Î°¡±â] Replated Protein:Interleukin-6 Drug:pentoxifylline Toxicity:inflammation. [¹Ù·Î°¡±â] Replated Protein:Tumor necrosis factor (TNF alpha) Drug:pentoxifylline Toxicity:inflammation. [¹Ù·Î°¡±â] Replated Protein:Metalloproteinase inhibitor 1 Drug:pentoxifylline Toxicity:antifibrogenic action. [¹Ù·Î°¡±â] Replated Protein:Tumor necrosis factor (TNF beta) Drug:pentoxifylline Toxicity:inflammation. [¹Ù·Î°¡±â] Replated Protein:Interleukin-1 Drug:pentoxifylline Toxicity:inflammation. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-10-13
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|