 |
| |
|
¾Æ¸ðŸ¼ÕÅ©¸²(µðÇÁ·ÎÇǿ»ê¾ËŬ·Î¸ÞŸ¼Õ) 450g Amotasone Cream.
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
657302481
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/450g/Åë(2022.02.01)(ÇöÀç¾à°¡)
\38,250 ¿ø/450g/Åë(2020.06.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
Èò»öÀÇ Å©¸²Á¦ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
450g/Åë |
| ÁÖ¼ººÐÄÚµå |
103433CCM
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
½ÀÁø․ÇǺο°±º, °Ç¼±
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
1ÀÏ 1-2ȸ Àû´ç·®À» ȯºÎ¿¡ ¾ã°Ô ¹Ù¸£°í Áõ»ó¿¡ µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù. ¼Ò¾ÆÀÇ °æ¿ì 3ÁÖ ÀÌ»ó »ç¿ëÇÏÁö ¾Ê´Â´Ù.
|
| ±Ý±â |
1) ¼¼±Õ(°áÇÙ, ¸Åµ¶ µî)․Áø±Õ(ĵð´ÙÁõ, ¹é¼± µî)․¹ÙÀÌ·¯½º(´ë»óÆ÷Áø, ´Ü¼øÆ÷Áø, ¼öµÎ, Á¾µÎÁõ µî)․µ¿¹°(¿È, »ç¸é¹ßÀÌ µî)¼º ÇǺΰ¨¿°Áõ ȯÀÚ(Áõ»óÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù)
2) ÀÌ ¾à ¶Ç´Â ÀÌ ¾à ¼ººÐ¿¡ °ú¹ÎÁõ ¹× ±× º´·ÂÀÌ Àִ ȯÀÚ
3) °í¸· õ°øÀÌ ÀÖ´Â ½ÀÁø¼º ¿ÜÀ̵µ¿° ȯÀÚ(õ°øºÎÀ§ÀÇ Ä¡À¯Áö¿¬ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù)
4) ±Ë¾ç(º£Ã¼Æ®º´ Á¦¿Ü), Á¦2µµ ½ÉÀ缺 ÀÌ»óÀÇ È»ó․µ¿»ó ȯÀÚ(ÇǺÎÀç»ýÀÌ ¾ïÁ¦µÇ¾î Ä¡À¯°¡ Áö¿¬µÉ ¼ö ÀÖ´Ù)
5) ÀÔÁÖÀ§ÇǺο°, º¸Åë¿©µå¸§, ÁÖ»çȯÀÚ
6) 1¼¼ ¹Ì¸¸ÀÇ ¿µ¾Æ |
| ½ÅÁßÅõ¿© |
1) ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀÎ ¹× ¼öÀ¯ºÎ
2) À¯․¼Ò¾Æ
3) °í·ÉÀÚ
4) ÀÌ ¾àÀº ÇÁ·ÎÇÊ·»±Û¸®ÄÝÀ» ÇÔÀ¯Çϰí ÀÖÀ¸¹Ç·Î ÀÌ ¼ººÐ¿¡ °ú¹ÎÇϰųª ¾Ë·¹¸£±â º´·ÂÀÌ Àִ ȯÀÚ¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù. |
| ÀÌ»ó¹ÝÀÀ |
1) ÇǺÎ
¨ç °¨¿°Áõ : ÇǺÎÀÇ ¼¼±Õ¼º(Àü¿°¼º ³ó°¡Áø, ¸ð³¶¿° µî) ¹× Áø±Õ¼º(ĵð´ÙÁõ, ¹é¼± µî), ¹ÙÀÌ·¯½º¼º °¨¿°ÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù[¹ÐºÀºØ´ë¹ý(ODT)ÀÇ °æ¿ì ³ªÅ¸³ª±â ½±´Ù]. ÀÌ¿Í °°Àº Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â ÀûÀýÇÑ Ç×±ÕÁ¦³ª Ç×Áø±ÕÁ¦ µîÀ» º´¿ëÇϰí Áõ»óÀÌ ½Å¼ÓÈ÷ °³¼±µÇÁö ¾ÊÀ» °æ¿ì¿¡´Â »ç¿ëÀ» ÁßÁöÇÑ´Ù.
¨è ÀϹÝÀû ÇǺÎÁõ»ó : ¸ð³¶¿°, ºÎ½º·³, ÇǺÎÀÚ±Ø, ÀÚÅë, ¹ß¿, ÀÛ¿°¨, ¹ßÁø, ¹ßÀû, È«Á¶, °¡·Á¿ò, ÇǺΰÇÁ¶, ³óÆ÷¼ºÇǺο°, ¾Ë·¹¸£±â¼º Á¢ÃËÇǺο°, ¶¡¶ì, ÇÑÁø, »óó¾ÇÈ, ¿åâ, ³óÆ÷Áõ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¸ç, ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â »ç¿ëÀ» ÁßÁöÇÑ´Ù.
¨é Àå±â ¿¬¿ë : ½ºÅ×·ÎÀ̵强 ¿©µå¸§, ½ºÅ×·ÎÀ̵强 ÇǺÎ(ÇǺÎÀ§Ãà, ¸ð¼¼Ç÷°üÈ®Àå, ÀÚ¹Ý), ½ºÅ×·ÎÀ̵强 ÁÖ»ç, ÀÔÁÖÀ§ÇǺο°(ÀÔÁÖÀ§․¾È¸éÀüü¿¡ È«¹Ý, ±¸Áø, ¸ð¼¼Ç÷°üÈ®Àå, µüÁö, Àμ³), ¾î¸°¼±(åÛ×÷àÈ)¾ç ÇǺκ¯È, ´Ù¸ð, »ö¼ÒÅ»½Ç, ¼±Á¶, ¼öÆ÷¼ºÇǺο°, ¾ÆÅäÇÇÇǺο°, ÇǺÎÃâÇ÷ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â õõÈ÷ »ç¿ë·®À» ÁÙ¿© ÄÚ¸£Æ¼ÄÚÀ̵带 ÇÔÀ¯ÇÏÁö ¾ÊÀº ¾àÀ¸·Î ¹Ù²Ù¾î »ç¿ëÇÑ´Ù.
2) ³»ºÐºñ°è : ´ë·® ¶Ç´Â Àå±â°£¿¡ °ÉÄ£ ±¤¹üÀ§ÇÑ »ç¿ë, ¹ÐºÀºØ´ë¹ý¿¡ ÀÇÇØ ÄÚ¸£Æ¼ÄÚÀ̵å Àü½Å Åõ¿©¿Í °°Àº ³úÇϼöü․ºÎ½ÅÇÇÁú°è ±â´ÉÀÇ ¾ïÁ¦¸¦ °¡Á®¿Ã ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù.
3) ´« : ¾È°ËÇǺο¡ »ç¿ë½Ã ¾È¾Ð »ó½Â, ³ì³»ÀåÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù. ´ë·® ¶Ç´Â Àå±â°£¿¡ °ÉÄ£ ±¤¹üÀ§ÇÑ »ç¿ë, ƯÈ÷ ¹ÐºÀºØ´ë¹ýÀ» »ç¿ëÇÒ °æ¿ì Èij¶ÇϹ鳻Àå, ³ì³»Àå µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Á¦Çüº° º¹¾àÁöµµ |
[Å©¸²] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Alclometasone¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ The mechanism of the anti-inflammatory activity of the topical steroids, in general, is unclear. However, corticosteroids are thought to act by the induction of phospholipase A2 inhibitory proteins, collectively called lipocortins. It is postulated that these proteins control the biosynthesis of potent mediators of inflammation such as prostaglandins and leukotrienes by inhibiting the release of their common precursor, arachidonic acid. Arachidonic acid is released from membrane phospholipids by phospholipase A2. Alclometasone also binds the corticosteroid receptor.
|
| Pharmacology |
Alclometasone¿¡ ´ëÇÑ Pharmacology Á¤º¸ Alclometasone is a synthetic corticosteroid for topical dermatologic use. The corticosteroids constitute a class of primarily synthetic steroids used topically as anti-inflammatory and antipruritic agents. Alclometasone is a selective glucocorticoid receptor agonist.
|
| Metabolism |
Alclometasone¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 3A4 (CYP3A4)
|
| Absorption |
Alclometasone¿¡ ´ëÇÑ Absorption Á¤º¸ Topical corticosteroids can be absorbed from normal intact skin. Studies have shown that approximately 3% of steroid is absorbed during 8 hours of contact with intact skin of normal volunteers.
|
| Biotransformation |
Alclometasone¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic.
|
| Toxicity |
Alclometasone¿¡ ´ëÇÑ Toxicity Á¤º¸ Symptoms of overdose include suppression of adrenal glands, temporary decrease in white blood cell counts, symptoms of hypersensitivity (such as skin rash, hives, itching, and difficulty breathing), and increased susceptibility to infection.
|
| Drug Interactions |
Alclometasone¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Alclometasone¿¡ ´ëÇÑ Description Á¤º¸ Alclometasone is synthetic glucocorticoid steroid for topical use in dermatology as anti-inflammatory, antipruritic, antiallergic, antiproliferative and vasoconstrictive agent. [Wikipedia]
|
| Dosage Form |
Alclometasone¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Cream TopicalOintment Topical
|
| Drug Category |
Alclometasone¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-inflammatory AgentsAntipruritic AgentsCorticosteroidsGlucocorticoids
|
| Smiles String Canonical |
Alclometasone¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CCC(=O)OCC(=O)C1(OC(=O)CC)C(C)CC2C3C(Cl)CC4=CC(=O)C=CC4(C)C3C(O)CC12C
|
| Smiles String Isomeric |
Alclometasone¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CCC(=O)OCC(=O)[C@@]1(OC(=O)CC)[C@H](C)C[C@H]2[C@@H]3[C@H](Cl)CC4=CC(=O)C=C[C@]4(C)[C@H]3[C@@H](O)C[C@]12C
|
| InChI Identifier |
Alclometasone¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C28H37ClO7/c1-6-22(33)35-14-21(32)28(36-23(34)7-2)15(3)10-18-24-19(29)12-16-11-17(30)8-9-26(16,4)25(24)20(31)13-27(18,28)5/h8-9,11,15,18-20,24-25,31H,6-7,10,12-14H2,1-5H3/t15-,18+,19-,20+,24-,25+,26+,27+,28+/m1/s1
|
| Chemical IUPAC Name |
Alclometasone¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ [(7R,8S,9S,10R,11S,13S,14S,16R,17R)-7-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-(2-propanoyloxyacetyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2024-06-05
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
The database contains the following fields: The generic name of each chemical For module A10 (liver enzyme composite module): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the number of active and marginally active scores for each compound at the five individual endpoints (see research article for full description of method) Number of endpoints at which each compound is marginally active (M) Number of endpoints at which each compound is active (A) For modules A11 to A15 (alkaline phosphatase increased, SGOT increased, SGPT increased, LDH increased, and GGT increased, respectively): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the RI and ADR values (see the research article for full description of method) Number of ADR reports for each compound, given as <4 or ¡Ã4 Reporting Index value for each compound, except where no shipping units were available (NSU) Group 1 comprises of compounds for which ADR data were available for the first five years of marketing, so when no ADR reports were listed during this period the compounds were evaluated as inactive. Group 2 comprises of compounds for which a 'steady state' period of ADR data were available (1992-1996). In cases where no ADR reports were filed during this period, the compounds were scored as 'NA' (data not available) since they may have had one or more ADR reports during their first five years of marketing which should not be negated by a lack of ADR reports during the steady-state period. ALCLOMETASONE[GGT Increase][Composite Activity](Score) I(Marginal) 0(Active) 0[Alkaline Phosphatase Increase](Activity Score) I(Number of Rpts) <4(Index value) 0[SGOT Increase](Activity Score) I(Number of Rpts) <4(Index value) 0[SGPT Increase](Activity Score) I(Number of Rpts) <4(Index value) 0[LDH Increase](Activity Score) I(Number of Rpts) <4(Index value) 0[GGT Increase](Activity Score) I(Number of Rpts) <4(Index value) 0
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|