| |
|
|
|
|
|
 |
| |
|
뉴실크(시클로피록스)
|
|
일반의약품 | 삭제
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
657800100[A20401921]
[보험코드에 따른 약품기본정보 직접조회]
\0 원/3g/병(2011.11.01)(현재약가)
\13,445 원/3g/병(2004.02.01)(변경전약가)
[상병코드조회]
[질병코드조회]
|
| 빠른조회 |
|
| 제품성상 |
무색 내지 미황색의 투명한 액제 [제형정보 확인] |
| 포장·유통단위 |
3, 5, 10그람 |
| 포장·코드단위 |
| 약품규격 |
단위 |
포장형태 |
대표코드 |
표준코드 |
비고 |
| 3그램 |
1 개 |
병 |
8806578001003 |
8806578001010 |
|
|
| 주성분코드 |
451601CLQ
[동일한 주성분코드를 가진 오리지날 또는 제네릭 의약품 조회]
|
| 허가사항 원문조회 |
[허가사항 원문조회]
|
| 효능효과 |
[적응증 별 검색]
조갑진균증(손발톱진균증)(손, 발톱무좀)
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
이 약을 처음 사용할 때에는 먼저 손톱깍기나 가위 등으로 가능한 한 많은 환부(질환 부위)를 제거하고 남아있는 환부(질환 부위)는 첨부된 손발톱용 사포(Sand paper)나 줄을 사용하여 거칠게 해주어야 한다. 특별한 지시가 없는 한 이 약은 첫째달은 이틀에 한번씩, 둘째달에는 적어도 주 2회, 셋째달 이후에는 주 1회 얇은 막이 형성되도록 환부(질환 부위)에 바른다. 매주 1회 정도는 첨부된 1회용 광택제거제를 사용하여 라카막 전체를 벗겨낸 뒤 사포를 사용하여 처음과 같이 환부(질환 부위)를 거칠게 해준다. 중도에 라카막이 벗겨졌을 경우에는 벗겨진 부분에만 바르는 것으로 충분하다. 적용기간은 증상의 정도에 따라 다르나, 6개월을 초과하지 않도록 한다.
|
| 금기 |
소아(충분한 임상경험이 없다)
|
| 신중투여 |
임부 또는 임신하고 있을 가능성이 있는 부인 및 수유부
|
| 이상반응 |
때때로 네일라카에 접촉된 손발톱 주위의 피부에서 발적(충혈되어 붉어짐), 인설(비늘)이 나타날 수 있다.
|
| 상호작용 |
이 약을 투여하는 동안에는 약 효과가 감소될 수 있으므로 손발톱 화장용 광택제의 사용을 피한다.
|
| Related FDA Approved Drug |
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| |
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 축약복약지도 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : B등급
(ciclopirox topical )
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
| Pharmacokinetics |
유료정보입니다.
|
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| Mechanism of Action |
Ciclopirox에 대한 Mechanism_Of_Action 정보
Unlike antifungals such as itraconazole and terbinafine, which affect sterol synthesis, ciclopirox is thought to act through the chelation of polyvalent metal cations, such as Fe3+ and Al3+. These cations inhibit many enzymes, including cytochromes, thus disrupting cellular activities such as mitochondrial electron transport processes and energy production. Ciclopirox also appears to modify the plasma membrane of fungi, resulting in the disorganization of internal structures. The anti-inflammatory action of ciclopirox is most likely due to inhibition of 5-lipoxygenase and cyclooxygenase.
|
| Pharmacology |
Ciclopirox에 대한 Pharmacology 정보
Ciclopirox is a broad-spectrum antifungal medication that also has antibacterial and anti-inflammatory properties. Its main mode of action is thought to be its high affinity for trivalent cations, which inhibit essential co-factors in enzymes. Ciclopirox exhibits either fungistatic or fungicidal activity in vitro against a broad spectrum of fungal organisms, such as dermatophytes, yeasts, dimorphic fungi, eumycetes, and actinomycetes. In addition to its broad spectrum of action, ciclopirox also exerts antibacterial activity against many Gram-positive and Gram-negative bacteria. Furthermore, the anti-inflammatory effects of ciclopirox have been demonstrated in human polymorphonuclear cells, where ciclopirox has inhibited the synthesis of prostaglandin and leukotriene. Ciclopirox can also exhibit its anti-inflammatory effects by inhibiting the formation of 5-lipoxygenase and cyclooxygenase.
|
| Protein Binding |
Ciclopirox에 대한 단백결합 정보
Protein binding is 94-97% following topical administration.
|
| Half-life |
Ciclopirox에 대한 반감기 정보
1.7 hours for 1% topical solution.
|
| Absorption |
Ciclopirox에 대한 Absorption 정보
Rapidly absorbed after oral administration. Mean absorption of ciclopirox after application to nails of all twenty digits and adjacent 5 millimeters of skin once daily for 6 months in patients with dermatophytic onychomycoses was less than 5% of the applied dose. Ciclopirox olamine also penetrates into hair and through the epidermis and hair follicles into sebaceous glands and dermis.
|
| Pharmacokinetics |
Ciclopirox의 약물동력학자료
- 흡수 : 외용 : 정상 피부 : 2% 미만
- 단백결합 : 94-98%
- 반감기 : 1.7시간
- 소실 : 흡수된 소량의 약물은 주로 신배설되고, 소량이 변배설된다.
|
| Biotransformation |
Ciclopirox에 대한 Biotransformation 정보
Glucuronidation is the main metabolic pathway of ciclopirox.
|
| Toxicity |
Ciclopirox에 대한 Toxicity 정보
Oral LD50 in rat is >10 ml/kg. Symptoms of overexposure include drowsiness and headache.
|
| Drug Interactions |
Ciclopirox에 대한 Drug_Interactions 정보
Not Available
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Drug Target |
[Drug Target]
|
| Description |
Ciclopirox에 대한 Description 정보
Ciclopirox (also called Loprox짰, Penlac짰 and Stieprox짰) is a synthetic antifungal agent for topical dermatologic use. [Wikipedia]
|
| Drug Category |
Ciclopirox에 대한 Drug_Category 정보
Antifungal Agents
|
| Smiles String Canonical |
Ciclopirox에 대한 Smiles_String_canonical 정보
CC1=CC(=O)N(O)C(=C1)C1CCCCC1
|
| Smiles String Isomeric |
Ciclopirox에 대한 Smiles_String_isomeric 정보
CC1=CC(=O)N(O)C(=C1)C1CCCCC1
|
| InChI Identifier |
Ciclopirox에 대한 InChI_Identifier 정보
InChI=1/C12H17NO2/c1-9-7-11(13(15)12(14)8-9)10-5-3-2-4-6-10/h7-8,10,15H,2-6H2,1H3
|
| Chemical IUPAC Name |
Ciclopirox에 대한 Chemical_IUPAC_Name 정보
6-cyclohexyl-1-hydroxy-4-methylpyridin-2-one
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2025-09-30
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
The database contains the following fields: The generic name of each chemical For module A10 (liver enzyme composite module): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the number of active and marginally active scores for each compound at the five individual endpoints (see research article for full description of method) Number of endpoints at which each compound is marginally active (M) Number of endpoints at which each compound is active (A) For modules A11 to A15 (alkaline phosphatase increased, SGOT increased, SGPT increased, LDH increased, and GGT increased, respectively): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the RI and ADR values (see the research article for full description of method) Number of ADR reports for each compound, given as <4 or ≥4 Reporting Index value for each compound, except where no shipping units were available (NSU) Group 1 comprises of compounds for which ADR data were available for the first five years of marketing, so when no ADR reports were listed during this period the compounds were evaluated as inactive. Group 2 comprises of compounds for which a 'steady state' period of ADR data were available (1992-1996). In cases where no ADR reports were filed during this period, the compounds were scored as 'NA' (data not available) since they may have had one or more ADR reports during their first five years of marketing which should not be negated by a lack of ADR reports during the steady-state period. CICLOPIROX[GGT Increase][Composite Activity](Score) I(Marginal) 0(Active) 0[Alkaline Phosphatase Increase](Activity Score) I(Number of Rpts) <4(Index value) 0[SGOT Increase](Activity Score) I(Number of Rpts) <4(Index value) 0[SGPT Increase](Activity Score) I(Number of Rpts) <4(Index value) 0[LDH Increase](Activity Score) I(Number of Rpts) <4(Index value) 0[GGT Increase](Activity Score) I(Number of Rpts) <4(Index value) 0
병용금기 및 특정연령대 금기 성분
|
|
|
|
전문/일반
내용보기
