| |
|
|
|
|
|
 |
| |
|
엘틴정(엘카르니틴) L-tine Tab.
|
|
일반의약품 | 비급여
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
054800160
[보험코드에 따른 약품기본정보 직접조회]
[비급여]
[상병코드조회]
[질병코드조회]
|
| 빠른조회 |
|
| 제품성상 |
흰색의 원형필름코팅정 [제형정보 확인] |
| 포장·유통단위 |
90정(10정/PTP포장×9) |
| 포장·코드단위 |
| 약품규격 |
단위 |
포장형태 |
대표코드 |
표준코드 |
비고 |
| 330밀리그램 |
90 정 |
PTP |
8800548001604 |
8800548001611 |
|
|
| 주성분코드 |
124503ATB
[동일한 주성분코드를 가진 오리지날 또는 제네릭 의약품 조회]
|
| 허가사항 원문조회 |
[허가사항 원문조회]
|
| 효능효과 |
[적응증 별 검색]
1. 1차성, 2차성 카르니틴결핍증
2. 허혈성심질환에 의한 심근대사장애 : 협심증, 급성심근경색
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
성인 : 엘-카르니틴으로서 1일 2-3g을 2-3회 분할 경구투여한다.
연령, 증상에 따라 적절히 증감한다.
|
| 금기 |
다음 환자에는 투여하지 말 것.
이 약에 과민증 환자
|
| 이상반응 |
일시적인 구역·구토, 복통, 설사, 체취가 나타날 수 있다.
이 약을 복용한 환자에게서 발진, 두드러기, 안면부종이 보고되었다.
이 약을 복용한 요독증 환자에게서 경증의 근무력증이 보고되었다.
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| |
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 축약복약지도 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| Mechanism of Action |
L-carnitine에 대한 Mechanism_Of_Action 정보
Levocarnitine can be synthesised within the body from the amino acids lysine or methionine. Vitamin C (ascorbic acid) is essential to the synthesis of carnitine. Levocarnitine is a carrier molecule in the transport of long chain fatty acids across the inner mitochondrial membrane. It also exports acyl groups from subcellular organelles and from cells to urine before they accumulate to toxic concentrations. Only the L isomer of carnitine (sometimes called vitamin BT) affects lipid metabolism. Levocarnitine is handled by several proteins in different pathways including carnitine transporters, carnitine translocases, carnitine acetyltransferases and carnitine palmitoyltransferases.
|
| Pharmacology |
L-carnitine에 대한 Pharmacology 정보
Levocarnitine is a carrier molecule in the transport of long chain fatty acids across the inner mitochondrial membrane. It also exports acyl groups from subcellular organelles and from cells to urine before they accumulate to toxic concentrations. Lack of carnitine can lead to liver, heart, and muscle problems. Carnitine deficiency is defined biochemically as abnormally low plasma concentrations of free carnitine, less than 20 µmol/L at one week post term and may be associated with low tissue and/or urine concentrations. Further, this condition may be associated with a plasma concentration ratio of acylcarnitine/levocarnitine greater than 0.4 or abnormally elevated concentrations of acylcarnitine in the urine. Only the L isomer of carnitine (sometimes called vitamin BT) affects lipid metabolism. The "vitamin BT" form actually contains D,L-carnitine, which competitively inhibits levocarnitine and can cause deficiency. Levocarnitine can be used therapeutically to stimulate gastric and pancreatic secretions and in the treatment of hyperlipoproteinemias.
|
| Metabolism |
L-carnitine에 대한 Metabolism 정보
# Phase_1_Metabolizing_Enzyme:Not Available
|
| Protein Binding |
L-carnitine에 대한 단백결합 정보
None
|
| Half-life |
L-carnitine에 대한 반감기 정보
17.4 hours (elimination) following a single intravenous dose.
|
| Absorption |
L-carnitine에 대한 Absorption 정보
Absolute bioavailability is 15% (tablets or solution).
|
| Biotransformation |
L-carnitine에 대한 Biotransformation 정보
Major metabolites include trimethylamine N-oxide and [3H]-gamma-butyrobetaine.
|
| Toxicity |
L-carnitine에 대한 Toxicity 정보
LD50 > 8g/kg (mouse, oral). Adverse effects include hypertension, fever, tachycardia and seizures.
|
| Drug Interactions |
L-carnitine에 대한 Drug_Interactions 정보
Not Available
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Drug Target |
[Drug Target]
|
| Description |
L-carnitine에 대한 Description 정보
Constituent of striated muscle and liver. It is used therapeutically to stimulate gastric and pancreatic secretions and in the treatment of hyperlipoproteinemias. [PubChem]
|
| Drug Category |
L-carnitine에 대한 Drug_Category 정보
MetaboliteNootropic AgentsNutraceuticalVitamin B ComplexVitamins (Vitamin B Complex)
|
| Smiles String Canonical |
L-carnitine에 대한 Smiles_String_canonical 정보
C[N+](C)(C)CC(O)CC([O-])=O
|
| Smiles String Isomeric |
L-carnitine에 대한 Smiles_String_isomeric 정보
C[N+](C)(C)C[C@H](O)CC([O-])=O
|
| InChI Identifier |
L-carnitine에 대한 InChI_Identifier 정보
InChI=1/C7H15NO3/c1-8(2,3)5-6(9)4-7(10)11/h6,9H,4-5H2,1-3H3/t6-/m1/s1
|
| Chemical IUPAC Name |
L-carnitine에 대한 Chemical_IUPAC_Name 정보
(3R)-3-hydroxy-4-trimethylazaniumylbutanoate
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2025-10-13
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
|
|
|
|
전문/일반
