| |
|
|
|
|
|
 |
| |
|
트리톤치과용연고(미노사이클린염산염) 10g Treaton Dental Ointment 5g
|
|
전문의약품 | 비급여
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
671705273
[보험코드에 따른 약품기본정보 직접조회]
[비급여]
[상병코드조회]
[질병코드조회]
|
| 빠른조회 |
|
| 제품성상 |
노란색의 연고제 [제형정보 확인] |
| 포장·유통단위 |
10그램 /튜브 |
| 주성분코드 |
195933COM
[동일한 주성분코드를 가진 오리지날 또는 제네릭 의약품 조회]
|
| 허가사항 원문조회 |
[허가사항 원문조회]
|
| 효능효과 |
[적응증 별 검색]
염산 미노사이클린에 감수성인
Porphyromonas ginglvalis,
Prevotella intermedia,
Prevotella melaninogenicus,
Eikenella corrodens,
Fusobacterium nucleatum,
Capnocytophaga spp.
Haemophilus actinomycetemcomitans
에 의한 치주염(만성 변연성 치주염)의 여러 증상의 개선
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
통상 1주일에 1회 치주낭에 충분한 양을 주입한다.
|
| 금기 |
다음 환자에게는 투여하지 말 것.
이 약 또는 이 약 구성성분 및 테트라사이클린계 항생물질에 과민반응 환자
|
| 이상반응 |
1) 과민반응 : 과민증상이 나타나는 일이 있으므로 이러한 증상이 나타났을 경우에는 투여를 중지한다.
2) 균교대증 : 국소에 미노사이클린 내성균 또는 비감염성균에 의한 감염증이 나타나는 경우에는 투여를 중지한다.
3) 기타 : 때때로 투여부위의 동통, 드물게, 자극(발열통), 지각이상(치아의 돌출감), 편두통, 발진이 나타날 수 있다.
|
| Related FDA Approved Drug |
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| |
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 축약복약지도 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : D등급
(임신 2기와 3기에 사용 금기. )
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
| Pharmacokinetics |
유료정보입니다.
|
| 제형별 복약지도 |
[연고] |
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| Mechanism of Action |
Minocycline에 대한 Mechanism_Of_Action 정보
Minocycline passes directly through the lipid bilayer or passively diffuses through porin channels in the bacterial membrane. Tetracyclines like minocycline bind to the 30S ribosomal subunit, preventing the binding of tRNA to the mRNA-ribosome complex and interfering with protein synthesis.
|
| Pharmacology |
Minocycline에 대한 Pharmacology 정보
Minocycline, the most lipid soluble and most active tetracycline antibiotic, is, like doxycycline, a long-acting tetracycline. Minocycline's effects are related to the inhibition of protein synthesis. Although minocycline's broader spectrum of activity, compared to other members of the group, includes activity against Neisseria meningitidis, its use as a prophylaxis is no longer recomended because of side effects (dizziness and vertigo). Current research is examining the possible neuroprotective effects of minocycline against progression of Huntington's Disease, an inherited neurodegenerative disorder. The neuroprotective action of minocycline may include its inhibitory effect on 5-lipoxygenase, an inflammatory enzyme associated with brain aging.
|
| Absorption |
Minocycline에 대한 Absorption 정보
Rapidly absorbed from the gastrointestinal tract and absorption is not significantly impaired by ingestion of food or milk. Oral bioavailability is 100%.
|
| Pharmacokinetics |
Minocycline HCl의 약물동력학자료
- 흡수 : 잘 흡수된다.
- 분포 :
- 태반통과, 유즙분비
- 많은 양이 장시간 지방에 축적되어 있다.
- 단백결합 : 70-75%
- 반감기 : 15시간
- 소실 : 신배설
|
| Toxicity |
Minocycline에 대한 Toxicity 정보
Minocycline has been observed to cause a dark discoloration of the thyroid in experimental animals (rats, minipigs, dogs and monkeys). In the rat, chronic treatment with minocycline has resulted in goiter accompanied by elevated radioactive iodine uptake and evidence of thyroid tumor production. Minocycline has also been found to produce thyroid hyperplasia in rats and dogs. LD50=2380 mg/kg (rat, oral), LD50=3600 mg/kg (mouse, oral)
|
| Drug Interactions |
Minocycline에 대한 Drug_Interactions 정보
Acitretin Increased risk of intracranial hypertensionAluminium Formation of non-absorbable complexesAmoxicillin Possible antagonism of actionAmpicillin Possible antagonism of actionAzlocillin Possible antagonism of actionAztreonam Possible antagonism of actionBacampicillin Possible antagonism of actionCarbenicillin Possible antagonism of actionClavulanate Possible antagonism of actionCloxacillin Possible antagonism of actionCyclacillin Possible antagonism of actionDicloxacillin Possible antagonism of actionFlucloxacillin Possible antagonism of actionHetacillin Possible antagonism of actionMethicillin Acyl-Serine Possible antagonism of actionMezlocillin Possible antagonism of actionNafcillin Possible antagonism of actionOxacillin Possible antagonism of actionPenicillin G Possible antagonism of actionPenicillin V Possible antagonism of actionPiperacillin Possible antagonism of actionPivampicillin Possible antagonism of actionPivmecillinam Possible antagonism of actionTazobactam Possible antagonism of actionTicarcillin Possible antagonism of actionZinc Formation of non-absorbable complexesTrisalicylate-choline Formation of non-absorbable complexesMagnesium oxide Formation of non-absorbable complexesMagnesium Formation of non-absorbable complexesSalicylate-magnesium Formation of non-absorbable complexesIron Formation of non-absorbable complexesBismuth Formation of non-absorbable complexesCalcium Formation of non-absorbable complexesAttapulgite Formation of non-absorbable complexesBismuth Subsalicylate Formation of non-absorbable complexesAnisindione The tetracycline increases the anticoagulant effectAcenocoumarol The tetracycline increases the anticoagulant effectDicumarol The tetracycline increases the anticoagulant effectWarfarin The tetracycline increases the anticoagulant effectDigoxin The tetracycline increases the effect of digoxin in 10% of patientsInsulin The tetracycline increases the risk of hypoglycemiaMethoxyflurane The tetracycline increases the renal toxicity of methoxyfluraneEthinyl Estradiol This anti-infectious agent could decrease the effect of the oral contraceptiveMestranol This anti-infectious agent could decrease the effect of the oral contraceptiveEtretinate Increased risk of intracranial hypertensionIsotretinoin This anti-infectious agent could decrease the effect of the oral contraceptive
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Drug Target |
[Drug Target]
|
| Description |
Minocycline에 대한 Description 정보
A tetracycline analog, having a 7-dimethylamino and lacking the 5 methyl and hydroxyl groups, which is effective against tetracycline-resistant staphylococcus infections. [PubChem]
|
| Dosage Form |
Minocycline에 대한 Dosage_Form 정보
Capsule Oral
|
| Drug Category |
Minocycline에 대한 Drug_Category 정보
Anti-Bacterial AgentsTetracyclines
|
| Smiles String Canonical |
Minocycline에 대한 Smiles_String_canonical 정보
CN(C)C1C2CC3CC4=C(C=CC(O)=C4C(O)=C3C(=O)C2(O)C(=O)C(C1=O)=C(N)O)N(C)C
|
| Smiles String Isomeric |
Minocycline에 대한 Smiles_String_isomeric 정보
CN(C)[C@H]1[C@@H]2C[C@@H]3CC4=C(C=CC(O)=C4C(O)=C3C(=O)[C@]2(O)C(=O)\C(C1=O)=C(/N)O)N(C)C
|
| InChI Identifier |
Minocycline에 대한 InChI_Identifier 정보
InChI=1/C23H27N3O7/c1-25(2)12-5-6-13(27)15-10(12)7-9-8-11-17(26(3)4)19(29)16(22(24)32)21(31)23(11,33)20(30)14(9)18(15)28/h5-6,9,11,17,27-28,32-33H,7-8,24H2,1-4H3/b22-16+/t9-,11-,17-,23-/m0/s1
|
| Chemical IUPAC Name |
Minocycline에 대한 Chemical_IUPAC_Name 정보
(2Z,4S,4aS,5aR,12aS)-2-(amino-hydroxymethylidene)-4,7-bis(dimethylamino)-10,11,12a-trihydroxy-4a,5,5a,6-tetrahydro-4H-tetracene-1,3,12-trione
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2025-07-25
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
|
|
|
|
전문/일반
