 |
| |
|
¶óÀÌÆ®¸ñ½ÃÁ¡¾È¾×(¸ñ½ÃÇ÷ϻç½Å¿°»ê¿°) 6mL Lightmoxi Eye Drops
|
Àü¹®ÀǾàǰ | ±Þ¿©
|
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
690300292
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\4,386 ¿ø/6mL/º´(2019.02.01)(ÇöÀç¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
Åõ¸íÇÑ ÇÃ¶ó½ºÆ½ ¿ë±â¿¡ µç ¿¯Àº ³ìȲ»öÀÇ Á¡¾È¾× [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
6mL/º´ |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 6¹Ð¸®¸®ÅÍ |
1 Á¡¾È¾× |
º´ |
8806903002903 |
8806903002927 |
2~25¡É º¸°ü |
|
| ÁÖ¼ººÐÄÚµå |
380334COS
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
´ÙÀ½ÀÇ °¨¼ö¼º ±ÕÁ¾¿¡ ÀÇÇÑ ¼¼±Õ¼º °á¸·¿°, °ËÆÇ¼±¿°, °¢¸·¿°(°¢¸·±Ë¾çÆ÷ÇÔ)ÀÇ Ä¡·á, ¾È°ú¼ö¼úÀüÈÄÀÇ ¹«±ÕÈ¿ä¹ý :
Æ÷µµ±¸±Õ¼Ó, ¿¬¼â»ó±¸±Õ¼Ó, Æó·Å±¸±Õ, À屸±Õ¼Ó, ¸¶ÀÌÅ©·ÎÄÚÄ«½º¼Ó, ¸ð¶ó¼¿¶ó¼Ó, ÄÚ¸®³×¹ÚÅ׸®¿ò¼Ó, ½ÃÆ®·Î¹ÚÅͼÓ, Ŭ·¾½Ã¿¤¶ó¼Ó, ¿£Å׷ιÚÅͼÓ, ¼¼¶óÄ¡¾Æ¼Ó, ÇÁ·ÎÅ׿콺¼Ó, ¸ô°¡³×¶ó ¸ô°¡´Ï, ÀÎÇ÷翣ÀÚ ±Õ, ½´µµ¸ð³ª½º¼Ó, ¹÷ũȦµ¥¸®¾Æ ¼¼ÆÄÄ¡¾Æ, ½ºÅ×³ëÆ®·ÎÆ÷¸ð³ª½º ¸»ÅäÇʸ®¾Æ, ¾Æ½Ã³×Åä¹ÚŸ ¼Ó, ¾ÆÅ©³×±Õ
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
1. ¼¼±Õ¼º°á¸·¿°, °ËÆÇ¼±¿°, °¢¸·¿°(°¢¸·±Ë¾ç Æ÷ÇÔ) : Åë»ó 1ȸ 1Àû, 1ÀÏ 3ȸ Á¡¾ÈÇÑ´Ù. Áõ»ó¿¡ µû¶ó ÀûÀÇ Áõ°¨ÇÑ´Ù.
2. ¾È°ú¼ö¼úÀüÈÄ ¹«±ÕÈ¿ä¹ý : Åë»ó ¼ö¼ú Àü¿¡´Â 1ȸ 1Àû 1ÀÏ 5ȸ, ¼ö¼ú ÈÄ¿¡´Â 1ȸ 1Àû 1ÀÏ 3ȸ Á¡¾ÈÇÑ´Ù.
3. Á¡¾È ÈÄ ³²Àº ¾×°ú ¿ë±â´Â ¹Ù·Î ¹ö¸°´Ù.(ÀÏȸ¿ë¿¡ ÇÑÇÔ)
|
| ±Ý±â |
1) ¸ñ½ÃÇ÷ϻç½Å, ´Ù¸¥ Äû³î·Ð°è ¾à¹° ¶Ç´Â ÀÌ ¾àÀÇ ´Ù¸¥ ¼ººÐ¿¡ °ú¹ÎÁõ º´·ÂÀÌ ÀÖ´ÂȯÀÚ
2) 1¼¼ ¹Ì¸¸ÀÇ ¿µ¾Æ |
| ½ÅÁßÅõ¿© |
1) ÀӺΠ¶Ç´Â ¼öÀ¯ºÎ |
| ÀÌ»ó¹ÝÀÀ |
1) ´« : °á¸·¿°, ½Ã·Â°¨¼Ò, ¾È±¸°ÇÁ¶, °¢¸·¿°, ¾È±¸ºÒÆí°¨, ¾È±¸ÃæÇ÷, ¾È±¸ÅëÁõ, °¡·Á¿òÁõ, °á¸·ÇÏ ÃâÇ÷, ´«¹°ÀÌ È¯ÀÚÀÇ ¾à 1-6%¿¡¼ ³ªÅ¸³µ½À´Ï´Ù.
2) ±âŸ : ¹ß¿, ±âħ, °¨¿°, ÁßÀÌ¿°, Àεο°, ¹ßÀû, ºñ¿°ÀÌ È¯ÀÚÀÇ ¾à 1-4%¿¡¼ ³ªÅ¸³µ½À´Ï´Ù.
3)ÀϺ»ÀÇ Çã°¡Àü ÀÓ»ó½ÃÇè¿¡¼ 586¸íÀÇ È¯ÀÚµéÀ» ´ë»óÇÏ¿´À» ¶§, 32°Ç(5.5%)ÀÇ ÀÌ»ó¹ÝÀÀÀÌ º¸°íµÇ¾ú½À´Ï´Ù. °¡Àå ºó¹øÇÏ°Ô º¸°íµÈ ÀÌ»ó¹ÝÀÀÀ¸·Î´Â ¾ÈÅë 18°Ç(3.1%), ¹Ì°¢ÀÌ»ó 8°Ç(1.4%), ¾È±¸ÃæÇ÷ 3°Ç(0.5%), ¾È±¸Àڱذ¨ 2°Ç(0.3%)°¡ ÀÖ¾ú½À´Ï´Ù. ÀÓ»ó½ÃÇè´ë»ó¿¡´Â 42·ÊÀÇ ¿µ¾Æ¿Í ¼Ò¾Æ(»ýÈÄ 41ÀÏ ÀÌ»ó 12»ì ¹Ì¸¸)°¡ Æ÷ÇԵǾî, ¾ÈÅë 2°Ç(4.8%), ¹Ì°¢ÀÌ»ó 1°Ç(2.4%), ÃÑ 3°Ç(7.1%)ÀÇ ÀÌ»ó¹ÝÀÀÀÌ º¸°íµÇ¾ú½À´Ï´Ù.
¨ç Áß´ëÇÑ ÀÌ»ó¹ÝÀÀ
¼îÅ© ȤÀº ¾Æ³ªÇʶô½Ã½º Áõ»ó : °æ±¸Á¦·Î Åõ¿©½Ã ¼îÅ©¿Í ¾Æ³ªÇʶô½Ã½ºÁõ»óÀÌ ³ªÅ¸³´Ù´Â º¸°í°¡ ÀÖÀ¸¹Ç·Î, ÃæºÐÈ÷ °üÂûÇϰí, È«¹Ý, ¹ßÁø, È£Èí°ï¶õ, Ç÷¾ÐÀúÇÏ, ¾È°ËºÎÁ¾ µîÀÇ Áõ»óÀÌ ³ªÅ¸³ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí ÀûÀýÇÑ Ã³Ä¡¸¦ ÇØ¾ß ÇÕ´Ï´Ù.
¨è ±âŸ ÀÌ»ó¹ÝÀÀ
´ÙÀ½ÀÇ Áõ»ó ȤÀº ÀÌ»óÀÌ °üÂûµÇ´Â °æ¿ì, Ä¡·á Áß´Ü µîÀÇ Àû´çÇÑ ÀÇÇÐÀû óġ°¡ ÀÌ·ç¾îÁ®¾ß ÇÕ´Ï´Ù.
| |
1% ÀÌ»ó 5% ¹Ì¸¸ |
0.1% ÀÌ»ó 1% ¹Ì¸¸ |
| ¾È±¸ |
¾ÈÅë |
¾È±¸ÃæÇ÷, Àڱذ¨, °¢¸·¿°, À̹°°¨, ¾È°ËºÎÁ¾, ½Ã¾ßÈ帲 |
| ±âŸ |
¹Ì°¢ÀÌ»ó |
Åõ¿©ºÎÀ§ °¨°¢ÀÌ»ó |
4) ½ÃÆÇ ÈÄ Á¶»ç¿¡¼ º¸°íµÇ¾úÁö¸¸ ¹ßÇö ºóµµ°¡ ÃøÁ¤ ºÒ°¡´É(not known)ÇÑ ÀÌ»ó¹ÝÀÀÀº ´ÙÀ½°ú °°´Ù.
- ½ÉÀå : ½É¹æ¼¼µ¿
- ½Å°æ°è : ¾îÁö·¯¿ò
- ´« : ¾È±¸³»¿°, ±Ë¾ç¼º°¢¸·¿°, °¢¸·¹Ì¶õ, °¢¸·Âû°ú»ó, ¾È³»¾ÐÁõ°¡, °¢¸·È¥Å¹, °¢¸· ħÀ±¹°, °¢¸·Ä§Âø, ¾Ë·¯Áö, °¢¸·¿°, °¢¸·ºÎÁ¾, ´«ºÎ½É, °¢¸·ÀÌ»ó, ´«²¨Ç®¿°, ´«²¨Ç®ºÎÁ¾, ´«¹°»ý»êÁõ°¡, ¾È±¸ºÐºñ¹°, ¾È±¸À̹°°¨
- È£Èí±â°è : È£Èí°ï¶õ
- ¼Òȱâ°è: ¿À½É
- ÇǺΠ¹× ÇÇÇÏÁ¶Á÷: È«¹Ý, ¹ßÁø, °¡·Á¿ò
- ¸é¿ª°è: °ú¹ÎÁõ
5) ±¹³» ½ÃÆÇ ÈÄ Á¶»ç°á°ú
- ±¹³»¿¡¼ Àç½É»ç¸¦ À§ÇÏ¿© 6³âµ¿¾È 768 ¸íÀ» ´ë»óÀ¸·Î ½Ç½ÃÇÑ ½ÃÆÇ ÈÄ Á¶»ç °á°ú À¯ÇØ»ç·Ê ¹ßÇöÀ²Àº ¾à°úÀÇ Àΰú°ü°è¿¡ »ó°ü¾øÀÌ 2.47% (19¸í/768¸í, 21°Ç)À¸·Î ³ªÅ¸³µÀ¸¸ç, ÀÌ Áß ÀÌ ¾à°ú Àΰú°ü°è¸¦ ¹èÁ¦ÇÒ ¼ö ¾ø´Â ¾à¹°À¯ÇعÝÀÀ ¹ßÇöÀ²Àº 2.21% (17¸í/768¸í, 19°Ç)À̾ú´Ù. ¾à¹°À¯ÇعÝÀÀÀ¸·Î´Â Àڱذ¨ÀÌ 1.30% (10¸í/768¸í, 10°Ç)À¸·Î °¡Àå ¸¹¾Ò°í, ±× ¿Ü °¢¸·¿° 0.39%(3 ¸í/768¸í, 3°Ç), ¾È±¸ºÒÆí°¨, ¾È±¸ÃæÇ÷, ¾È±¸ÅëÁõ °¢°¢ 0.26%(2¸í/768¸í, 2°Ç) ¼øÀ¸·Î Á¶»çµÇ¾ú´Ù
|
| »óÈ£ÀÛ¿ë |
1) ÀÌ ¾àÀ¸·Î ¾à¹°°£ »óÈ£ÀÛ¿ëÀÌ ¿¬±¸µÈ ¹Ù´Â ¾ø½À´Ï´Ù.
2) in vitro ½ÇÇè¿¡¼ CYP3A4, CYP2D6, CYP2C9, CYP2C19, CYP1A2¸¦ ÀúÇØÇÏÁö ¾ÊÀ¸¹Ç·Î, cytochrome P450 µ¿Á¾È¿¼Ò¿¡ ÀÇÇØ ´ë»çµÇ´Â ¾à¹°µéÀÇ ¾à¹°µ¿·ÂÇп¡ º¯È¸¦ ÁÖÁö ¾ÊÀ» °ÍÀÔ´Ï´Ù. |
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Moxifloxacin¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ The bactericidal action of moxifloxacin results from inhibition of the enzymes topoisomerase II (DNA gyrase) and topoisomerase IV. DNA gyrase is an essential enzyme that is involved in the replication, transcription and repair of bacterial DNA. Topoisomerase IV is an enzyme known to play a key role in the partitioning of the chromosomal DNA during bacterial cell division.
|
| Pharmacology |
Moxifloxacin¿¡ ´ëÇÑ Pharmacology Á¤º¸ Moxifloxacin is a quinolone/fluoroquinolone antibiotic. Moxifloxacin can be used to treat infections caused by the following bacteria: Aerobic Gram-positive microorganisms: Corynebacterium species, Micrococcus luteus, Staphylococcus aureus, Staphylococcus epidermidis, Staphylococcus haemolyticus, Staphylococcus hominis, Staphylococcus warneri, Streptococcus pneumoniae, and Streptococcus viridans group. Aerobic Gram-negative microorganisms: Acinetobacter lwoffii, Haemophilus influenzae, and Haemophilus parainfluenzae. Other microorganisms: Chlamydia trachomatis. Moxifloxacin is bactericidal and its mode of action depends on blocking of bacterial DNA replication by binding itself to an enzyme called DNA gyrase, which allows the untwisting required to replicate one DNA double helix into two. Notably the drug has 100 times higher affinity for bacterial DNA gyrase than for mammalian. Moxifloxacin is a broad-spectrum antibiotic that is active against both Gram-positive and Gram-negative bacteria.
|
| Protein Binding |
Moxifloxacin¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 50% bound to serum proteins, independent of drug concentration.
|
| Half-life |
Moxifloxacin¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 11.5-15.6 hours (single dose, oral)
|
| Absorption |
Moxifloxacin¿¡ ´ëÇÑ Absorption Á¤º¸ Well absorbed from the gastrointestinal tract. Absolute oral bioavailability is approximately 90%. Food has little effect on absorption.
|
| Biotransformation |
Moxifloxacin¿¡ ´ëÇÑ Biotransformation Á¤º¸ Approximately 52% or oral or intravenous dose is metabolized via glucuronide and sulphate conjugation. The cytochrome P450 system is not involved in metabolism. The sulphate conjugate accounts for 38% of the dose, and the glucuronide conjugate accounts for 14% of the dose.
|
| Toxicity |
Moxifloxacin¿¡ ´ëÇÑ Toxicity Á¤º¸ Symptoms of overdose include CNS and gastrointestinal effects such as decreased activity, somnolence, tremor, convulsions, vomiting, and diarrhea. The minimal lethal intravenous dose in mice and rats is 100 mg/kg.
|
| Drug Interactions |
Moxifloxacin¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Aluminium Formation of non-absorbable complexesBismuth Formation of non-absorbable complexesCalcium Formation of non-absorbable complexesIron Formation of non-absorbable complexesMagnesium oxide Formation of non-absorbable complexesMagnesium Formation of non-absorbable complexesSucralfate Formation of non-absorbable complexesZinc Formation of non-absorbable complexesZiprasidone Increased risk of cardiotoxicity and arrhythmiasSotalol Increased risk of cardiotoxicity and arrhythmiasQuinidine Increased risk of cardiotoxicity and arrhythmiasQuinidine barbiturate Increased risk of cardiotoxicity and arrhythmiasJosamycin Increased risk of cardiotoxicity and arrhythmiasErythromycin Increased risk of cardiotoxicity and arrhythmiasDihydroquinidine barbiturate Increased risk of cardiotoxicity and arrhythmiasDisopyramide Increased risk of cardiotoxicity and arrhythmiasAmiodarone Increased risk of cardiotoxicity and arrhythmiasBretylium Increased risk of cardiotoxicity and arrhythmiasBepridil Increased risk of cardiotoxicity and arrhythmiasAnisindione Moxifloxacin increases the anticoagulant effectAcenocoumarol Moxifloxacin increases the anticoagulant effectDicumarol Moxifloxacin increases the anticoagulant effectWarfarin Moxifloxacin increases the anticoagulant effectQuinupristin This combination presents an increased risk of toxicity
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Description |
Moxifloxacin¿¡ ´ëÇÑ Description Á¤º¸ Moxifloxacin is a synthetic fluoroquinolone antibiotic agent. Bayer AG developed the drug (initially called BAY 12-8039) and it is marketed worldwide (as the hydrochloride) under the brand name Avelox (in some countries also Avalox) for oral treatment.
|
| Dosage Form |
Moxifloxacin¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Solution IntravenousSolution OphthalmicTablet Oral
|
| Drug Category |
Moxifloxacin¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Bacterial AgentsAnti-Infective AgentsQuinolones
|
| Smiles String Canonical |
Moxifloxacin¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ COC1=C2N(C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CC2CCCNC2C1)C1CC1
|
| Smiles String Isomeric |
Moxifloxacin¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ COC1=C2N(C=C(C(O)=O)C(=O)C2=CC(F)=C1N1C[C@@H]2CCCN[C@@H]2C1)C1CC1
|
| InChI Identifier |
Moxifloxacin¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C21H24FN3O4/c1-29-20-17-13(19(26)14(21(27)28)9-25(17)12-4-5-12)7-15(22)18(20)24-8-11-3-2-6-23-16(11)10-24/h7,9,11-12,16,23H,2-6,8,10H2,1H3,(H,27,28)/t11-,16+/m0/s1/f/h27H
|
| Chemical IUPAC Name |
Moxifloxacin¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 7-[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2024-11-27
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|