| |
|
|
|
|
|
 |
| |
|
듀악트캅셀 DUACT CAP.[Acrivastine , Pseudoephedrine HCl]
|
|
전문의약품 | 삭제
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
650000160[A00401281]
[보험코드에 따른 약품기본정보 직접조회]
\0 원/1캅셀(2007.03.01)(현재약가)
\138 원/1캅셀(2002.10.30)(변경전약가)
[상병코드조회]
[질병코드조회]
|
| 빠른조회 |
|
| 제품성상 |
백색분말이 충전된 상.하단 백색의 경질캅셀 [제형정보 확인] |
| 포장·유통단위 |
10, 12, 100, 120, 500캅셀 |
| 주성분코드 |
259500ACH
[동일한 주성분코드를 가진 오리지날 또는 제네릭 의약품 조회]
|
| 허가사항 원문조회 |
[허가사항 원문조회]
|
| 효능효과 |
[적응증 별 검색]
알레르기성 비염에 의한 다음 증상의 완화
: 재채기, 콧물, 가려움증, 눈물, 비충혈
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
성인 및 12세 이상의 소아 : 1회 1캅셀 1일 3회 복용한다.
|
| 주요약물 상호작용 |
[조회]
|
| 금기 |
1) 이 약 또는 트리프롤리딘, 슈도에페드린에 과민성 또는 불내성인 환자
2) 중증의 고혈압 또는 관상동맥질환 환자
3) 슈도에페드린 제제를 투여중인 환자
4) MAO억제제를 투여중이거나 투여를 중지한지 2주 이내인 환자
5) 신장애 환자
|
| 신중투여 |
1) 고혈압, 심장질환(허혈성 포함) 환자
2) 당뇨병, 갑상선기능항진 환자
3) 안압 상승, 전립선비대 환자
4) 협착성 위궤양, 유문십이지장 폐쇄 환자
|
| 이상반응 |
1)중추신경계 : 드물게 두통, 졸음, 경련, 어지러움, 초조, 불면이 나타날 수 있으며 수면장애나 환각을 포함한 중추신경계의 흥분증상이 나타날 수 있다.
2) 피부 : 때때로 자극성 또는 비자극성의 피부발진이 나타날 수 있다.
3) 비뇨기계 : 전립선 비대환자에서 요저류가 나타날 수 있다.
4) 과민증 : 아나필락시스, 혈관부종, 기관지경축, 다형홍반이 나타날 수 있다.
5) 기타 : 구역, 구갈, 무력증, 소화불량, 인두염, 기침, 월경불순이 나타날 수 있다.
6) 이 약 성분인 슈도에페드린은 빈맥, 심계항진, 두통, 졸음, 구역을 일으킬 수 있다.
|
| 상호작용 |
1) 충혈제거제, 식욕억제제, 암페타민성 흥분제 또는 MAO 억제제와 같은 교감신경흥분제와 병용투여시 교감신경 흥분성 아민의 대사를 방해하여 혈압이 상승될 수 있다.
2) 브레트리움, 베타니딘, 구와네티딘, 데브리소퀸, 메칠도파 및 αβ-아드레날린 수용체차단제 등 항고혈압제와 이 약을 병용시 이들 약의 효과가 부분적으로 역전될 수 있다.
3) 항균제인 후라졸리돈이 용량과 관련하여 MAO 억제작용을 일으키는 것으로 알려져있다. 비록 중증의 고혈압이 일어났다는 보고는 없었으나 이 약을 병용하지 않는다.
4) OTC 항히스타민제나 충혈제거제와 병용하지 않는다.
5) 알코올 또는 중추 억제제에 의해 중추장애 작용이 증강될 수 있다.
|
| Related FDA Approved Drug |
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| |
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : C등급
(pseudoephedrine )
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
신장애, 간장애시
용량조절 |
유료정보입니다.
|
| Pharmacokinetics |
유료정보입니다.
|
| 복약라벨 |
| 이미지 |
복약설명 |
 |
어지러움이 있을수 있습니다. |
|
|
| * |
복약이미지는 모든 복약지도 사항을 표시한것은 아니며, 추가적으로 업데이트되거나 수정될 수 있습니다. |
| * |
복약이미지의 표시여부는 실제 약물복용시 중요도에 따른것은 아니며 단순히 허가정보상 키워드를 기준으로 등록되었습니다. |
| * |
귀하가 복약이미지 정보를 신뢰함은 전적으로 귀하의 책임입니다. 드럭인포는 이에 대한 어떠한 보증도 하지 않습니다. |
|
|
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| 독성정보 |
Ephedrine에 대한 독성정보 : 정보보기
출처: 국립독성과학원 독성물질정보DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Pseudoephedrine에 대한 Mechanism_Of_Action 정보
Pseudoephedrine acts directly on both alpha- and, to a lesser degree, beta-adrenergic receptors. Through direct action on alpha-adrenergic receptors in the mucosa of the respiratory tract, pseudoephedrine produces vasoconstriction. Pseudoephedrine relaxes bronchial smooth muscle by stimulating beta2-adrenergic receptors. Like ephedrine, pseudoephedrine releasing norepinephrine from its storage sites, an indirect effect.
|
| Pharmacology |
Pseudoephedrine에 대한 Pharmacology 정보
Pseudoephedrine is a sympathomimetic agent, structurally similar to ephedrine, used to relieve nasal and sinus congestion and reduce air-travel-related otalgia in adults. The salts pseudoephedrine hydrochloride and pseudoephedrine sulfate are found in many over-the-counter preparations either as single-ingredient preparations, or more commonly in combination with antihistamines and/or paracetamol/ibuprofen. Unlike antihistamines, which modify the systemic histamine-mediated allergic response, pseudoephedrine only serves to relieve nasal congestion commonly associated with colds or allergies. The advantage of oral pseudoephedrine over topical nasal preparations, such as oxymetazoline, is that it does not cause rebound congestion (rhinitis medicamentosa).
|
| Metabolism |
Pseudoephedrine에 대한 Metabolism 정보
# Phase_1_Metabolizing_Enzyme:Monoamine oxidase type A (MAO-A)
|
| Protein Binding |
Pseudoephedrine에 대한 단백결합 정보
Pseudoephedrine does not bind to human plasma proteins over the concentration range of 50 to 2000 ng/mL
|
| Half-life |
Pseudoephedrine에 대한 반감기 정보
9-16 hours
|
| Absorption |
Pseudoephedrine에 대한 Absorption 정보
Pseudoephedrine is readily and almost completely absorbed from the GI tract and there is no evidence of first-pass metabolism.
|
| Pharmacokinetics |
Pseudoephedrine HCl의 약물동력학자료
- 비충혈제거 효과의 발현시간 (경구투여시) : 15-30분
- 작용지속시간 : 4-6 시간 (서방형 제제는 12시간 지속)
- 대사 : 간에서 일부 대사
- 반감기 : 9-16 시간
- 소실 : 투여량의 70-90%가 미변화체로, 1-6%가 norpseudoephedrine으로 소변으로 배설됨. 신배설은 뇨 pH와 뇨량에 의해 변화되며 알칼리뇨는 pseudoephedrine의 신배설을 감소시킴.
Acrivastine의 약물동력학자료
- 작용발현시간 :
- 알러지성 비염 : 1시간
- 두드러기 : 15-25분
- 최대효과 발현시간 : 두드러기 : 1.5-2 시간
- 작용지속시간 : 알러지성 비염, 두드러기 : 12시간
- 흡수 : 신속하게 흡수된다.
- 단백결합 : 50%
- 대사 : 간에서 부분적으로 활성형 대사체로 대사된다.
- 반감기 : 1.5-1.9 시간 (steady state에 도달하면 3.5 시간으로 연장된다.)
- 혈중최고농도 도달시간 : 1-1.5 시간
- 소실 : 65%가 미변화체로 신배설된다.
|
| Biotransformation |
Pseudoephedrine에 대한 Biotransformation 정보
Hepatic.
|
| Toxicity |
Pseudoephedrine에 대한 Toxicity 정보
Common adverse reactions include nervousness, restlessness, and insomnia. Rare adverse reactions include difficult/painful urination, dizziness/lightheadedness, heart palpitations, headache, increased sweating, nausea/vomiting, trembling, troubled breathing, unusual paleness, and weakness.
|
| Drug Interactions |
Pseudoephedrine에 대한 Drug_Interactions 정보
Alseroxylon Increased arterial pressureIsocarboxazid Increased arterial pressureLinezolid Possible increase of arterial pressureMethyldopa Increased arterial pressureBromocriptine The sympathomimetic increases the toxicity of bromocriptineTranylcypromine Increased arterial pressureMidodrine Increased arterial pressureMoclobemide Moclobemide increases the sympathomimetic effectPargyline Increased arterial pressurePhenelzine Increased arterial pressureRasagiline Increased arterial pressureReserpine Increased arterial pressureTrimipramine The tricyclic increases the sympathomimetic effectProtriptyline The tricyclic increases the sympathomimetic effectNortriptyline The tricyclic increases the sympathomimetic effectAmitriptyline The tricyclic increases the sympathomimetic effectAmoxapine The tricyclic increases the sympathomimetic effectClomipramine The tricyclic increases the sympathomimetic effectImipramine The tricyclic increases the sympathomimetic effectDesipramine The tricyclic increases the sympathomimetic effectDoxepin The tricyclic increases the sympathomimetic effectDeserpidine Increased arterial pressureGuanethidine The agent decreases the effect of guanethidine
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Food Interaction |
Pseudoephedrine에 대한 Food Interaction 정보
Take without regard to meals.
|
| Drug Target |
[Drug Target]
|
| Description |
Pseudoephedrine에 대한 Description 정보
An alpha- and beta-adrenergic agonist that may also enhance release of norepinephrine. It has been used in the treatment of several disorders including asthma, heart failure, rhinitis, and urinary incontinence, and for its central nervous system stimulatory effects in the treatment of narcolepsy and depression. It has become less extensively used with the advent of more selective agonists. [PubChem]
|
| Drug Category |
Pseudoephedrine에 대한 Drug_Category 정보
Adrenergic AgentsBronchodilator AgentsCentral Nervous System AgentsNasal DecongestantsSympathomimeticsVasoconstrictor Agents
|
| Smiles String Canonical |
Pseudoephedrine에 대한 Smiles_String_canonical 정보
CNC(C)C(O)C1=CC=CC=C1
|
| Smiles String Isomeric |
Pseudoephedrine에 대한 Smiles_String_isomeric 정보
CN[C@@H](C)[C@@H](O)C1=CC=CC=C1
|
| InChI Identifier |
Pseudoephedrine에 대한 InChI_Identifier 정보
InChI=1/C10H15NO/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,10-12H,1-2H3/t8-,10+/m0/s1
|
| Chemical IUPAC Name |
Pseudoephedrine에 대한 Chemical_IUPAC_Name 정보
(1S,2S)-2-methylamino-1-phenylpropan-1-ol
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2025-11-03
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
|
|
|
|
전문/일반
내용보기
