| |
|
|
|
|
|
 |
| |
|
Æ®¸®¹Ì³ªÅ©¸²
|
|
Àü¹®ÀǾàǰ | ºñ±Þ¿©
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
Àü¹®/ÀÏ¹Ý |
Àü¹®
|
|
Á¦Á¶È¸»ç |
|
ÆÇ¸Åȸ»ç |
|
Çã°¡Á¤º¸ |
ÃëÇÏ
(2021.07.01)
|
BIT ¾àÈ¿ºÐ·ù |
±âŸ ÇǺΠ& Á¡¸· °ü·Ã ¾à¹° (Other Skin & Mucous Membrane Related Agents)
|
º¹ÁöºÎºÐ·ù |
269[±âŸÀÇ ¿ÜÇÇ¿ë¾à ] |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå |
|
644802650 [ºñ±Þ¿©]
|
|
|
ATCÄÚµå |
Other dermatologicals / D11AX |
NDCÄÚµå |
[Proprietary Name Search _ ƯÇãµî·Ï¸í,»óÇ¥¸íÀ¸·Î °Ë»ö]
[Active Ingredient Search _ ÁÖ¼ººÐÀ¸·Î °Ë»ö]
[NDC Number Search _ NDCÄÚµå·Î °Ë»ö]
|
¼ººÐ / ÇÔ·® |

|
÷°¡Á¦ |
¶ó¿ì¸±È²»ê³ªÆ®·ý,
¹Ì³×¶ö¿ÀÀϤý¶ó³î¸°¾ËÄÚ¿Ã,
¹é³³,
¼¼Åº¿Ã,
¼Ò¸£ºñź½ºÅ׾Ʒ¹ÀÌÆ®,
¾Æ½ºÄÚ¸£ºê»êÆÈ¹ÌÅ×ÀÌÆ®,
¿¡µ¥Æ®»ê³ªÆ®·ý¼öȹ°,
¿ÁÆ¿µµµ¥Ä¿Ã,
À¯µ¿ÆÄ¶óÇÉ,
Á¤Á¦¼ö,
ÄÝ·¹½ºÅ×·Ñ,
ÅäÄÚÆä·Ñ¾Æ¼¼Å×ÀÌÆ®,
ÆÄ¶ó¿Á½Ãº¥Á¶»ê¸ÞÆ¿,
ÆÄ¶ó¿Á½Ãº¥Á¶»êÇÁ·ÎÇÊ,
ÆÄ¶óÇÉ,
Æú¸®¼Ò¸£º£ÀÌÆ®60,
Æú¸®¿¡Æ¿·»±Û¸®ÄÝ400,
Æú¸®¿¡Æ¿·»±Û¸®ÄÝ4000,
Æú¸®¿Á½Ã¿¡Ä¥·»¼¼Æ¿¿¡ÅÚ,
ÇÁ·ÎÇÊ·»±Û¸®ÄÝ,
ÇǷξÆÈ²»ê³ªÆ®·ý
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
644802650
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
[ºñ±Þ¿©]
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 15±×·¥ |
1 °³ |
Æ©ºê |
8806448026501 |
8806448026518 |
|
|
| ÁÖ¼ººÐÄÚµå |
559500CCM
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
Áߵ ³»Áö ÁßÁõÀÇ ¾È¸é ÈæÇÇÁõÀÇ ´Ü±â Ä¡·á (Àڿܼ± Â÷´ÜÁ¦ µî ÇÞºû ³ëÃâÀ» Â÷´ÜÇÒ ¼ö ÀÖ´Â ¹æ¹ýÀ» º´¿ëÇÒ°Í)
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
1ÀÏ 1ȸ Àú³á (Àû¾îµµ Ãëħ 30ºÐ ÀÌÀü)¿¡ ȯºÎ¿¡ ¹Ù¸¥´Ù
|
| ±Ý±â |
ÀÌ ¾àÀÇ ¼ººÐ¿¡ °ú¹ÎÇÑ È¯ÀÚ
|
| ½ÅÁßÅõ¿© |
ÀÌ ¾àÀº ÇǷξÆÈ²»ê³ªÆ®·ýÀÌ ÇÔÀ¯µÇ¾î ÀÖ¾î ¾Æ³ªÇʶô½Ã¿Í °°Àº ¾Ë·¹¸£±â¸¦ ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¸ç ÀϺΠ°¨¼ö¼º ȯÀÚ¿¡¼´Â »ý¸íÀ» À§ÇùÇÒ Á¤µµ ¶Ç´Â À̺¸´Ù ¾àÇÑ Ãµ½Ä¹ßÀÛÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù. ÀÏ¹Ý »ç¶÷¿¡¼ÀÇ ¾ÆÈ²»ê°¨¼ö¼º¿¡ ´ëÇÑ ÃѰýÀûÀÎ ºóµµ´Â ¾Ë·ÁÁöÁö ¾Ê¾ÒÀ¸³ª ³·Àº °ÍÀ¸·Î º¸ÀÌ¸ç ¾ÆÈ²»ê°¨¼ö¼ºÀº ºñõ½ÄȯÀÚº¸´Ù õ½ÄȯÀÚ¿¡¼ ºó¹øÇÑ °ÍÀ¸·Î ³ªÅ¸³µ´Ù. |
| ÀÌ»ó¹ÝÀÀ |
1) Á¶ÀýµÈ ÀÓ»ó½ÃÇè¿¡¼ ÀÌ ¾àÀ» 8ÁÖ µ¿¾È »ç¿ëÇÑ 161¸íÀÇ ºÎÀÛ¿ëÀ» ¸ð´ÏÅ͸µÇÑ °á°ú, ÀÌ Áß 102¸í(63%)ÀÌ ¿¬±¸ ±â°£ Áß ÃÖ¼ÒÇÑ 1°³ ÀÌ»óÀÇ Ä¡·á¿Í °ü·ÃµÈ ÀÌ»ó¹ÝÀÀÀ» ³ªÅ¸³»¾ú´Ù. °¡Àå ÈçÇÑ ÀÌ»ó¹ÝÀÀÀº µµÆ÷ ºÎÀ§¿¡ ¹ß»ýµÇ´Â È«¹Ý, ³«¼³, ÀÛ¿°¨, °ÇÁ¶°¨, ¼Ò¾çÁõÀ̾úÀ¸¸ç ´ëºÎºÐ °æµµ-Áߵ¿¡ ÇØ´çÇÏ´Â °ÍÀ̾ú´Ù. ¿¬±¸ÀÚ¿¡ ÀÇÇØ ÀÌ ¾à°ú °ü·ÃµÈ °ÍÀ¸·Î Æò°¡µÈ °ÍÀ¸·Î½á, ÃÖ¼Ò 1% ÀÌ»óÀÇ È¯ÀÚ¿¡¼ ¹ß»ýµÈ ÀÌ»ó¹ÝÀÀÀº (Ç¥ 1)°ú °°´Ù. °ø°³, Àå±â°£ ¾ÈÀü¼º ¿¬±¸¿¡¼, ÀÌ ¾àÀ» 6°³¿ù°£ Áö¼ÓÀûÀ¸·Î »ç¿ëÇÑ È¯ÀÚµéÀÇ ÀÌ»ó¹ÝÀÀ ¹ßÇö ¾ç»óÀº 8ÁÖ°£ »ç¿ëÇÑ È¯ÀÚµé°ú À¯»çÇÏ¿´´Ù.
=========================================================
(Ç¥ 1) Æ®¸®·ç¸¶ Å©¸² »ç¿ë ȯÀÚÀÇ ÃÖ¼Ò 1% À̻󿡼 ¹ß»ýµÈ Ä¡·á °ü·Ã ÀÌ»ó¹ÝÀÀ ºóµµ (N=161)
----------------------------------------------------------------
ÀÌ»ó¹ÝÀÀ¸í ȯÀÚ¼ö(%)
----------------------------------------------------------------
È«¹Ý 66(41%)
----------------------------------------------------------------
³«¼³ 61(38%)
----------------------------------------------------------------
ÀÛ¿°¨ 29(18%)
----------------------------------------------------------------
°ÇÁ¶°¨ 23(14%)
----------------------------------------------------------------
¼Ò¾çÁõ 18(11%)
---------------------------------------------------------------
¿©µå¸§ 8(5%)
----------------------------------------------------------------
Áö°¢ÀÌ»ó 5(3%)
----------------------------------------------------------------
¸ð¼¼Ç÷°üÈ®ÀåÁõ 5(3%)
----------------------------------------------------------------
°¨°¢°ú¹Î 3(2%)
----------------------------------------------------------------
»ö¼Òº¯È 3(2%)
----------------------------------------------------------------
ÀÚ±Ø 3(2%)
----------------------------------------------------------------
±¸Áø 2(1%)
----------------------------------------------------------------
¿©µå¸§¾ç ¹ßÁø 1(1%)
----------------------------------------------------------------
ÁÖ»ç 1(1%)
----------------------------------------------------------------
±¸° °ÇÁ¶ 1(1%)
----------------------------------------------------------------
¹ßÁø 1(1%)
----------------------------------------------------------------
¼Ò¼öÆ÷ 1(1%)
=========================================================
2) ¿Ü¿ë ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀ̵忡¼ µå¹°°Ô º¸°íµÇ´Â ±¹¼Ò ÀÌ»ó¹ÝÀÀÀ¸·Î½á, ƯÈ÷ ¿ª°¡°¡ ³ôÀº ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀ̵带 ¹ÐºÀ¿ä¹ýÀ¸·Î »ç¿ëÇÑ °æ¿ì¿¡ º¸´Ù ºó¹øÇÏ°Ô ¹ß»ýµÉ ¼ö ÀÖ´Â ÀÌ»ó¹ÝÀÀÀ¸·Î ¹ß»ýºóµµ¿¡ µû¶ó ³ª¿ÇÏ¸é ´ÙÀ½°ú °°´Ù. : ÀÛ¿°¨, ¼Ò¾çÁõ, Àڱذ¨, °ÇÁ¶°¨, ¸ð³¶¿°, ¿©µå¸§¾ç ¹ßÁø, »ö¼ÒÀúÄ§Âø, ÀÔÁÖÀ§ ÇǺο°, ¾Ë·¯Áö¼º Á¢Ã˼º ÇǺο°, 2Â÷ °¨¿°, ÇǺÎÀ§Ãà, ¼±Á¶Áõ, ÇÑÁø.
|
| »óÈ£ÀÛ¿ë |
1) ÀÌ ¾àÀ» »ç¿ëÇÏ´Â µ¿¾È¿¡´Â ¾à¿ëºñ´©, ¿¬¸¶¿ë ºñ´© ȤÀº ¼¼Á¤Á¦, °ÇÁ¶ÀÛ¿ëÀÌ ÀÖ´Â ºñ´©³ª ÈÀåǰ, ¾ËÄÚ¿ÃÀ» ´Ù·® ÇÔÀ¯ÇÑ ¾Æ½ºÆ®¸°Á¨Æ®, °¢Áú¿ëÇØ ¾à¹° ȤÀº ±âŸ Àڱع°ÁúÀº »ç¿ëÇÏÁö ¸»¾Æ¾ß ÇÑ´Ù.
2) ±¤°ú¹Î¼ºÀ» ÀÏÀ¸Å°´Â °ÍÀ¸·Î ¾Ë·ÁÁø ¾à¹°°úÀÇ º´¿ë½Ã¿¡´Â ÁÖÀÇÇÏ¿©¾ß ÇÑ´Ù.
|
| Off-label Usage |
[Á¶È¸]
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Á¦Çüº° º¹¾àÁöµµ |
[Å©¸²] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Hydroquinone¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Tretinoin¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Tretinoin binds to alpha, beta, and gamma retinoic acid receptors (RARs). RAR-alpha and RAR-beta have been associated with the development of acute promyelocytic leukemia and squamous cell cancers, respectively. RAR-gamma is associated with retinoid effects on mucocutaneous tissues and bone. Although the exact mechanism of action of tretinoin is unknown, current evidence suggests that the effectiveness of tretinoin in acne is due primarily to its ability to modify abnormal follicular keratinization. Comedones form in follicles with an excess of keratinized epithelial cells. Tretinoin promotes detachment of cornified cells and the enhanced shedding of corneocytes from the follicle. By increasing the mitotic activity of follicular epithelia, tretinoin also increases the turnover rate of thin, loosely-adherent corneocytes. Through these actions, the comedo contents are extruded and the formation of the microcomedo, the precursor lesion of acne vulgaris, is reduced. Tretinoin is not a cytolytic agent but instead induces cytodifferentiation and decreased proliferation of APL cells in culture and in vivo. When Tretinoin is given systemically to APL patients, tretinoin treatment produces an initial maturation of the primitive promyelocytes derived from the leukemic clone, followed by a repopulation of the bone marrow and peripheral blood by normal, polyclonal hematopoietic cells in patients achieving complete remission (CR). The exact mechanism of action of tretinoin in APL is unknown.
|
| Pharmacology |
Tretinoin¿¡ ´ëÇÑ Pharmacology Á¤º¸ Tretinoin, also known as all-trans-retinoic acid (ATRA), is a naturally occurring derivative of vitamin A (retinol). Retinoids such as tretinoin are important regulators of cell reproduction, proliferation, and differentiation and are used to treat acne and photodamaged skin and to manage keratinization disorders such as ichthyosis and keratosis follicularis. Tretinoin also represents the class of anticancer drugs called differentiating agents and is used in the treatment of acute promyelocytic leukemia (APL).
|
| Protein Binding |
Tretinoin¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ > 95%
|
| Half-life |
Tretinoin¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 0.5-2 hours
|
| Absorption |
Tretinoin¿¡ ´ëÇÑ Absorption Á¤º¸ 1-31% (topical)
|
| Pharmacokinetics |
TretinoinÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ÀÛ¿ë¹ßÇö½Ã°£ : ¿©µå¸§ : ±¹¼ÒÀû¿ë : 2-3ÁÖ
- ÃÖ´ëÈ¿°ú ¹ßÇö½Ã°£ : ¿©µå¸§ : ±¹¼ÒÀû¿ë : 6ÁÖ ÀÌ»ó
- Èí¼ö : ±¹¼Ò Àû¿ë : Àü½Å Èí¼ö´Â Àû´Ù.
- ´ë»ç : Àü½ÅÀûÀ¸·Î Èí¼öµÈ ¼Ò·®Àº °£¿¡¼ ´ë»çµÈ´Ù.
- ¼Ò½Ç : ¼Òº¯, ´ãÁóÀ» ÅëÇØ ¹è¼³µÈ´Ù.
Fluocinolone AcetonideÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : Á¦Á¦ÀÇ ³óµµ(strength)¿Í Àû¿ëµÈ ¾ç, Àû¿ë ºÎÀ§ÀÇ ÇǺΠ»óÅ¿¡ µû¶ó ´Ù¸£´Ù.
- Èí¼öµÇ´Â ¹üÀ§´Â Èí¼öµÇ´Â ÃþÀÌ µÎ²¨¿î °æ¿ì´Â (¼Õ¹Ù´Ú, ¹ß¹Ù´Ú, ÆÈ²ÞÄ¡ µî) 1%¿¡¼ ºÎÅÍ Èí¼öµÇ´Â ÃþÀÌ ¾ãÀº °æ¿ì´Â (¾ó±¼, ¾È°Ë µî) 36% Á¤µµ±îÁö ´Ù¾çÇÏ´Ù.
- ÇǺο¡ ¼Õ»óÀ̳ª ¿°ÁõÀÌ Àְųª ±× ºÎÀ§¸¦ ¹ÐºÀ(occlude)½ÃÄÑ ÁÖ¸é Èí¼öµÇ´Â Á¤µµ°¡ Áõ°¡ÇÑ´Ù.
- ºÐÆ÷ : ÁÖ·Î Àû¿ëµÈ ÇǺο¡ ºÐÆ÷ÇÑ´Ù. Àü½Å ¼øÈ¯°è·Î Èí¼öµÈ ¾à¹°Àº ±ÙÀ°, °£, ÇǺÎ, Àå°ü, ½ÅÀåÀ¸·Î ºü¸£°Ô ºÐÆ÷µÈ´Ù.
- ´ë»ç : ÀÏÂ÷ÀûÀ¸·Î ÇǺο¡¼ ´ë»çµÈ´Ù. Àü½Å ¼øÈ¯°è·Î Èí¼öµÈ ¼Ò·®ÀÇ ¾à¹°Àº ÀÏÂ÷ÀûÀ¸·Î °£¿¡¼ Ȱ¼ºÀÌ ¾ø´Â ´ë»çü·Î ´ë»çµÈ´Ù.
- ¼Ò½Ç : ÀÏÂ÷ÀûÀ¸·Î glucuronides, sulfates Æ÷ÇÕü³ª ºñÆ÷ÇÕ ´ë»çü·Î ½Å¹è¼³ µÈ´Ù. ¼Ò·®ÀÇ ´ë»çü´Â º¯À¸·Î ¹è¼³µÈ´Ù.
HydroquinoneÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ÀÛ¿ë¹ßÇö½Ã°£ : °³Ã¼Â÷°¡ Å©´Ù. (´ë·« 3ÁÖ¡6°³¿ù)
- ÀÛ¿ëÁö¼Ó½Ã°£ : Å»»öÈ¿°ú´Â ´ë°³ 2-6 °³¿ù Áö¼ÓµÈ´Ù.
- Èí¼ö : ¿Ü¿ë : 35%
|
| Biotransformation |
Tretinoin¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic
|
| Toxicity |
Tretinoin¿¡ ´ëÇÑ Toxicity Á¤º¸ Not Available
|
| Drug Interactions |
Tretinoin¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Tretinoin¿¡ ´ëÇÑ Description Á¤º¸ Tretinoin, also known as all-trans-retinoic acid (ATRA), is a naturally occurring derivative of vitamin A (retinol). Retinoids such as tretinoin are important regulators of cell reproduction, proliferation, and differentiation and are used to treat acne and photodamaged skin and to manage keratinization disorders such as ichthyosis and keratosis follicularis. Tretinoin also represents the class of anticancer drugs called differentiating agents and is used in the treatment of acute promyelocytic leukemia (APL).
|
| Dosage Form |
Tretinoin¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Capsule OralCream TopicalGel TopicalLiquid Topical
|
| Drug Category |
Tretinoin¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antineoplastic AgentsCell Stimulants and ProliferantsKeratolytic Agents
|
| Smiles String Canonical |
Tretinoin¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(O)=O
|
| Smiles String Isomeric |
Tretinoin¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CC(\C=C\C1=C(C)CCCC1(C)C)=C/C=C/C(C)=C/C(O)=O
|
| InChI Identifier |
Tretinoin¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C20H28O2/c1-15(8-6-9-16(2)14-19(21)22)11-12-18-17(3)10-7-13-20(18,4)5/h6,8-9,11-12,14H,7,10,13H2,1-5H3,(H,21,22)/f/h21H
|
| Chemical IUPAC Name |
Tretinoin¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexenyl)nona-2,4,6,8-tetraenoic acid
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2024-06-05
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|