| |
|
|
|
|
|
 |
| |
|
원틸라겔 WONTILLA GEL
|
|
전문의약품 | 비급여
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
 |
제품별 연령금기 고시 |
|
|
| 성분명 |
성분코드 |
특정연령 |
고시번호 |
고시일자 |
비고 |
| chlorhexidine gluconate solution, lidocaine hydrochloride |
660100CCM |
24 개월 미만 |
20180088 |
2018-11-02 |
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
| 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
645906051
[보험코드에 따른 약품기본정보 직접조회]
[비급여]
[상병코드조회]
[질병코드조회]
|
| 빠른조회 |
|
| 제품성상 |
무색투명한 프리필드시린지에 무색 내지 거의 무색의 투명한 겔제 [제형정보 확인] |
| 포장·유통단위 |
10관/상자(6밀리리터/관) |
| 주성분코드 |
660100CCM
[동일한 주성분코드를 가진 오리지날 또는 제네릭 의약품 조회]
|
| 허가사항 원문조회 |
[허가사항 원문조회]
|
| 효능효과 |
[적응증 별 검색]
다음 시술시 표면마취, 소독, 윤활작용 :
카테터 삽입, 요도(남성·여성)내 수술, 각종 내시경 검사, 삽관, 시술로 인한 직장과 결장에서의 손상 예방
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
1. 카테터삽입
이 약 6 mL 또는 11 mL를 주입한다. 귀두와 요도를 깨끗이 한 후 요도에 서서히 주입하고 국소마취와 소독효과가 나타낼 때까지 귀두를 압박한다.
2. 방광경검사
이 약 11 mL를 사용하며, 필요시 6 mL 또는 11 mL를 추가로 주입한다. 외부조임근을 포함하여 전체요도에 도포한다.
3. 요도협착(요도구절개술)
이 약 11 mL를 사용하며, 필요시 6 mL 또는 11 mL를 추가로 주입하고 클램프로 집어준다. 요도 마취효과는 5 ∼ 10분 후 나타난다.
4. 소독
이 약 6 mL 또는 11 mL 를 점막에 골고루 바르거나 주입한다.
5. 기타
적용부위에 6 mL 또는 11 mL를 천천히 주입하며, 삽입될 카테터나 시술도구에 골고루 도포한다.
국소마취 및 소독효과는 5 ∼ 10분 후에 나타난다.
|
| 금기 |
1) 아미드계 마취제, 클로르헥시딘제제 또는 알킬파라옥시벤조산 등 이 약의 성분에 대하여 과민반응이 있는 환자
2) 손상된 피부, 눈 및 눈주위
3) 뇌, 척수, 귀(내이, 중이, 외이)(청각신경 또는 중추신경에 직접 사용할 경우 난청, 신경장애를 일으킬 수 있다)
4) 포르피린증
5) 조절되지 않는 간질
6) 중증의 심장전도 이상
7) 2세 미만의 소아 |
| 신중투여 |
1) 적용 부위에 점막의 외상이 있는 환자 또는 패혈증 환자
2) 간질 환자
3) 심장 전도 이상, 서맥, 간기능 손상, 중증의 쇼크 환자
4) 천식 등 알레르기 질환 및 그 병력 또는 가족력이 있는 환자
5) 임부 및 임신하고 있을 가능성이 있는 여성 또는 수유부
|
| 이상반응 |
1) 쇼크 : 쇼크가 나타날 수 있으므로 충분히 관찰하고 혈압저하, 안면창백, 맥박의 이상, 호흡억제, 구역, 불쾌감, 식은땀, 어지럼, 답답함, 발적 등이 나타나는 경우에는 즉시 사용을 중지하고 적절한 처치를 한다.
2) 신경계
(1) 진전, 경련 등의 중증의 심각한 증상이 나타날 수 있으므로 충분히 관찰하고 이러한 증상이 나타나는 경우에는 즉시 투여중지하고 디아제팜 또는 초단시간형 바르비탈산 제제(티오펜탈나트륨) 투여 등 적절한 처치를 한다.
(2) 졸음, 불안, 흥분, 무시, 어지럼, 구역·구토, 신경과민, 의식소실, 불쾌감, 식은땀, 답답함, 피로, 방향감각상실, 안장애, 언어장애, 귀울림, 경련, 감각이상(자주 투여시), 이상황홀감, 환각, 우울, 혼수, 일반경련, 호흡저하(드물게, 특히 과량투여시), 초조, 하품, 떨림, 걱정, 눈떨림, 병적다변증, 두통, 귀울림, 반응느림, 흥분 등이 나타날 수 있으므로 충분히 관찰하여 쇼크 또는 중증의 심각한 증상으로 이행하는 것에 주의하고 필요에 따라 적절한 처치를 한다.
3) 심혈관계
저혈압, 심근억제, 서맥, 심정지, 부정맥, 방실블록, 심실세동(경우에 따라), 빈맥, 고혈압, 기능저하지속 등이 나타날 수 있다.
4) 호흡기계
빠른호흡 및 호흡곤란
5) 위장관계
구역·구토와 같은 위장관 불쾌감(자주 투여 시)
6) 과민반응 : 때때로 발적, 발진, 두드러기 등의 피부증상 및 부종이 나타날 수 있으며 이러한 경우에는 즉시 사용을 중지한다.
7) 과량투여시 요도손상이 나타날 수 있다.
8) 드물게 클로르헥시딘에 의한 접촉부위의 알레르기 습진이 나타날 수 있다.
9) 광선민감화가 나타날 수 있다.
|
| 상호작용 |
1) 이 약과 부정맥용제(토카이니드 등)를 병용투여하는 경우, 이상반응이 증강될 수 있으므로 주의한다.
2) 동물실험결과 이 약과 페티딘을 병용투여시 리도카인의 독성이 증가될 수 있으므로 주의한다.
3) 클로르헥시딘은 양이온성 살균제이므로 음이온성 물질(비누)과 함께 사용하지 않는다. |
| Off-label Usage |
[조회]
|
| Related FDA Approved Drug |
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| |
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 축약복약지도 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : B등급
(lidocaine; )
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
| 복약라벨 |
| 이미지 |
복약설명 |
 |
어지러움이 있을수 있습니다. |
|
|
| * |
복약이미지는 모든 복약지도 사항을 표시한것은 아니며, 추가적으로 업데이트되거나 수정될 수 있습니다. |
| * |
복약이미지의 표시여부는 실제 약물복용시 중요도에 따른것은 아니며 단순히 허가정보상 키워드를 기준으로 등록되었습니다. |
| * |
귀하가 복약이미지 정보를 신뢰함은 전적으로 귀하의 책임입니다. 드럭인포는 이에 대한 어떠한 보증도 하지 않습니다. |
|
|
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| 독성정보 |
Lidocaine에 대한 독성정보 : 정보보기
출처: 국립독성과학원 독성물질정보DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Chlorhexidine에 대한 Mechanism_Of_Action 정보
Chlorhexidine's antimicrobial effects are associated with the attractions between chlorhexidine (cation) and negatively charged bacterial cells. After chlorhexidine is absorpted onto the organism's cell wall, it disrupts the integrity of the cell membrane and causes the leakage of intracellular components of the organisms.
Lidocaine에 대한 Mechanism_Of_Action 정보
Lidocaine stabilizes the neuronal membrane by inhibiting the ionic fluxes required for the initiation and conduction of impulses thereby effecting local anesthetic action.
|
| Pharmacology |
Chlorhexidine에 대한 Pharmacology 정보
Chlorhexidine, a topical antimicrobial agent, is bactericidal. Because of its positive charge, the chlorhexidine molecule reacts with the microbial cell surface to destroy the integrity of the cell membrane. This novel mechanism of action makes it highly unlikely for the development of bacterial resistance.
Lidocaine에 대한 Pharmacology 정보
Lidocaine is an anesthetic agent indicated for production of local or regional anesthesia and in the treatment of ventricular tachycardia occurring during cardiac manipulation, such as surgery or catheterization, or which may occur during acute myocardial infarction, digitalis toxicity, or other cardiac diseases. The mode of action of the antiarrhythmic effect of Lidocaine appears to be similar to that of procaine, procainamide and quinidine. Ventricular excitability is depressed and the stimulation threshold of the ventricle is increased during diastole. The sinoatrial node is, however, unaffected. In contrast to the latter 3 drugs, Lidocaine in therapeutic doses does not produce a significant decrease in arterial pressure or in cardiac contractile force. In larger doses, lidocaine may produce circulatory depression, but the magnitude of the change is less than that found with comparable doses of procainamide.
|
| Metabolism |
Chlorhexidine에 대한 Metabolism 정보
# Phase_1_Metabolizing_Enzyme:Not Available
Lidocaine에 대한 Metabolism 정보
# Phase_1_Metabolizing_Enzyme:Cytochrome P450 1A2 (CYP1A2)Cytochrome P450 2D6 (CYP2D6)
|
| Absorption |
Chlorhexidine에 대한 Absorption 정보
Absorption of chlorhexidine from the gastrointestinal tract is very poor. Additionally, an in vivo study in 18 adult patients found no detectable plasma or urine chlorhexidine concentrations following insertion of four periodontal implants under clinical conditions.
Lidocaine에 대한 Absorption 정보
Information derived from diverse formulations, concentrations and usages reveals that lidocaine is completely absorbed following parenteral administration, its rate of absorption depending, for example, upon various factors such as the site of administration and the presence or absence of a vasoconstrictor agent.
|
| Toxicity |
Chlorhexidine에 대한 Toxicity 정보
LD50= 2g/kg (human, oral); LD50= 3 g/kg (rat, oral); LD50= 2.5 g/kg (mice, oral); LD50= 21 mg/kg (male rat, IV); LD50= 23 mg/kg (female rat, IV); LD50= 25 mg/kg (male mice, IV); LD50= 24 mg/kg (female mice, IV); LD50= 1g/kg (rat, subcutaneous); LD50= 637 mg/kg (male mice, subcutaneous); LD50= 632 mg/kg (female mice, subcutaneous)
Lidocaine에 대한 Toxicity 정보
The oral LD 50 of lidocaine HCl in non-fasted female rats is 459 (346-773) mg/kg (as the salt) and 214 (159-324) mg/kg (as the salt) in fasted female rats. Symptoms of overdose include convulsions, hypoxia, acidosis, bradycardia, arrhythmias and cardiac arrest.
|
| Drug Interactions |
Chlorhexidine에 대한 Drug_Interactions 정보
Not Available
Lidocaine에 대한 Drug_Interactions 정보
Not Available
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Food Interaction |
Lidocaine에 대한 Food Interaction 정보
Not Available
|
| Drug Target |
[Drug Target]
|
| Description |
Chlorhexidine에 대한 Description 정보
A disinfectant and topical anti-infective agent used also as mouthwash to prevent oral plaque. [PubChem]
Lidocaine에 대한 Description 정보
A local anesthetic and cardiac depressant used as an antiarrhythmia agent. Its actions are more intense and its effects more prolonged than those of procaine but its duration of action is shorter than that of bupivacaine or prilocaine. [PubChem]
|
| Dosage Form |
Chlorhexidine에 대한 Dosage_Form 정보
Aerosol TopicalDressing TopicalGel TopicalKit DentalLiquid BuccalLiquid OralLiquid TopicalLotion TopicalOintment TopicalSolution TopicalSponge Topical
Lidocaine에 대한 Dosage_Form 정보
Aerosol TopicalAerosol, metered TopicalCream TopicalGel TopicalJelly TopicalJelly UrethralLiquid BuccalLiquid DentalLiquid InfiltrationLiquid IntravenousLiquid OralLiquid TopicalLotion TopicalOintment TopicalSolution InfiltrationSolution IntramuscularSolution IntravenousSolution OralSolution TopicalSpray TopicalSwab Topical
|
| Drug Category |
Chlorhexidine에 대한 Drug_Category 정보
Anti-Bacterial AgentsAnti-Infective Agents, LocalAnti-InfectivesDisinfectantsMouthwashes
Lidocaine에 대한 Drug_Category 정보
AnestheticsAnesthetics, LocalAnti-Arrhythmia AgentsAntiarrhythmic Agents
|
| Smiles String Canonical |
Chlorhexidine에 대한 Smiles_String_canonical 정보
NC(NC1=CC=C(Cl)C=C1)=NC(N)=NCCCCCCN=C(N)N=C(N)NC1=CC=C(Cl)C=C1
Lidocaine에 대한 Smiles_String_canonical 정보
CCN(CC)CC(=O)NC1=C(C)C=CC=C1C
|
| Smiles String Isomeric |
Chlorhexidine에 대한 Smiles_String_isomeric 정보
N\C(NC1=CC=C(Cl)C=C1)=N/C(N)=N/CCCCCC\N=C(N)\N=C(/N)NC1=CC=C(Cl)C=C1
Lidocaine에 대한 Smiles_String_isomeric 정보
CCN(CC)CC(=O)NC1=C(C)C=CC=C1C
|
| InChI Identifier |
Chlorhexidine에 대한 InChI_Identifier 정보
InChI=1/C22H30Cl2N10/c23-15-5-9-17(10-6-15)31-21(27)33-19(25)29-13-3-1-2-4-14-30-20(26)34-22(28)32-18-11-7-16(24)8-12-18/h5-12H,1-4,13-14H2,(H5,25,27,29,31,33)(H5,26,28,30,32,34)/f/h31-32H,25-28H2/b29-19+,30-20+,33-21+,34-22+
Lidocaine에 대한 InChI_Identifier 정보
InChI=1/C14H22N2O/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4/h7-9H,5-6,10H2,1-4H3,(H,15,17)/f/h15H
|
| Chemical IUPAC Name |
Chlorhexidine에 대한 Chemical_IUPAC_Name 정보
(1E)-2-[6-[[amino-[[amino-[(4-chlorophenyl)amino]methylidene]amino]methylidene]amino]hexyl]-1-[amino-[(4-chlorophenyl)amino]methylidene]guanidine
Lidocaine에 대한 Chemical_IUPAC_Name 정보
2-diethylamino-N-(2,6-dimethylphenyl)acetamide
|
| Drug-Induced Toxicity Related Proteins |
DOCA 의 Drug-Induced Toxicity Related Protein정보
Replated Protein:Aquaporin-2
Drug:DOCA
Toxicity:hypertension.
[바로가기]
LIDOCAINE 의 Drug-Induced Toxicity Related Protein정보
Replated Protein:glucose-regulated protein
Drug:lidocaine
Toxicity:intestinal disorder.
[바로가기]
Replated Protein:Alkaline phosphatase
Drug:lidocaine
Toxicity:lidocaine induced hepatitis.
[바로가기]
Replated Protein:C-reactive protein
Drug:lidocaine
Toxicity:fever.
[바로가기]
Replated Protein:C-reactive protein
Drug:lidocaine
Toxicity:lidocaine induced hepatitis.
[바로가기]
Replated Protein:Alpha-1-acid glycoprotein
Drug:lidocaine
Toxicity:lidocaine tolerance.
[바로가기]
Replated Protein:Gamma-glutamyltranspeptidase
Drug:lidocaine
Toxicity:fever.
[바로가기]
Replated Protein:Alkaline phosphatase
Drug:lidocaine
Toxicity:fever.
[바로가기]
Replated Protein:Gamma-glutamyltranspeptidase
Drug:lidocaine
Toxicity:lidocaine induced hepatitis.
[바로가기]
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2022-12-26
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
|
|
|
|
전문/일반
