| |
|
|
|
|
|
 |
| |
|
µð¿Àº£Æ®¸®¿¡ÀÌ¿¬°í(Ä®½ÃÆ÷Æ®¸®¿Ã)_(1.5mg/30g)
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
644805151
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/30g/°³(2020.11.01)(ÇöÀç¾à°¡)
\11,733 ¿ø/30g/°³(2017.03.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹ÝÅõ¸íÇÑ Èò»ö ³»Áö ¹ÌȲ»öÀÇ ¿¬°íÁ¦ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
ÀÚ»çÆ÷Àå´ÜÀ§ |
| ÁÖ¼ººÐÄÚµå |
121530COM
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
°Ç¼±(°æÁõ ¹× ÁßµîÁõ)
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¼ºÀÎ
ȯºÎ¿¡ 1ÀÏ 1-2ȸ(¾ÆÄ§, Àú³á) ¹Ù¸¥´Ù. ÃÖ´ë È¿°ú¸¦ À§Çؼ´Â 1ÀÏ 2ȸ »ç¿ëÇØ¾ß ÇÑ´Ù. 1ÁÖ¿¡ 100g(1ÀÏ ¾à 15gÀÌ»ó)À» ÃʰúÇÏ¿© »ç¿ëÇÏÁö ¾Ê´Â´Ù. Ä®½ÃÆ÷Æ®¸®¿ÃÀ» ÇÔÀ¯ÇÏ´Â ´Ù¸¥ ¾à°ú ÇÔ²² »ç¿ëÇÒ °æ¿ì, ÀÌ ¾àÀ» Æ÷ÇÔÇØ¼ ¸ðµç Ä®½ÃÆ÷Æ®¸®¿Ã ÇÔÀ¯ Á¦Á¦ÀÇ 1ÁÖÀÏ ÃÑÅõ¿©·®ÀÌ Ä®½ÃÆ÷Æ®¸®¿Ã 5mgÀ» ÃʰúÇØ¼´Â ¾È µÈ´Ù.
|
| ±Ý±â |
1) ÀÌ ¾à ¹× ÀÌ ¾à ¼ººÐ¿¡ °ú¹ÎÁõ ¹× ±× º´·ÂÀÌ Àִ ȯÀÚ
2) °íÄ®½·Ç÷Áõ µî Ä®½·´ë»ç Àå¾Ö ȯÀÚ
3) ºñŸ¹Î D µ¶¼ºÀ» ³ªÅ¸³»´Â ȯÀÚ |
| ½ÅÁßÅõ¿© |
ÀÌ ¾àÀº ÇÁ·ÎÇÊ·»±Û¸®ÄÝÀ» ÇÔÀ¯Çϰí ÀÖÀ¸¹Ç·Î ÀÌ ¼ººÐ¿¡ °ú¹ÎÇϰųª ¾Ë·¹¸£±â º´·ÂÀÌ Àִ ȯÀÚ¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù. |
| ÀÌ»ó¹ÝÀÀ |
ÀÌ»ó¹ÝÀÀÀÇ ºóµµ´Â ÀÓ»ó½ÃÇè ¹× ÀÚ¹ßÀû º¸°í¿¡¼ ³ª¿Â µ¥ÀÌÅ͸¦ Á¾ÇÕ ºÐ¼®ÇÏ¿© Æò°¡µÇ¾ú´Ù.
°¡Àå ºó¹øÇÏ°Ô º¸°íµÈ ÀÌ»ó¹ÝÀÀÀº °¡·Á¿ò, ÇǺΠÀÚ±Ø, È«¹ÝÀ̾ú´Ù.
Àü½Å ¹ÝÀÀ(°íÄ®½·Ç÷Áõ ¹× °íÄ®½·´¢)ÀÌ º¸°íµÈ ¹Ù ÀÖ´Ù. °ú·® Åõ¿©½Ã ÀÌ·¯ÇÑ ¹ÝÀÀÀÌ ¹ß»ýÇÒ À§ÇèÀÌ Áõ°¡ÇÑ´Ù.
ÀÌ»ó¹ÝÀÀÀº MedDRA SOC¿¡ ÀÇÇØ ¿°ÅµÇ¸ç °³º°ÀûÀÎ ÀÌ»ó¹ÝÀÀÀº ºóµµ°¡ ³ôÀº ¼ø¼´ë·Î ³ª¿µÈ´Ù. µ¿ÀÏÇÑ ºóµµ ³»¿¡¼´Â ÁßÁõµµ°¡ °¨¼ÒÇÏ´Â ¼ø¼´ë·Î ³ª¿µÈ´Ù.
¸Å¿ì ÈçÇÏ°Ô (¡Ã1/10), ÈçÇÏ°Ô (¡Ã1/100¿¡¼ <1/10)
ÈçÇÏÁö ¾Ê°Ô (¡Ã1/1,000¿¡¼ <1/100), µå¹°°Ô (¡Ã1/10,000¿¡¼ <1/1,000), ¸Å¿ì µå¹°°Ô (<1/10,000)
| ºóµµ |
ÀÌ»ó¹ÝÀÀ |
| °¨¿° |
| ÈçÇÏÁö ¾Ê°Ô (¡Ã1/1,000¿¡¼ <1/100) |
¸ð³¶¿° |
| ¸é¿ª°è ÀÌ»ó |
| µå¹°°Ô (¡Ã1/10,000¿¡¼ <1/1,000) |
°ú¹ÎÁõ |
| ´ë»ç ¹× ¿µ¾ç ÀÌ»ó |
| µå¹°°Ô (¡Ã1/10,000¿¡¼ <1/1,000) |
°íÄ®½·Ç÷Áõ |
| ÇǺΠ¹× ÇÇÇÏÁ¶Á÷ ÀÌ»ó |
| ÈçÇÏ°Ô (¡Ã1/100¿¡¼ <1/10) |
°Ç¼±ÀÇ ¾ÇÈ, ÇǺο°, È«¹Ý, ¹ÚÇÇ, ÀÛ¿°¨, ÇǺΠÀÚ±Ø, °¡·Á¿ò |
| ÈçÇÏÁö ¾Ê°Ô (¡Ã1/1,000¿¡¼ <1/100) |
¹ßÁø*, ÇǺΠ°ÇÁ¶ |
| µå¹°°Ô (¡Ã1/10,000¿¡¼ <1/1,000) |
±¤°ú¹ÎÁõ, ÇǺΠºÎÁ¾, µÎµå·¯±â, Áö·ç¼º ÇǺο° |
| ½ÅÀå ¹× ¿ä°ü ÀÌ»ó |
| µå¹°°Ô (¡Ã1/10,000¿¡¼ <1/1,000) |
°íÄ®½·´¢ |
| ÀϹÝÀû ÀÌ»ó ¹× Åõ¿©ºÎÀ§ »óÅ |
| ÈçÇÏ°Ô (¡Ã1/100¿¡¼ <1/10) |
Åõ¿©ºÎÀ§ ÅëÁõ |
| ÈçÇÏÁö ¾Ê°Ô (¡Ã1/1,000¿¡¼ <1/100) |
Åõ¿©ºÎÀ§ »ö¼ÒÄ§Âø º¯È |
* È«¹Ý¼º ¹ßÁø, ¹Ý±¸Áø¹ßÁø, È«¿ª¸ð¾ç¹ßÁø, ±¸Áø¹ßÁø, ³óÆ÷¹ßÁø°ú °°Àº ´Ù¾çÇÑ À¯ÇüÀÇ ¹ßÁø ¹ÝÀÀÀÌ º¸°íµÇ¾ú´Ù.
|
| »óÈ£ÀÛ¿ë |
ÀÌ ¾à¿¡ ´ëÇÑ »óÈ£ÀÛ¿ëÀº ¿¬±¸µÇÁö ¾Ê¾Ò´Ù. |
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Á¦Çüº° º¹¾àÁöµµ |
[¿¬°í] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Calcipotriol¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ The precise mechanism of calcipotriol in remitting psoriasis is not well-understood. However, it has been shown to have comparable affinity with calcitriol for the Vitamin D receptor, while being less than 1% as active as the calcitriol in regulating calcium metabolism. The Vitamin D receptor (VDR) belongs to the steroid/thyroid receptor superfamily, and is found on the cells of many different tissues including the thyroid, bone, kindney, and T cells of the immune system. T cells are known to play a role in psoriasis, and it is thought that the binding of calcipotriol to the VDR modulates the T cells gene transcription of cell differentiation and proliferation related genes.
|
| Pharmacology |
Calcipotriol¿¡ ´ëÇÑ Pharmacology Á¤º¸ Calcipotriene is a synthetic analog of vitamin D. In humans, the natural supply of vitamin D depends mainly on exposure to the ultraviolet rays of the sun for conversion of 7-dehydrocholesterol to vitamin D3 (cholecalciferol) in the skin.
|
| Absorption |
Calcipotriol¿¡ ´ëÇÑ Absorption Á¤º¸ Clinical studies with radiolabeled ointment indicate that approximately 6% (+3%, SD) of the applied dose of calcipotriene is absorbed systemically when the ointment is applied topically to psoriasis plaques or 5% (+2.6%, SO) when applied to normal skin.
|
| Pharmacokinetics |
CalcipotriolÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ÀÛ¿ë¹ßÇö½Ã°£ : 1ÁÖ
- ÃÖ´ëÈ¿°ú ¹ßÇö½Ã°£ : 8ÁÖ
- ÀÛ¿ëÁö¼Ó½Ã°£ : ¹Ýº¹ Àû¿ë : 4ÁÖ
- Èí¼ö : ±¹¼Ò Àû¿ë : Á¤»ó ÇǺο¡ Àû¿ë½Ã ¾à 5%, °Ç¼± plaque¿¡ Àû¿ë½Ã ¾à 6%°¡ Àü½ÅÀûÀ¸·Î Èí¼öµÈ´Ù.
- ´ë»ç : Àü½ÅÀûÀ¸·Î Èí¼öµÈ ¾à¹°Àº Àû¿ë 24½Ã°£ À̳»¿¡ ÁÖ·Î °£¿¡¼ ºñȰ¼ºÇü ´ë»çü·Î ´ë»çµÈ´Ù.
|
| Biotransformation |
Calcipotriol¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic. Calcipotriene metabolism following systemic uptake is rapid, and occurs via a similar pathway to the natural hormone. The primary metabolites are much less potent than the parent compound.
|
| Toxicity |
Calcipotriol¿¡ ´ëÇÑ Toxicity Á¤º¸ Topically applied calcipotriene can be absorbed in sufficient amounts to produce systemic effects. Elevated serum calcium has been observed with excessive use of calcipotriene.
|
| Drug Interactions |
Calcipotriol¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Calcipotriol¿¡ ´ëÇÑ Description Á¤º¸ Calcipotriol (INN) or calcipotriene (USAN) is a sythetic derivative of calcitriol or Vitamin D.
|
| Dosage Form |
Calcipotriol¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Cream TopicalOintment TopicalShampoo Topical
|
| Drug Category |
Calcipotriol¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antipsoriatic AgentsDermatologic AgentsVitamin D3 Receptor inhibitor
|
| Smiles String Canonical |
Calcipotriol¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC(C=CC(O)C1CC1)C1CCC2C1(C)CCCC2=CC=C1CC(O)CC(O)C1=C
|
| Smiles String Isomeric |
Calcipotriol¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@H](\C=C\[C@@H](O)C1CC1)[C@H]1CC[C@H]2[C@@]1(C)CCC\C2=C\C=C1\C[C@H](O)C[C@@H](O)C1=C
|
| InChI Identifier |
Calcipotriol¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C27H40O3/c1-17(6-13-25(29)20-8-9-20)23-11-12-24-19(5-4-14-27(23,24)3)7-10-21-15-22(28)16-26(30)18(21)2/h6-7,10,13,17,20,22-26,28-30H,2,4-5,8-9,11-12,14-16H2,1,3H3/b13-6+,19-7-,21-10-
|
| Chemical IUPAC Name |
Calcipotriol¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (1R,3S,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(E,2R)-5-cyclopropyl-5-hydroxypent-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-12-05
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|