 |
| |
|
°¨¸¶¸°Å©¸²(¸°´Ü) 30g Gammalin Cream
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
Àü¹®/ÀÏ¹Ý |
Àü¹®
|
|
Á¦Á¶È¸»ç |
űØÁ¦¾à(ÁÖ)
|
ÆÇ¸Åȸ»ç |
űØÁ¦¾à(ÁÖ)
|
Çã°¡Á¤º¸ |
ÃëÇÏ
(2021.07.01)
|
BIT ¾àÈ¿ºÐ·ù |
¿È & ÀÌÄ¡·áÁ¦ (Scabicides & Pediculicides)
|
º¹ÁöºÎºÐ·ù |
265[±â»ý¼º ÇǺÎÁúȯ¿ëÁ¦ ] |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå |
644800081 \0 ¿ø/30g/°³(2018.03.01)(ÇöÀç¾à°¡)\630 ¿ø/30g/°³(2016.01.01)(º¯°æÀü¾à°¡)
|
|
|
ATCÄÚµå |
Lindane / P03AB02 |
NDCÄÚµå |
[Proprietary Name Search _ ƯÇãµî·Ï¸í,»óÇ¥¸íÀ¸·Î °Ë»ö]
[Active Ingredient Search _ ÁÖ¼ººÐÀ¸·Î °Ë»ö]
[NDC Number Search _ NDCÄÚµå·Î °Ë»ö]
|
¼ººÐ / ÇÔ·® |
[½ÉÆò¿ø ÁÖ¼ººÐÄÚµå ±âÁØ ¼ººÐÇÔ·®Á¤º¸ Á¶È¸]

|
÷°¡Á¦ |
±Û¸®¼¼¸°¸ð³ë½ºÅ׾Ʒ¹ÀÌÆ®,
¹é»ö¹Ù¼¿¸°,
ºÎÆ¿·¹ÀÌÆ¼µåÈ÷µå·Ï½ÃÅç·ç¿£,
¼¼Æ¿ÆÈ¹ÌÅ×ÀÌÆ®,
½ºÅ׾Ƹ£»ê,
½ºÅ׾Ƹ±¾ËÄÚ¿Ã,
À¯µ¿ÆÄ¶óÇÉ,
À̼ÒÇÁ·ÎÇʹ̸®½ºÅ×ÀÌÆ®,
Á¤Á¦¶ó³î¸°,
Á¤Á¦¼ö,
Á¶ÇÕÇâ·á(½ºÅ²Äɾî 23538),
Æ®·Ñ¾Æ¹Î,
ÆÄ¶ó¿Á½Ãº¥Á¶»ê¸ÞÆ¿,
ÆÄ¶ó¿Á½Ãº¥Á¶»êÇÁ·ÎÇÊ,
ÆÄ¶óÇÉ,
ÇÁ·ÎÇÊ·»±Û¸®ÄÝ
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
644800081
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/30g/°³(2018.03.01)(ÇöÀç¾à°¡)
\630 ¿ø/30g/°³(2016.01.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»öÀÇ Ä£¼ö¼ºÅ©¸²ÀÌ´Ù [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
ÀÚ»çÆ÷Àå´ÜÀ§¿¡ µû¸§ |
| ÁÖ¼ººÐÄÚµå |
184330CCM
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
¿È, ÀÌ
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
(Å©¸²Á¦)
¹Ýµå½Ã Áö½ÃÇÑ ´ë·Î¸¸ »ç¿ëÇÏ¸ç ±ÇÀå¿ë·®À» ÃʰúÇÏÁö ¾Ê´Â´Ù.
1. ¿È
°ÇÁ¶ÇÑ ÇǺο¡ ÃæºÐ·®À» ¹®Áú·¯ Æì ¹Ù¸¥´Ù. »óó µüÁö°¡ ÀÖÀ» °æ¿ì¿¡´Â µû¶æÇÑ ¹°·Î ¾Ä´Â °ÍÀÌ Ä¡·á¿¡ µµ¿òÀ» ÁÖ³ª, ÀÌ ¾àÀ» »ç¿ëÇϱâ Àü 1½Ã°£ À̳»¿¡ ¾ÄÀ¸¸é ¾ÈµÈ´Ù. ¾ÄÀº ÈÄ¿¡ ÇǺθ¦ °ÇÁ¶½ÃŲ ÈÄ ÀÌ ¾àÀ» ¹Ù¸¥´Ù. ¸ñ¿¡¼ ¹ß³¡±îÁö °ÇÁ¶ÇÑ ÇǺÎÀü½Å¿¡ ¾ã°Ô ¹Ù¸¥ ÈÄ Àß ¹®Áö¸£°í 6-12½Ã°£ ÈÄ¿¡ ¹°·Î ¿ÏÀüÈ÷ ¾Ä´Â´Ù. º¸Åë 1ȸ Àû¿ëÀ¸·Î Ä¡À¯µÈ´Ù. Ä¡·á ÈÄ¿¡µµ °¡·Á¿òÀÌ ÀÖÀ» ¼ö ÀÖÀ¸³ª À̰ÍÀº Ä¡·áµÇÁö ¾ÊÀº °ÍÀÌ ¾Æ´Ï¸ç »ì¾ÆÀÖ´Â ¿È¹ú·¹°¡ º¸ÀÌÁö ¾Ê´Â´Ù¸é ÀçÄ¡·áÇÒ Çʿ䰡 ¾ø´Ù.
º¸Åë ÇǺΠÁ¢ÃËÁö¼Ó½Ã°£Àº ¾î¸°ÀÌ´Â 6½Ã°£, ¼ºÀÎÀº 12½Ã°£±îÁö·Î Á¦ÇѵǾî¾ß ÇÑ´Ù.
2. ÀÌ
¸¶¸¥ ¸Ó¸®¿¡ µÎÇÇ¿Í ¸ð¹ß Àüü¿¡ ÃæºÐ·®À» ¹®Áú·¯ Æì ¹Ù¸£°í 3-5ºÐ µ¿¾È ¾àÀÌ ÀÛ¿ëÇϵµ·Ï ÇÑ ÈÄ ¹°·Î Çó±¸¾î ³½´Ù.
º¸Åë 1ȸ Àû¿ëÀ¸·Î Ä¡À¯µÈ´Ù. Ä¡·á ÈÄ¿¡µµ °¡·Á¿òÀÌ ÀÖÀ» ¼ö ÀÖÀ¸³ª À̰ÍÀº Ä¡·áµÇÁö ¾ÊÀº °ÍÀÌ ¾Æ´Ï¸ç »ì¾ÆÀÖ´Â À̰¡ º¸ÀÌÁö ¾Ê´Â´Ù¸é ÀçÄ¡·áÇÒ Çʿ䰡 ¾ø´Ù.
|
| ±Ý±â |
1) ÀÌ ¾à ¹× ÀÌ ¾à ¼ººÐ¿¡ °ú¹ÎÁõ ȯÀÚ
2) ¹Ì¼÷¾Æ(ÇǺÎÅõ°ú¼ºÀÌ ¸¸±âÀÇ Ãâ»ê¾Æº¸´Ù ³ôÀ¸¸ç °£È¿¼Ò°¡ ¿ÏÀüÈ÷ ¹ß´ÞµÇ¾î ÀÖÁö ¾Ê´Ù)
3) 3¼¼ ¹Ì¸¸ÀÇ ¿µÀ¯¾Æ
4) ÀÓºÎ, ¼öÀ¯ºÎ
5) ¹ßÀÛ Áúȯ ȯÀÚ ¶Ç´Â ¹ßÀÛÀÇ À§ÇèÀÌ Àִ ȯÀÚ(¿¹: µÎºÎ¼Õ»ó, ³úÁ¾¾ç, ô¼öÁ¾¾ç, °£°æÈ, ½ÉÇÑ ¾ËÄÝÁßµ¶)
6) ÀÌ ¾àÀÇ Àü½ÅÈí¼ö¸¦ Áõ°¡½Ãų ¼ö ÀÖ´Â ±âŸ ÇǺÎÁúȯ(¿¹: ¾ÆÅäÇǼº ÇǺο°, °Ç¼± µî)ÀÌ Àִ ȯÀÚ
7) ÀÌ/¿È¿¡ °¨¿°µÇÁö ¾ÊÀº ȯÀÚ (ÀÌ ¾àÀº °¨¿°ÁõÀÇ ¿¹¹æ¸ñÀûÀ¸·Î »ç¿ëÇÏÁö ¾Ê´Â´Ù. °¨¿°µÈ ÀÌ/¿È¸¸À» Á¦°ÅÇÒ ¼ö ÀÖ´Ù)
8) °ú°Å ¸°´ÜÁ¦Á¦¸¦ »ç¿ëÇÏ¿© ÀÌ»ó¹ÝÀÀÀÌ ¹ß»ýÇÑ ÀûÀÌ Àִ ȯÀÚ
|
| ½ÅÁßÅõ¿© |
1) À¯¼Ò¾Æ
2) ÁßÁõÀÇ ºÎ¼öÀûÀÎ Áúȯ ȯÀÚ
3) °í·ÉÀÚ(ÀúÇ×·ÂÀÌ ¾àȵǾî ÀÖ´Ù)
|
| ÀÌ»ó¹ÝÀÀ |
1) ÀÌ ¾àÀº ÇǺηΠÈí¼öµÇ¾î ¾îÁö·¯¿ò¿¡¼ ¹ßÀÛ¿¡ À̸£±â±îÁöÀÇ ÁßÃ߽Űæ°è µ¶¼º »Ó ¾Æ´Ï¶ó, Ç÷¾× ¹× °£¿¡ µ¶¼ºÀ» ³ªÅ¸³¾ ¼ö ÀÖ´Ù. ³ªÀÌ ¾î¸° »ç¶÷¿¡°Ô´Â µ¶¼ºÀÌ ´õ °ÇÏ´Ù.
2) ¿Ü±¹¿¡¼ °ú¿ë·®, Áö³ªÄ£ ³ëÃâ, ½Ç¼ö ¹× °íÀÇ¿¡ ÀÇÇÑ Àû¿ë, ¹Ýº¹Åõ¿© ¶Ç´Â Àå±â°£ÀÇ Àû¿ë ÈÄ¿¡ ¹ßÀÛ°ú »ç¸ÁÀÌ º¸°íµÈ ¹Ù ÀÖ´Ù. Áö½Ã´ë·Î ÀÌ ¾àÀ» »ç¿ëÇÑ °æ¿ì¿¡µµ µå¹°°Ô ¹ßÀÛÀÌ º¸°íµÈ ¹Ù ÀÖ´Ù.
3) ÀÚ±Ø, °¡·Á¿ò, ¹ßÀû, ½ÀÁø¼º ¹ßÁø µîÀÇ ±¹¼ÒÀûÀÎ °ú¹Î¹ÝÀÀÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¸ç ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â ÀÌ ¾à Åõ¿©¸¦ ÁßÁöÇϰí ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »óÀÇÇÑ´Ù.
4) ¹Ì±¹¿¡¼ ¸°´Ü ·Î¿À¼ÇÀÇ ½ÃÆÇ ÈÄ ´ÙÀ½°ú °°Àº ÀÌ»ó¹ÝÀÀÀÌ Ãß°¡ÀûÀ¸·Î º¸°íµÇ¾ú´Ù. : Å»¸ðÁõ, ÇǺο°, µÎÅë, ÅëÁõ, °¨°¢ÀÌ»ó, °¡·Á¿ò, µÎµå·¯±â
ÀÌ·¯ÇÑ ÀÌ»ó¹ÝÀÀ°ú ¸°´Ü Á¦Á¦¿ÍÀÇ Àΰú°ü°è´Â ¾Ë·ÁÁöÁö ¾Ê¾Ò´Ù.
|
| »óÈ£ÀÛ¿ë |
1) À¯Á¦´Â ÀÌ ¾àÀÇ ÇǺÎÈí¼ö¸¦ ÃËÁø½Ãų ¼ö ÀÖÀ¸¹Ç·Î Å©¸², ¿¬°í ¶Ç´Â À¯Á¦ µî°ú º´¿ëÇÏÁö ¾Ê´Â´Ù. ÀÌ ¾à »ç¿ë ÈÄ ¾Ä¾î³¾ ¶§ ƯÈ÷ ºñ´©¿Í ÇÕ¼º¼¼Á¦¸¦ »ç¿ëÇÏÁö ¾Ê´Â´Ù (°Ö/·Î¿À¼ð/Å©¸²Á¦).
À¯Á¦´Â ÀÌ ¾àÀÇ ÇǺÎÈí¼ö¸¦ ÃËÁø½Ãų ¼ö ÀÖÀ¸¹Ç·Î ÀÌ ¾àÀ» Àû¿ëÇϱ⠹ٷΠÀü ¹× ÈÄ¿¡ À¯¼º Æ®¸®Æ®¸ÕÆ®, À¯¼º Çì¾îµå·¹½Ì ¶Ç´Â ÄÁµð¼Å³Ê¸¦ »ç¿ëÇÏÁö ¾Ê´Â´Ù(¾×Á¦¿¡ ÇÑÇÔ).
2) ¹ßÀÛ ¿ªÄ¡°¡ ³·¾ÆÁú ¼ö ÀÖ´Â ¾à¹°(Ç×Á¤½Åº´¾à, Ç׿ì¿ïÁ¦, Å׿ÀÇʸ°, »çÀÌŬ·Î½ºÆ÷¸°, ¹ÌÄÚÆä³î·¹ÀÌÆ®¸ðÆäÆ¿, Ÿũ·Î¸®¹«½º, Ȳ»êŬ·Î·ÎÄý, ÇǸ®¸ÞŸ¹Î, À̼ҴϾÆÁþ, ¸ÞÆä¸®µò, ¹æ»ç¼º Á¶¿µÁ¦, ÁßÃ߽Űæ°è Àۿ뼺 Ç×Äݸ°Á¦, ¸ÞÅäÄ«¸£¹Ù¸ô, Æä´Ï½Ç¸°°è, ÀÌ¹ÌÆä³Û°è ¹× Äû³î·Ð°è Ç×»ýÁ¦)À» º¹¿ëÇϰí Àִ ȯÀÚ¿¡°Ô´Â ÀÌ ¾àÀ» ½ÅÁßÇÏ°Ô Ã³¹æÇϰí ÁÖÀDZí°Ô °üÂûÇØ¾ß ÇÑ´Ù.
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
(lindane; )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Á¦Çüº° º¹¾àÁöµµ |
[Å©¸²] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Lindane¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Lindane is an organochloride insecticide that exerts its parasiticidal action by being directly absorbed into the parasites (primarily lice, or scabies) and their ova. The gamma-aminobutyric acid (GABA(1)) receptor/chloride ionophore complex is the primary site of action for lindane, and other insecticides such as endosulfan, and fipronil. Blockage of the GABA-gated chloride channel reduces neuronal inhibition, which leads to hyperexcitation of the central nervous system, convulsions, and death.
|
| Pharmacology |
Lindane¿¡ ´ëÇÑ Pharmacology Á¤º¸ Scabies is a common, highly pruritic infestation of the skin caused by Sarcoptes scabiei (lice). It is a very contagious condition with specific lesions, such as burrows, and nonspecific lesions, such as papules, vesicles and excoriations. The typical areas of the body it affects are finger webs, scalp (hair), wrists, axillary folds, abdomen, buttocks, inframammary folds and genitalia (males). It is characterized by intense night-time itching. Scabies is spread through close personal contact (relatives, sexual partners, schoolchildren, chronically ill patients and crowded communities). Scabies infestations and the corresponding symptoms can be eliminated by killing the scabies with topical insecticides or scabicides. Lindane is a scabicide that is essentially and organochloride insecticide.
|
| Protein Binding |
Lindane¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 91%
|
| Half-life |
Lindane¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 18 hours
|
| Absorption |
Lindane¿¡ ´ëÇÑ Absorption Á¤º¸ Lindane is absorbed significantly through the skin. A mean peak blood concentration of 28 nanograms per mL occurred in infants and children 6 hours after total body application of lindane lotion for scabies.
|
| Biotransformation |
Lindane¿¡ ´ëÇÑ Biotransformation Á¤º¸ Primarily hepatic through dechlorination leading to 2-chlorophenol, 0-chlorophenol, chlorocyclohexane, chlorocyclohexanol.
|
| Toxicity |
Lindane¿¡ ´ëÇÑ Toxicity Á¤º¸ Lindane is a moderately toxic compound via oral exposure, with a reported oral LD50 of 88 to 190 mg/kg in rats. Gamma-HCH (which constitutes 99% of lindane) is generally considered to be the most acutely toxic of the isomers following single administration. It is moderately toxic via the dermal route as well, with reported dermal LD50 values of 500 to 1000 mg/kg in rats, 300 mg/kg in mice, 400 mg/kg in guinea pigs, and 300 mg/kg in rabbits. Acute exposure to lindane may lead to central nervous system stimulation (usually developing within 1 hour), mental/motor impairment, excitation, clonic (intermittent) and tonic (continuous) convulsion. Other adverse reactions include central nervous system toxicity, as well as skin and gastrointestinal changes.
|
| Drug Interactions |
Lindane¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Lindane¿¡ ´ëÇÑ Description Á¤º¸ An organochlorine insecticide that has been used as a pediculicide and a scabicide. It has been shown to cause cancer. [PubChem]
|
| Drug Category |
Lindane¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antiscabies AgentInsecticidesScabicide
|
| Smiles String Canonical |
Lindane¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl
|
| Smiles String Isomeric |
Lindane¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ Cl[C@H]1[C@H](Cl)[C@@H](Cl)[C@H](Cl)[C@@H](Cl)[C@@H]1Cl
|
| InChI Identifier |
Lindane¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C6H6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H
|
| Chemical IUPAC Name |
Lindane¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 1,2,3,4,5,6-hexachlorocyclohexane
|
| Drug-Induced Toxicity Related Proteins |
LINDANE ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Fatty acid synthase Drug:lindane Toxicity:affect fatty acid synthesis. [¹Ù·Î°¡±â] Replated Protein:Citrate cleavage enzyme Drug:lindane Toxicity:affect fatty acid synthesis. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2024-06-05
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|