 |
| |
|
ÅäÇǼֹÐÅ©·Î¼Ç 5g TOPISOL MILK LOTION
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
Àü¹®/ÀÏ¹Ý |
Àü¹®
|
|
Á¦Á¶È¸»ç |
ÁÖ½Äȸ»çÁ¦´º¿ø»çÀ̾ð½º
|
ÆÇ¸Åȸ»ç |
ÄÚ¿À·ÕÁ¦¾à(ÁÖ)
|
Çã°¡Á¤º¸ |
Á¤»ó
(2007.03.20)
|
BIT ¾àÈ¿ºÐ·ù |
¿Ü¿ë ½ºÅ×·ÎÀ̵å (Steroids : Skin & Mucous Membrane)
|
º¹ÁöºÎºÐ·ù |
264[ÁøÅ롤Áø¾ç¡¤¼ö·Å¡¤¼Ò¿°Á¦ ] |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå |
670301771 \0 ¿ø/5g/°³(2018.10.06)(ÇöÀç¾à°¡)\905 ¿ø/5g/°³(2016.01.01)(º¯°æÀü¾à°¡)
|
|
|
ATCÄÚµå |
Methylprednisolone aceponate / D07AC14 |
NDCÄÚµå |
[Proprietary Name Search _ ƯÇãµî·Ï¸í,»óÇ¥¸íÀ¸·Î °Ë»ö]
[Active Ingredient Search _ ÁÖ¼ººÐÀ¸·Î °Ë»ö]
[NDC Number Search _ NDCÄÚµå·Î °Ë»ö]
|
¼ººÐ / ÇÔ·® |
[½ÉÆò¿ø ÁÖ¼ººÐÄÚµå ±âÁØ ¼ººÐÇÔ·®Á¤º¸ Á¶È¸]

|
÷°¡Á¦ |
°æÁúÀ¯µ¿ÆÄ¶óÇÉ,
µðºÎÆ¿È÷µå·Ï½ÃÅç·ç¿£,
º¥Áú¾ËÄÚ¿Ã,
¼¼Åº¿Ã,
¼ö»êȳªÆ®·ý,
¿¡µ¥Æ®»ê³ªÆ®·ý¼öȹ°,
¿Ã·¹Àϸ¶Å©·Î°ñ±Û¸®¼¼¸®µå,
À𽺹ÎÇâ HP-305195,
Á¤Á¦¼ö,
Ä«º¸¸Ó 940,
Åׯ÷¿ÀÁî63
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
670301771
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/5g/°³(2018.10.06)(ÇöÀç¾à°¡)
\905 ¿ø/5g/°³(2016.01.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
Èò»öÀÇ ·Î¼Ç [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
50g¡¿1EA, º¸ 190¿ø/g |
| ÁÖ¼ººÐÄÚµå |
193431CLT
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
½ÀÁø(¾ÆÅäÇÇÇǺο°, ½É»ó¼º½ÀÁø µî)
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
1ÀÏ 1ȸ Àû´ç·®À» ȯºÎ¿¡ ¾ã°Ô ¹Ù¸¥´Ù. ¼ºÀÎÀÇ °æ¿ì 12ÁÖ, ¼Ò¾ÆÀÇ °æ¿ì´Â 4ÁÖ ÀÌ»ó °è¼ÓÇØ¼ »ç¿ëÇÏÁö ¾Ê´Â´Ù.
|
| ±Ý±â |
1) ¼¼±Õ(°áÇÙ, ¸Åµ¶ µî)¤ýÁø±Õ(ĵð´ÙÁõ, ¹é¼± µî)¤ý¹ÙÀÌ·¯½º(´ë»óÆ÷Áø, ´Ü¼øÆ÷Áø, ¼öµÎ, Á¾µÎÁõ µî)¤ý¹é½ÅÁ¢Á¾ÈÄÀÇ ÇǺÎÁúȯ¤ýµ¿¹°(¿È, »ç¸é¹ßÀÌ µî)¼º ÇǺΰ¨¿°Áõ ȯÀÚ(Áõ»óÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù)
2) ÀÌ ¾à ¶Ç´Â ÀÌ ¾à ¼ººÐ¿¡ °ú¹ÎÁõ ¹× ±× º´·ÂÀÌ Àִ ȯÀÚ
3) °í¸· õ°øÀÌ ÀÖ´Â ½ÀÁø¼º ¿ÜÀ̵µ¿° ȯÀÚ(õ°øºÎÀ§ÀÇ Ä¡À¯Áö¿¬ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù)
4) ±Ë¾ç(º£Ã¼Æ®º´ Á¦¿Ü), Á¦2µµ ½ÉÀ缺 ÀÌ»óÀÇ È»ó¤ýµ¿»ó ȯÀÚ(ÇǺÎÀç»ýÀÌ ¾ïÁ¦µÇ¾î Ä¡À¯°¡ Áö¿¬µÉ ¼ö ÀÖ´Ù)
5) ÀÔÁÖÀ§ÇǺο°, º¸Åë¿©µå¸§, ÁÖ»ç ȯÀÚ
6) 3¼¼ ÀÌÇÏÀÇ À¯¾Æ |
| ½ÅÁßÅõ¿© |
1) ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀÎ ¹× ¼öÀ¯ºÎ
2) À¯¤ý¼Ò¾Æ
3) °í·ÉÀÚ |
| ÀÌ»ó¹ÝÀÀ |
1) ÇǺÎ
¨ç °¨¿°Áõ : ÇǺÎÀÇ ¼¼±Õ¼º(Àü¿°¼º ³ó°¡Áø, ¸ð³¶¿° µî) ¹× Áø±Õ¼º(ĵð´ÙÁõ, ¹é¼± µî) °¨¿°ÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù[¹ÐºÀºØ´ë¹ý(ODT)ÀÇ °æ¿ì ³ªÅ¸³ª±â ½±´Ù]. ÀÌ¿Í °°Àº Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â ÀûÀýÇÑ Ç×±ÕÁ¦³ª Ç×Áø±ÕÁ¦ µîÀ» º´¿ëÇÏ°í ½Å¼ÓÈ÷ °³¼±µÇÁö ¾ÊÀ» °æ¿ì¿¡´Â »ç¿ëÀ» ÁßÁöÇÑ´Ù.
¨è ÀϹÝÀû ÇǺÎÁõ»ó : ¸ð³¶¿°, ºÎ½º·³, ÇǺÎÀÚ±Ø, ÀÚÅë, ¹ß¿, ÀÛ¿°¨, ¹ßÁø, ¹ßÀû, È«Á¶, °¡·Á¿ò, ÇǺΰÇÁ¶, ³óÆ÷¼ºÇǺο°, ¾Ë·¹¸£±â¼º Á¢ÃËÇǺο°, ¶¡¶ì, ÇÑÁø, »óó¾ÇÈ, ¿åâ, ³óÆ÷Áõ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¸ç, ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â »ç¿ëÀ» ÁßÁöÇÑ´Ù.
¨é Àå±â ¿¬¿ë : ½ºÅ×·ÎÀ̵强 ¿©µå¸§, ½ºÅ×·ÎÀ̵强 ÇǺÎ(ÇǺÎÀ§Ãà, ¸ð¼¼Ç÷°üÈ®Àå, ÀÚ¹Ý), ½ºÅ×·ÎÀ̵强 ÁÖ»ç, ÀÔÁÖÀ§ÇǺο°(ÀÔÁÖÀ§¤ý¾È¸éÀüü¿¡ È«¹Ý, ±¸Áø, ¸ð¼¼Ç÷°üÈ®Àå, µüÁö, Àμ³), ¾î¸°¼±(åà×÷àÐ)¾ç ÇǺκ¯È, ´Ù¸ð, ÇǺκ¯»ö, ¼±Á¶, ¼öÆ÷¼ºÇǺο°, ¾ÆÅäÇÇÇǺο°, ÇǺÎÃâÇ÷ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â õõÈ÷ »ç¿ë·®À» ÁÙ¿© ÄÚ¸£Æ¼ÄÚÀ̵带 ÇÔÀ¯ÇÏÁö ¾ÊÀº ¾àÀ¸·Î ¹Ù²Ù¾î »ç¿ëÇÑ´Ù.
2) ³»ºÐºñ°è : ´ë·® ¶Ç´Â Àå±â°£¿¡ °ÉÄ£ ±¤¹üÀ§ÇÑ »ç¿ë, ¹ÐºÀºØ´ë¹ý¿¡ ÀÇÇØ ÄÚ¸£Æ¼ÄÚÀ̵å Àü½Å Åõ¿©¿Í °°Àº ³úÇϼöü¤ýºÎ½ÅÇÇÁú°è ±â´ÉÀÇ ¾ïÁ¦¸¦ °¡Á®¿Ã ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù.
3) ´« : ¾È°ËÇǺο¡ »ç¿ë½Ã ¾È¾Ð »ó½Â, ³ì³»ÀåÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù. ´ë·® ¶Ç´Â Àå±â°£¿¡ °ÉÄ£ ±¤¹üÀ§ÇÑ »ç¿ë, ƯÈ÷ ¹ÐºÀºØ´ë¹ýÀ» »ç¿ëÇÒ °æ¿ì Èij¶ÇϹ鳻Àå, ³ì³»Àå µîÀ̳ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| Related FDA Approved Drug |
±âÁØ ¼ººÐ: BENZYL ALCOHOLULESFIA (BENZYL ALCOHOL)
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
(methylprednisolone;prednisolone; )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Benzyl alcohol¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
MethylPrednisolone¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Unbound glucocorticoids cross cell membranes and bind with high affinity to specific cytoplasmic receptors, modifying transcription and protein synthesis. By this mechanism, glucocorticoids can inhibit leukocyte infiltration at the site of inflammation, interfere with mediators of inflammatory response, and suppress humoral immune responses. The antiinflammatory actions of corticosteroids are thought to involve phospholipase A2 inhibitory proteins, lipocortins, which control the biosynthesis of potent mediators of inflammation such as prostaglandins and leukotrienes.
|
| Pharmacology |
MethylPrednisolone¿¡ ´ëÇÑ Pharmacology Á¤º¸ Methylprednisolone and its derivatives, methylprednisolone sodium succinate and methylprednisolone acetate, are synthetic glucocorticoids used as antiinflammatory or immunosuppressive agents.
|
| Metabolism |
MethylPrednisolone¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 3A4 (CYP3A4)
|
| Absorption |
MethylPrednisolone¿¡ ´ëÇÑ Absorption Á¤º¸ Oral bioavailability 80-99%
|
| Toxicity |
MethylPrednisolone¿¡ ´ëÇÑ Toxicity Á¤º¸ LD50=2000 mg/kg (orally in rat)
|
| Drug Interactions |
MethylPrednisolone¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
MethylPrednisolone¿¡ ´ëÇÑ Description Á¤º¸ A prednisolone derivative with similar anti-inflammatory action. [PubChem]
|
| Dosage Form |
MethylPrednisolone¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Powder IntramuscularPowder IntravenousPowder, for solution IntravenousSuspension IntramuscularTablet Oral
|
| Drug Category |
MethylPrednisolone¿¡ ´ëÇÑ Drug_Category Á¤º¸ Adrenergic AgentsAnti-inflammatory AgentsAntiemeticsGlucocorticoidsNeuroprotective Agents
|
| Smiles String Canonical |
MethylPrednisolone¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC1CC2C3CCC(O)(C(=O)CO)C3(C)CC(O)C2C2(C)C=CC(=O)C=C12
|
| Smiles String Isomeric |
MethylPrednisolone¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@H]1C[C@H]2[C@@H]3CC[C@](O)(C(=O)CO)[C@@]3(C)C[C@H](O)[C@@H]2[C@@]2(C)C=CC(=O)C=C12
|
| InChI Identifier |
MethylPrednisolone¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C22H30O5/c1-12-8-14-15-5-7-22(27,18(26)11-23)21(15,3)10-17(25)19(14)20(2)6-4-13(24)9-16(12)20/h4,6,9,12,14-15,17,19,23,25,27H,5,7-8,10-11H2,1-3H3/t12-,14-,15-,17-,19+,20-,21-,22-/m0/s1
|
| Chemical IUPAC Name |
MethylPrednisolone¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (6S,8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-6,10,13-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one
|
| Drug-Induced Toxicity Related Proteins |
ALCOHOL ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Pancreatitis associated protein Drug:alcohol Toxicity:regular subclinical pancreatic damage. [¹Ù·Î°¡±â] Replated Protein:Mitochondrial 2-oxoglutarate/malate carrier protein (OGCP) Drug:alcohol Toxicity:mitochondrial glutathione depletion. [¹Ù·Î°¡±â] Replated Protein:Proto-oncogene protein c-fos Drug:alcohol Toxicity:alcohol intoxication. [¹Ù·Î°¡±â] Replated Protein:Opioid growth factor receptor Drug:alcohol Toxicity:alcohol intoxication. [¹Ù·Î°¡±â] Replated Protein:Glutathione S-transferase Mu 1 Drug:alcohol Toxicity:chronic pancreatitis (CP). [¹Ù·Î°¡±â] Replated Protein:D(2) dopamine receptor Drug:alcohol Toxicity:chronic pancreatitis. [¹Ù·Î°¡±â] Replated Protein:Signal transducer and activator of transcription 3 (Sta3) Drug:alcohol Toxicity:alcohol intoxication. [¹Ù·Î°¡±â] Replated Protein:Proto-oncogene protein c-fos Drug:alcohol Toxicity:alcohol intoxication. [¹Ù·Î°¡±â] Replated Protein:Myeloperoxidase Drug:alcohol Toxicity:acute pancreatitis. [¹Ù·Î°¡±â] Replated Protein:Mitogen-activated protein kinase Drug:alcohol Toxicity:alcohol intoxication. [¹Ù·Î°¡±â] Replated Protein:Extracellular signal-regulated kinase Drug:alcohol Toxicity:alcohol intoxication. [¹Ù·Î°¡±â] Replated Protein:Parathyroid hormone Drug:alcohol Toxicity:hyperparathyroidism. [¹Ù·Î°¡±â] Replated Protein:carbohydrate-deficient serotransferrin (??) Drug:alcohol Toxicity:alcohol abuse. [¹Ù·Î°¡±â] ALCOHOL(ETOH) ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Insulin Drug:alcohol(EtOH) Toxicity:impairs insulin. [¹Ù·Î°¡±â] Replated Protein:Eukaryotic translation initiation factor 4E-binding protein Drug:alcohol(EtOH) Toxicity:impairs insulin. [¹Ù·Î°¡±â] Replated Protein:Eukaryotic translation initiation factor 4E Drug:alcohol(EtOH) Toxicity:impairs insulin. [¹Ù·Î°¡±â] METHYLPREDNISOLONE ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Tyrosine aminotransferase Drug:methylprednisolone Toxicity:liver toxicity. [¹Ù·Î°¡±â] Replated Protein:P-selectin Drug:methylprednisolone Toxicity:chronic idiopathic thrombocytopenic purpura (ITP). [¹Ù·Î°¡±â] Replated Protein:Interleukin-6 Drug:methylprednisolone Toxicity:chronic idiopathic thrombocytopenic purpura (ITP). [¹Ù·Î°¡±â] Replated Protein:Glucocorticoid receptor Drug:methylprednisolone Toxicity:liver toxicity. [¹Ù·Î°¡±â] Replated Protein:Thrombopoietin (TPO) Drug:methylprednisolone Toxicity:chronic idiopathic thrombocytopenic purpura (ITP). [¹Ù·Î°¡±â] METHYLPREDNISOLONE (MPL) ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Glucocorticoid receptor Drug:methylprednisolone (MPL) Toxicity:liver toxicity. [¹Ù·Î°¡±â] Replated Protein:Tyrosine aminotransferase Drug:methylprednisolone (MPL) Toxicity:liver toxicity. [¹Ù·Î°¡±â] PREDNISOLONE ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:DNA topoisomerase 1 Drug:prednisolone Toxicity:appearance of apoptotic cells. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2024-08-08
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|