| |
|
|
|
|
|
 |
| |
|
Æ©¶õÆ®½Ã·´(¾Æ¼¼Æ¿½Ã½ºÅ×ÀÎ) (100mL) TURANT SYRUP
|
|
ÀϹÝÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
670303512
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/100(1)mL/º´(2018.03.01)(ÇöÀç¾à°¡)
\20 ¿ø/100(1)mL/º´(2016.01.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
ÇÃ¶ó½ºÆ½º´¿¡ ÃæÀüµÈ °úÀÏÇâÀÌ ³ª´Â ¹«»ö ¶Ç´Â ¹ÌȲ»öÀÇ Åõ¸íÇÑ ½Ã·´ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
100ml, 550ml |
| ÁÖ¼ººÐÄÚµå |
101838ASY
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
´ÙÀ½ Áúȯ¿¡¼ÀÇ °´´ã¹èÃâ°ï¶õ : ±Þ¤ý¸¸¼º±â°üÁö¿°, ±â°üÁöõ½Ä, Èĵο°, ºÎºñµ¿¿°, ³¶¼º¼¶À¯Áõ
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¾Æ¼¼Æ¿½Ã½ºÅ×ÀÎÀ¸·Î¼ ´ÙÀ½ ¿ë·®À» ½ÄÀü¿¡ º¹¿ëÇÑ´Ù.
1. ±Þ¼ºÁúȯ
¼ºÀÎ : 1ȸ 200 mg 1ÀÏ 3ȸ
¼Ò¾Æ : 6 ¢¦ 14¼¼ 1ȸ 200 mg 1ÀÏ 2ȸ
2 ¢¦ 5¼¼ 1ȸ 100 mg 1ÀÏ 3ȸ
2. ¸¸¼ºÁúȯ
¼ºÀÎ : 1ȸ 200 mg 1ÀÏ 2ȸ
¼Ò¾Æ : 6 ¢¦ 14¼¼ 1ȸ 100 mg 1ÀÏ 3ȸ
3. ³¶¼º¼¶À¯Áõ
¼Ò¾Æ : 6¼¼ ÀÌ»ó 1ȸ 200 mg 1ÀÏ 3ȸ,
2 ¢¦ 5¼¼ 1ȸ 100 mg 1ÀÏ 4ȸ
|
| ±Ý±â |
1) ÀÌ ¾à ¶Ç´Â ÀÌ ¾àÀÇ ±¸¼º¼ººÐ¿¡ °ú¹Î¹ÝÀÀ ȯÀÚ
2) À§¡¤½ÊÀÌÁöÀå±Ë¾ç ȯÀÚ
3) 2¼¼ ¹Ì¸¸ ¿µ¾Æ |
| ½ÅÁßÅõ¿© |
1) ÀӺΠ: ÀӺο¡ ´ëÇÑ ÀûÀýÇÑ ¿¬±¸°¡ ¾øÀ¸¹Ç·Î ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ¿©¼º¿¡´Â ¹Ýµå½Ã ÇÊ¿äÇÑ °æ¿ì¿¡¸¸ Åõ¿©ÇÑ´Ù.
2) ¼öÀ¯ºÎ : ÀÌ ¾àÀÌ ¸ðÀ¯·Î ºÐºñµÇ´ÂÁö ¾Ë·ÁÁöÁö ¾Ê¾ÒÀ¸³ª ¸¹Àº ¾àµéÀÌ ¸ðÀ¯·Î ºÐºñµÇ¹Ç·Î ¼öÀ¯ºÎ¿¡ Åõ¿©ÇÒ °æ¿ì¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù. |
| ÀÌ»ó¹ÝÀÀ |
´ÙÀ½°ú °°À» °æ¿ì ÀÌ ¾àÀÇ º¹¿ëÀ» Áï°¢ ÁßÁöÇϰí ÀÇ»ç, Ä¡°úÀÇ»ç, ¾à»ç¿Í »óÀÇÇÒ °Í. »ó´ã½Ã °¡´ÉÇÑ ÇÑ ÀÌ Ã·ºÎ¹®¼¸¦ ¼ÒÁöÇÒ °Í.
1) ¼Òȱâ°è : µå¹°°Ô ±¸¿ª, ±¸Åä, ±¸³»¿°, °¡½¿¾²¸², ¼³»ç µî
2) °ú¹Î¹ÝÀÀ : µå¹°°Ô µÎµå·¯±â, °¡·Á¿ò, ¹ßÁø, µÎÅë, À̸í, ±â°üÁö°æ·Ã(ƯÈ÷ õ½Ä ȯÀÚ) µî
3) µå¹°°Ô ºó¸Æ, °íÇ÷¾Ð. ¸Å¿ì µå¹°°Ô ¾Æ³ªÇʶô½Ã½º
4) ±¹³» ÀÚ¹ßÀû À¯ÇØ»ç·Ê º¸°íÀÚ·á(1989 ¢¦ 2013 »ó¹Ý±â)¸¦ ºÐ¼®ÇÑ °á°ú, À¯ÇØ»ç·Ê°¡ º¸°íµÈ ´Ù¸¥ ÀǾàǰ¿¡¼ ¹ß»ýÇÑ À¯ÇØ»ç·Ê¿¡ ºñÇØ Åë°èÀûÀ¸·Î À¯ÀÇÇÏ°Ô ¸¹ÀÌ º¸°íµÈ À¯ÇØ»ç·Ê´Â ´ÙÀ½°ú °°ÀÌ ³ªÅ¸³µ´Ù. ´Ù¸¸, À̷μ °ð ÇØ´ç¼ººÐ°ú ´ÙÀ½ÀÇ À¯ÇØ»ç°è °£¿¡ Àΰú°ü°è°¡ ÀÔÁõµÈ °ÍÀ» ÀǹÌÇÏ´Â °ÍÀº ¾Æ´Ï´Ù.
¡¤È£Èí°ï¶õ
|
| Off-label Usage |
[Á¶È¸]
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Bµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Acetylcysteine¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Acetylcysteine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Acetylcysteine may protect against acetaminophen overdose-induced hepatotoxicity by maintaining or restoring hepatic concentrations of glutathione. Glutathione is required to inactivate an intermediate metabolite of acetaminophen that is thought to be hepatotoxic. In acetaminophen overdose, excessive quantities of this metabolite are formed because the primary metabolic (glucuronide and sulfate conjugation) pathways become saturated. Acetylcysteine may act by reducing the metabolite to the parent compound and/or by providing sulfhydryl for conjugation of the metabolite. Experimental evidence also suggests that a sulfhydryl-containing compound such as acetylcysteine may also directly inactivate the metabolite. Inhalation - Acetylcysteine exerts its mucolytic action through its free sulfhydryl group, which opens the disulfide bonds and lowers mucus viscosity. This action increases with increasing pH and is most significant at pH 7 to 9. The mucolytic action of acetylcysteine is not affected by the presence of DNA.
|
| Pharmacology |
Acetylcysteine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Acetylcysteine has been shown to reduce the extent of liver injury following acetaminophen overdose. It is most effective when given early, with benefit seen principally in patients treated within 8-10 hours of the overdose. Acetylcysteine likely protects the liver by maintaining or restoring the glutathione levels, or by acting as an alternate substrate for conjugation with, and thus detoxification of, the reactive metabolite.
|
| Protein Binding |
Acetylcysteine¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 83%
|
| Half-life |
Acetylcysteine¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 5.6 hours (adults), 11 hours (neonates)
|
| Absorption |
Acetylcysteine¿¡ ´ëÇÑ Absorption Á¤º¸ Bioavailability is 6??0% following oral administration and less than 3% following topical administration.
|
| Pharmacokinetics |
AcetylcysteineÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ÃÖ´ë Á¡¾×¿ëÇØÈ¿°ú ¹ßÇö½Ã°£
- ÀÛ¿ëÁö¼Ó½Ã°£ : 1½Ã°£ ÀÌ»ó
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£
- ºÐÆ÷¿ëÀû
- ´Ü¹é°áÇÕ
- ¹Ý°¨±â
- ȯ¿øÇü acetylcysteine : 2½Ã°£
- Àüü acetylcysteineÀ¸·Î¼ 5.5 ½Ã°£
|
| Biotransformation |
Acetylcysteine¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic. Deacetylated by the liver to cysteine and subsequently metabolized.
|
| Toxicity |
Acetylcysteine¿¡ ´ëÇÑ Toxicity Á¤º¸ Single intravenous doses of acetylcysteine at 1000 mg/kg in mice, 2445 mg/kg in rats, 1500 mg/kg in guinea pigs, 1200 mg/kg in rabbits and 500 mg/kg in dogs were lethal. Symptoms of acute toxicity were ataxia, hypoactivity, labored respiration, cyanosis, loss of righting reflex and convulsions.
|
| Drug Interactions |
Acetylcysteine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Description |
Acetylcysteine¿¡ ´ëÇÑ Description Á¤º¸ The N-acetyl derivative of cysteine. It is used as a mucolytic agent to reduce the viscosity of mucous secretions. It has also been shown to have antiviral effects in patients with HIV due to inhibition of viral stimulation by reactive oxygen intermediates. [PubChem]
|
| Dosage Form |
Acetylcysteine¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Liquid Respiratory (inhalation)Solution Respiratory (inhalation)
|
| Drug Category |
Acetylcysteine¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antiviral AgentsExpectorantsFree Radical Scavengers
|
| Smiles String Canonical |
Acetylcysteine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC(=O)NC(CS)C(O)=O
|
| Smiles String Isomeric |
Acetylcysteine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CC(=O)N[C@@H](CS)C(O)=O
|
| InChI Identifier |
Acetylcysteine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C5H9NO3S/c1-3(7)6-4(2-10)5(8)9/h4,10H,2H2,1H3,(H,6,7)(H,8,9)/t4-/m0/s1/f/h6,8H
|
| Chemical IUPAC Name |
Acetylcysteine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (2R)-2-acetamido-3-sulfanylpropanoic acid
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-08-12
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|