 |
| |
|
³×Æ¿¸®½ÅÁÖ150mg(Ȳ»ê³×Æ¿¸¶À̽Å)
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
670300041
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1.5mL/¾ÚÇÃ(2018.03.01)(ÇöÀç¾à°¡)
\3,279 ¿ø/1.5mL/¾ÚÇÃ(2017.02.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹«»ö-¿¯Àº Ȳ»öÀÇ Åõ¸íÇÑ ¾×ü°¡ ÃæÁøµÈ ¹«»öÅõ¸íÇÑ ¾ÚÇÃÁ¦ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
1.5¹Ð¸®¸®ÅÍ ¡¿ 10,20,50¾ÚÇà |
| ÁÖ¼ººÐÄÚµå |
200732BIJ
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
¡Û À¯È¿±ÕÁ¾
³×Æ¿¸¶À̽ſ¡ °¨¼ö¼ºÀÎ ´ëÀå±Õ, Æó·Å°£±Õ, ³ì³ó±Õ, ÇÁ·ÎÅ׿콺, Æ÷µµ±¸±Õ, Ŭ·¹ºê½Ã¿¤¶ó, ¿£Å׷ιÚÅÍ, ¼¼¶óƼ¾Æ, ½ÃÆ®·Î¹ÚÅÍ
¡Û ÀûÀÀÁõ
- ºñ´¢»ý½Ä±â °¨¿°Áõ
- ÇǺΠ¹× ÇǺÎÁ¶Á÷ °¨¿°Áõ, È»ó, ¿Ü»ó ¹× ¼ö¼ú ÈÄ °¨¿°¿¹¹æ
- ±â°üÁö¿°, Æó·Å, ³óÈä - ÆÐÇ÷Áõ - °ñ ¹× °üÀý °¨¿°Áõ - º¹¸·¿° µî º¹ºÎ ³» °¨¿°Áõ
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¿øÀαÕÀÇ °¨¼ö¼º, °¨¿°ÀÇ Á¤µµ, ȯÀÚÀÇ »óÅÂ(ƯÈ÷ ½Å±â´É»óÅÂ) µîÀ» °í·ÁÇÏ ¿© Åõ¿©·®À» °áÁ¤Ç쵂 ÀϹÝÀûÀ¸·Î ¾Æ·¡¿Í °°ÀÌ Åõ¿©ÇÑ´Ù.
1. ±ÙÀ°ÁÖ»ç
1) ¼ºÀÎ
- ¿ä·Î°¨¿°Áõ : ³×Æ¿¸¶À̽ÅÀ¸·Î¼ 1ÀÏ Ã¼Áß kg´ç 3 ¢¦ 4 mg(¿ª°¡)À» 2ȸ ºÐ ÇÒ Åõ¿©ÇÑ´Ù.
- ÁßÁõÀÇ Àü½Å°¨¿°Áõ : ÀÌ ¾àÀ¸·Î¼ 1ÀÏ Ã¼Áß kg´ç 4.0 ¢¦ 6.5 mg(¿ª°¡)À» 2 ¢¦ 3ȸ ºÐÇÒ Åõ¿©ÇÑ´Ù.
2) À¯¾Æ ¹× ¼Ò¾Æ(6ÁÖ ¢¦ 12¼¼) : ÀÌ ¾àÀ¸·Î¼ 1ÀÏ Ã¼Áß kg´ç 5.5 ¢¦ 7.5 mg (¿ª°¡)À» 2 ¢¦ 3ȸ ºÐÇÒ Åõ¿©ÇÑ´Ù.
3) ½Å»ý¾Æ(»ýÈÄ 6Á̸ֹ¸) : ÀÌ ¾àÀ¸·Î¼ 1ÀÏ Ã¼Áß kg´ç 4.0 ¢¦ 6.0 mg(¿ª°¡) À» 2ȸ ºÐÇÒ Åõ¿©ÇÑ´Ù.
2. Á¤¸ÆÁÖ»ç
Á¤¸ÆÁÖ»ç½ÃÀÇ ¿ë·®Àº ±ÙÀ°ÁÖ»ç¿Í µ¿ÀÏÇϸç 3 ¢¦ 5ºÐ ÀÌ»ó µ¿¾È ÁÖÀÔ°üÀ¸ ·Î Á¤¸ÆÁÖ»çÇÑ´Ù.
ÀÌ ¾àÀº ±ÙÀ°ÁÖ»ç ½Ã ºü¸£°í ¿ÏÀüÇÏ°Ô Èí¼öµÇ¹Ç·Î, Á¤¸ÆÁÖ»ç´Â ±ÙÀ°Áֻ縦 ÁÖ»çÇϱ⠾î·Á¿î °æ¿ì(¿¹, ¼îÅ©, ÁßÁõÈ»ó, Ç÷¾×ÇÐÀû ÃâÇ÷Àå¾Ö, ±ÙÀ°ÀÇ °¨ ¼Ò, ÆÐÇ÷Áõ, ¿ïÇ÷½ÉºÎÀü µîÀÌ Àִ ȯÀÚ)¿¡ Åõ¿©ÇÑ´Ù.
<ÀÌ ¾àÀÇ Á¶Á¦¹ý>
Á¡Àû Á¤¸ÆÁÖ»ç ½Ã´Â 50 ¢¦ 200 mLÀÇ »ý¸®½Ä¿° ÁÖ»ç¾×, 5 % Æ÷µµ´çÁÖ»ç¾×¿¡ 1ȸ ¿ë·®À» Èñ¼®ÇÏ¿© 30ºÐ ¢¦ 2½Ã°£¿¡ °ÉÃÄ ÃµÃµÈ÷ ÁÖ»çÇÑ´Ù.
¼Ò¾ÆÀÇ °æ¿ì¿¡´Â Èñ¼®¾×ÀÇ ¾çÀ» ÀûÀýÈ÷ °¨·® Á¶ÀýÇÑ´Ù.
ÀÌ ¾àÀº ´Ù¸¥ ¾à¹°°úÀÇ È¥ÇÕÀÌ ±ÝÁöµÇ¾î ÀÖÀ¸¸ç ÀÌ ¾àÀÇ Àû´çÇÑ Èñ¼®Á¦·Î »ý¸®½Ä¿° ÁÖ»ç¾×, ÁÖ»ç¿ë¼ö, 5 % ¶Ç´Â 10 % Æ÷µµ´çÁÖ»ç¾×, 10 % °ú´ç ÁÖ »ç¾× µîÀÌ ÀÖ´Ù.
|
| ÁÖ¿ä¾à¹° »óÈ£ÀÛ¿ë |
[Á¶È¸]
|
| ±Ý±â |
1) ÀÌ ¾à ¶Ç´Â ´Ù¸¥ ¾Æ¹Ì³ë±Û¸®ÄÚ»çÀ̵å°è Ç×»ý¹°Áú ¹× ¹Ù½ÃÆ®¶ó½Å¿¡ °ú¹Î¹ÝÀÀÀÇ º´·ÂÀÌ Àִ ȯÀÚ
2) ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ¿©¼º ¹× ¼öÀ¯ºÎ
3) ±ÙÀ°Àå¾Ö ȯÀÚ(¿¹, ÁßÁõ ±Ù¹«·ÂÁõ)(½Å°æ±Ù Â÷´ÜÀÛ¿ëÀÌ ÀÖ¾î È£Èí¾ïÁ¦°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù)
4) 2¼¼ ¹Ì¸¸ÀÇ ¾î¸°ÀÌ(º¥Áú¾ËÄÚ¿Ã Æ÷ÇÔ Ç°¸ñ¿¡ ÇÑÇÔ) |
| ½ÅÁßÅõ¿© |
1) º»ÀÎ ¶Ç´Â ºÎ¸ð, ÇüÁ¦°¡ ¾Æ¹Ì³ë±Û¸®ÄÚ»çÀ̵å°è Ç×»ý¹°Áú¿¡ ÀÇÇÑ ³Ã»ÀÚ ¶Ç´Â ±× ¿Ü ´Ù¸¥ ³Ã»ÀÚÀÎ °æ¿ì¿¡´Â Åõ¿©ÇÏÁö ¾Ê´Â °ÍÀ» ¿øÄ¢À¸·Î Çϳª ºÎµæÀÌ Åõ¿©ÇÒ °æ¿ì¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
2) ½ÅÀå¾Ö ȯÀÚ(Ç÷Áß³óµµ°¡ ³ô°Ô Áö¼ÓµÇ¾î ½ÅÀå¾Ö°¡ ¾Ç鵃 ¼ö ÀÖÀ¸¸ç ¶ÇÇÑ Á¦8³ú½Å°æÀå¾Ö µîÀÇ ÀÌ»ó¹ÝÀÀÀÌ °ÇÏ°Ô ³ªÅ¸³¯ ¼ö ÀÖ´Ù)
3) °£Àå¾Ö ȯÀÚ(°£Àå¾Ö°¡ ¾Ç鵃 ¼ö ÀÖ´Ù)
4) °æ±¸ ¼·Ãë°¡ ¿ëÀÌÇÏÁö ¾ÊÀº ȯÀÚ ¶Ç´Â ºñ°æ±¸¿µ¾ç ȯÀÚ, °í·ÉÀÚ, Àü½Å»óŰ¡ ³ª»Û ȯÀÚ(ºñŸ¹Î K °áÇÌÁõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÃæºÐÈ÷ °üÂû
ÇÑ´Ù)
5) ÆÄŲ½¼º´ ȯÀÚ
6) ÀÌ ¾àÀº °ÇÁ¶¾ÆÈ²»ê³ªÆ®·ý, ÇǷξÆÈ²»ê³ªÆ®·ýÀÌ ÇÔÀ¯µÇ¾î ÀÖ¾î ¾Æ³ªÇʶô½Ã¿Í °°Àº ¾Ë·¹¸£±â¸¦ ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¸ç ÀϺΠ°¨¼ö¼º ȯÀÚ¿¡¼´Â »ý¸íÀ» À§ÇùÇÒ Á¤µµ ¶Ç´Â À̺¸´Ù ¾àÇÑ Ãµ½Ä¹ßÀÛÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù. ÀÏ¹Ý »ç¶÷¿¡¼ÀÇ ¾ÆÈ²»ê°¨¼ö¼º¿¡ ´ëÇÑ ÃѰýÀûÀÎ ºóµµ´Â ¾Ë·ÁÁöÁö ¾Ê¾ÒÀ¸³ª ³·Àº °ÍÀ¸·Î º¸ÀÌ¸ç ¾ÆÈ²»ê°¨¼ö¼ºÀº ºñõ½ÄȯÀÚº¸´Ù õ½ÄȯÀÚ¿¡¼ ºó¹øÇÑ °ÍÀ¸·Î ³ªÅ¸³µ´Ù. |
| ÀÌ»ó¹ÝÀÀ |
1) ¼îÅ© : ¼îÅ©¸¦ ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î ÃæºÐÈ÷ °üÂûÇϰí û»öÁõ, È£Èí°ï¶õ, ÈäºÎºÒÄè°¨, Ç÷¾ÐÀúÇÏ µîÀÇ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÏ´Â µî
ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù.
2) °ú¹Î¹ÝÀÀ : ¶§¶§·Î ¹ßÁø, µå¹°°Ô °¡·Á¿ò, ¹ß¿ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³ª´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
3) ¼Òȱâ°è : µå¹°°Ô ±¸¿ª, ±¸Åä, ±¸°¢¿°, ¼³»ç, º¯ºñ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
4) Ç÷¾×°è : ¶§¶§·Î ºóÇ÷, ¹«°ú¸³±¸Áõ, È£»ê±¸ Áõ°¡, µå¹°°Ô ¹éÇ÷±¸ °¨¼Ò, Ç÷¼ÒÆÇ °¨¼Ò µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
5) ½Å°æ°è : ¶§¶§·Î ³Ã», ¾îÁö·³, À̸í, ¹æÇâ°¨°¢Àå¾Ö, ¾È±¸ÁøÅÁ µîÀÇ Á¦8³ú½Å°æÀå¾Ö, ÀÌÆó°¨, µå¹°°Ô ÀÔ¼ú, Çô µîÀÇ ¸¶ºñ°¨ÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÃæºÐÈ÷ °üÂûÇϰí ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³ª´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÏ´Â °ÍÀÌ ¹Ù¶÷Á÷Çϳª ºÎµæÀÌ Åõ¿©¸¦ °è¼ÓÇÒ °æ¿ì¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
6) ±Ù°ñ°Ý°è : ±ÙÀ°ÅëÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
7) °£Àå : ¶§¶§·Î °£Àå¾Ö°¡ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÃæºÐÈ÷ °üÂûÇÏ¿© ALT, AST, ALP, Ç÷û ºô¸®·çºó »ó½Â µîÀÇ ÀÌ»óÀÌ ÀÎÁ¤µÇ´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
8) ½ÅÀå : µå¹°°Ô ±Þ¼º½ÅºÎÀü µîÀÇ ÁßÁõÀÇ ½ÅÀå¾Ö°¡ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î Á¤±âÀûÀ¸·Î °Ë»ç¸¦ ½Ç½ÃÇÏ´Â µî ÃæºÐÈ÷ °üÂûÇÏ¿© ÀÌ»óÀÌ ÀÎÁ¤µÇ´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù. ¶ÇÇÑ ¶§¶§·Î BUN»ó½Â, Å©·¹¾ÆÆ¼´Ñ »ó½Â, ¿ä¼Ò°ß ÀÌ»ó, ÇÌ´¢ µîÀÌ ³ªÅ¸³ª´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϸç, µå¹°°Ô ºÎÁ¾, Ç÷´¢, Ä®·ý µî ÀüÇØÁú ÀÌ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
9) ºñŸ¹Î °áÇÌÁõ : ºñŸ¹Î K °áÇÌÁõ»ó(ÀúÇÁ·ÎÆ®·ÒºóÇ÷Áõ, ÃâÇ÷°æÇâ µî), ºñŸ¹Î B±º °áÇÌÁõ»ó(Çô¿°, ±¸³»¿°, ½Ä¿åºÎÁø, ½Å°æ¿° µî)ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ
´Ù.
10) ÁÖ»çºÎÀ§ : ÁÖ»çºÎÀ§ÀÇ °æÈ¿Í µå¹°°Ô ÅëÁõ, Á¤¸ÆÇ÷ÀüÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù(±ÙÀ°Áֻ翡 ÇÑÇÔ).
11) ±âŸ : ÀÌ ¾à Åõ¿©·Î ºñ°¨¼ö¼º±Õ°ú Áø±ÕÀÇ °úÀ×¼ºÀå, Àå±âÅõ¿© ½Ã ĵð´Ù¼º Áú¿°, ±¸°¥, µÎÅë, ¹«±â·Â, ºó¸Æ, ¿ÀÇÑ, ü¾×Àú·ù, ÇÁ·ÎÆ®·Òºó½Ã°£ Áõ°¡, Ç÷´çÄ¡ »ó½Â µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| »óÈ£ÀÛ¿ë |
1) µ¦½ºÆ®¶õ, ¾Æ¸£±ä»ê³ªÆ®·ý µî ½ÅÀå¾Ö¸¦ ÀÏÀ¸Å³ ¼ö ÀÖ´Â Ç÷¾× ´ë¿ëÁ¦ÀÇ ½Åµ¶¼ºÀ» Áõ°½Ãų ¼ö ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇÑ Ç÷¾× ´ë¿ëÁ¦¿Í´Â º´¿ëÅõ¿©ÇÏÁö ¾Ê´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù. ¶ÇÇÑ º´¿ëÅõ¿©¿¡ ÀÇÇØ ¾Æ¹Ì³ë±Û¸®ÄÚ»çÀ̵å°è ¾à¹°ÀÌ Ç÷Áß¿¡ ÃàÀûµÇ°í ±ÙÀ§¼¼´¢°ü »óÇǼ¼Æ÷ÀÇ °øÆ÷º¯¼ºÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ½ÅÀå¾Ö°¡ ³ªÅ¸³¯ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí Åõ¼®¿ä¹ý µî ÀûÀýÇÑ Ã³Ä¡¸¦ ½Ç½ÃÇÑ´Ù.
2) Äí¶ó·¹À¯»çÀÛ¿ë(½Å°æ±Ù Á¢ÇպΠÂ÷´ÜÀÛ¿ë)¿¡ ÀÇÇÑ È£Èí¾ïÁ¦°¡ ³ªÅ¸³¯ ¼öÀÖÀ¸¹Ç·Î ¸¶ÃëÁ¦, ±ÙÀÌ¿ÏÁ¦(Åõº¸Äí¶ó¸°, ºê·ÒÈÆÇÅ©·Î´½, ºê·ÒȺ£Å©·Î´½, ÅçÆä¸®¼Õ, AÇü º¸Åø¸®´©½º µ¶¼Ò, ¼÷»ç¸ÞÅä´½, ¿¡Å׸£, ÇÒ·Îź, µ¥Ä«¸ÞÅä´½)¿Í º´¿ëÇÒ °æ¿ì¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù. È£Èí¾ïÁ¦°¡ ³ªÅ¸³µÀ» °æ¿ì¿¡´Â Ä®½·Á¦Á¦ÀÇ Á¤¸ÆÁÖ»ç, Äݸ°¿¡½ºÅ×¶óÁ¦ ÀúÇØÁ¦ µîÀ» Åõ¿©ÇÑ´Ù.
3) ·çÇÁÀÌ´¢Á¦(¿¡Å¸Å©¸°»ê, Ǫ·Î¼¼¹Ìµå, ¾ÆÁ¶¼¼¹Ìµå µî)¿ÍÀÇ º´¿ë¿¡ ÀÇÇØ ½Åµ¶¼º ¹× û°¢±âµ¶¼ºÀÌ Áõ°¡µÉ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇÑ ÀÌ´¢Á¦¿Í´Â º´¿ëÅõ¿©
ÇÏÁö ¾Ê´Â´Ù.
4) ¼¼ÆÈ·Î½ºÆ÷¸°°è¿Í ´Ù¸¥ ¾Æ¹Ì³ë±Û¸®ÄÚ»çÀ̵å°è Ç×»ý¹°Áú°úÀÇ º´¿ë¿¡ ÀÇÇØ µ¶¼ºÀÌ Áõ°¡Çß´Ù´Â º¸°í°¡ ÀÖ´Ù.
5) ´ÙÀ½°ú °°Àº ½ÅÀå¾Ö ¶Ç´Â Á¦8³ú½Å°æÀå¾Ö¸¦ ÀÏÀ¸Å³ ¼ö ÀÖ´Â ¾à¹°°ú´Â º´¿ëÅõ¿©ÇÏÁö ¾Ê´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù. : ´Ù¸¥ ¾Æ¹Ì³ë±Û¸®ÄÚ»çÀ̵å°è Ç×»ý¹°Áú, ¼¼ÆÈ·Î½ºÆ÷¸°°è, ºñ¿À¸¶À̽Å, Æú¸®¹Í½Å B, Äݸ®½ºÆ¾, ¹é±ÝÇÔÀ¯ Ç׾Ǽº Á¾¾çÁ¦(½Ã½ºÇöóƾ, Ä«¸£º¸Çöóƾ, ³×´ÙÇÃ¶óÆ¾ µî), ¹ÝÄÚ¸¶À̽Å, ¿£ºñ¿À¸¶À̽Å, ½ÃŬ·Î½ºÆ÷¸°, ¾ÏÆ÷Å׸®½Å B, Ÿũ·Î¸®¹«½º, ¾Æ½ÃŬ·Î¹ö, ¹Ù½ÃÆ®¶ó½Å µî |
| Related FDA Approved Drug |
±âÁØ ¼ººÐ: NETILMICIN SULFATENETROMYCIN (NETILMICIN SULFATE)
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Dµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
ÀÓ»êºÎ ¶Ç´Â ÀӽŰèȹÁß º¹¿ë±ÝÁö |
|
 |
º¯ºñ°¡ »ý±æ¼ö ÀÖ½À´Ï´Ù. |
|
 |
¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Netilmicin¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Aminoglycosides like netilmicin "irreversibly" bind to specific 30S-subunit proteins and 16S rRNA. Specifically netilmicin binds to four nucleotides of 16S rRNA and a single amino acid of protein S12. This interferes with decoding site in the vicinity of nucleotide 1400 in 16S rRNA of 30S subunit. This region interacts with the wobble base in the anticodon of tRNA. This leads to interference with the initiation complex, misreading of mRNA so incorrect amino acids are inserted into the polypeptide leading to nonfunctional or toxic peptides and the breakup of polysomes into nonfunctional monosomes, leaving the bacterium unable to synthesize proteins vital to its growth.
|
| Pharmacology |
Netilmicin¿¡ ´ëÇÑ Pharmacology Á¤º¸ Netilmicin is a semisynthetic, water soluble antibiotic of the aminoglycoside group, produced by the fermentation of Micromonospora inyoensis, a species of actinomycete. Aminoglycosides are useful primarily in infections involving aerobic, Gram-negative bacteria, such as Pseudomonas, Acinetobacter, and Enterobacter. It is active at low concentrations against a wide variety of pathogenic bacteria including Escherichia coli, bacteria of the Klebsiella-Enterobacter-Serratia group, Citrobacter sp., Proteus sp. (indole-positive and indole-negative), including Proteus mirabilis, P. morganii, P. rettgrei, P. vulgaris, Pseudomonas aeruginosa and Neisseria gonorrhoea. Netilmicin is also active in vitro against isolates of Hemophilus influenzae, Salmonella sp., Shigella sp. and against penicillinase and non-penicillinase-producing Staphylococcus including methicillin-resistant strains. Some strains of Providencia sp., Acinetobacter sp. and Aeromonas sp. are also sensitive to netilmicin. Many strains of the above organisms which are found to be resistant to other aminoglycosides, such as kanamycin, gentamicin, tobramycin and sisomicin, are susceptible to netilmicin in vitro. Occasionally, strains have been identified which are resistant to amikacin but susceptible to netilmicin. The combination of netilmicin and penicillin G has a synergistic bactericidal effect against most strains of Streptococcus faecalis (enterococcus). The combined effect of netilmicin and carbenicillin or ticarcillin is synergistic for many strains of Pseudomonas aeruginosa. In addition, many isolates of Serratia, which are resistant to multiple antibiotics, are inhibited by synergistic combinations of netilmicin with carbenicillin, azlocillin, mezlocillin, cefamandole, cefotaxime or moxalactam. Aminoglycosides are mostly ineffective against anaerobic bacteria, fungi and viruses.
|
| Protein Binding |
Netilmicin¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Protein-binding of is low and depends on the test conditions (mainly the concentration of cations in the test medium).
|
| Half-life |
Netilmicin¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 2.5 hours
|
| Absorption |
Netilmicin¿¡ ´ëÇÑ Absorption Á¤º¸ Rapidly and completely absorbed after IM administration, peak serum levels were achieved within 30-60 minutes. Aminoglycosides are poorly absorbed from the gastrointestinal tract.
|
| Pharmacokinetics |
Netilmicin SulfateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : ±ÙÀ°ÁÖ»ç : Àß Èí¼öµÈ´Ù.
- ºÐÆ÷ :
- ºÐÆ÷¿ëÀû : 0.16-0.34 L/kg
- Ç÷û, ³ó¾ç, º¹¼ö, º¹¸·¾×, ´É¸·¾×, Ȱ¾×, ¸²ÇÁ¾×, ½É¸·¾×À» Æ÷ÇÔÇÑ ¼¼Æ÷¿Ü¾×À¸·Î ºÐÆ÷
- ¿ä¿¡ °í³óµµ·Î ³óÃà
- ÅÂ¹Ý Åë°ú
- ¹Ý°¨±â : 2-3 ½Ã°£ (³ªÀÌ¿Í ½Å±â´É¿¡ ÀÇÁ¸)
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : ±ÙÀ°ÁÖ»ç : 0.5-1 ½Ã°£ À̳»
- ¼Ò½Ç : ÁÖ·Î »ç±¸Ã¼ ¿©°ú¸¦ ÅëÇØ¼ ½Å¹è¼³
|
| Biotransformation |
Netilmicin¿¡ ´ëÇÑ Biotransformation Á¤º¸ No evidence of metabolic transformation, typically 80% is recoverable in the urine within 24 hours
|
| Toxicity |
Netilmicin¿¡ ´ëÇÑ Toxicity Á¤º¸ Netilmicin has the potential to cause disturbances in balance and a hearing loss.
|
| Drug Interactions |
Netilmicin¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Atracurium The agent increases the effect of muscle relaxantDoxacurium The agent increases the effect of muscle relaxantGallamine Triethiodide The agent increases the effect of muscle relaxantMetocurine The agent increases the effect of muscle relaxantMivacurium The agent increases the effect of muscle relaxantPancuronium The agent increases the effect of muscle relaxantPipecuronium The agent increases the effect of muscle relaxantRocuronium The agent increases the effect of muscle relaxantSuccinylcholine The agent increases the effect of muscle relaxantTubocurarine The agent increases the effect of muscle relaxantVecuronium The agent increases the effect of muscle relaxantThalidomide Thalidomide increases the renal toxicity of the aminoglycosideTorasemide Increased ototoxicityFurosemide Increased ototoxicityEthacrynic acid Increased ototoxicityBumetanide Increased ototoxicityCefamandole Increased risk of nephrotoxicityCefazolin Increased risk of nephrotoxicityCefonicid Increased risk of nephrotoxicityCefoperazone Increased risk of nephrotoxicityCeforanide Increased risk of nephrotoxicityCefotaxime Increased risk of nephrotoxicityCefotetan Increased risk of nephrotoxicityCefoxitin Increased risk of nephrotoxicityCeftazidime Increased risk of nephrotoxicityCeftizoxime Increased risk of nephrotoxicityCeftriaxone Increased risk of nephrotoxicityCefuroxime Increased risk of nephrotoxicityCephalothin Group Increased risk of nephrotoxicityCephapirin Increased risk of nephrotoxicityCisplatin Increased risk of nephrotoxicityCefradine Increased risk of nephrotoxicity
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Netilmicin¿¡ ´ëÇÑ Description Á¤º¸ Semisynthetic 1-N-ethyl derivative of sisomycin, an aminoglycoside antibiotic with action similar to gentamicin, but less ear and kidney toxicity. [PubChem]
|
| Drug Category |
Netilmicin¿¡ ´ëÇÑ Drug_Category Á¤º¸ AminoglycosidesAnti-Bacterial AgentsProtein Synthesis Inhibitors
|
| Smiles String Canonical |
Netilmicin¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CCNC1CC(N)C(OC2OC(CN)=CCC2N)C(O)C1OC1OCC(C)(O)C(NC)C1O
|
| Smiles String Isomeric |
Netilmicin¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CCN[C@@H]1C[C@H](N)[C@@H](O[C@H]2OC(CN)=CC[C@H]2N)[C@@H](O)[C@H]1O[C@H]1OC[C@](C)(O)[C@@H](NC)[C@H]1O
|
| InChI Identifier |
Netilmicin¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C21H41N5O7/c1-4-26-13-7-12(24)16(32-19-11(23)6-5-10(8-22)31-19)14(27)17(13)33-20-15(28)18(25-3)21(2,29)9-30-20/h5,11-20,25-29H,4,6-9,22-24H2,1-3H3/t11-,12+,13-,14-,15-,16-,17+,18+,19-,20-,21+/m1/s1
|
| Chemical IUPAC Name |
Netilmicin¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (2R,3R,4R,5R)-2-[(1S,2S,3R,4S,6R)-4-amino-3-[[(2S,3R)-3-amino-6-(aminomethyl)-3,4-dihydro-2H-pyran-2-yl]oxy]-6-ethylamino-2-hydroxycyclohexyl]oxy-5-methyl-4-methylaminooxane-3,5-diol
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-09-08
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|