 |
| |
|
¼Ö·çÄÚÅ×ÇÁÁÖ250mg SOLU-CORTEF VIAL.[Hydrocortisone sodium succinate]
|
|
Àü¹®ÀǾàǰ | ºñ±Þ¿©
|
|
¼öÀÔÀǾàǰ
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
648900461
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1º´(2018.03.01)(ÇöÀç¾à°¡)
\2,494 ¿ø/1º´(2017.02.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¾Æ·¡ ±¸È¹Àº ¹é»öºÐ¸» À§ ±¸È¹Àº ¹«»öÅõ¸íÇÑ ¿ëÁ¦¸¦ ÇÔÀ¯ÇÑ 2±¸È¹À¸·Î ÀÌ·ç¾îÁø ¹«»öÅõ¸íÇÑ vial [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
1VIAL |
| ÁÖ¼ººÐÄÚµå |
171202BIJ
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
ÀÌ ¾àÀº °æ±¸¿ä¹ýÀÇ È¿°ú°¡ ºÒÈ®½ÇÇϰí, ¶ÇÇÑ ¿ë·®, Á¦Çü ¹× Åõ¿©°æ·Î µîÀ¸·Î º¸¾Æ Ä¡·á¿ëµµ¿¡ ÀûÀýÇÏ´Ù°í °£ÁÖÇÒ °æ¿ì, ¾Æ·¡ÀÇ Áúȯ¿¡ Á¤¸Æ ¶Ç´Â ±ÙÀ°ÁÖ»çÇÑ´Ù.
1. ³»ºÐºñ Àå¾Ö : ¿ø¹ß¼º ¹× ¼Ó¹ß¼º ºÎ½ÅÇÇÁú±â´ÉºÎÀüÁõ(È÷µå·ÎÄÚ¸£Æ¼¼ÕÀ̳ª ÄÚ¸£Æ¼¼ÕÀÌ 1Â÷ ¼±Åà ¾à¹°À̸ç, ÇÊ¿äÇÑ °æ¿ì ±¤ÁúÄÚ¸£Æ¼ÄÚÀ̵å¿Í º´¿ëÇØ¼ ÇÕ¼º ÄÚ¸£Æ¼ÄÚÀ̵带 »ç¿ëÇÒ ¼öµµ ÀÖ°í, ƯÈ÷ ¿µ¾Æ±â¿¡´Â ±¤ÁúÄÚ¸£Æ¼ÄÚÀ̵带 º´¿ëÇÏ´Â °ÍÀÌ Áß¿äÇÏ´Ù), ±Þ¼º ºÎ½ÅÇÇÁú±â´ÉºÎÀüÁõ(È÷µå·ÎÄÚ¸£Æ¼¼ÕÀ̳ª ÄÚ¸£Æ¼¼ÕÀÌ 1Â÷ ¼±Åà ¾à¹°À̸ç, ÇÊ¿äÇÒ °æ¿ì ƯÈ÷ ÇÕ¼º ÄÚ¸£Æ¼ÄÚÀ̵带 »ç¿ëÇÒ °æ¿ì, ±¤ÁúÄÚ¸£Æ¼ÄÚÀ̵åÀÇ º¸ÃæÀÌ ÇÊ¿äÇÒ ¼öµµ ÀÖ´Ù), ¼ö¼ú Àü ¹× ½ÉÇÑ ¿Ü»óÀ̳ª Áúº´½Ã, ºÎ½Å±â´ÉºÎÀüÁõ ȯÀÚ ¶Ç´Â ÄÚ¸£Æ¼ÄÚÀ̵åÀÇ º¸À¯·®ÀÌ Àǽɽº·¯¿î ȯÀÚ, ¼ï(Åë»ó¿ä¹ýÀ¸·Î´Â ¹ÝÀÀÀÌ ¾ø°í, ºÎ½Å±â´É ºÎÀü ¶Ç´Â ¿ì·ÁµÇ´Â °æ¿ì), ¼±Ãµ¼º ºÎ½Å ÀÌ»óÁõ½Ä, ¾Ï¿¡ ¼ö¹ÝµÈ °íÄ®½·Ç÷Áõ, ºñÈ³ó¼º °©»ó¼±¿°
2. ·ù¸¶Æ¼½º¼º Àå¾Ö
±Þ¼ºÁøÇà ¶Ç´Â ¾Çȸ¦ ¹æÁöÇϱâ À§ÇÑ ´Ü±âÅõ¿©¿ë º¸Á¶¿ä¹ýÀ¸·Î¼ ´ÙÀ½ÀÇ Áúȯ : ¿Ü»ó ÈÄ °ñ°üÀý¿°, °ñ°üÀý¿°ÀÇ È°¸·¿°, ¿¬¼Ò¼º ·ù¸¶Æ¼½º¾ç °üÀý¿°À» Æ÷ÇÔÇÏ´Â ·ù¸¶Æ¼½º¾ç °üÀý¿°(°æ¿ì¿¡ µû¶ó¼´Â Àú¿ë·® À¯Áö¿ä¹ýÀÌ ÇÊ¿äÇÒ ¼öµµ ÀÖ´Ù), ±Þ¼º ¹× ¾Æ±Þ¼º Á¡¾×³¶¿°, »ó°ú¿°, ±Þ¼º ºñƯÀ̼º °ÇÃÊ¿°, ±Þ¼º Åëdz¼º °üÀý¿°, °Ç¼±¼º °üÀý¿°, °Á÷¼º ôÃß¿°
3. ±³¿ø¼º Áúȯ
¾ÇÈ Áß¿¡ Àְųª À¯Áö¿ä¹ýÀÌ ÇÊ¿äÇÑ ´ÙÀ½ÀÇ Áúȯ : Àü½Å¼º È«¹Ý¼º ·çǪ½º, Àü½Å¼º ÇǺαٿ°(´Ù¹ß¼º ±Ù¿°), ±Þ¼º ·ù¸¶Æ¼½º¼º ½É¿°
4. ÇǺΠÁúȯ : õÆ÷â, ÁßÁõ ´ÙÇü¼º È«¹Ý(½ºÆ¼ºì½º-Á¸½¼ ÁõÈıº), ¹ÚÅ»¼º ÇǺο°, ¼öÆ÷¼º Æ÷Áø¾ç ÇǺο°, ÁßÁõ Áö·ç¼º ÇǺο°, ÁßÁõ °Ç¼±, ±Õ»ó½ÄÀ°Á¾
5. ¾Ë·¹¸£±â¼º Áúȯ
ÁßÁõ ¶Ç´Â ºÒ´ÉÀ» ÃÊ·¡Çϱ⠽¬¿î ¾Ë·¹¸£±â¼º ÁúȯÀ¸·Î¼ Åë»óÀûÀΠóġ·Î´Â ¹ÝÀÀÀÌ ¾ø´Â ´ÙÀ½ÀÇ Áúȯ : ±â°üÁö õ½Ä, Á¢Ã˼º ÇǺο°, ¾ÆÅäÇǼº ÇǺο°, Ç÷ûº´, °èÀý¼º ¶Ç´Â ´Ù³â¼º ¾Ë·¹¸£±â¼º ºñ¿°, ¾à¹°°ú¹Î¹ÝÀÀ, ¼öÇ÷½ÃÀÇ µÎµå·¯±â¼º ¹ÝÀÀ, ±Þ¼º ºñ°¨¿°¼º ÈĵκÎÁ¾(¿¡Çdz×ÇÁ¸°ÀÌ 1Â÷ ¼±Åþà)
6. ¾È°ú Áúȯ
ÁßÁõ ±Þ¤ý¸¸¼º ¾Ë·¹¸£±â¼º ¶Ç´Â ¿°Áõ¼ºÀÎ ´« ¹× ±× ºÎ¼Ó±â°ü¿¡ °ü·ÃµÇ´Â ´ÙÀ½ÀÇ Áúȯ : ¾È´ë»óÆ÷Áø, ȫä¿° ¹× ȫä¸ð¾çü¿°, ¸Æ¶ô¸Á¸·¿°, ÈĺÎÀÇ »êÀ缺 Æ÷µµ¸·¿° ¹× ¸Æ¶ô¸·¿°, ½Ã½Å°æ¿°, ±³°¨½Å°æ¼º ¾È¿°, Àü¹æÀÇ ¿°Áõ, ¾Ë·¹¸£±â¼º °á¸·¿°, ¾Ë·¹¸£±â¼º °¢¸·ÁÖÀ§ ±Ë¾ç, °¢¸·¿°
7. À§Àå°ü Áúȯ
°áÁ¤Àû À§±â¸¦ ³Ñ±â±â À§ÇÑ ´ÙÀ½ÀÇ Áúȯ : ±Ë¾ç¼º ´ëÀå¿°(Àü½Å¿ä¹ý), ±¹ÇѼº Àå¿°(Àü½Å¿ä¹ý)
8. È£Èí±â°èÁúȯ : ÁõÈļº »ç¸£ÄÚÀ̵åÁõ, º£¸±·ý Áßµ¶Áõ, Àü°Ý¼º ¶Ç´Â ÆÄÁ¾¼º Æó°áÇÙ(ÀûÀýÇÑ Ç×°áÇÙ ÈÇпä¹ýÁ¦¿Í º´¿ëÅõ¿©), ´Ù¸¥ ¹æ¹ýÀ¸·Î ³´Áö ¾Ê´Â ·ÚÇ÷¯ ÁõÈıº, ÈíÀμº Æó¿°
9. Ç÷¾× Áúȯ : ÈÄõ¼º(ÀÚ°¡¸é¿ª¼º) ¿ëÇ÷¼º ºóÇ÷, ¼ºÀÎÀÇ Æ¯¹ß¼º Ç÷¼ÒÆÇ °¨¼Ò¼º ÀÚ¹ÝÁõ(±ÙÀ°ÁÖ»ç´Â ±Ý±âÀ̸ç Á¤¸ÆÁÖ»çÇÑ´Ù), ¼ºÀÎÀÇ ¼Ó¹ß¼º Ç÷¼ÒÆÇ°¨¼ÒÁõ, Àû¾Æ±¸°¨¼ÒÁõ(ÀûÇ÷±¸ ºóÇ÷), ¼±Ãµ¼º ÀûÇ÷±¸Çü¼º ºÎÀü¼º ºóÇ÷
10. Á¾¾ç¼º Áúȯ
´ÙÀ½ÁúȯÀÇ °í½ÄÀû °ü¸® : ¼Ò¾ÆÀÇ ±Þ¼º ¹éÇ÷º´, ¼ºÀÎÀÇ ¹éÇ÷º´ ¹× ¸²ÇÁÁ¾
11. ºÎÁ¾¼º Áúȯ : ¿äµ¶ÁõÀÌ ¾ø´Â Ư¹ß¼º ½ÅÁõÈÄ ¶Ç´Â È«¹Ý¼º ·çǪ½º·Î ÀÎÇÑ ½ÅÁõÈÄ¿¡ ÀÖ¾î¼ ¹è´¢Áõ°¡¿Í À¯µµ ¹× ´Ü¹é´¢ÀÇ ¿ÏÈ
12. ½Å°æ°è Áúȯ : ´Ù¹ß¼º °æÈÁõÀÇ ±Þ¼º ¾ÇÈ
13. ±âŸ : 1) °áÇÙ¼º ¼ö¸·¿°(ÁöÁÖ¸·ÇÏÀÇ Â÷´Ü»óÅ ¶Ç´Â Â÷´ÜÀÌ ¿ì·ÁµÇ´Â °æ¿ì·Î¼, ÀûÀýÇÑ Ç×°áÇÙ ÈÇпä¹ýÁ¦¿Í º´¿ëÅõ¿©), ¼±¸ðÃæÁõ(½Å°æ¼º ¶Ç´Â ½É±Ù¼º ÇÕº´ÁõÀÌ ¼ö¹ÝµÈ °æ¿ì)
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
1. ÀÌ ¾àÀº Á¤¸ÆÁÖ»ç, Á¤¸Æ³»Á¡ÀûÁÖÀÔ ¹× ±ÙÀ°Áֻ簡 ¸ðµÎ °¡´ÉÇϸç, ÀÀ±Þ½Ã¿¡´Â ¿ì¼± Á¤¸ÆÁÖ»çÇÏ´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù. ÀÏ´Ü À§±â¸¦ ³Ñ±â¸é Áö¼ÓÀû È¿°ú¸¦ ¾òÀ» ¼ö ÀÖ´Â ÁÖ»ç ¶Ç´Â °æ±¸¿ä¹ýÀ» °±¸ÇØ¾ß ÇÑ´Ù. ÁßÁõÀÇ ¼ïÀ» Ä¡·áÇÒ °æ¿ì ´Ù·®Åõ¿©(¾à¸®ÇÐÀû ¿ë·®)¸¦ ±ÇÀåÇÏ´Â °æÇâÀÌ ÀÖ´Ù.
2. È£¹Ú»êÈ÷µå·ÎÄÚ¸£Æ¼¼Õ³ªÆ®·ýÀ» óÀ½ ÁÖ»çÇÒ ¶§¿¡´Â ÃÖ¼ÒÇÑ 30ÃÊ(100mg)-10ºÐ(500mg)¿¡ °ÉÃļ Á¤¸Æ³»¿¡ ÁÖ»çÇÑ´Ù. ÀϹÝÀûÀ¸·Î ÄÚ¸£Æ¼ÄÚÀ̵åÀÇ ´Ù·®Åõ¿© ¿ä¹ýÀº ȯÀÚÀÇ »óŰ¡ ¾ÈÁ¤µÉ ¶§(º¸Åë 48-72 ½Ã°£À» ÃʰúÇÏÁö ¾ÊÀ½) ±îÁö¸¸ °è¼ÓÇØ¾ß ÇÑ´Ù.
3. ÄÚ¸£Æ¼ÄÚÀ̵åÀÇ ´Ü½Ã°£¿¡ °ÉÄ£ ´Ù·®Åõ¿©¿ä¹ý°ú °ü·ÃµÈ ºÎÀÛ¿ëÀÌ º¸°íµÈ ¿¹´Â µå¹°Áö¸¸ ¼Òȼº ±Ë¾çÀÌ ÀϾ ¼ö ÀÖÀ¸¹Ç·Î ¿¹¹æÀûÀ¸·Î Á¦»êÁ¦¿ä¹ýÀ» ¾µ ¼ö ÀÖ´Ù.
4. È÷µå·ÎÄÚ¸£Æ¼¼ÕÀÇ ´Ù·®Åõ¿©¿ä¹ýÀÌ 48-72½Ã°£À» ÃʰúÇÏ¿© °è¼ÓµÉ °æ¿ì °í³ªÆ®·ýÇ÷ÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇÑ °æ¿ì¿¡´Â ³ªÆ®·ý Àú·ù°¡ °ÅÀÇ ¾ø°Å³ª ÀüÇô ¾ø´Â È£¹Ú»ê¸ÞÄ¥ÇÁ·¹µå´Ï¼Ö·Ð³ªÆ®·ý°ú °°Àº ÄÚ¸£Æ¼ÄÚÀ̵å·Î ´ëüÇÒ ¼öµµ ÀÖ´Ù.
5. È÷µå·ÎÄÚ¸£Æ¼¼ÕÀÇ Ãʱâ¿ë·®Àº ȯÀÚÀÇ »óÅ¿¡ µû¶ó 100-500mgÀ¸·Î Çϰí, ȯÀÚÀÇ ¹ÝÀÀ ¹× ÀÓ»óÀû »óȲ¿¡ µû¶ó 2, 4, 6½Ã°£ÀÇ °£°ÝÀ» µÎ°í¼ ¹Ýº¹ ÁÖ»çÇÒ ¼ö ÀÖ´Ù.
6. ¼Ò¾Æ¿¡ Åõ¿©ÇÒ °æ¿ì¿¡´Â ¿ë·®À» ÁÙÀÏ ¼ö ÀÖÀ¸³ª, ÀÌ·¯ÇÑ °æ¿ìÀÇ °¨·®Àº ¿¬·ÉÀ̳ª üÁߺ¸´Ù´Â ÁÖ·Î Áõ»óÀÇ Á¤µµ¿Í ȯÀÚÀÇ ¹ÝÀÀ¿¡ µû¶ó Á¶Á¤ÇÏ¿©¾ß Çϸç 1ÀÏ ¿ë·®Àº 25mgÀÌ»óÀÌ µÇµµ·Ï ÇÑ´Ù.
7. ÄÚ¸£Æ¼ÄÚÀÌµå ¿ä¹ý¿¡ µû¸¥ ÁßÁõ½ºÆ®·¹½ºÀÇ ¿°·Á°¡ Àִ ȯÀÚ´Â ºÎ½ÅÇÇÁúÀÌ»ó¿¡ °üÇÑ Áõ»ó ¹× ÁõÈĸ¦ ¸é¹ÐÈ÷ °üÂûÇØ¾ß ÇÑ´Ù.
ÄÚ¸£Æ¼ÄÚÀÌµå ¿ä¹ýÀº ÀÏ»óÀûÀÎ ¿ä¹ýÀÇ º¸Á¶¿ä¹ýÀ̸ç ÀÌ¿Í ´ëüµÉ ¼ö ¾ø´Ù.
|
| ±Ý±â |
1) À¯È¿ÇÑ Ç×±ÕÁ¦°¡ ¾ø´Â °¨¿°Áõ, Àü½Å Áø±Õ °¨¿° ȯÀÚ(¸é¿ª±â´É¾ïÁ¦ÀÛ¿ë¿¡ ÀÇÇØ °¨¿°ÁõÀ» ¾ÇȽÃų ¼ö ÀÖ´Ù)
2) ÀÌ ¾à¿¡ °ú¹ÎÁõ ȯÀÚ
3) ´Ü¼øÆ÷Áø, ´ë»óÆ÷Áø, ¼öµÎ ȯÀÚ
4) °üÀý°³» ¶Ç´Â °ÇÁÖÀ§¿¡ °¨¿°ÁõÀÌ Àִ ȯÀÚ(¸é¿ª±â´É¾ïÁ¦ÀÛ¿ë¿¡ ÀÇÇØ °¨¿°ÁõÀ» ¾ÇȽÃų ¼ö ÀÖ´Ù)
5) °üÀý°³»°¡ ºÒ¾ÈÁ¤ÇÑ È¯ÀÚ
6) »ý¹é½Å Åõ¿© ȯÀÚ
7) ½Å»ý¾Æ, ¹Ì¼÷¾Æ(º¥Áú¾ËÄÚ¿ÃÀ» ÇÔÀ¯Çϰí ÀÖ´Â Á¦Á¦¿¡ ÇÑÇÑ´Ù.)
8) ´ÙÀ½ Åõ¿©°æ·Î·Î Åõ¿©ÇÏÁö ¸» °Í : °æ¸· ¿Ü Åõ¿©(¡®4. ÀÌ»ó¹ÝÀÀ¡¯ Ç× ÂüÁ¶) |
| ½ÅÁßÅõ¿© |
1) Åõ¿©ÇÏÁö ¾Ê´Â °ÍÀ» ¿øÄ¢À¸·Î ÇÏÁö¸¸ ´ÙÀ½ ȯÀÚ¿¡´Â ƯÈ÷ ÇÊ¿äÇÑ °æ¿ì¿¡ ÇÑÇÏ¿© ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
(1) ¼Òȼº ±Ë¾ç ȯÀÚ(¼ÒȰüº¸È£ÀÛ¿ëÀ» °¨¾à½Ã۰í, Á¶Á÷ÀÇ ¼öº¹À» ¹æÇØÇϹǷΠÁõ»óÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù)
(2) Á¤½Åº´ ȯÀÚ(´ë³úÀý¿¬°èÀÇ ½Å°æÀü´Þ¹°Áú¿¡ ¿µÇâÀ» ÁÖ¾î Áõ»óÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù)
(3) ÁßÁõ °ñ´Ù°øÁõ ȯÀÚ(°ñÇü¼º¾ïÁ¦ÀÛ¿ë µî¿¡ ÀÇÇØ °ñ´Ù°øÁõÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù)
(4) ³ì³»Àå ȯÀÚ(¾È¾ÐÀÌ »ó½ÂÇÏ¿© ³ì³»ÀåÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù)
(5) °Ô½Ç¿° ȯÀÚ
(6) °áÇÙ¼º Áúȯ ȯÀÚ(¸é¿ª±â´É¾ïÁ¦ÀÛ¿ë¿¡ ÀÇÇØ Áõ»óÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù)
(7) ´Ü¼øÆ÷Áø¼º °¢¸·¿° ȯÀÚ(°¢¸·Ãµ°øÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù)
(8) Èij¶ÇÏ ¹é³»Àå ȯÀÚ
(9) °íÇ÷¾Ð ȯÀÚ(³ªÆ®·ý Àú·ù¿¡ ÀÇÇØ Áõ»óÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù)
(10) ÀüÇØÁú ÀÌ»ó ȯÀÚ(ÀüÇØÁú´ë»ç¿¡ ¿µÇâÀ» ÁÖ¾î Áõ»óÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù)
(11) Ç÷ÀüÁõ ȯÀÚ(Ç÷¾×ÀÀ°í ÃËÁøÀÛ¿ë¿¡ ÀÇÇØ Áõ»óÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù). ÄÚ¸£Æ¼ÄÚÀ̵å´Â Á¤¸Æ Ç÷Àü»öÀüÁõÀ» Æ÷ÇÔÇÑ Ç÷ÀüÁõÀ» ¹ß»ý½ÃŰ´Â °ÍÀ¸·Î º¸°íµÇ¾ú´Ù. µû¶ó¼, ÄÚ¸£Æ¼ÄÚÀ̵å´Â Ç÷Àü»öÀü¼º Àå¾Ö°¡ Àְųª, Ãë¾àÇÑ È¯ÀÚ¿¡°Ô ÁÖÀÇÇÏ¿© »ç¿ëÇØ¾ß ÇÑ´Ù.
(12) ÃÖ±Ù Àå¹®ÇÕ¼úÀ» ¹ÞÀº ȯÀÚ(â»óÄ¡À¯°¡ ¹æÇعÞÀ» ¼ö ÀÖ´Ù)
(13) ±Þ¼º ½É±Ù°æ»öÀÇ º´·ÂÀÌ Àִ ȯÀÚ(½ÉÆÄ¿À» ÀÏÀ¸Ä×´Ù´Â º¸°í°¡ ÀÖ´Ù)
(14) ¾È°ú Åõ¿©½Ã ¹ÙÀÌ·¯½º¼º °á¸·¡¤°¢¸· Áúȯ, °áÇÙ¼º¡¤Áø±Õ¼º¡¤±Þ¼º È³ó¼º ¾ÈÁúȯ ȯÀÚ(¸é¿ª ±â´É ¾ïÁ¦ÀÛ¿ë¿¡ ÀÇÇØ °¨¿°ÁõÀÌ ¾Ç鵃 ¼ö ÀÖ°í, °¢¸· õ°øÀÌ ÀϾ ¼ö ÀÖ´Ù)
2) °¨¿°Áõ ȯÀÚ(¸é¿ª±â´É¾ïÁ¦ÀÛ¿ë¿¡ ÀÇÇØ Áõ»óÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù)
3) ´ç´¢º´ ȯÀÚ(´ç½Å»ýÀÛ¿ë¿¡ ÀÇÇØ Ç÷´çÄ¡°¡ »ó½ÂÇÏ¿© ´ç´¢º´ÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù)
4) °ñ´Ù°øÁõ ȯÀÚ(°ñÇü¼º¾ïÁ¦ÀÛ¿ë µî¿¡ ÀÇÇØ °ñ´Ù°øÁõÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù)
5) ½ÅºÎÀü, ¿ïÇ÷¼º ½ÉºÎÀü ȯÀÚ(³ªÆ®·ý Àú·ù¿¡ ÀÇÇØ Áõ»óÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù)
6) °©»ó¼±±â´ÉÀúÇÏÁõ, °æº¯Áõ ȯÀÚ(ÄÚ¸£Æ¼ÄÚÀ̵å È¿°ú°¡ Ç×ÁøµÉ ¼ö ÀÖ´Ù)
7) Áö¹æ°£, Áö¹æ»öÀüÁõ ȯÀÚ(ÁöÁú´ë»ç¿¡ ¿µÇâÀ» ÁÖ¾î Áõ»óÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù)
8) ÁßÁõ ±Ù¹«·ÂÁõ ȯÀÚ(»ç¿ëÃʱâ ÀϽÃÀûÀ¸·Î Áõ»óÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù)
9) ºñƯÀ̼º ±Ë¾ç¼º ´ëÀå¿°(õ°ø, ³ó¾ç ¶Ç´Â ±âŸ È³ó¼º °¨¿°ÁõÀÌ À¯¹ßµÉ ¼ö ÀÖ´Â) ȯÀÚ
10) Ç÷Àü¼º Á¤¸Æ¿° ¼ÒÀÎÀÌ Àִ ȯÀÚ
11) °ñ´Ù°øÁõ, °íÇ÷¾Ð, ¿ïÇ÷¼º ½ÉºÎÀü, ½É°¢ÇÑ °¨Á¤ÀÌ»ó, ´ç´¢º´, °áÇÙ, ³ì³»Àå, °£Àå¾Ö, ³úÀüÁõ, ¼Òȼº ±Ë¾ç, ÄÚ¸£Æ¼ÄÚÀ̵å·Î ÀÎÇÑ ±Ùº´ÁõÀÇ º´·ÂÀÌ Àִ ȯÀÚ(º´ÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù)
12) ¼Ò¾Æ ¹× °í·ÉÀÚ
13) °£Àå¾Ö ȯÀÚ (È÷µå·ÎÄÚ¸£Æ¼¼ÕÀÇ ´ë»ç¿Í ¹è¼³ÀÌ ±Þ°ÝÈ÷ °¨¼ÒµÇ¾î ¾àÈ¿°¡ Áõ°¡µÉ ¼ö ÀÖ´Ù.) |
| ÀÌ»ó¹ÝÀÀ |
1) ´ÙÀ½ Áõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÃæºÐÈ÷ °üÂûÇϰí, ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³ª´Â °æ¿ì¿¡´Â ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù.
| ±â°ü°è ºÐ·ù |
ºóµµ´Â ¾Ë·ÁÁöÁö ¾ÊÀ½ (±âÁ¸ÀÇ ÀÚ·á·Î Æò°¡ÇÒ ¼ö ¾øÀ½) |
| °¨¿° ¹× °¨¿°Áõ |
°¨¿°ÀÇ ÀºÆó; ±âȸ°¨¿°(¾î¶² º´¿øÃ¼À̵ç, ¾î´À ½Åü À§Ä¡À̵ç, °æÁõ¿¡¼ Ä¡¸íÀû±îÁö) °¨¿°(°áÇÙÀÇ ÀçȰ¼ºÈ¸¦ Æ÷ÇÔÇÏ¿© Ȱ¼ºÈµÊ) |
| ¾ç¼º ¹× ¾Ç¼º, ºÒƯÁ¤ Á¾¾ç (³¶Á¾ ¹× Æú¸³ Æ÷ÇÔ) |
Ä«Æ÷½ÃÀ°Á¾(ÄÚ¸£Æ¼ÄÚÀÌµå ¿ä¹ýÀ» ¹Þ°í Àִ ȯÀÚ¿¡¼ ¹ß»ý) |
| Ç÷¾× ¹× ¸²ÇÁ°è |
¹éÇ÷±¸ Áõ°¡ |
| ¸é¿ª°è |
°ú¹ÎÁõ(¾Æ³ªÇʶô½Ã½º ¹× À¯»ç ¾Æ³ªÇʶô½Ã½º ¹ÝÀÀ[¿¹: ±â°üÁö °æ·Ã, ÈĵκÎÁ¾, µÎµå·¯±â]) ÇǺΰ˻翡 ´ëÇÑ ¹ÝÀÀ ¾ïÁ¦ |
| ³»ºÐºñ°è |
Äí½Ì¾ç»óÅÂ(Cushingoid) ³úÇϼöü ºÎ½ÅÃà¾ïÁ¦ ¼Ó¹ß¼º ºÎ½Å±â´ÉºÎÀü(ƯÈ÷ ¿Ü»ó, ¼ö¼ú, Áúº´ µîÀÇ ½ºÆ®·¹½º½Ã) |
| ´ë»ç ¹× ¿µ¾ç |
³ªÆ®·ýÀú·ù, ü¾×Àú·ù, ÀúÄ®·ýÇ÷¼º ¾ËÄ®¸®Áõ, ³»´ç´É Àå¾Ö |
| Á¤½Å°è |
Á¤½Åº´/Á¤½Åº´Àû ¼Ò°ß(´ÙÇà°¨, ºÒ¸é, °¨Á¤¿äµ¿, Àΰݺ¯È, ¿ì¿ïÁõ, Á¤½ÅºÐ¿ÁõÀÇ ¾ÇÈ, ±âÁ¸ °¨Á¤Àû ºÒ¾ÈÁ¤ ¶Ç´Â Á¤½Åº´Àû ÇൿÀÇ ¾ÇÈ), ¾îÁö·¯¿ò, µÎÅë |
| ½Å°æ°è |
µÎ°³³»¾Ð Áõ°¡, ¾ç¼º µÎ°³°³» °íÇ÷¾Ð, °æ·Ã, °æ¸·¿Ü Áö¹æÁ¾Áõ |
| ´« |
¿¬¿ë¿¡ ÀÇÇÑ ¾È¾ÐÇ×Áø, ³ì³»Àå, Èij¶ÇÏ ¹é³»Àå, °õÆÎÀ̳ª ¹ÙÀÌ·¯½º¿¡ ÀÇÇÑ ´«ÀÇ 2Â÷ °¨¿°À» ÃÊ·¡ÇÒ ¼ö ÀÖÀ¸¹Ç·Î Á¤±âÀûÀÎ °Ë»ç ¹Ù¶÷Á÷ÇÔ Áß½ÉÀå¾× ¸Æ¶ô¸Á¸·º´Áõ µî¿¡ ÀÇÇØ ¸Á¸·Àå¾Ö, ¾È±¸µ¹Ãâ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ½ ½Ã¾ßÈ帲ÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ½ |
| ½ÉÀå |
¿ïÇ÷¼º½ÉºÎÀü(°¨¼ö¼º ȯÀÚ¿¡ ÇØ´ç) Á¶»ê¾ÆÀÇ ºñ´ë¼º ½É±Ùº´Áõ |
| Ç÷°ü |
Ç÷Àü»öÀüÁõ, °íÇ÷¾Ð |
| È£Èí±â, ÈäºÎ ¹× Á¾°Ý |
Æó»öÀüÁõ, °¡»ÛÈ£Èí Áõ»ó |
| À§Àå°ü°è |
¼Òȼº ±Ë¾ç(õ°ø ¹× ÃâÇ÷ÀÇ °¡´É¼ºÀÌ ÀÖ´Â), À§ÃâÇ÷, ÃéÀå¿°, º¹ºÎÆØ¸¸°¨, ¼ÒȺҷ®, ±¸¿ª, ½ÄµµÄµð´Ù, ½Äµµ¿°, Àåõ°ø |
| ÇǺΠ¹× ÇÇÇÏÁ¶Á÷ |
Á¡»óÃâÇ÷, ¹Ý»óÃâÇ÷, ¾È¸é È«¹Ý, ¹ßÇÑ Áõ°¡, ÇǺÎÀ§ÃàÁõ, ¸ð¼¼Ç÷°üÈ®Àå, ¿©µå¸§, Ÿ¹Ú»ó |
| ±Ù°ñ°Ý°è, °áÇÕÁ¶Á÷ ¹× »À |
±ÙÀ°º´Áõ, ±Ù·Â¾àÈ, ±ÙÀ°½ÇÁúÀÇ ¼Õ½Ç, »À±«»ç, °ñ´Ù°øÁõ, º´¸®ÇÐÀû °ñÀý, ¼ºÀåÁö¿¬ |
| »ý½Ä±â°è ¹× À¯¹æ |
¿ù°æºÒ¼ø, ¹«¿ù°æ |
| Àü½Å ÀÌ»ó ¹× Åõ¿© ºÎÀ§ |
Ä¡À¯Àå¾Ö |
| °Ë»ç |
¾È¾Ð»ó½Â ź¼öȹ°³»¼º°¨¼Ò Àν¶¸°(¶Ç´Â ´ç´¢º´È¯ÀÚ¿¡¼ °æ±¸ Ç÷´ç°ÇÏÁ¦) ¿ä±¸·® Áõ°¡ Ç÷ÁßÄ®·ý°¨¼Ò Áú¼ÒÆòÇüÀ½¼º(´Ü¹éºÐÇØ´ë»ç·Î ÀÎÇÑ) ´¢ÁßÄ®½·Áõ°¡, ¾Ë¶ó´Ñ¾Æ¹Ì³ëÀü´ÞÈ¿¼Ò Áõ°¡ ¾Æ½ºÆÄ¸£Å×ÀÌÆ®¾Æ¹Ì³ëÀü´ÞÈ¿¼Ò Áõ°¡ Ç÷Áß ¾ËÄ«¸®ÀλêºÐÇØÈ¿¼Ò Áõ°¡ üÁß Áõ°¡ |
| ¼Õ»ó, Áßµ¶ ¹× ½Ã¼ú ÈÄ ÇÕº´Áõ |
ô¼ö¾Ð¹Ú°ñÀý, °ÇÆÄ¿(ƯÈ÷ ¾ÆÅ³·¹½º°Ç) |
| ±âŸ |
±Çۨ |
2) ºñ°æ±¸Àû ÄÚ¸£Æ¼ÄÚÀÌµå ¿ä¹ý°ú °ü·ÃÇÏ¿© ´ÙÀ½ÀÇ ºÎÀÛ¿ëÀÌ º¸°íµÈ ¹Ù ÀÖ´Ù : »ö¼Ò °ú´ÙÄ§Âø ¶Ç´Â »ö¼Ò °ú¼ÒÄ§Âø, ÇÇÇÏ ¹× ÁøÇÇÀÇ À§ÃàÇö»ó, ¹«±Õ¼º ³ó¾ç
3) ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀÌµå °æ¸· ¿Ü Åõ¿©¿¡ ÀÇÇØ ô¼ö°æ»ö, ÇϹݽŸ¶ºñ, »çÁö¸¶ºñ, °ÑÁú½Ã°¢»ó½Ç ¹× ³úÁ¹Áß(³ú°£ Æ÷ÇÔ) µîÀÌ º¸°íµÇ¾ú´Ù.
|
| »óÈ£ÀÛ¿ë |
1) ´ÙÇü¼º ½É½Çºó¸ÆÀ» ÀÏÀ¸Å³¼ö ÀÖ´Â ¾à(¾Æ½ºÅ×¹ÌÁ¹, º£ÇÁ¸®µô, ¿¡¸®½º·Î¸¶À̽ŠIV, ÇÒ·ÎÆÇÆ®¸°, ÆæÅ¸¹Ìµò, ½ºÆÄ¸£Ç÷ϻç½Å, ºóÄ«¹Î, ¼³ÅäÇÁ¸®µå)°ú º´¿ëÅõ¿©ÇÏÁö ¾Ê´Â´Ù.
2) ´ÙÇü¼º ½É½Çºó¸ÆÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Â Ç׺ÎÁ¤¸Æ¾à(¾Æ¹Ì¿À´Ù·Ð, µð¼ÒÇǶó¹Ìµå, Äû´Ïµò, ¼ÒÅ»¿Ã)Àº ¼¸Æ, QT °£°Ý ¿¬Àå, ÀúÄ®·ýÇ÷Áõ µîÀº ºÎÁ¤¸ÆÀ» ÀÏÀ¸Å°´Â ¿øÀÎÀÌ µÇ¹Ç·Î ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù. ½É½Çºó¸ÆÀÌ ³ªÅ¸³ª¸é Ç׺ÎÁ¤¸Æ¾à Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
3) ¹Ù¸£ºñÅ»°è ¾à¹°(Æä³ë¹Ù¸£ºñÅ»),Æä´ÏÅäÀÎ, ¸®ÆÊÇǽÅ, Ä«¸£¹Ù¸¶Á¦ÇÉ, ÇÁ¸®¹Ìµ·, ¾Æ¹Ì³ë±Û·çÅ×Ä¡´Ïµå, ¸®ÆÄºÎƾ°ú º´¿ëÅõ¿©¿¡ ÀÇÇØ ÀÌ ¾àÀÇ ÀÛ¿ëÀÌ °¨¼ÒµÉ ¼ö ÀÖÀ¸¹Ç·Î º´¿ëÅõ¿©½Ã ¿ë·®¿¡ ÁÖÀÇÇÑ´Ù.
4) ¿¡¸®½º·Î¸¶À̽Å, Æ®·Ñ·¹¾Èµµ¸¶À̽Å, ÄÉÅäÄÚ³ªÁ¹°ú °°Àº ¾à¹°Àº ÄÚ¸£Æ¼ÄÚÀ̵åÀÇ ´ë»ç¸¦ ¾ïÁ¦ÇÏ¿© û¼ÒÀ²À» °¨¼Ò½ÃŲ´Ù.
5) °æ±¸¿ë Ç×ÀÀ°íÁ¦¿¡ ´ëÇÑ ÄÚ¸£Æ¼ÄÚÀ̵åÀÇ ÀÛ¿ëÀº ÀÏÁ¤ÇÏÁö ¾Ê´Ù. ÄÚ¸£Æ¼ÄÚÀ̵å¿Í Ç×ÀÀ°íÁ¦¸¦ º´¿ëÇÏ¿´À» ¶§ Ç×ÀÀ°íÁ¦ÀÇ ÀÛ¿ëÀÌ Áõ°¡µÇ¾ú´Ù´Â º¸°í¿Í °¨¼ÒµÇ¾ú´Ù´Â º¸°í°¡ ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù.
6) °æ±¸¿ë Ç÷´ç°ÇÏÁ¦(ÅçºÎŸ¹Ìµå, Ŭ·Î¸£ÇÁ·ÎÆÄ¹Ìµå)¿Í º´¿ëÅõ¿©½Ã ÀÌ ¾àÀÇ ÀÛ¿ëÀ» °¨¾à½ÃŰ´Â °ÍÀÌ º¸°íµÇ¾úÀ¸¹Ç·Î, ¿ë·®À» Á¶ÀýÇÏ´Â µî ÁÖÀÇÇÑ´Ù(ÀÌ ¾àÀº °£Àå¿¡¼ÀÇ ´ç»ýÇÕ¼ºÀ» ÃËÁøÇÏ°í ¸»ÃÊ¿¡¼ÀÇ ´çÀÌ¿ëÀ» ¾ïÁ¦ÇÑ´Ù).
7) ÀÌ´¢Á¦(Ä®·ýº¸Á¸¼º ÀÌ´¢Á¦´Â Á¦¿Ü), ¾ÏÆ÷Å׸®½Å B, Ä«¸£º£³ëÁ¹·Ð, ¿ÏÈÁ¦¿Í º´¿ë¿¡ ÀÇÇØ ÀúÄ®·ýÇ÷ÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î, ÀÚÁÖ Ç÷Áß Ä®·ý³óµµ¸¦ °Ë»çÇÏ°í º´¿ëÅõ¿©½Ã ¿ë·®¿¡ ÁÖÀÇÇÑ´Ù.
8) ÄÚ¸£Æ¼ÄÚ½ºÅ×·ÎÀ̵å´Â Àü½Å Áø±Õ °¨¿°À» ¾ÇȽÃų ¼ö ÀÖÀ¸¹Ç·Î ¾ÏÆ÷Å׸®½Å B Ä¡·á ÈÄ »ý¸íÀ» À§ÇùÇÏ´Â ÀÌ»ó ¹ÝÀÀÀ» Á¶ÀýÇϱâ À§ÇØ ÀÀ±Þ »óȲ¿¡¼¸¸ Åõ¿©ÇØ¾ß ÇÑ´Ù. ¾ÏÆ÷Å׸®½Å B¿Í ÇÏÀ̵å·ÎÄÚ¸£Æ¼¼ÕÀ» µ¿½Ã¿¡ Åõ¿©ÇÏ¸é ½ÉÀå ºñ´ë ¹× ¿ïÇ÷¼º ½ÉºÎÀüÀÌ ¹ß»ýÇÑ »ç·Êµµ ¾Ë·ÁÁ® ÀÖ´Ù.
9) µð±âÅ»¸®½º ¹è´çü¿Í º´¿ëÅõ¿©½Ã ºÎÁ¤¸Æ, ÀúÄ®·ýÇ÷Áõ°ú °ü·ÃµÈ µ¶¼ºÀÌ Áõ°¡ÇÒ ¼ö ÀÖÀ¸¹Ç·Î Ç÷Áß Ä®·ý³óµµ¸¦ °Ë»çÇÏ°í °æ¿ì¿¡ µû¶ó¼´Â ½ÉÀüµµ °Ë»ç¸¦ ½Ç½ÃÇÑ´Ù.
10) À̼ҴϾÆÁöµå¿Í º´¿ëÅõ¿©½Ã À̼ҴϾÆÁöµåÀÇ Ç÷Áß³óµµ°¡ °¨¼ÒÇϹǷΠ¿ë·®Á¶ÀýÀÌ ÇÊ¿äÇÏ´Ù.
11) Ç÷¾Ð°ÇÏÁ¦¿Í º´¿ëÅõ¿©½Ã Ç÷¾Ð°ÇÏÈ¿°ú¸¦ °¨¼Ò½Ãų ¼ö ÀÖ´Ù(³ªÆ®·ý Áõ°¡·Î ¼öºÐ Àú·ù À§ÇèÀÌ ÀÖ´Ù).
12) ¾ËÆÄ ÀÎÅÍÆä·Ð°ú º´¿ëÅõ¿©½Ã ÀÎÅÍÆä·ÐÀÇ È°¼ºÀ» ¾ïÁ¦ÇÒ ¼ö ÀÖ´Ù.
13) ½ºÅ×·ÎÀ̵å´Â ÁßÁõ ±Ù¹«·ÂÁõ¿¡ Ç×Äݸ°¿¡½ºÅ×¶óÁ¦ÀÇ È¿°ú¸¦ °¨¼Ò½ÃŲ´Ù.
14) ºñ½ºÅ×·ÎÀ̵强 ¼Ò¿°Á¦¿Í º´¿ëÅõ¿©½Ã À§Àå°ü ±Ë¾çÀÇ À§ÇèÀ» Áõ°¡½Ãų ¼ö ÀÖÀ¸¸ç, ¾Æ½ºÇǸ°°ú º´¿ëÅõ¿©½Ã ¾Æ½ºÇǸ°ÀÇ ½Åû¼ÒÀ²À» Áõ°¡½ÃÄÑ »ì¸®½Ç»ê¿°ÀÇ Ç÷Á߳󵵸¦ °¨¼Ò½ÃŰ°Å³ª ÀÌ ¾àÀ» Áß´ÜÇßÀ» ¶§ »ì¸®½Ç»ê¿°ÀÇ µ¶¼ºÀ» Áõ°¡½Ãų ¼ö ÀÖÀ¸¹Ç·Î ¿ë·®¿¡ ÁÖÀÇÇÑ´Ù. ƯÈ÷ ÀúÇÁ·ÎÆ®·ÒºóÇ÷Áõ ȯÀÚ¿¡¼ ÀÌ ¾à°ú ¾Æ½ºÇǸ°À» º´¿ëÅõ¿©½Ã ÁÖÀÇÇÑ´Ù.
15) ºñÅ»ºÐ±Ø¼º ±ÙÀÌ¿ÏÁ¦(ºê·ÒÈÆÇÅ©·Î´Ï¿ò µî)¿Í º´¿ë¿¡ ÀÇÇØ ±ÙÀ̿ϻóŰ¡ ¿¬ÀåµÉ ¼ö ÀÖ´Ù.
16) Ŭ·Î·ÎÄý, È÷µå·Ï½ÃŬ·Î·ÎÄý°úÀÇ º´¿ë¿¡ ÀÇÇØ ±Ùº´Áõ, ½É±ÙÁõ ¹ß»ýÀ§ÇèÀÌ Áõ°¡ÇÒ ¼ö ÀÖ´Ù. |
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Dµî±Þ
(ÀӽŠ1±â Åõ¿©½Ã )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Hydrocortisone¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Hydrocortisone binds to the cytosolic glucocorticoid receptor. After binding the receptor the newly formed receptor-ligand complex translocates itself into the cell nucleus, where it binds to many glucocorticoid response elements (GRE) in the promoter region of the target genes. The DNA bound receptor then interacts with basic transcription factors, causing the increase in expression of specific target genes. The anti-inflammatory actions of corticosteroids are thought to involve lipocortins, phospholipase A2 inhibitory proteins which, through inhibition arachidonic acid, control the biosynthesis of prostaglandins and leukotrienes. Specifically glucocorticoids induce lipocortin-1 (annexin-1) synthesis, which then binds to cell membranes preventing the phospholipase A2 from coming into contact with its substrate arachidonic acid. This leads to diminished eicosanoid production. The cyclooxygenase (both COX-1 and COX-2) expression is also suppressed, potentiating the effect. In another words, the two main products in inflammation Prostaglandins and Leukotrienes are inhibited by the action of Glucocorticoids. Glucocorticoids also stimulate the lipocortin-1 escaping to the extracellular space, where it binds to the leukocyte membrane receptors and inhibits various inflammatory events: epithelial adhesion, emigration, chemotaxis, phagocytosis, respiratory burst and the release of various inflammatory mediators (lysosomal enzymes, cytokines, tissue plasminogen activator, chemokines etc.) from neutrophils, macrophages and mastocytes. Additionally the immune system is suppressed by corticosteroids due to a decrease in the function of the lymphatic system, a reduction in immunoglobulin and complement concentrations, the precipitation of lymphocytopenia, and interference with antigen-antibody binding.
|
| Pharmacology |
Hydrocortisone¿¡ ´ëÇÑ Pharmacology Á¤º¸ Hydrocortisone is the most important human glucocorticoid. It is essential for life and regulates or supports a variety of important cardiovascular, metabolic, immunologic and homeostatic functions. Topical hydrocortisone is used for its anti-inflammatory or immunosuppressive properties to treat inflammation due to corticosteroid-responsive dermatoses. Glucocorticoids are a class of steroid hormones characterised by an ability to bind with the cortisol receptor and trigger a variety of important cardiovascular, metabolic, immunologic and homeostatic effects. Glucocorticoids are distinguished from mineralocorticoids and sex steroids by having different receptors, target cells, and effects. Technically, the term corticosteroid refers to both glucocorticoids and mineralocorticoids, but is often used as a synonym for glucocorticoid. Glucocorticoids suppress cell-mediated immunity. They act by inhibiting genes that code for the cytokines IL-1, IL-2, IL-3, IL-4, IL-5, IL-6, IL-8 and TNF-alpha, the most important of which is the IL-2. Reduced cytokine production limits T cell proliferation. Glucocorticoids also suppress humoral immunity, causing B cells to express lower amounts of IL-2 and IL-2 receptors. This diminishes both B cell clonal expansion and antibody synthesis. The diminished amounts of IL-2 also leads to fewer T lymphocyte cells being activated.
|
| Metabolism |
Hydrocortisone¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 3A4 (CYP3A4)
|
| Protein Binding |
Hydrocortisone¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 95%
|
| Half-life |
Hydrocortisone¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 6-8 hours
|
| Absorption |
Hydrocortisone¿¡ ´ëÇÑ Absorption Á¤º¸ Topical corticosteroids can be absorbed from normal intact skin. Inflammation and/or other disease processes in the skin increase percutaneous absorption.
|
| Pharmacokinetics |
Hydrocortisone sodium succinateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : Á÷ÀåÀ» Á¦¿ÜÇÑ ¸ðµç Åõ¿©°æ·Î¿¡¼ ºü¸£°Ô Èí¼öµÈ´Ù.
- ´ë»ç : °£¿¡¼ ´ë»çµÈ´Ù.
- »ý¸®Àû ¹Ý°¨±â : 8¡12½Ã°£
- ¼Ò½Ç : ÁÖ·Î 17-hydroxysteroids¿Í 17-ketosteroidsÀÇ ÇüÅ·Π½Å¹è¼³µÈ´Ù.
- ¿ëÇØ¼ºÀÌ Å« ´Ù¸¥ ¾à¹°°ú ºñ±³ÇßÀ» ¶§ hydrocortisone acetate´Â ÀÛ¿ë¹ßÇö½Ã°£Àº ´À¸®Áö¸¸ ÀÛ¿ëÁö¼Ó½Ã°£ÀÌ ±æ´Ù.
- Hydrocortisone sodium succinate´Â ¹°¿¡ ½±°Ô ³ì¾Æ »¡¸® Ȱ¼ºÈµÈ´Ù.
|
| Biotransformation |
Hydrocortisone¿¡ ´ëÇÑ Biotransformation Á¤º¸ Primarily hepatic via CYP3A4
|
| Toxicity |
Hydrocortisone¿¡ ´ëÇÑ Toxicity Á¤º¸ Side effects include inhibition of bone formation, suppression of calcium absorption and delayed wound healing
|
| Drug Interactions |
Hydrocortisone¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Ambenonium The corticosteroid decreases the effect of anticholinesterasesEdrophonium The corticosteroid decreases the effect of anticholinesterasesNeostigmine The corticosteroid decreases the effect of anticholinesterasesPyridostigmine The corticosteroid decreases the effect of anticholinesterasesAspirin The corticosteroid decreases the effect of salicylatesBismuth Subsalicylate The corticosteroid decreases the effect of salicylatesSalicylate-magnesium The corticosteroid decreases the effect of salicylatesSalicylate-sodium The corticosteroid decreases the effect of salicylatesSalsalate The corticosteroid decreases the effect of salicylatesTrisalicylate-choline The corticosteroid decreases the effect of salicylatesWarfarin The corticosteroid alters the anticoagulant effectAcenocoumarol The corticosteroid alters the anticoagulant effectDicumarol The corticosteroid alters the anticoagulant effectAnisindione The corticosteroid alters the anticoagulant effectCholestyramine Cholestyramine decreases the effect of hydrocortisoneColestipol Cholestyramine decreases the effect of hydrocortisoneAmobarbital The barbiturate decreases the effect of the corticosteroidAprobarbital The barbiturate decreases the effect of the corticosteroidButabarbital The barbiturate decreases the effect of the corticosteroidButalbital The barbiturate decreases the effect of the corticosteroidButethal The barbiturate decreases the effect of the corticosteroidDihydroquinidine barbiturate The barbiturate decreases the effect of the corticosteroidHeptabarbital The barbiturate decreases the effect of the corticosteroidHexobarbital The barbiturate decreases the effect of the corticosteroidMethohexital The barbiturate decreases the effect of the corticosteroidMethylphenobarbital The barbiturate decreases the effect of the corticosteroidPentobarbital The barbiturate decreases the effect of the corticosteroidPhenobarbital The barbiturate decreases the effect of the corticosteroidPrimidone The barbiturate decreases the effect of the corticosteroidQuinidine barbiturate The barbiturate decreases the effect of the corticosteroidSecobarbital The barbiturate decreases the effect of the corticosteroidTalbutal The barbiturate decreases the effect of the corticosteroidRifampin The enzyme inducer decreases the effect of the corticosteroidPhenytoin The enzyme inducer decreases the effect of the corticosteroidMephenytoin The enzyme inducer decreases the effect of the corticosteroidFosphenytoin The enzyme inducer decreases the effect of the corticosteroidEthotoin The enzyme inducer decreases the effect of the corticosteroidMidodrine Increased arterial pressure
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Hydrocortisone¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take with food to reduce irritation. Calcium, phosphorous, potassium, Vitamin A, C, D and zinc needs increased with long term use.
|
| Drug Target |
[Drug Target]
|
| Description |
Hydrocortisone¿¡ ´ëÇÑ Description Á¤º¸ The main glucocorticoid secreted by the adrenal cortex. Its synthetic counterpart is used, either as an injection or topically, in the treatment of inflammation, allergy, collagen diseases, asthma, adrenocortical deficiency, shock, and some neoplastic conditions. [PubChem]
|
| Dosage Form |
Hydrocortisone¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Aerosol RectalCream TopicalEnema RectalLiquid TopicalLotion TopicalOintment OphthalmicOintment TopicalPowder, for solution IntramuscularPowder, for solution IntravenousTablet Oral
|
| Drug Category |
Hydrocortisone¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-inflammatory Agents
|
| Smiles String Canonical |
Hydrocortisone¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC12CCC(=O)C=C1CCC1C3CCC(O)(C(=O)CO)C3(C)CC(O)C21
|
| Smiles String Isomeric |
Hydrocortisone¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@]12CCC(=O)C=C1CC[C@H]1[C@@H]3CC[C@](O)(C(=O)CO)[C@@]3(C)C[C@H](O)[C@H]21
|
| InChI Identifier |
Hydrocortisone¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C21H30O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-16,18,22,24,26H,3-8,10-11H2,1-2H3/t14-,15-,16-,18+,19-,20-,21-/m0/s1
|
| Chemical IUPAC Name |
Hydrocortisone¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one
|
| Drug-Induced Toxicity Related Proteins |
HYDROCORTISONE ÀÇ Drug-Induced Toxicity Related ProteinÁ¤º¸ Replated Protein:Interleukin-8 Drug:hydrocortisone Toxicity:inflammation. [¹Ù·Î°¡±â]
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-05-08
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|