| |
|
|
|
|
|
 |
| |
|
º¸±Û¸°Á¤0.3mg(º¸±Û¸®º¸½º) Voglin Tab. 0.3mg
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
625200410
Àú°¡¾à ´ëü Àμ¾Æ¼ºê Áö±Þ ´ë»ó
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1Á¤(2021.11.01)(ÇöÀç¾à°¡)
\134 ¿ø/1Á¤(2021.10.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
Èò»ö-¿¬ÇÑȲ»öÀÇ ¿øÇü Á¤Á¦ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
30Á¤/º´, 300Á¤/º´ |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 0.3¹Ð¸®±×·¥ |
300 Á¤ |
º´ |
8806252004108 |
8806252004122 |
|
| 0.3¹Ð¸®±×·¥ |
30 Á¤ |
º´ |
8806252004108 |
8806252004115 |
|
|
| ÁÖ¼ººÐÄÚµå |
249002ATB
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
´ç´¢º´ÀÇ ½ÄÈÄ °íÇ÷´ç°³¼±(´Ü, ½Ä»ç¿ä¹ý, ¿îµ¿¿ä¹ýÀ» ÇàÇϰí Àִ ȯÀÚ¿¡¼ ÃæºÐÇÑ È¿°ú¸¦ ¾òÀ» ¼ö ¾ø´Â °æ¿ì, ¶Ç´Â ½Ä»ç¿ä¹ý, ¿îµ¿¿ä¹ý¿¡ Ãß°¡ÇÏ¿© °æ±¸Ç÷´ç°ÇÏÁ¦ ¶Ç´Â Àν¶¸° Á¦Á¦¸¦ »ç¿ëÇϰí Àִ ȯÀÚ¿¡¼ ÃæºÐÇÑ È¿°ú¸¦ ¾òÀ» ¼ö ¾ø´Â °æ¿ì¿¡ ÇÑÇÔ.)
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
ȯÀÚ¿¡ µû¶ó¼ È¿°ú¿Í ³»¾à¼ºÀÌ ´Ù¸£¹Ç·Î ¹Ýµå½Ã Àǻ簡 ȯÀÚÀÇ »óȲ¿¡ ¸Â°Ô ¿ë·®À» °áÁ¤ÇÑ´Ù. º¸Åë ´ÙÀ½°ú °°ÀÌ Åõ¿©ÇÑ´Ù.
Åë»ó ¼ºÀÎÀº º¸±Û¸®º¸½º·Î¼ 1ȸ 0.2mgÀ» 1ÀÏ 3ȸ ¸Å ½ÄÀü¿¡ °æ±¸Åõ¿© ÇÑ´Ù. ¶Ç È¿°ú°¡ ºÒÃæºÐÇÑ °æ¿ì¿¡´Â °æ°ú¸¦ ÃæºÐÈ÷ °üÂûÇÏ¸é¼ 1ȸ·®À» 0.3mg±îÁö Áõ·®ÇÒ ¼ö ÀÖ´Ù.
|
| ±Ý±â |
´ÙÀ½ ȯÀÚ¿¡´Â Åõ¿©ÇÏÁö ¸» °Í.
1) ÁßÁõ ÄÉÅæÁõ, ´ç´¢º´¼º È¥¼ö ¶Ç´Â ÀüÈ¥¼ö ȯÀÚ(¼ö¾× ¹× Àν¶¸°À» Åõ¿©ÇÑ´Ù.)
2) ÁßÁõ°¨¿°Áõ, ¼ö¼ú ÀüÈÄ, ÁßÁõ ¿Ü»ó ȯÀÚ(Àν¶¸°À» Åõ¿©ÇÑ´Ù.)
3) ÀÌ ¾àÀÇ ¼ººÐ¿¡ ´ëÇÑ °ú¹Î¹ÝÀÀÀÇ º´·ÂÀÌ Àִ ȯÀÚ
|
| ½ÅÁßÅõ¿© |
´ÙÀ½ ȯÀÚ¿¡°Ô´Â ½ÅÁßÈ÷ Åõ¿©ÇÒ °Í.
1) ¼ÒÈ ¹× Èí¼ö Àå¾Ö¸¦ ¼ö¹ÝÇÑ ¸¸¼º ÀåÁúȯ ȯÀÚ(ȯÀÚÀÇ »óŸ¦ ¾ÇȽÃų ¼ö ÀÖ´Ù.)
2) Àå³»°¡½ºÀÇ ¹ß»ý Áõ°¡¿¡ ÀÇÇØ¼ Áõ»óÀÌ ¾ÇȵǴ ȯÀÚ(°³º¹¼ö¼úÀ̳ª ÀåÆó»öÀÇ º´·Â, ·Î¿¥ÇïµåÁõÈıº, ÁßÁõÀÇ Ç츣´Ï¾Æ, ´ëÀåÀÇ ÇùÂø, ±Ë¾ç µî)
3) ÁßÁßÀÇ °£ ¶Ç´Â ½ÅÀå¾Ö ȯÀÚ(´ë»ç±â´É º¯È·Î Ç÷´çÁ¶Àý »óŰ¡ ¹Ù²ð ¼ö ÀÖ´Ù.)
4) °í·ÉÀÚ
5) ´Ù¸¥ Ç÷´ç°ÇÏÁ¦¸¦ Åõ¿©¹Þ°í Àִ ȯÀÚ(º´¿ë¿¡ ÀÇÇØ ÀúÇ÷´çÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î Àú¿ë·®ºÎÅÍ Åõ¿©¸¦ ½ÃÀÛÇÏ´Â µî ½ÅÁßÇÏ°Ô Åõ¿©ÇÑ´Ù.)
|
| ÀÌ»ó¹ÝÀÀ |
1) Áß´ëÇÑ ÀÌ»ó¹ÝÀÀ
(1) ´Ù¸¥ °æ±¸Ç÷´ç°ÇÏÁ¦¿ÍÀÇ º´¿ë¿¡¼ ÀúÇ÷´ç(0.1~5%¹Ì¸¸)ÀÌ ³ªÅ¸³ª´Â °æ¿ì°¡ ÀÖ´Ù. ¶Ç, ´Ù¸¥ °æ±¸Ç÷´ç°ÇÏÁ¦¸¦ º´¿ëÇÏÁö ¾Ê´Â °æ¿ì¿¡µµ ÀúÇ÷´ç(0.1%¹Ì¸¸)ÀÌ º¸°íµÇ¾î ÀÖ´Ù. º»Á¦´Â ÀÌ´ç·ùÀÇ ¼ÒÈ¡¤Èí¼ö¸¦ Áö¿¬½ÃŰ¹Ç·Î, ÀúÇ÷´ç Áõ»óÀÌ ÀÎÁ¤µÈ °æ¿ì¿¡´Â ¼³ÅÁ(ÀÚ´ç)ÀÌ ¾Æ´Ñ Æ÷µµ´çÀ» Åõ¿©ÇÏ´Â µî ÀûÀýÇÑ Åõ¿©¸¦ ½Ç½ÃÇÑ´Ù.
(2) º¹ºÎÆØ¸¸, ¹æ±Í Áõ°¡(0.1~5%¹Ì¸¸) µîÀÌ ³ªÅ¸³ª, Àå³»°¡½º µîÀÇ Áõ°¡¿¡ ÀÇÇØ, ÀåÆó»ö °°Àº Áõ»ó(0.1%¹Ì¸¸)ÀÌ ³ªÅ¸³ª´Â °æ¿ì°¡ Àֱ⠶§¹®¿¡ ÃæºÐÇÑ °üÂûÀ» ½Ç½ÃÇÏ¿© Áõ»óÀÌ ÀÎÁ¤µÈ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÏ´Â µî ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù.
(3) ±Þ¼º°£¿°, AST, ALTÀÇ »ó½Â µîÀ» µ¿¹ÝÇÏ´Â Áß´ëÇÑ °£±â´É ÀåÇØ, Ȳ´Þ(¸ðµÎ 0.1% ¹Ì¸¸)ÀÌ ³ªÅ¸³ª´Â °æ¿ì°¡ Àֱ⠶§¹®¿¡ ÃæºÐÇÑ °üÂûÀ» ½Ç½ÃÇÏ¿© Áõ»óÀÌ ÀÎÁ¤µÈ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù.
(4) ÁßÁõÀÇ °£°æº¯ ȯÀÚ¿¡ Åõ¿©ÇÑ °æ¿ì, º¯ºñ µîÀ» °è±â·Î °í¾Ï¸ð´Ï¾ÆÇ÷ÁõÀÌ ¾Çȵǰí, ÀǽÄÀåÇØ(ºóµµºÒ¸í)¸¦ µ¿¹ÝÇÏ´Â °æ¿ì°¡ Àֱ⠶§¹®¿¡, ¹èº¯»óȲ µîÀ» ÃæºÐÈ÷ °üÂûÇϰí ÀÌ»óÀÌ ÀÎÁ¤µÈ °æ¿ì¿¡´Â Áï½Ã Åõ¿©¸¦ ÁßÁöÇÏ´Â µîÀÇ Ã³Ä¡¸¦ ÇÑ´Ù.
2) ±âŸ ÀÌ»ó¹ÝÀÀ
| 0.1~5% ¹Ì¸¸
| 0.1% ¹Ì¸¸
| 1) ¼Òȱâ
| ¼³»ç, ¹±Àºº¯, º¹¸í, º¹Åë, º¯ºñ, ½Ä¿åºÎÁø, ±¸¿ª, ±¸Åä, ¼Ó¾²¸², ¼ÒȺҷ®
| ±¸³»¿°, ±¸°¥, ¹Ì°¢ÀÌ»ó, Àå°ü ³¶Æ÷»ó ±âÁ¾Áõ, Àܺ¯°¨, À§¿°
| 2) °ú¹Î¹ÝÀÀÁÖ1)
|
| ¹ßÁø, ¼Ò¾ç, ±¤¼±°ú¹ÎÁõ
| 3) °£Àå
| AST, ALT, LDH, ¥ã-GTP, ALPÀÇ »ó½Â
|
| 4) Á¤½Å½Å°æ°è
|
| µÎÅë, ¾îÁö·¯¿ò, ÈÖû°Å¸², Á¹À½
| 5) Ç÷¾×
| ºóÇ÷
| Ç÷¼ÒÆÇ °¨¼Ò
| 6) ±âŸ
| Àú¸², ¾È¸éµîÀÇ ºÎÁ¾, ´«ÀÌ Ä§Ä§ÇÔ, Ȳö°Å¸², ±Çۨ, ¹«·Â°¨, °íÄ®·ýÇ÷Áõ, Ç÷û¾Æ¹Ð¶óÁ¦ »ó½Â, HDLÄÝ·¹½ºÅ×·Ñ ÀúÇÏ, ¹ßÇÑ, Å»¸ð
|
|
ÁÖ1) ÀÌ·¯ÇÑ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
3) ±¹³» ½ÃÆÇ ÈÄ Á¶»ç°á°ú(Á¶»çÁõ·Ê¼ö : 3,843¸í) ³ªÅ¸³ ÀÌ»ó¹ÝÀÀÀº ´ÙÀ½°ú °°À¸¸ç, ÀÌ ¾à°úÀÇ °ü·Ã ¿©ºÎ´Â È®½ÇÇÏÁö ¾Ê´Ù. : Çú¹Ù´Ã(1¸í)
|
| »óÈ£ÀÛ¿ë |
´ÙÀ½ ¾à¹°Àº Ç÷´çÁ¶Àý ÀÛ¿ë¿¡ ¿µÇâÀ» ÁÙ ¼ö ÀÖÀ¸¹Ç·Î º´¿ëÅõ¿© ½Ã, ÇØ´ç ¾à¹°°úÀÇ »óÈ£ÀÛ¿ëÀ» ÃæºÐÈ÷ °í·ÁÇÑ´Ù.
- Ç÷´ç°ÇÏ ÀÛ¿ëÀ» Áõ°½ÃŰ´Â ¾à¹° : ¥â-Â÷´ÜÁ¦, »ì¸®½Ç»êÁ¦Á¦, MAO ÀúÇØÁ¦, °íÁöÇ÷Áõ Ä¡·á¸¦ À§ÇÑ ÇǺ극ÀÌÆ® Á¦Á¦, ¿ÍÆÄ¸°, Àν¶¸°, ¼³Æù¿ä¼Ò°è, ¼³Æù¾Æ¹Ìµå°è, ºñ±¸¾Æ´Ïµå°è µî
- Ç÷´ç°ÇÏ ÀÛ¿ëÀ» ¾àȽÃŰ´Â ¾à¹° : ¿¡Çdz×ÇÁ¸°, ÄÚ¸£Æ¼ÄÚÀ̵å, °©»ó¼±È£¸£¸ó µî
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Voglibose¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Alpha-glucosidase inhibitors are saccharides that act as competitive inhibitors of enzymes needed to digest carbohydrates: specifically alpha-glucosidase enzymes in the brush border of the small intestines. The membrane-bound intestinal alpha-glucosidases hydrolyze oligosaccharides, trisaccharides, and disaccharides to glucose and other monosaccharides in the small intestine. Acarbose also blocks pancreatic alpha-amylase in addition to inhibiting membrane-bound alpha-glucosidases. Pancreatic alpha-amylase hydrolyzes complex starches to oligosaccharides in the lumen of the small intestine. Inhibition of these enzyme systems reduces the rate of digestion of complex carbohydrates. Less glucose is absorbed because the carbohydrates are not broken down into glucose molecules. In diabetic patients, the short-term effect of these drugs therapies is to decrease current blood glucose levels: the long term effect is a small reduction in hemoglobin-A1c level. (From Drug Therapy in Nursing, 2nd ed)
|
| Pharmacology |
Voglibose¿¡ ´ëÇÑ Pharmacology Á¤º¸ Voglibose, an alpha-glucosidase inhibitor, is a synthetic compound with potent and enduring therapeutic efficacies against disorders of sensory, motor and autonomic nerve systems due to diabetes mellitus. The drug was approved in Japan in 1994 for the treatment of diabetes, and it is under further investigation by Takeda for the treatment of impaired glucose tolerance. Alpha-glucosidase inhibitors are oral anti-diabetic drugs used for diabetes mellitus type 2 that work by preventing the digestion of complex carbohydrates (such as starch). Complex carbohydrates are normally converted into simple sugars (monosaccharides) which can be absorbed through the intestine. Hence, alpha-glucosidase inhibitors reduce the impact of complex carbohydrates on blood sugar.
|
| Absorption |
Voglibose¿¡ ´ëÇÑ Absorption Á¤º¸ Slowly and poorly absorbed
|
| Pharmacokinetics |
VogliboseÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : °ÅÀǾøÀ½, ±×·¯³ª Àü½Å adverse effects(ºÒ·®¹ÝÀÀ) ÀÖÀ½
- ÃÖ°í Ç÷Áß³óµµ µµ´Þ½Ã°£: 1~1.5½Ã°£.
- ´ë»ç : °£´ë»ç °ÅÀǾøÀ½
- ¼Ò½Ç : ½ÅÀå ¹è¼³ °ÅÀǾøÀ½
|
| Biotransformation |
Voglibose¿¡ ´ëÇÑ Biotransformation Á¤º¸ Little metabolism occurs and no metabolites have as yet been identified.
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Voglibose¿¡ ´ëÇÑ Description Á¤º¸ Voglibose (INN and USAN) is an alpha-glucosidase inhibitor used for lowering post-prandial blood glucose levels in people with diabetes mellitus. It is made in India by Ranbaxy Labs and sold under the trade name Volix. [Wikipedia]
|
| Drug Category |
Voglibose¿¡ ´ëÇÑ Drug_Category Á¤º¸ Hypoglycemic Agents
|
| Smiles String Canonical |
Voglibose¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ OCC(CO)NC1CC(O)(CO)C(O)C(O)C1O
|
| Smiles String Isomeric |
Voglibose¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ OCC(CO)N[C@H]1C[C@](O)(CO)[C@@H](O)[C@H](O)[C@H]1O
|
| InChI Identifier |
Voglibose¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C10H21NO7/c12-2-5(3-13)11-6-1-10(18,4-14)9(17)8(16)7(6)15/h5-9,11-18H,1-4H2/t6-,7-,8+,9-,10-/m0/s1
|
| Chemical IUPAC Name |
Voglibose¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (1S,2S,3R,4S,5S)-5-(1,3-dihydroxypropan-2-ylamino)-1-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2024-07-25
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|