 |
| |
|
Á¦ÀÌÆ®·ÑÇöʾ×(¸Þ°Ô½ºÆ®·Ñ¾Æ¼¼Å×ÀÌÆ®)
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
644913630
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1mL(2016.10.01)(ÇöÀç¾à°¡)
\167 ¿ø/1mL(2014.08.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
ºÒÅõ¸íÇÑ ¿ë±â¿¡ µç ¿À·»Áö Çâ°ú ¸ÀÀÌ ÀÖ´Â Èò»ö~Å©¸²»öÀÇ Çöʾ×À¸·Î ÁøÅÁÇÏ¸é ½±°Ô ºÐ»êµÈ´Ù. [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| ÁÖ¼ººÐÄÚµå |
189301ASS
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
¾Ï ¶Ç´Â AIDS ȯÀÚÀÇ ½Ä¿åºÎÁø, ¾Ç¾×Áú ¶Ç´Â ¿øÀκҸíÀÇ ÇöÀúÇÑ Ã¼Áß°¨¼ÒÀÇ Ä¡·á
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¸Þ°Ô½ºÆ®·Ñ¾Æ¼¼Å×ÀÌÆ®·Î¼ 1ÀÏ 800 mg(20 mL)À» Àß Èçµé¾î º¹¿ëÇÑ´Ù.
ÀÓ»ó½ÃÇè¿¡¼ ÀÌ ¾àÀ¸·Î¼ 1ÀÏ 400¢¦800 mg(10¡20 mL) º¹¿ëÀ¸·Î ÀÓ»óÀû È¿°ú¸¦ ³ªÅ¸³»¾ú´Ù.
|
| ±Ý±â |
1) ÀÌ ¾à ¹× ÀÌ ¾àÀÇ ±¸¼º¼ººÐ¿¡ °ú¹Î¹ÝÀÀÀÇ º´·ÂÀÌ Àִ ȯÀÚ
2) ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ¿©¼º
|
| ½ÅÁßÅõ¿© |
1) Ç÷Àü»öÀüÁúȯÀÇ º´·ÂÀÌ Àִ ȯÀÚ
2) ´ç´¢º´ ȯÀÚ(ÀÌ ¾àÀÇ Åõ¿©·Î Àν¶¸°ÀÇÁ¸´ç´¢º´ÀÌ ¾Ç鵃 ¼ö ÀÖ´Ù.)
|
| ÀÌ»ó¹ÝÀÀ |
1) 2°³ÀÇ À¯È¿¼ºÆò°¡ ÀÓ»ó½ÃÇè°ú °³¹æÇ¥Áö½ÃÇè(open label trial) Áß Ä¡·á±ºÀÇ 5%
| |
¹ßÇöÀ²(%) |
| ÀÓ»ó½ÃÇè 1 (n=236) |
ÀÓ»ó½ÃÇè 2 (n=87) |
°³¹æÇ¥Áö ½ÃÇè |
| ÃÊ»ê¸Þ°Ô½ºÆ®·Ñ Åõ¿©·®(mg/ÀÏ) |
À§¾à |
100 |
400 |
800 |
À§¾à |
800 |
1200 |
| ȯÀÚ¼ö |
N=34 |
N=68 |
N=69 |
N=65 |
N=38 |
N=49 |
N=176 |
| ¼³»ç |
15 |
13 |
8 |
15 |
8 |
6 |
10 |
| ¹ß±âºÎÀü |
3 |
4 |
6 |
14 |
0 |
4 |
7 |
| ¹ßÁø |
9 |
9 |
4 |
12 |
3 |
2 |
6 |
| º¹ºÎÆØ¸¸°¨ |
9 |
0 |
1 |
9 |
3 |
10 |
6 |
| °íÇ÷¾Ð |
0 |
0 |
0 |
8 |
0 |
0 |
4 |
| ¹«·ÂÁõ |
3 |
2 |
3 |
6 |
8 |
4 |
5 |
| ºÒ¸éÁõ |
0 |
3 |
4 |
6 |
0 |
0 |
1 |
| ±¸¿ª |
9 |
4 |
0 |
5 |
3 |
4 |
5 |
| ºóÇ÷ |
6 |
3 |
3 |
5 |
0 |
0 |
0 |
| ¹ß¿ |
3 |
6 |
4 |
5 |
3 |
2 |
1 |
| ¼º¿å°¨Åð |
3 |
4 |
0 |
5 |
0 |
2 |
1 |
| ¼ÒȺҷ® |
0 |
0 |
3 |
3 |
5 |
4 |
2 |
| °íÇ÷´çÁõ |
3 |
0 |
6 |
3 |
0 |
0 |
3 |
| µÎÅë |
6 |
10 |
1 |
3 |
3 |
0 |
3 |
| ÅëÁõ |
6 |
0 |
0 |
2 |
5 |
6 |
4 |
| ±¸Åä |
9 |
3 |
0 |
2 |
3 |
6 |
4 |
| Æó·Å |
6 |
2 |
0 |
2 |
3 |
0 |
1 |
| ºó´¢ |
0 |
0 |
1 |
2 |
5 |
2 |
1 |
À̻󿡼 ³ªÅ¸³ ÀÌ»ó¹ÝÀÀÀº ´ÙÀ½ Ç¥¿Í °°´Ù.
2) 2°³ÀÇ À¯È¿¼ºÆò°¡ ÀÓ»ó½ÃÇè Áß 1¢¦3%¿¡¼ ³ªÅ¸³ ÀÌ»ó¹ÝÀÀÀº ´ÙÀ½°ú °°´Ù.
(1) °¨°¢±â°è : ¾à½Ã
(2) ¼Òȱâ°è : º¯ºñ, ±¸°°ÇÁ¶, °£ºñ´ë, Ÿ¾×ºÐºñÁõ°¡, ±¸°Äµð´ÙÁõ
(3) ¼øÈ¯±â°è : ½É±Ùº´Áõ, ½É°èÇ×Áø
(4) È£Èí±â°è : È£Èí°ï¶õ, ±âħ, Àεο°, Æó±â´ÉÀå¾Ö
(5) Ç÷¾×°è : ¹éÇ÷±¸°¨¼ÒÁõ
(6) ºñ´¢±â°è : ´Ü¹é´¢, ¿ä½Ç±Ý, ¿ä·Î°¨¿°, ¿©¼ºÇüÀ¯¹æ
(7) ½Å°æ°è : °¨°¢ÀÌ»ó, È¥¶õ, °æ·Ã, ¿ì¿ï, ½Å°æº´Áõ, °¨°¢ÀúÇÏ, ºñÁ¤»óÀûÀÎ »ý°¢
(8) ÇǺΠ: Å»¸ðÁõ, Ç츣Æä½º, °¡·Á¿ò, ´ë¼öÆ÷¼º ¹ßÁø, ¹ßÇÑ, ÇǺÎÀå¾Ö
(9) ´ë»ç°è : LDH »ó½Â, ºÎÁ¾ ¹× ¸»ÃʺÎÁ¾
(10) Àü½Å : ÈäÅë, º¹Åë, °¨¿°, ĵð´ÙÁõ, À°Á¾
3) ÀÓ»ó½ÃÇè¿¡ Âü°¡ÇÑ 10¸íÀÇ HIV °¨¿° ¿©¼º ȯÀÚ¿¡¼ µ¹¹ßÃâÇ÷ÀÌ º¸°íµÇ¾ú´Ù.
4) ±âŸ : û°¢¼Õ½Ç, ½ÉºÎÀü, Á¤¼º¯È, È«Á¶, Äí½Ì¾ç ¾ó±¼, Á¾¾ç¹ßÀû(°íÄ®½·Ç÷ÁõÀ» µ¿¹ÝÇϰųª µ¿¹ÝÇÏÁö ¾Ê´Â), ¼Õ¸ñ±¼ÁõÈıº, Á¹À½ÀÌ º¸°íµÇ¾ú´Ù.
5) ½ÃÆÇÈÄ Á¶»ç¿¡¼ º¸°íµÈ ÀÌ»ó¹ÝÀÀ
(1) ½ÃÆÇÈÄ Á¶»ç¿¡¼ Ç÷Àü¼ºÁ¤¸Æ¿°À» Æ÷ÇÔÇÏ´Â Ç÷Àü»öÀüÁõ»ó°ú Æó»öÀüÁõ ¹× ´çºÒ³»¼ºÀÌ º¸°íµÇ¾ú´Ù.
(2) ±¹³»¿¡¼ 5³â µ¿¾È 694¸íÀ» ´ë»óÀ¸·Î ½Ç½ÃÇÑ ½ÃÆÇÈÄ Á¶»ç°á°ú Ãß°¡·Î ³ªÅ¸³ ÀÌ»ó¹ÝÀÀ Áß 2°Ç ÀÌ»ó º¸°íµÈ ÀÌ»ó¹ÝÀÀÀº ´ÙÀ½°ú °°À¸¸ç ÀÌ ¾à°úÀÇ Àΰú°ü°è´Â ºÐ¸íÇÏÁö ¾Ê´Ù. : ºÒ¾È, ±¸³»¿°, Á¡¸·¿°, ¾î±úÅëÁõ
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Xµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
ÀÓ»êºÎ ¶Ç´Â ÀӽŰèȹÁß º¹¿ë±ÝÁö |
|
 |
º¯ºñ°¡ »ý±æ¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Megestrol¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Several investigators have reported on the appetite enhancing property of megestrol acetate and its possible use in cachexia. The precise mechanism by which megestrol acetate produces effects in anorexia and cachexia is unknown at the present time. The biochemical mechanism of progestin antitumour activity is not well but may involve interaction with progesterone and glucocorticoid receptors, androgenic properties. Megestrol also has direct cytotoxic effects on breast cancer cells in tissue culture and suppresses luteinising hormone release from the pituitary.
|
| Pharmacology |
Megestrol¿¡ ´ëÇÑ Pharmacology Á¤º¸ Megestrol is a synthetic progestin and has the same physiologic effects as natural progesterone. The precise mechanism of megestrol¡¯s antianorexic and anticachetic effects is unknown. Initially developed as a contraceptive, it was first evaluated in breast cancer treatment in 1967.
|
| Protein Binding |
Megestrol¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Not Available
|
| Half-life |
Megestrol¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 34 hours
|
| Absorption |
Megestrol¿¡ ´ëÇÑ Absorption Á¤º¸ Variable, but well absorbed orally.
|
| Pharmacokinetics |
Megestrol AcetateÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ÀÛ¿ë¹ßÇö½Ã°£ :
Àû¾îµµ 2 °³¿ùÀÌ»óÀÇ Áö¼ÓÀû Ä¡·á ÇÊ¿ä
- Èí¼ö : °æ±¸ : Àß Èí¼ö
- ´ë»ç : °£¿¡¼ free steroids ¹× glucuronide conjugates·Î ´ë»ç
- ÀÛ¿ëÁö¼Ó½Ã°£ :
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : 1-3 ½Ã°£
- ¼Ò½Ç : ½Å¼Ò½Ç : 10 ÀÏÀ̳» 57-78 % ¼Ò½Ç
º¯À¸·ÎÀÇ ¼Ò½Ç : 10ÀÏÀ̳» 8-30 %¼Ò½Ç
|
| Biotransformation |
Megestrol¿¡ ´ëÇÑ Biotransformation Á¤º¸ Primarily hepatic. Megestrol metabolites which were identified in urine constituted 5% to 8% of the dose administered. Respiratory excretion as labeled carbon dioxide and fat storage may have accounted for at least part of the radioactivity not found in urine and feces. No active metabolites have been identified.
|
| Toxicity |
Megestrol¿¡ ´ëÇÑ Toxicity Á¤º¸ No serious unexpected side effects have resulted from studies involving megestrol acetate oral suspension administered in dosages as high as 1200 mg/day.
|
| Drug Interactions |
Megestrol¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Amobarbital The enzyme inducer decreases the effect of hormonesAprobarbital The enzyme inducer decreases the effect of hormonesButabarbital The enzyme inducer decreases the effect of hormonesButalbital The enzyme inducer decreases the effect of hormonesButethal The enzyme inducer decreases the effect of hormonesHeptabarbital The enzyme inducer decreases the effect of hormonesHexobarbital The enzyme inducer decreases the effect of hormonesGriseofulvin The enzyme inducer decreases the effect of hormonesEthotoin The enzyme inducer decreases the effect of hormonesFosphenytoin The enzyme inducer decreases the effect of hormonesPhenytoin The enzyme inducer decreases the effect of hormonesMephenytoin The enzyme inducer decreases the effect of hormonesTalbutal The enzyme inducer decreases the effect of hormonesSecobarbital The enzyme inducer decreases the effect of hormonesPrimidone The enzyme inducer decreases the effect of hormonesPentobarbital The enzyme inducer decreases the effect of hormonesPhenobarbital The enzyme inducer decreases the effect of hormonesMethohexital The enzyme inducer decreases the effect of hormonesMethylphenobarbital The enzyme inducer decreases the effect of hormones
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Megestrol¿¡ ´ëÇÑ Food Interaction Á¤º¸ Take with food.
|
| Drug Target |
[Drug Target]
|
| Description |
Megestrol¿¡ ´ëÇÑ Description Á¤º¸ 17-Hydroxy-6-methylpregna-3,6-diene-3,20-dione. A progestational hormone used most commonly as the acetate ester. As the acetate, it is more potent than progesterone both as a progestagen and as an ovulation inhibitor. It has also been used in the palliative treatment of breast cancer. [PubChem]
|
| Drug Category |
Megestrol¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antineoplastic Agents, HormonalContraceptives, Oral, Synthetic
|
| Smiles String Canonical |
Megestrol¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC(=O)C1(O)CCC2C3C=C(C)C4=CC(=O)CCC4(C)C3CCC12C
|
| Smiles String Isomeric |
Megestrol¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CC(=O)[C@@]1(O)CC[C@H]2[C@@H]3C=C(C)C4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C
|
| InChI Identifier |
Megestrol¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C22H30O3/c1-13-11-16-17(20(3)8-5-15(24)12-19(13)20)6-9-21(4)18(16)7-10-22(21,25)14(2)23/h11-12,16-18,25H,5-10H2,1-4H3/t16-,17+,18+,20-,21+,22+/m1/s1
|
| Chemical IUPAC Name |
Megestrol¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (8R,9S,10R,13S,14S,17R)-17-acetyl-17-hydroxy-6,10,13-trimethyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2022-12-19
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|