|   | 
                  
                       | 
                      | 
                    
                        
                            
                                | 
                                  
                                 | 
                             
                             |  
                            
                                
                                    
                                        
  
    
	  | 
   
  
    
        
          |   | 
          
              
                | 
                    Çí»ì·»Ä°¼¿50mg(¾ËÆ®·¹Å¸¹Î)    
                    
                 | 
               
              
                
                     Àü¹®ÀǾàǰ | »èÁ¦  
                         |  
                    
                    	
                    
                 | 
               
              
                | 
					  
                  
				  
                 | 
               
              
              
              
              
              |   |  
              
                
                    
                        | 
                      ¾Ë¸²:  | 
                      µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. | 
                     
                    | 
               
            
              
                
                   
                   
                   
                   
		   
                 | 
               
              
                | 
                  
                  
                 | 
               
              | 
            | 
         
       
       | 
   
    |  
  
    | 
      
     | 
     
  |                   
                                        | 
                                             | 
                                         
                            
                                
                            
                            
                              
                                                        
                              
                                                
                            
 |   
    | 
      
     | 
 
 |  
    
   
    | 
       
        À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
        ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
        À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
        ·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
       
     | 
   
  
     | 
   
  
  
    
      
  
    
       |  
      
        
          
            
                | Çã°¡Á¤º¸ | 
             
           
         | 
       
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
  
  
  
   
    û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå  »óÇÑ±Ý¾× | 
    
      
      
        
        649805790  
	    
	    
            [º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸] 
          
        
        
        
          
          
            \0 ¿ø/1ĸ½¶(2016.12.01)(ÇöÀç¾à°¡)
            \1,696 ¿ø/1ĸ½¶(2014.02.01)(º¯°æÀü¾à°¡)
        
          
            
	 
  	   
  	   
       
      
       
       
     
      
      
     
      
    
    
    
      
     [»óº´ÄÚµåÁ¶È¸]
      
      [Áúº´ÄÚµåÁ¶È¸]
     
     | 
   
   
    | ºü¸¥Á¶È¸ | 
    
      
     |   
   
  
  
  
   
    | Á¦Ç°¼º»ó | 
    ¹é»öºÐ¸»À» ÇÔÀ¯ÇÏ´Â ¹é»ö°æÁúݼ¿  [Á¦ÇüÁ¤º¸ È®ÀÎ] |   
   
  
  
  
  
  
  
  
   
    | Æ÷À塤ÄÚµå´ÜÀ§ | 
    
        
        
            | ¾àǰ±Ô°Ý | 
            ´ÜÀ§ | 
            Æ÷ÀåÇüÅ | 
            ´ëÇ¥ÄÚµå | 
            Ç¥ÁØÄÚµå | 
            ºñ°í | 
	     
        
        
            | 50¹Ð¸®±×·¥ | 
            100 ĸ½¶ | 
            º´ | 
            8806498057906 | 
            8806498057913 | 
             | 
	     
        
         
     | 
   
      
  
  	
   
    | ÁÖ¼ººÐÄÚµå | 
    
      358301ACH  
      
	  [µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
     | 
   
  
  
  
 
  
  
    
  
  
  
  
  
  
  
  
  
  
 
  
  
  
 
  
  
  
  
  
  
   
    | Çã°¡»çÇ× ¿ø¹®Á¶È¸ | 
    
      
	    [Çã°¡»çÇ× ¿ø¹®Á¶È¸] 
     | 
   
  
  
  
  
     
  
  
  
   
    | È¿´ÉÈ¿°ú | 
    
    [ÀûÀÀÁõ º° °Ë»ö] 
      
    
     
	 
      ½Ã½ºÇÃ¶óÆ¾ ¹×/¶Ç´Â ¾ËųÈÁ¦·Î 1Â÷ Ä¡·á ÈÄ, Áö¼ÓÀûÀ̰ųª Àç¹ßÇÑ ³¼Ò¾Ï ȯÀÚÀÇ °í½ÄÀû Ä¡·á
      
     | 
   
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
    
  
  
  
  
  
   
    | ¿ë¹ý¿ë·® | 
    
      * Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù. 
    
     
      
      
      [󹿾à¾î] 
      ¾ËÆ®·¹Å¸¹ÎÀ¸·Î¼ 1ÀÏ 260 mg/§³À» 4ȸ(½ÄÈÄ ¹× Ãëħ Àü)·Î ºÐÇÒÇÏ¿© 14ÀÏ ¶Ç´Â 21Àϰ£ ¿¬¼Ó °æ±¸Åõ¿©Çϸç, 28ÀÏÀ» ÁÖ±â·Î ÇÑ´Ù. 
´ÙÀ½ÀÇ °æ¿ì¿¡´Â ÀϽÃÀû(14ÀÏ ¶Ç´Â ±× ÀÌ»ó)À¸·Î Åõ¿©¸¦ ÁßÁöÇϰí, ÀçÅõ¿© ½Ã¿¡´Â ÀÌ ¾àÀ¸·Î¼ 1ÀÏ 200 mg/§³À¸·Î ½ÃÀÛÇÑ´Ù. 
 - °ßµð±â Èûµç ¼Òȱâ°è ÀÌ»ó¹ÝÀÀ ¹ß»ý 
 - ¹éÇ÷±¸¼ö°¡ 2,000/§§ ¹Ì¸¸ ¶Ç´Â °ú¸³±¸¼ö°¡ 1,000/§§ ¹Ì¸¸ 
 - Ç÷¼ÒÆÇ¼ö°¡ 75,000/§§ ¹Ì¸¸ 
 - ½Å°æµ¶¼ºÀÇ ÁøÇà 
¿ë·®À» °¨¼ÒÇÏ¿©µµ ½Å°æÇÐÀû Áõ»óÀÌ ¾ÈÁ¤µÇÁö ¾ÊÀ¸¸é Åõ¿©¸¦ Áß´ÜÇÑ´Ù.     
      	
     | 
   
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
   
    | ±Ý±â | 
     1) ÀÌ ¾à ¹× ÀÌ ¾àÀÇ ±¸¼º¼ººÐ¿¡ °ú¹Î¹ÝÀÀ ȯÀÚ 
 2) ±âÁ¸ÀÇ ÁßÁõ °ñ¼ö¾ïÁ¦ ¶Ç´Â ÁßÁõ ½Å°æÇÐÀû µ¶¼ºÀÌ Àִ ȯÀÚ | 
   
  
  
  
  
    
  
  
  
  
  
   
    | ÀÌ»ó¹ÝÀÀ | 
    
        1) ¼Òȱâ°è 
   ¸ÅÀÏ Áö¼ÓÀûÀ¸·Î ÀÌ ¾àÀ» °í¿ë·® Åõ¿©ÇÏ¸é ±¸¿ª, ±¸ÅäÀÇ ¹ßÇöÀÌ Á¡ÁøÀûÀ¸·Î Áõ°¡ÇÒ ¼ö ÀÖ´Ù. ´ëºÎºÐ ÀÌ·± Áõ»óÀº ÁøÅäÁ¦¿¡ ÀÇÇØ Á¶Àý °¡´ÉÇÏÁö¸¸ ½É°¢ÇÒ °æ¿ì¿¡´Â ¿ë·®À» °¨¼ÒÇϰųª µå¹°°Ô Åõ¿©¸¦ Áß´ÜÇÒ ¼ö ÀÖ´Ù. ¸î ÁÖ°£ÀÇ Åõ¿© ÈÄ¿¡ ÀϺÎÀÇ °æ¿ì¿¡¼ ÀÌ·¯ÇÑ Áõ»óµé¿¡ ´ëÇÑ ³»¼ºÀÌ ³ªÅ¸³ª±âµµ Çß´Ù. ±¸¿ª, ±¸ÅäÀÇ ¹ßÇöÀ²°ú Á¤µµ´Â »ó¿ë·®À¸·Î Åõ¿© ½Ã °¨¼ÒÇÑ´Ù. 
   ÀÌ ¾àÀ» ´Üµ¶Åõ¿©ÇÑ 2°¡Áö ÀÓ»ó½ÇÇè¿¡¼ ÀϹÝÀû ½ºÄÉÁÙ·Î »ó¿ë·®À» °£ÇæÅõ¿©ÇÏ¿´À» ¶§ ÁßÁõ ±¸¿ª, ±¸Åä·Î ÀÌ ¾àÀÇ Åõ¿©¸¦ Áß´ÜÇÑ °ÍÀº ´ÜÁö 1%(ȯÀÚ 1¸í)¿´´Ù. 
2) ½Å°æ°è 
   ¸»ÃʽŰ溴Áõ°ú ÁßÃ߽Űæ°è Áõ»óÀÎ ±âºÐÀå¾Ö, ÀǽÄÀå¾Ö, Á¶È¿îµ¿ºÒ´É, ¾îÁö·¯¿òÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ÀÌ·¯ÇÑ Áõ»óÀº ¸ÅÀÏ Áö¼ÓÀûÀ¸·Î °í¿ë·®À» Åõ¿©¹Þ´Â ȯÀÚ¿¡¼ ³ªÅ¸³ª³ª Åõ¿©¸¦ Áß´ÜÇϸé ȸº¹µÈ´Ù. 
 3) Ç÷¾×°è 
   °¡º¿î ¹éÇ÷±¸°¨¼ÒÁõ, Ç÷¼ÒÆÇ°¨¼ÒÁõ, ºóÇ÷ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. 
   ÀÌ ¾àÀÇ »ó¿ë·® Åõ¿© ½Ã °ñ¼ö¾ïÁ¦¿Í °ü·ÃÇÏ¿© °¡º¿î ¹éÇ÷±¸°¨¼ÒÁõÀÌ ³ªÅ¸³¯ ¼ö Àִµ¥, °£Çæ ¶Ç´Â Áö¼ÓÀûÀ¸·Î Åõ¿© ¹ÞÀº ȯÀÚÀÇ 15% ¹Ì¸¸¿¡¼ ¹éÇ÷±¸¼ö°¡ 3,000/§§ ÀÌÇÏ¿´À¸¸ç, 1% ¹Ì¸¸¿¡¼ 1,000/§§ ÀÌÇÏÀÇ ¹éÇ÷±¸°¨¼ÒÁõÀ» º¸¿´´Ù. 
   ȯÀÚÀÇ 10% ¹Ì¸¸¿¡¼ Ç÷¼ÒÆÇ¼ö°¡ 50,000/§§ ÀÌÇÏÀÎ Ç÷¼ÒÆÇ°¨¼ÒÁõÀ» º¸¿´´Ù. 
   1ÀÏ Ã¼Áß kg´ç 8¢¦12 mgÀ» 21ÀÏ ÀÌ»ó Åõ¿©ÇÒ ¶§ ¹éÇ÷±¸¿Í Ç÷¼ÒÆÇ¼ö°¡ ÃÖÀúÄ¡¿¡ À̸£´Â ½ÃÁ¡Àº 3¢¦4ÁÖÀ̰í, Á¤»ó¼öÄ¡·Î ȸº¹ÇÏ´Â ½Ã°£Àº 6ÁÖÀÌ´Ù. ¶ÇÇÑ 1ÀÏ Ã¼Áß kg´ç 6¢¦8 mgÀ» °è¼Ó Åõ¿©ÇÒ ¶§ ÀÌµé ¼öÄ¡°¡ ÃÖÀúÄ¡¿¡ À̸£´Â ½ÃÁ¡Àº 6¢¦8ÁÖÀÌ´Ù. 
 4) ±âŸ 
   ¶§¶§·Î °£µ¶¼º, ÇǺιßÁø, °¡·Á¿ò, Å»¸ðÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. 
 5) ´ÙÀ½ Ç¥´Â ½Ã½ºÇÃ¶óÆ¾ º¹ÇÕ¿ä¹ýÀ¸·Î 1Â÷ Ä¡·á ÈÄ ÀÌ ¾àÀ» Åõ¿© ¹ÞÀº ³¼Ò¾Ï ȯÀÚ 76¸íÀ» ´ë»óÀ¸·Î ÇÑ ÀÚ·áÀÌ´Ù. ÇÑ ½ÇÇè¿¡¼´Â ÀÌ ¾àÀ¸·Î¼ 1ÀÏ 260 mg/§³À» 28ÀÏ ÁÖ±â·Î 14ÀÏ µ¿¾È Åõ¿©ÇÏ¿´°í, ´Ù¸¥ ½ÃÇè¿¡¼´Â 1ÀÏ Ã¼Áß kg´ç 6¢¦8 mgÀ» 28ÀÏ ÁÖ±â·Î 21ÀÏ µ¿¾È Åõ¿©ÇÏ¿´´Ù. 
	
		
			| 
			 ÀÌ»ó¹ÝÀÀ 
			 | 
			
			 ¹ßÇöÀ²(%) 
			 | 
		 
		
			| 
			 ¼Òȱâ°è 
			 | 
			
			 ±¸¿ª ¹× ±¸Åä 
			°æÁõ¢¦Áߵ 
			ÁßÁõ 
			 | 
			
			 33 
			32 
			1 
			 | 
		 
		
			| 
			 ALP »ó½Â 
			 | 
			
			 9 
			 | 
		 
		
			| 
			 ½Å°æ°è 
			 | 
			
			 ¸»Ãʰ¨°¢½Å°æº´Áõ 
			°æÁõ 
			Áߵ¢¦ÁßÁõ 
			 | 
			
			 31 
			22 
			9 
			 | 
		 
		
			| 
			 ½Ä¿åºÎÁø ¹× ÇÇ·Î 
			 | 
			
			 1 
			 | 
		 
		
			| 
			 ¹ßÀÛ 
			 | 
			
			 1 
			 | 
		 
		
			| 
			 Ç÷¾×°è 
			 | 
			
			 ¹éÇ÷±¸°¨¼ÒÁõ 
			¹éÇ÷±¸¼ö 2,000¢¦2,999/§§ 
			¹éÇ÷±¸¼ö <2,000/§§ 
			 | 
			
			 5 
			4 
			1 
			 | 
		 
		
			| 
			 Ç÷¼ÒÆÇ°¨¼ÒÁõ 
			Ç÷¼ÒÆÇ¼ö 75,000¢¦99,000/§§ 
			Ç÷¼ÒÆÇ¼ö <75,000/§§ 
			 | 
			
			 9 
			6 
			3 
			 | 
		 
		
			| 
			 ºóÇ÷ 
			°æÁõ 
			Áߵ¢¦ÁßÁõ 
			 | 
			
			 33 
			20 
			13 
			 | 
		 
		
			| 
			 ½ÅÀå 
			 | 
			
			 Ç÷ûũ·¹¾ÆÆ¼´Ñ 1.6¢¦3.75 mg/dL 
			 | 
			
			 7 
			 | 
		 
		
			| 
			 BUN 
			25¢¦40 mg% 
			41¢¦60 mg% 
			>60 mg% 
			 | 
			
			 9 
			5 
			3 
			1 
			 | 
		 
	
 
      
     | 
   
        
  
  
    
   
    | »óÈ£ÀÛ¿ë | 
     1) ÀÌ ¾à°ú MAO¾ïÁ¦Á¦°è¿ Ç׿ì¿ïÁ¦¸¦ µ¿½ÃÅõ¿©Çϸé ÁßÁõ ±â¸³¼º ÀúÇ÷¾ÐÀ» ÀÏÀ¸Å³ ¼ö ÀÖ´Ù. 
 2) ·§Æ®¿¡¼ ¸¶ÀÌÅ©·Î¼Ø ¾à¹°´ë»ç ÀúÇØÁ¦ÀÎ ½Ã¸ÞƼµòÀº ÀÌ ¾àÀÇ ¹Ý°¨±â¿Í µ¶¼ºÀ» Áõ°¡½ÃŲ´Ù. 
 3) ³¼Ò¾Ï ȯÀÚ¿¡°Ô ÀÌ ¾à°ú ½Ã½ºÇÃ¶óÆ¾ ¹× ÇǸ®µ¶½ÅÀ» º´¿ëÅõ¿© ÇÑ °á°ú, ÇǸ®µ¶½ÅÀº ½Å°æµ¶¼ºÀ» ÇöÀúÇÏ°Ô °¨¼Ò½ÃÄ×À¸³ª ¹ÝÀÀ±â°£¿¡´Â ¿ªÈ¿°ú¸¦ ³ªÅ¸³»¹Ç·Î ÇǸ®µ¶½ÅÀº ÀÌ ¾à ¹× ½Ã½ºÇÃ¶óÆ¾°ú´Â º´¿ëÅõ¿©ÇÏÁö ¾Êµµ·Ï ÇÑ´Ù. | 
   
  
    
  
  
       	
  
     
  
  
  
  
  
   
    | Related FDA Approved Drug | 
    
      
      ±âÁØ ¼ººÐ: ALTRETAMINEHEXALEN (ALTRETAMINE) 
        
     | 
      
  
  
  |  
     
   
  
    
       |  
      
        
          
            
                | Á¤º¸¿ä¾à |         
             
           
         | 
             	    
       |  
      | 
  
    µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
    
  
  
    
  
   |  
     
   
  
    
       |  
      
        
          
            
                | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |         
             
           
         | 
             	    
       |  
      | 	 |  
     
   
  
    
       |  
      
        
          
            
                | Á¦Ç°Á¤º¸ |            
             
           
         | 
             	  
       |  
       |  
     
   
  
    
       |  
      
        
          
            
                | º¹¾àÁ¤º¸ |            
             
           
         | 
             	  
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
   
    | LACTmed ¹Ù·Î°¡±â | 
    
      
        [¹Ù·Î°¡±â]
     | 
     
  
  
   
    | ¾à¸®ÀÛ¿ë | 
    
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
       
     | 
     
  
  
  
   
    | Ãà¾àº¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
       
  
  
   
    | º¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
                                                          															
  
   
  
  
   
    | ÀӺο¡´ëÇÑÅõ¿© | 
    
      
      
        
	      
	      
	        | *  | 
	        
	          ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù. 
	         | 
	         
	       
	       | 
	   
	  
	    |   | 
	   
	  
	    
	      FDA : Dµî±Þ 
				        	
					  
					
	   | 
	  
	  
	  
	     
	     
	     
	     
	     
	     
	   | 
	 
	
	  
	      
	      
	        | *  | 
	        
	          »ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
	         | 
	         
	      
	        | *  | 
	        
	          ¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
	         | 
	         
	       
	   | 
	 
       
     | 
   
  
  
  	   
  
  	   
  
  	   
  
  
     
      | Pharmacokinetics | 
      
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
      
       |   
     
  
  
  
  
  
  
  	
  
  
  
   
    | º¹¾à¶óº§ | 
    
    
    
      | À̹ÌÁö | 
      º¹¾à¼³¸í | 
     
    
    
        | 
      ¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. | 
     
    
       | 
     
    
     |  
    
      
	
	  
            | *  | 
	    º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. | 
	   
	  
            | *  | 
	    º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. | 
	   
	  
            | *  | 
	    ±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. | 
	   
	   
     |   
     | 
   
  	
  
  
  
   
    | º¸°ü»ó ÁÖÀÇ | 
    
      
    	
     | 
   
  
  
   
    | Á¶Á¦½Ã ÁÖÀÇ | 
    
      
    	
     | 
      
 
 |  
     
   
  
    
       |  
      
        
          
            
                | ½É»çÁ¤º¸ |            
             
           
         | 
             	  
       |  
       |  
     
     
  
    
       |  
      
        
          
            
                | ÇмúÁ¤º¸ |          
             
           
         | 
             	  
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
    | DUR (ÀǾàǰ»ç¿ëÆò°¡) | 
    º´¿ë±Ý±â :
     
	 °í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
	 
	  [»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]										
	  ¿¬·É´ë±Ý±â :
      °í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
      
       [¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
       
       
        
        
     | 
   
  
   
    | Mechanism of Action | 
    
       Altretamine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ The precise mechanism by which altretamine exerts its cytotoxic effect is unknown. 
     | 
   
  
   
    | Pharmacology | 
     
       Altretamine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Altretamine is a novel antineoplastic agent. The precise mechanism by which altretamine exerts its cytotoxic effect is unknown, although a number of theoretical possibilities have been studied. Structurally, altretamine resembles the alkylating agent triethylenemelamine, yet in vitro tests for alkylating activity of altretamine and its metabolitics have been negative. Altretamine has been demonstrated to be efficacious for certain ovarian tumors resistant to classical alkylating agents. Metabolism of altretamine is a requirement of cytotoxicity. Synthetic monohydroxymethylmelamines, and products of altretamine metabolism, in vitro and in vivo, can form covalent adducts with tissue macromolecules including DNA, but the relevance of these reactions to antitumor activity is unknown. 
     | 
   
  
   
    | Metabolism | 
    
       Altretamine¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Not Available 
     | 
   
  
   
    | Protein Binding | 
    
       Altretamine¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 94% 
     | 
   
  
   
    | Half-life | 
    
       Altretamine¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 4.7-10.2 hours 
     | 
   
  
   
    | Absorption | 
    
       Altretamine¿¡ ´ëÇÑ Absorption Á¤º¸ Not Available 
     | 
   
  
   
    | Pharmacokinetics | 
    
       AltretamineÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á 
- Èí¼ö : °æ±¸·Î Àß ¿ÏÀüÇÏ°Ô Èí¼öµÊ(75-89%)
 - ºÐÆ÷ 
- ÃÖ°í Ç÷Á߳󵵿¡ À̸£´Â ½Ã°£ : 0.5-3½Ã°£
  
 - ´ë»ç : °£¿¡¼ ºü¸£°Ô Å»¸ÞƿȵÊ
 - ¹è¼³ : ¼Òº¯À¸·Î ¹è¼³( < 1%°¡ ¹Ìº¯Èü·Î ¹è¼³)
  
     | 
   
  
   
    | Biotransformation | 
    
       Altretamine¿¡ ´ëÇÑ Biotransformation Á¤º¸ Not Available 
     | 
   
  
   
    | Toxicity | 
    
       Altretamine¿¡ ´ëÇÑ Toxicity Á¤º¸ Not Available 
     | 
   
  
   
    | Drug Interactions | 
    
       Altretamine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available 
     | 
   
  
   
    CYP450  Drug Interaction | 
    
      [CYP450 TableÁ÷Á¢Á¶È¸] 
     | 
   
  
   
    | Drug Target | 
    
      
      [Drug Target]
     | 
   
  
   
    | Description | 
    
       Altretamine¿¡ ´ëÇÑ Description Á¤º¸ An alkylating agent proposed as an antineoplastic. It also acts as a chemosterilant for male houseflies and other insects. [PubChem] 
     | 
   
  
   
    | Dosage Form | 
    
       Altretamine¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Capsule	Oral 
     | 
   
  
   
    | Drug Category | 
    
       Altretamine¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antineoplastic AgentsAntineoplastic Agents, Alkylating 
     | 
   
  
   
    | Smiles String Canonical | 
    
       Altretamine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CN(C)C1=NC(=NC(=N1)N(C)C)N(C)C 
     | 
   
  
   
    | Smiles String Isomeric | 
    
       Altretamine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CN(C)C1=NC(=NC(=N1)N(C)C)N(C)C 
     | 
   
  
   
    | InChI Identifier | 
    
       Altretamine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C9H18N6/c1-13(2)7-10-8(14(3)4)12-9(11-7)15(5)6/h1-6H3 
     | 
   
  
   
    | Chemical IUPAC Name | 
    
       Altretamine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ N2,N2,N4,N4,N6,N6-hexamethyl-1,3,5-triazine-2,4,6-triamine 
     | 
   
    
  |  
     
     
  
    
       |  
      
        
          
            
                | »ç¿ëÀÚÄÁÅÙÃ÷ |           
             
           
         | 
             	  
       |  
       |  
     
         
 
     | 
   
   
     | 
   
  
    
      
        
          
            
              - 
                ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2021-12-09
              
 
              - 
                
                 º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
                
              
     
             
         |                 
       
     |       
          
                
                    
                       ¾Ë¸² | 
                       
                      »ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù.  | 
                    
                    | 
               
      
      
                
                    
                       °æ°í | 
                     
                      µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù. 
                          Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â 
                          Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
                            ¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
                          ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
 | 
  
                    | 
               
  
 
  
    ¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é 
    ¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
   
  The database contains the following fields: The generic name of each chemical For module A10 (liver enzyme composite module): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the number of active and marginally active scores for each compound at the five individual endpoints (see research article for full description of method) Number of endpoints at which each compound is marginally active (M) Number of endpoints at which each compound is active (A) For modules A11 to A15 (alkaline phosphatase increased, SGOT increased, SGPT increased, LDH increased, and GGT increased, respectively): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the RI and ADR values (see the research article for full description of method) Number of ADR reports for each compound, given as <4 or ¡Ã4 Reporting Index value for each compound, except where no shipping units were available (NSU) Group 1 comprises of compounds for which ADR data were available for the first five years of marketing, so when no ADR reports were listed during this period the compounds were evaluated as inactive. Group 2 comprises of compounds for which a 'steady state' period of ADR data were available (1992-1996). In cases where no ADR reports were filed during this period, the compounds were scored as 'NA' (data not available) since they may have had one or more ADR reports during their first five years of marketing which should not be negated by a lack of ADR reports during the steady-state period. ALTRETAMINE[GGT Increase][Composite Activity](Score)  I(Marginal)  0(Active)  0[Alkaline Phosphatase Increase](Activity Score)  I(Number of Rpts)  <4(Index value)  18.3[SGOT Increase](Activity Score)  I(Number of Rpts)  <4(Index value)  0[SGPT Increase](Activity Score)  I(Number of Rpts)  <4(Index value)  0[LDH Increase](Activity Score)  I(Number of Rpts)  <4(Index value)  0[GGT Increase](Activity Score)  I(Number of Rpts)  <4(Index value)  0
 
  º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
 
  
  |  
                           
                         | 
                       
                      | 
                   |