| |
|
|
|
|
|
 |
| |
|
코스톱캡슐 COSTOP CAP.
|
|
전문의약품 | 삭제
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
642801260
[보험코드에 따른 약품기본정보 직접조회]
\0 원/1캡슐(2018.10.06)(현재약가)
\105 원/1캡슐(2017.02.01)(변경전약가)
[상병코드조회]
[질병코드조회]
|
| 빠른조회 |
|
| 제품성상 |
흰색의 구형과립이 들어있는 상부 분홍색, 하부 흰색의 경질캡슐 [제형정보 확인] |
| 포장·유통단위 |
6cap. |
| 포장·코드단위 |
| 약품규격 |
단위 |
포장형태 |
대표코드 |
표준코드 |
비고 |
| 120밀리그램 |
300 캡슐 |
병 |
8806428012609 |
8806428012630 |
|
| 120밀리그램 |
30 캡슐 |
병 |
8806428012609 |
8806428012623 |
|
| 120밀리그램 |
6 캡슐 |
PTP |
8806428012609 |
8806428012616 |
|
|
| 주성분코드 |
259900ACH
[동일한 주성분코드를 가진 오리지날 또는 제네릭 의약품 조회]
|
| 허가사항 원문조회 |
[허가사항 원문조회]
|
| 효능효과 |
[적응증 별 검색]
다음 증상을 수반하는 계절성 및 다년성 알레르기 비염의 완화
: 코막힘, 재채기, 콧물, 눈•코의 소양증
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
1. 12세 이상의 소아와 성인
식사와 관계없이 1회 1캡슐씩 1일 2회(아침, 저녁) 복용한다.
이 약은 씹거나 부수어서 복용하지 말고 그대로 삼켜서 복용한다.
2. 이 약은 2~3주 이상 복용하지 않도록 한다.
3. 신기능 저하 환자 및 간기능 저하 환자의 경우 감량하여 1회 1캡슐씩 1일 1회 복용한다.
|
| 금기 |
1) 이 약 또는 ephedrine 또는 piperazine류에 과민증이 있는 환자.
2) 심각한 고혈압 또는 심각한 관상 동맥환자.
3) Monoamine oxidase 저해제를 투여 받고 있는 환자.
4) 안내압이 증가되어 있거나 뇨저류가 있는 환자. |
| 신중투여 |
1) 당뇨병, 갑상선기능항진증, 고혈압, 빈박, 부정맥, 신장 및 간기능 부전환자.
2) 교감신경양약물 ( 비충혈제거약, 식욕억제제, amphetamine 등의 정신 흥분제), 삼환계 항우울약, 디기탈리스 제제를 투여 받는 환자.
3) 기타 다른 중추신경 흥분약을 투여 받는 환자.
4) 이 약은 황색4호 (타트트라진) 를 함유하고 있으므로 이 성분에 과민하거나 알레르기 병력이 있는 환자에는 신중히 투여할 것. |
| 이상반응 |
1) 구갈, 두통, 불면, 수면, 무기력, 빈박, 신경과민증, 어지러움증, 현운, 오심 등이 투여대상 중 1% 이상에서 나타났다.
2) 공포, 흥분, 긴장, 불안, 진전, 호흡곤란, 환각, 경련, 중추신경억제, 부정맥, 저혈압이 있는 심혈관계 허탈 등이 나타날 수 있다.
3) 피부반응, 혈관부종, 아나필락시스성 쇼크 등의 과민증이 일어날 수 있다.
4) 급성 전신성 발진성 농포증(AGEP), 발열, 홍반, 다수의 작은 농포와 같은 중증 피부 이상반응이 나타날 수 있다.
5) 슈도에페드린 성분과 관련하여 허혈성 대장염의 증상(급격한 복통, 직장 출혈 등)이 발현될 수 있다. 이 경우 이 약의 복용을 중단해야 한다.
6) 슈도에페드린 성분과 관련하여 가역적 후뇌 병증 증후군 및 가역적 뇌혈관 수축 증후군 증상(갑작스러운 심한 두통, 번개 두통, 구역, 구토, 혼돈, 발작, 시각 장애 등)이 나타나면 이 약의 복용을 즉시 중단해야 한다.
7) 조절장애, 시야흐림, 안통, 시각장애, 눈부심, 동공확대 등의 안과질환 이상반응이 나타날 수 있다.
8) 발기기능장애가 나타날 수 있다.
|
| 상호작용 |
1) Monoamine oxidase 저해제, β₂-교감신경 효능 억제약은 교감신경양 작용을 증가시킨다. MAO 저해제의 긴 작용시간 때문에 MAO 저해제 투여 최소 15일 후 이 약물을 복용한다.
2) 교감신경양아민은 methyldopa, guanethidine, reserpine의 항고혈압 효과를 감소시킨다.
3) 슈도에페드린을 디기탈리스와 병용 투여할 때 전위성 심박조율기의 활성이 증가될 수 있다.
4) 슈도에페드린은 제산제에 의해 흡수속도가 증가되는 반면, 카올린에 의해 흡수 속도가 감소된다. |
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| |
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 축약복약지도 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : C등급
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
신장애, 간장애시
용량조절 |
유료정보입니다.
|
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| Mechanism of Action |
Cetirizine에 대한 Mechanism_Of_Action 정보
Cetirizine competes with histamine for binding at H1-receptor sites on the effector cell surface, resulting in suppression of histaminic edema, flare, and pruritus. The low incidence of sedation can be attributed to reduced penetration of cetirizine into the CNS as a result of the less lipophilic carboxyl group on the ethylamine side chain.
Pseudoephedrine에 대한 Mechanism_Of_Action 정보
Pseudoephedrine acts directly on both alpha- and, to a lesser degree, beta-adrenergic receptors. Through direct action on alpha-adrenergic receptors in the mucosa of the respiratory tract, pseudoephedrine produces vasoconstriction. Pseudoephedrine relaxes bronchial smooth muscle by stimulating beta2-adrenergic receptors. Like ephedrine, pseudoephedrine releasing norepinephrine from its storage sites, an indirect effect.
|
| Pharmacology |
Cetirizine에 대한 Pharmacology 정보
Cetirizine, the active metabolite of the piperazine H1-receptor antagonist hydroxyzine, is used to treat chronic idiopathic urticaria, perennial allergic rhinitis, seasonal allergic rhinitis, allergic asthma, physical urticaria, and atopic dermatitis.
Pseudoephedrine에 대한 Pharmacology 정보
Pseudoephedrine is a sympathomimetic agent, structurally similar to ephedrine, used to relieve nasal and sinus congestion and reduce air-travel-related otalgia in adults. The salts pseudoephedrine hydrochloride and pseudoephedrine sulfate are found in many over-the-counter preparations either as single-ingredient preparations, or more commonly in combination with antihistamines and/or paracetamol/ibuprofen. Unlike antihistamines, which modify the systemic histamine-mediated allergic response, pseudoephedrine only serves to relieve nasal congestion commonly associated with colds or allergies. The advantage of oral pseudoephedrine over topical nasal preparations, such as oxymetazoline, is that it does not cause rebound congestion (rhinitis medicamentosa).
|
| Metabolism |
Cetirizine에 대한 Metabolism 정보
# Phase_1_Metabolizing_Enzyme:Cytochrome P450 3A43 (CYP3A43)
Pseudoephedrine에 대한 Metabolism 정보
# Phase_1_Metabolizing_Enzyme:Monoamine oxidase type A (MAO-A)
|
| Protein Binding |
Cetirizine에 대한 단백결합 정보
Very high (93%) plasma protein binding
Pseudoephedrine에 대한 단백결합 정보
Pseudoephedrine does not bind to human plasma proteins over the concentration range of 50 to 2000 ng/mL
|
| Half-life |
Cetirizine에 대한 반감기 정보
8.3 hours
Pseudoephedrine에 대한 반감기 정보
9-16 hours
|
| Absorption |
Cetirizine에 대한 Absorption 정보
mean peak plasma concentration (Cmax) of 114 ng/mL at a time (Tmax) of 2.2 hours postdose was observed for cetirizine
Pseudoephedrine에 대한 Absorption 정보
Pseudoephedrine is readily and almost completely absorbed from the GI tract and there is no evidence of first-pass metabolism.
|
| Biotransformation |
Cetirizine에 대한 Biotransformation 정보
Not Available
Pseudoephedrine에 대한 Biotransformation 정보
Hepatic.
|
| Toxicity |
Cetirizine에 대한 Toxicity 정보
Somnolence (sleepiness or unusual drowsiness), restlessness, irritability
Pseudoephedrine에 대한 Toxicity 정보
Common adverse reactions include nervousness, restlessness, and insomnia. Rare adverse reactions include difficult/painful urination, dizziness/lightheadedness, heart palpitations, headache, increased sweating, nausea/vomiting, trembling, troubled breathing, unusual paleness, and weakness.
|
| Drug Interactions |
Cetirizine에 대한 Drug_Interactions 정보
Not Available
Pseudoephedrine에 대한 Drug_Interactions 정보
Alseroxylon Increased arterial pressureIsocarboxazid Increased arterial pressureLinezolid Possible increase of arterial pressureMethyldopa Increased arterial pressureBromocriptine The sympathomimetic increases the toxicity of bromocriptineTranylcypromine Increased arterial pressureMidodrine Increased arterial pressureMoclobemide Moclobemide increases the sympathomimetic effectPargyline Increased arterial pressurePhenelzine Increased arterial pressureRasagiline Increased arterial pressureReserpine Increased arterial pressureTrimipramine The tricyclic increases the sympathomimetic effectProtriptyline The tricyclic increases the sympathomimetic effectNortriptyline The tricyclic increases the sympathomimetic effectAmitriptyline The tricyclic increases the sympathomimetic effectAmoxapine The tricyclic increases the sympathomimetic effectClomipramine The tricyclic increases the sympathomimetic effectImipramine The tricyclic increases the sympathomimetic effectDesipramine The tricyclic increases the sympathomimetic effectDoxepin The tricyclic increases the sympathomimetic effectDeserpidine Increased arterial pressureGuanethidine The agent decreases the effect of guanethidine
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Food Interaction |
Cetirizine에 대한 Food Interaction 정보
Avoid alcohol.Take without regard to meals.
Pseudoephedrine에 대한 Food Interaction 정보
Take without regard to meals.
|
| Drug Target |
[Drug Target]
|
| Description |
Cetirizine에 대한 Description 정보
A potent second-generation histamine H1 antagonist that is effective in the treatment of allergic rhinitis, chronic urticaria, and pollen-induced asthma. Unlike many traditional antihistamines, it does not cause drowsiness or anticholinergic side effects. [PubChem]
Pseudoephedrine에 대한 Description 정보
An alpha- and beta-adrenergic agonist that may also enhance release of norepinephrine. It has been used in the treatment of several disorders including asthma, heart failure, rhinitis, and urinary incontinence, and for its central nervous system stimulatory effects in the treatment of narcolepsy and depression. It has become less extensively used with the advent of more selective agonists. [PubChem]
|
| Dosage Form |
Cetirizine에 대한 Dosage_Form 정보
Syrup OralTablet Oral
Pseudoephedrine에 대한 Dosage_Form 정보
Liquid OralSyrup OralTablet OralTablet, extended release Oral
|
| Drug Category |
Cetirizine에 대한 Drug_Category 정보
Anti-Allergic AgentsAntihistaminesHistamine H1 Antagonists, Non-Sedating
Pseudoephedrine에 대한 Drug_Category 정보
Adrenergic AgentsBronchodilator AgentsCentral Nervous System AgentsNasal DecongestantsSympathomimeticsVasoconstrictor Agents
|
| Smiles String Canonical |
Cetirizine에 대한 Smiles_String_canonical 정보
OC(=O)COCCN1CCN(CC1)C(C1=CC=CC=C1)C1=CC=C(Cl)C=C1
Pseudoephedrine에 대한 Smiles_String_canonical 정보
CNC(C)C(O)C1=CC=CC=C1
|
| Smiles String Isomeric |
Cetirizine에 대한 Smiles_String_isomeric 정보
OC(=O)COCCN1CCN(CC1)[C@H](C1=CC=CC=C1)C1=CC=C(Cl)C=C1
Pseudoephedrine에 대한 Smiles_String_isomeric 정보
CN[C@@H](C)[C@@H](O)C1=CC=CC=C1
|
| InChI Identifier |
Cetirizine에 대한 InChI_Identifier 정보
InChI=1/C21H25ClN2O3/c22-19-8-6-18(7-9-19)21(17-4-2-1-3-5-17)24-12-10-23(11-13-24)14-15-27-16-20(25)26/h1-9,21H,10-16H2,(H,25,26)/f/h25H
Pseudoephedrine에 대한 InChI_Identifier 정보
InChI=1/C10H15NO/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,10-12H,1-2H3/t8-,10+/m0/s1
|
| Chemical IUPAC Name |
Cetirizine에 대한 Chemical_IUPAC_Name 정보
2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetic acid
Pseudoephedrine에 대한 Chemical_IUPAC_Name 정보
(1S,2S)-2-methylamino-1-phenylpropan-1-ol
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2025-01-03
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
|
|
|
|
전문/일반
