|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
674900350
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1g(2014.03.01)(ÇöÀç¾à°¡)
\526 ¿ø/1g(2014.02.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»öÀÇ Å©¸²Á¦ÀÌ´Ù. [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
Á¦Á¶¿øÀÇ Æ÷Àå´ÜÀ§ |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 30±×·¥ |
1 °³ |
Æ©ºê |
8806749003508 |
8806749003515 |
|
|
| ÁÖ¼ººÐÄÚµå |
121501CCM
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
¢º È¿´ÉÈ¿°ú
(¿¬°íÁ¦)(Å©¸²Á¦)
°Ç¼±(°æÁõ ¶Ç´Â Áߵ)
(¾×Á¦)
µÎÇÇÀÇ °Ç¼±
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
[ÁÖ¼ººÐÄÚµå:121501CCM ¿¡ µû¸¥ ½É»çÁöħ¿¶÷]
¢º ¿ë¹ý¿ë·®
(¿¬°íÁ¦)(Å©¸²Á¦)
ȯºÎ¿¡ 1ÀÏ 1-2ȸ(¾ÆÄ§, Àú³á) ¹Ù¸¥´Ù. À¯Áö ¿ä¹ý½Ã ȯÀÚ¿¡ µû¶ó »ç¿ëȽ¼ö¸¦ ÁÙÀÏ ¼ö ÀÖ´Ù. 1ÁÖ¿¡ 100g(1ÀÏ ¾à 15gÀÌ»ó)À»ÃʰúÇÏ¿© »ç¿ëÇÏÁö ¾Ê´Â´Ù.
(¾×Á¦)
1ÀÏ 2ȸ(¾ÆÄ§, Àú³á) µÎÇÇÀÇ È¯ºÎ¿¡ Àû¿ëÇÑ´Ù.1ÁÖ¿¡ 60mL¸¦ ÃʰúÇÏ¿© »ç¿ëÇÏÁö ¾Ê´Â´Ù. Ä®½ÃÆ÷Æ®¸®¿Ã¿¬°í ¶Ç´Â Å©¸²°ú ÇÔ²² »ç¿ëÇÒ °æ¿ì, Ä®½ÃÆ÷Æ®¸®¿Ã ÃÑÅõ¿©·®ÀÌ 1ÁÖÀÏ¿¡Ä®½ÃÆ÷ Æ®¸®¿Ã ¿¬°í ¶Ç´Â Å©¸² 100g¿¡ ÇØ´çÇϴ¾çÀÎ 5mgÀ» ÃʰúÇÏÁö ¾Ê´Â´Ù(¾× 1mL´Â ¿¬°í ¶Ç ´Â Å©¸²ÀÇ 1g¿¡ ÇØ´çÇÑ´Ù).
|
| ±Ý±â |
1) ÀÌ ¾à ¹× ÀÌ ¾à ¼ººÐ¿¡ °ú¹ÎÁõ ¹× ±× º´·ÂÀÌ Àִ ȯÀÚ
2) °íÄ®½·Ç÷Áõ µî Ä®½·´ë»ç Àå¾Ö ȯÀÚ
3) ºñŸ¹ÎD µ¶¼ºÀ» ³ªÅ¸³»´Â ȯÀÚ
4) ±Þ¼º °Ç¼±¼º ¹ßÁø ȯÀÚ(¾×Á¦¿¡ ÇÑÇÔ)
|
| ÀÌ»ó¹ÝÀÀ |
1) ÀÛ¿°¨, °¡·Á¿ò, ¾È¸é ¹× µÎÇǸ¦Æ÷ÇÔÇÑ ÇǺΠÀÚ±ØÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
2) È«¹Ý, ÇǺΠ°ÇÁ¶,¹ÚÇÇ, ¹ßÁø, ÇǺο°, °Ç¼±ÀÇ ¾ÇÈ(¾È¸é ¹× µÎÇÇ °Ç¼± Æ÷ÇÔ), ±¤°ú¹ÎÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
3) ¶§¶§·Î ÇǺÎÀ§Ãà, °ú»ö¼ÒÄ§Âø, °íÄ®½·Ç÷Áõ, ¸ð³¶¿°ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
4) ¾È¸é ¹× ÀÔÁÖÀ§ ÇǺο°ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Á¦Çüº° º¹¾àÁöµµ |
[Å©¸²] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Calcipotriol¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ The precise mechanism of calcipotriol in remitting psoriasis is not well-understood. However, it has been shown to have comparable affinity with calcitriol for the Vitamin D receptor, while being less than 1% as active as the calcitriol in regulating calcium metabolism. The Vitamin D receptor (VDR) belongs to the steroid/thyroid receptor superfamily, and is found on the cells of many different tissues including the thyroid, bone, kindney, and T cells of the immune system. T cells are known to play a role in psoriasis, and it is thought that the binding of calcipotriol to the VDR modulates the T cells gene transcription of cell differentiation and proliferation related genes.
|
| Pharmacology |
Calcipotriol¿¡ ´ëÇÑ Pharmacology Á¤º¸ Calcipotriene is a synthetic analog of vitamin D. In humans, the natural supply of vitamin D depends mainly on exposure to the ultraviolet rays of the sun for conversion of 7-dehydrocholesterol to vitamin D3 (cholecalciferol) in the skin.
|
| Absorption |
Calcipotriol¿¡ ´ëÇÑ Absorption Á¤º¸ Clinical studies with radiolabeled ointment indicate that approximately 6% (+3%, SD) of the applied dose of calcipotriene is absorbed systemically when the ointment is applied topically to psoriasis plaques or 5% (+2.6%, SO) when applied to normal skin.
|
| Biotransformation |
Calcipotriol¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic. Calcipotriene metabolism following systemic uptake is rapid, and occurs via a similar pathway to the natural hormone. The primary metabolites are much less potent than the parent compound.
|
| Toxicity |
Calcipotriol¿¡ ´ëÇÑ Toxicity Á¤º¸ Topically applied calcipotriene can be absorbed in sufficient amounts to produce systemic effects. Elevated serum calcium has been observed with excessive use of calcipotriene.
|
| Drug Interactions |
Calcipotriol¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Calcipotriol¿¡ ´ëÇÑ Description Á¤º¸ Calcipotriol (INN) or calcipotriene (USAN) is a sythetic derivative of calcitriol or Vitamin D.
|
| Dosage Form |
Calcipotriol¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Cream TopicalOintment TopicalShampoo Topical
|
| Drug Category |
Calcipotriol¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antipsoriatic AgentsDermatologic AgentsVitamin D3 Receptor inhibitor
|
| Smiles String Canonical |
Calcipotriol¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC(C=CC(O)C1CC1)C1CCC2C1(C)CCCC2=CC=C1CC(O)CC(O)C1=C
|
| Smiles String Isomeric |
Calcipotriol¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ C[C@H](\C=C\[C@@H](O)C1CC1)[C@H]1CC[C@H]2[C@@]1(C)CCC\C2=C\C=C1\C[C@H](O)C[C@@H](O)C1=C
|
| InChI Identifier |
Calcipotriol¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C27H40O3/c1-17(6-13-25(29)20-8-9-20)23-11-12-24-19(5-4-14-27(23,24)3)7-10-21-15-22(28)16-26(30)18(21)2/h6-7,10,13,17,20,22-26,28-30H,2,4-5,8-9,11-12,14-16H2,1,3H3/b13-6+,19-7-,21-10-
|
| Chemical IUPAC Name |
Calcipotriol¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (1R,3S,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(E,2R)-5-cyclopropyl-5-hydroxypent-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2021-12-09
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|