드러그인포 약품요약정보 - 목틴캡슐200mg(아세틸시스테인)

허가정보

항목

내용

안전성 서한

청구코드(KD코드)
비급여점검코드
상한금액

643501030[A21402951] [보험코드에 따른 약품기본정보 직접조회]
\64 원/1캡슐(2025.02.01)(현재약가)
\64 원/1캡슐(2017.02.01)(변경전약가)
[상병코드조회]
[질병코드조회]

빠른조회


요약정보	[효능] [용법] [금기] [신중투여] [이상반응]

상세정보	[효능] [용법] [경고] [금기] [신중투여] [이상반응] [일반주의] [상호작용] [임산부] [수유부] [소아] [고령자] [신장애환자] [간장애환자] [적용주의] [과량투여] [임상검사치] [보관] [기타]

제품성상

흰색 분말이 든 상, 하 연청색의 경질캡슐제 [제형정보 확인]

포장·유통단위

300캡슐/병

포장·코드단위

약품규격	단위	포장형태	대표코드	표준코드	비고
200밀리그램	300 캡슐	병	8806435010308	8806435010353
200밀리그램	30 캡슐	병	8806435010308	8806435010346
200밀리그램	500 캡슐	병	8806435010308	8806435010339
200밀리그램	100 캡슐	병	8806435010308	8806435010322
200밀리그램	10 캡슐	PTP	8806435010308	8806435010315

주성분코드

101804ACH [동일한 주성분코드를 가진 오리지날 또는 제네릭 의약품 조회]

허가사항 원문조회

[허가사항 원문조회]

효능효과

[적응증 별 검색]

다음 질환에서의 객담배출곤란 : 급ㆍ만성기관지염, 기관지천식, 후두염, 부비동염, 낭성섬유증

[질환별 복약지도]

용법용량

* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.

[처방약어]

아세틸시스테인으로서 다음 용량을 식전에 소량의 물과 함께 복용한다.

1. 급성질환

성인 : 1회 200 mg 1일 3회

소아 : 6 ～ 14세 1회 200 mg 1일 2회

2. 만성질환

성인 : 1회 200 mg 1일 2회

소아 : 6 ～ 14세 1회 100 mg 1일 3회

3. 낭성섬유증

소아 : 6세 이상 1회 200 mg 1일 3회

[BMI지수 계산] [Body Surface Area 계산] [Cockcroft-Gault GFR 계산] [MDRD GFR 계산]

[피해야 할 음식] [복용을 잊은 경우 대처법]

금기

1) 이 약 또는 이 약의 구성성분에 과민반응 환자

2) 위•십이지장궤양 환자

3) 2세 미만 영아

4) 이 약은 유당을 함유하고 있으므로, 갈락토오스 불내성(galactose intolerance), Lapp 유당분해효소 결핍증(Lapp lactase deficiency) 또는 포도당-갈락토오스 흡수장애(glucose-galactose malabsorption) 등의 유전적인 문제가 있는 환자에게는 투여하면 안 된다.

신중투여

1) 임부 : 임부에 대한 적절한 연구가 없으므로 임부 또는 임신하고 있을 가능성이 있는 여성에는 반드시 필요한 경우에만 투여한다.

2) 수유부 : 이 약이 모유로 분비되는지 알려지지 않았으나 많은 약들이 모유로 분비되므로 수유부에 투여할 경우에는 신중히 투여한다.

이상반응

다음과 같을 경우 이 약의 복용을 즉각 중지하고 의사, 치과의사, 약사와 상의할 것. 상담시 가능한 한 이 첨부문서를 소지할 것.

1) 소화기계 : 드물게 구역, 구토, 구내염, 가슴쓰림, 설사 등

2) 과민반응 : 드물게 두드러기, 가려움, 발진, 두통, 이명, 기관지경련(특히 천식 환자) 등

3) 드물게 빈맥, 고혈압. 매우 드물게 아나필락시스

4) 국내 자발적 유해사례 보고자료(1989 ～ 2013 상반기)를 분석한 결과, 유해사례가 보고된 다른 의약품에서 발생한 유해사례에 비해 통계적으로 유의하게 많이 보고된 유해사례는 다음과 같이 나타났다. 다만, 이로서 곧 해당성분과 다음의 유해사례 간에 인과관계가 입증된 것을 의미하는 것은 아니다.

· 호흡곤란

[Human Liver Adverse Effects Database]

[주요 이상반응정보]

Off-label Usage

[조회]

Related FDA Approved Drug

기준 성분:ACETYLCYSTEINE
ACETADOTE (ACETYLCYSTEINE)
ACETYLCYSTEINE (ACETYLCYSTEINE)
MUCOMYST (ACETYLCYSTEINE)
MUCOMYST W/ ISOPROTERENOL (ACETYLCYSTEINE; ISOPROTERENOL HYDROCHLORIDE)
MUCOSIL-10 (ACETYLCYSTEINE)
MUCOSIL-20 (ACETYLCYSTEINE)

정보요약

드럭인포 의약품 요약/상세정보

코드 및 분류정보

항목	내용
성분코드	M050972/아세틸시스테인 200밀리그램 /
주성분코드	101804ACH [동일한 주성분코드를 가진 오리지날 또는 제네릭 의약품 조회]
대표코드	8806435010308
BIT 약효분류	진해거담제 & 기침감기약 (Cough & Cold remedies)
ATC 코드	Acetylcysteine / R05CB01 [코드분류상세설명] [ATC코드예측]
복지부분류코드	222 (진해거담제 )
의약품 바코드정보	내용보기 목틴캅셀(아세틸시스테인)(수출명:뮤코브론치)/A21402951 제품규격:200밀리그램/제품수량:10/제형:정 폼목기준코드:199902656 /대표코드:8806435010308/표준코드:8806435010315 구바코드:-/비고:- 목틴캅셀(아세틸시스테인)(수출명:뮤코브론치)/A21402951 제품규격:200밀리그램/제품수량:100/제형:정 폼목기준코드:199902656 /대표코드:8806435010308/표준코드:8806435010322 구바코드:8806029115327/비고:- 목틴캅셀(아세틸시스테인)(수출명:뮤코브론치)/A21402951 제품규격:200밀리그램/제품수량:500/제형:정 폼목기준코드:199902656 /대표코드:8806435010308/표준코드:8806435010339 구바코드:8806029115310/비고:- 목틴캅셀(아세틸시스테인)(수출명:뮤코브론치)/A21402951 제품규격:200밀리그램/제품수량:30/제형:캡슐 폼목기준코드:199902656 /대표코드:8806435010308/표준코드:8806435010346 구바코드:8806029115389/비고:-
주성분코드 분석 및 중복처방 검토	[주성분코드 분석 및 중복처방 검토]
Drugs By Indication	[전체보기]
Drugs By Classification	[전체보기]

제품정보

항목	내용
청구코드(KD코드) 비급여점검코드 상한금액	643501030[A21402951] [보험코드에 따른 약품기본정보 직접조회] \64 원/1캡슐(2025.02.01)(최신약가) \64 원/1캡슐(2017.02.01)(변경전약가) [상병코드조회] [질병코드집 다운로드]
제품성상	흰색 분말이 든 상, 하 연청색의 경질캡슐제 [제형정보 확인]
대체관련	비교용출 시험완료
포장·유통단위	300캡슐/병
보관방법	기밀용기, 실온보관(1-30℃)
동일주성분코드 검색순위	유료정보입니다.
Brandname 정보	Acetylcysteine Brand Names/Synonyms (R)-2-Amino-3-mercaptopropanoic acid (R)-Cysteine 2-Amino-3-mercaptopropionic acid C Cys Cystein Cysteine, L- Half-cystine L-(+)-Cysteine L-Alanine, 3-mercapto- L-Cys L-cysteine N-acetyl-L-cysteine (NAC) Propanoic acid, 2-amino-3-mercapto-, (R)- Thioserine acetylcysteine b-Mercaptoalanine carbocysteine Brand Name Mixtures Amino Acid Concentrate Inj (Arginine Hcl + Calcium Chloride + Dexpanthenol + Dextrose + Dl-Methionine + Glutamic Acid + Histidine Hcl + Isoleucine + L-Cysteine Hydrochloride + L-Lysine Hydrochloride + Leucine + Magnesium Sulfate + Nicotinamide + Phenylalanine + Potassium Chloride + Sodium Acetate + Threonine + Tryptophan + Valine + Vitamin B1 (Thiamine) + Vitamin B12 + Vitamin B2 (Riboflavin) + Vitamin B6 (Pyridoxine)) Amino Acid Inj (Arginine + Calcium Chloride + D-Pantothenic Acid (Calcium D-Pantothenate) + Dextrose + Histidine + Isoleucine + L-Cysteine Hydrochloride + Leucine + Lysine + Magnesium Sulfate + Methionine + Nicotinamide + Phenylalanine + Potassium Chloride + Pyridoxine Hydrochloride + Sodium Acetate + Threonine + Tryptophan + Valine + Vitamin B1 + Vitamin B12 + Vitamin B2) Amino Lite (Arginine + Calcium Chloride + Dextrose + Isoleucine + L-Cysteine Hydrochloride + L-Histidine Hcl + L-Lysine Hydrochloride + Leucine + Magnesium Sulfate + Methionine + Nicotinic Acid + Phenylalanine + Potassium Chloride + Pyridoxine Hydrochloride + Sodium Glutamate + Thiamine Hydrochloride + Threonine + Tryptophan + Valine + Vitamin B12 + Vitamin B2 (Riboflavin 5'-Phosphate Sodium)) Aminoderm Poudre (Glycine + L-Cysteine + Neomycin Sulfate + Threonine) Bvs Amino Acid Solution Inj (Arginine Hcl + Calcium Chloride + Dexpanthenol + Dextrose + Dl-Isoleucine + L-Cysteine Hydrochloride + L-Histidine Hcl + L-Lysine Hydrochloride + Leucine + Magnesium Sulfate + Methionine + Nicotinamide + Phenylalanine + Potassium Chloride + Pyridoxine Hydrochloride + Sodium Acetate Hemodialysis + Sodium Glutamate + Threonine + Tryptophan + Valine + Vitamin B1 + Vitamin B12 + Vitamin B2) Cicatrin Powder (Bacitracin Zinc + Glycine + L-Cysteine + Neomycin Sulfate + Threonine) Nephramine Liq Iv (Dl-Methionine + Histidine + Isoleucine + L-Cysteine (L-Cysteine Hydrochloride) + Leucine + Lysine (Lysine Acetate) + Phenylalanine + Sodium Bisulfite + Threonine + Tryptophan + Valine) Primene 10% (Glutamic Acid + Glycine + Histidine + L-Alanine + L-Arginine + L-Aspartic Acid + L-Cysteine + L-Isoleucine + L-Leucine + L-Lysine + L-Ornithine Dihydrochloride + L-Phenylalanine + L-Proline + L-Threonine + L-Tyrosine + L-Valine + Methionine + Serine + Taurine + Tryptophan) Primene 10%-Liq Iv (Glutamic Acid + Glycine + Histidine + L-Alanine + L-Arginine + L-Aspartic Acid + L-Cysteine Hydrochloride + L-Isoleucine + L-Leucine + L-Lysine + L-Ornithine + L-Phenylalanine + L-Proline + L-Threonine + L-Tyrosine + L-Valine + Methionine + Serine + Taurine + Tryptophan) Stv Amino Acid Sol Inj (Arginine Hcl + Calcium Chloride + Dexpanthenol + Dextrose + Dl-Methionine + Glutamic Acid + Histidine Hcl + Isoleucine + L-Cysteine Hydrochloride + L-Lysine Hydrochloride + Leucine + Magnesium Sulfate + Nicotinamide + Phenylalanine + Potassium Chloride + Pyridoxine Hydrochloride + Sodium Acetate + Threonine + Tryptophan + Valine + Vitamin B1 (Thiamine) + Vitamin B12 + Vitamin B2 (Riboflavin)) Vamin 18 Electrolyte-Free (Glutamic Acid + Glycine + Histidine + L-Alanine + L-Arginine + L-Aspartic Acid + L-Cysteine + L-Isoleucine + L-Leucine + L-Lysine (Lysine Acetate) + L-Phenylalanine + L-Proline + L-Threonine + L-Tyrosine + L-Valine + Methionine + Serine + Tryptophan) Vamin N (Calcium Chloride + Glutamic Acid + Glycine + Histidine + L-Alanine + L-Arginine + L-Aspartic Acid + L-Cysteine (L-Cysteine Hydrochloride) + L-Isoleucine + L-Leucine + L-Lysine (L-Lysine Hydrochloride) + L-Phenylalanine + L-Proline + L-Threonine + L-Tyrosine + L-Valine + Magnesium Sulfate + Methionine + Potassium Chloride + Potassium Hydroxide + Serine + Sodium Hydroxide + Tryptophan) Chemical IUPAC Name 2-amino-3-sulfanyl-propanoic acid

복약정보

항목

내용

LACTmed 바로가기

[바로가기]

약리작용

유료정보입니다.

축약복약지도

유료정보입니다.

복약지도

유료정보입니다.

임부에대한투여

*	전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.

FDA : B등급

*	상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
*	반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.

Pharmacokinetics

유료정보입니다.

보관상 주의

조제시 주의

심사정보

항목	내용
심사지침검색	[심평원 심사지침열람]
DUR 관련 고시	[병용연령금기 의약품 / 임부금기 의약품 / 비용효과적 함량 의약품 / 안전성 관련 급여중지 의약품]

학술정보

항목	내용
DUR (의약품사용평가)	병용금기 : 고시된 병용금기 내용은 없습니다. [상호작용/병용금기검색] 연령대금기 : 고시된 연령금기 내용은 없습니다. [연령대금기상세검색]
독성정보	Acetylcysteine에 대한 독성정보 : 정보보기 출처: 국립독성과학원 독성물질정보DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do
Mechanism of Action	Acetylcysteine에 대한 Mechanism_Of_Action 정보 Acetylcysteine may protect against acetaminophen overdose-induced hepatotoxicity by maintaining or restoring hepatic concentrations of glutathione. Glutathione is required to inactivate an intermediate metabolite of acetaminophen that is thought to be hepatotoxic. In acetaminophen overdose, excessive quantities of this metabolite are formed because the primary metabolic (glucuronide and sulfate conjugation) pathways become saturated. Acetylcysteine may act by reducing the metabolite to the parent compound and/or by providing sulfhydryl for conjugation of the metabolite. Experimental evidence also suggests that a sulfhydryl-containing compound such as acetylcysteine may also directly inactivate the metabolite. Inhalation - Acetylcysteine exerts its mucolytic action through its free sulfhydryl group, which opens the disulfide bonds and lowers mucus viscosity. This action increases with increasing pH and is most significant at pH 7 to 9. The mucolytic action of acetylcysteine is not affected by the presence of DNA.
Pharmacology	Acetylcysteine에 대한 Pharmacology 정보 Acetylcysteine has been shown to reduce the extent of liver injury following acetaminophen overdose. It is most effective when given early, with benefit seen principally in patients treated within 8-10 hours of the overdose. Acetylcysteine likely protects the liver by maintaining or restoring the glutathione levels, or by acting as an alternate substrate for conjugation with, and thus detoxification of, the reactive metabolite.
Protein Binding	Acetylcysteine에 대한 단백결합 정보 83%
Half-life	Acetylcysteine에 대한 반감기 정보 5.6 hours (adults), 11 hours (neonates)
Absorption	Acetylcysteine에 대한 Absorption 정보 Bioavailability is 6??0% following oral administration and less than 3% following topical administration.
Pharmacokinetics	Acetylcysteine의 약물동력학자료 최대 점액용해효과 발현시간 흡입 : 5-10분 이내 작용지속시간 : 1시간 이상 혈중최고농도 도달시간 경구 : 1-2 시간 분포용적 경구 : 0.33-0.47 L/kg 단백결합 경구 : 50% 반감기 환원형 acetylcysteine : 2시간 전체 acetylcysteine으로서 5.5 시간
Biotransformation	Acetylcysteine에 대한 Biotransformation 정보 Hepatic. Deacetylated by the liver to cysteine and subsequently metabolized.
Toxicity	Acetylcysteine에 대한 Toxicity 정보 Single intravenous doses of acetylcysteine at 1000 mg/kg in mice, 2445 mg/kg in rats, 1500 mg/kg in guinea pigs, 1200 mg/kg in rabbits and 500 mg/kg in dogs were lethal. Symptoms of acute toxicity were ataxia, hypoactivity, labored respiration, cyanosis, loss of righting reflex and convulsions.
Drug Interactions	Acetylcysteine에 대한 Drug_Interactions 정보 Not Available
CYP450 Drug Interaction	[CYP450 Table직접조회]
Description	Acetylcysteine에 대한 Description 정보 The N-acetyl derivative of cysteine. It is used as a mucolytic agent to reduce the viscosity of mucous secretions. It has also been shown to have antiviral effects in patients with HIV due to inhibition of viral stimulation by reactive oxygen intermediates. [PubChem]
Drug Category	Acetylcysteine에 대한 Drug_Category 정보 Antiviral AgentsExpectorantsFree Radical Scavengers
Smiles String Canonical	Acetylcysteine에 대한 Smiles_String_canonical 정보 CC(=O)NC(CS)C(O)=O
Smiles String Isomeric	Acetylcysteine에 대한 Smiles_String_isomeric 정보 CC(=O)N[C@@H](CS)C(O)=O
InChI Identifier	Acetylcysteine에 대한 InChI_Identifier 정보 InChI=1/C5H9NO3S/c1-3(7)6-4(2-10)5(8)9/h4,10H,2H2,1H3,(H,6,7)(H,8,9)/t4-/m0/s1/f/h6,8H
Chemical IUPAC Name	Acetylcysteine에 대한 Chemical_IUPAC_Name 정보 (2R)-2-acetamido-3-sulfanylpropanoic acid

사용자컨텐츠

항목

내용

핵심 요약 정보

Acetylcysteine

Brand Names/Synonyms

Brand Name Mixtures

Chemical IUPAC Name