| |
|
|
|
|
|
 |
| |
|
디겐타안연고 Digenta Eye Oinment
|
|
전문의약품 | 삭제
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
645304200
[보험코드에 따른 약품기본정보 직접조회]
\0 원/1g(2016.10.01)(현재약가)
\791 원/1g(2014.02.01)(변경전약가)
[상병코드조회]
[질병코드조회]
|
| 빠른조회 |
|
| 제품성상 |
흰색-미황색의 거의 냄새가 없는 안연고제 [제형정보 확인] |
| 포장·코드단위 |
| 약품규격 |
단위 |
포장형태 |
대표코드 |
표준코드 |
비고 |
| 5그램 |
1 개 |
튜브 |
8806453042008 |
8806453042022 |
|
|
| 주성분코드 |
332200COO
[동일한 주성분코드를 가진 오리지날 또는 제네릭 의약품 조회]
|
| 허가사항 원문조회 |
[허가사항 원문조회]
|
| 효능효과 |
[적응증 별 검색]
1. 겐타마이신에 감수성 있는 균에 의한 전안부 감염
2. 세균 감염의 의험성이 있는 전안부 염증
|
| 허가사항 초과시 인정기준 |
[조회]
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
1. 세균성 감염:감염된 눈에 1회 5mm 길이로 1일 3-4회 도포한다.
2. 눈 수술후 치료시:인펙토후람 점안액의 보조요법으로 취침전 5mm 길이로 도포한다.
|
| 주요약물 상호작용 |
[조회]
|
| 금기 |
1)이 약 성분에 과민증의 병력이 있는 환자
2)각막 손상 및 궤양 환자
3)바이러스 감염 (예 : 단순포진, 우두) 또는 진균감염 환자
4)안결핵 환자
5)녹내장 환자 |
| 이상반응 |
점안시 일시적인 작열감이 소수의 환자에서 보고되었으며 드물게 가려움, 발적, 광과민증과 같은 과민반응이 나타났다.
|
| 상호작용 |
1)다른 안과용약과 같이 적용해야 할 때에는 각각의 주성분이 씻겨나가지 않도록 하지 위해 적어도 5분의 간격을 두고 적용해야 한다. 겐타마이신을 암포테리신B, 헤파린, 설파디아진, 세팔로친,클록사실린과 병용 투여하면 눈에 보일 정도의 침전이 생길 수 있다.
2) CYP3A4 저해제 (리토나비르 또는 코비시스타트 포함)와 병용 투여시 전신 노출이 증가되어, 전신적 이상 반응 발생 위험이 증가할 수 있다. 치료상의 유익성이 전신 코르티코스테로이드 이상반응 발생의 위험성을 상회한다고 판단되는 경우에만 병용 투여하며, 환자의 전신 코르티코스테로이드 영향을 살펴야 한다.
|
| Off-label Usage |
[조회]
|
| Related FDA Approved Drug |
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| |
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 축약복약지도 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : C등급
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
신장애, 간장애시
용량조절 |
유료정보입니다.
|
| Pharmacokinetics |
유료정보입니다.
|
| 제형별 복약지도 |
[연고][안연고] |
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| Mechanism of Action |
Fluorometholone에 대한 Mechanism_Of_Action 정보
There is no generally accepted explanation for the mechanism of action of ocular corticosteroids. However, corticosteroids are thought to act by the induction of phospholipase A2 inhibitory proteins, collectively called lipocortins. It is postulated that these proteins control the biosynthesis of potent mediators of inflammation such as prostaglandins and leukotrienes by inhibiting the release of their common precursor, arachidonic acid. Arachidonic acid is released from membrane phospholipids by phospholipase A2.
Gentamicin에 대한 Mechanism_Of_Action 정보
Aminoglycosides like gentamicin "irreversibly" bind to specific 30S-subunit proteins and 16S rRNA. Specifically gentamicin binds to four nucleotides of 16S rRNA and a single amino acid of protein S12. This interferes with decoding site in the vicinity of nucleotide 1400 in 16S rRNA of 30S subunit. This region interacts with the wobble base in the anticodon of tRNA. This leads to interference with the initiation complex, misreading of mRNA so incorrect amino acids are inserted into the polypeptide leading to nonfunctional or toxic peptides and the breakup of polysomes into nonfunctional monosomes.
|
| Pharmacology |
Fluorometholone에 대한 Pharmacology 정보
Corticosteroids such as fluorometholone inhibit the inflammatory response to a variety of inciting agents and probably delay or slow healing. They inhibit the edema, fibrin deposition, capillary dilation, leukocyte migration, capillary proliferation, fibroblast proliferation, deposition of collagen, and scar formation associated with inflammation.
Gentamicin에 대한 Pharmacology 정보
Gentamicin is a broad spectrum aminoglycoside antibiotic. Aminoglycosides work by binding to the bacterial 30S ribosomal subunit, causing misreading of t-RNA, leaving the bacterium unable to synthesize proteins vital to its growth. Aminoglycosides are useful primarily in infections involving aerobic, Gram-negative bacteria, such as Pseudomonas, Acinetobacter, and Enterobacter. In addition, some mycobacteria, including the bacteria that cause tuberculosis, are susceptible to aminoglycosides. Infections caused by Gram-positive bacteria can also be treated with aminoglycosides, but other types of antibiotics are more potent and less damaging to the host. In the past the aminoglycosides have been used in conjunction with penicillin-related antibiotics in streptococcal infections for their synergistic effects, particularly in endocarditis. Aminoglycosides are mostly ineffective against anaerobic bacteria, fungi and viruses.
|
| Metabolism |
Fluorometholone에 대한 Metabolism 정보
# Phase_1_Metabolizing_Enzyme:Cytochrome P450 3A4 (CYP3A4)
|
| Protein Binding |
Fluorometholone에 대한 단백결합 정보
Not Available
Gentamicin에 대한 단백결합 정보
Low (between 0 and 30%)
|
| Half-life |
Fluorometholone에 대한 반감기 정보
Not Available
Gentamicin에 대한 반감기 정보
3-3½ hours in infants one week to six months of age; this increases to 5½ hours in full-term and large premature infants less than one week old.
|
| Absorption |
Fluorometholone에 대한 Absorption 정보
Not Available
Gentamicin에 대한 Absorption 정보
Injections lead to peak serum concentrations in 30-60 minutes. Topical gentamicin is readily absorbed from large burned, denuded, or granulating areas but not through intact skin. Absorption of gentamicin is faster and greater with the cream compared to the ointment. Gentamicin is absorbed in small quantities following topical application to the eye. Gentamicin is also absorbed in small amounts following topical application to the ear (especially if the eardrum is perforated or if tissue damage is present).
|
| Pharmacokinetics |
Fluorometholone의 약물동력학자료
- 흡수 : 대부분은 방수(aqueous humor)로 흡수되고 소량이 전신흡수 된다.
Gentamicin Sulfate의 약물동력학자료
- 흡수 : 경구 : 흡수되지 않는다.
- 분포 : 태반 통과
- 분포용적 : 부종이나 복수가 있거나 수액을 과다 투여했을 때 증가되고, 탈수시에 감소된다.
- 신생아 : 0.4-0.6 L/kg
- 소아 : 0.3-0.35 L/kg
- 성인 : 0.2-0.3 L/kg
표 1. 다양한 조직으로 분포된 정도 (혈액과의 비율 (%))
|
위치 |
분포 정도 |
|
눈 |
미미하다. |
|
중추신경계 |
미미하다.(25% 이하) |
|
흉막 |
우수하다 |
|
기관지 분비물 |
미미하다. |
|
타액 |
어느정도 분포된다.(10-50%) |
|
폐조직 |
우수하다. |
|
복수 |
다양하다.(43-132%) |
|
복막액 |
미미하다. |
|
담즙 |
다양하다.(25-90%) |
|
담도 패색시 답즙 |
미미하다. |
|
활액 |
우수하다. |
|
뼈 |
미미하다. |
|
전립선 |
미미하다. |
|
요 |
우수하다. |
|
신장조직 |
우수하다. |
- 뇌척수액으로의 분포는 뇌막에 염증이 있을 때도 미미하다.
- 뇌척수액 대 혈액의 농도비 (%)
- 단백결합 : 30% 이하
- 반감기 :
- 신생아
- 1주 이하 : 3-11.5 시간
- 1주-6개월 : 3-3.5 시간
- 성인 :
- 1.5-3 시간
- 말기 신질환 : 36-70 시간
- 혈중최고농도 도달시간 :
- 근육주사 : 30-90 분 이내
- 정맥주사 : 30분 주입 후 30분 이내
- 소실 : 클리러런스는 환자의 신기능에 의존한다. 대부분이 사구체 여과를 통해 미변화체로 신배설
|
| Biotransformation |
Fluorometholone에 대한 Biotransformation 정보
Not Available
|
| Toxicity |
Fluorometholone에 대한 Toxicity 정보
Side effects may include acute anterior uveitis and perforation of the globe. Keratitis, conjunctivitis, corneal ulcers, mydriasis, conjunctival hyperemia, loss of accommodation and ptosis have occasionally been reported following local use of corticosteroids. LD50 = 234 mg/kg (rats)
Gentamicin에 대한 Toxicity 정보
Mouse, intravenous LD50: 52 mg/kg; rat, intravenous LD50: 96 mg/kg.
|
| Drug Interactions |
Fluorometholone에 대한 Drug_Interactions 정보
Not Available
Gentamicin에 대한 Drug_Interactions 정보
Atracurium The agent increases the effect of muscle relaxantDoxacurium The agent increases the effect of muscle relaxantGallamine Triethiodide The agent increases the effect of muscle relaxantMetocurine The agent increases the effect of muscle relaxantMivacurium The agent increases the effect of muscle relaxantPancuronium The agent increases the effect of muscle relaxantPipecuronium The agent increases the effect of muscle relaxantRocuronium The agent increases the effect of muscle relaxantSuccinylcholine The agent increases the effect of muscle relaxantTubocurarine The agent increases the effect of muscle relaxantVecuronium The agent increases the effect of muscle relaxantBumetanide Increased ototoxicityEthacrynic acid Increased ototoxicityFurosemide Increased ototoxicityTorasemide Increased ototoxicityThalidomide Thalidomide increases the renal toxicity of the aminoglycosideCisplatin Increased risk of nephrotoxicityCefradine Increased risk of nephrotoxicityCephapirin Increased risk of nephrotoxicityCefamandole Increased risk of nephrotoxicityCefazolin Increased risk of nephrotoxicityCefonicid Increased risk of nephrotoxicityCefoperazone Increased risk of nephrotoxicityCeforanide Increased risk of nephrotoxicityCefotaxime Increased risk of nephrotoxicityCefotetan Increased risk of nephrotoxicityCefoxitin Increased risk of nephrotoxicityCeftazidime Increased risk of nephrotoxicityCeftizoxime Increased risk of nephrotoxicityCeftriaxone Increased risk of nephrotoxicityCefuroxime Increased risk of nephrotoxicityCephalothin Group Increased risk of nephrotoxicity
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Drug Target |
[Drug Target]
|
| Description |
Fluorometholone에 대한 Description 정보
A glucocorticoid employed, usually as eye drops, in the treatment of allergic and inflammatory conditions of the eye. It has also been used topically in the treatment of various skin disorders. (From Martindale, The Extra Pharmacopoeia, 30th ed, p732)
Gentamicin에 대한 Description 정보
A complex of three different closely related aminoglycoside sulfates, Gentamicins C1, C2, and C1(subA), obtained from Micromonospora purpurea and related species. They are broad-spectrum antibiotics, but may cause ear and kidney damage. They act to inhibit protein synthesis (genetic translation). [PubChem]
|
| Dosage Form |
Fluorometholone에 대한 Dosage_Form 정보
Solution / drops OphthalmicSuspension Ophthalmic
Gentamicin에 대한 Dosage_Form 정보
Cream TopicalLiquid OphthalmicOintment OphthalmicOintment TopicalSolution Auricular (otic)Solution IntravenousSolution OphthalmicSolution / drops Auricular (otic)Solution / drops Ophthalmic
|
| Drug Category |
Fluorometholone에 대한 Drug_Category 정보
Anti-Allergic AgentsAnti-inflammatory AgentsGlucocorticoids
Gentamicin에 대한 Drug_Category 정보
Anti-Bacterial AgentsProtein Synthesis Inhibitors
|
| Smiles String Canonical |
Fluorometholone에 대한 Smiles_String_canonical 정보
CC1CC2C3CCC(O)(C(C)=O)C3(C)CC(O)C2(F)C2(C)C=CC(=O)C=C12
Gentamicin에 대한 Smiles_String_canonical 정보
CNC(C)C1CCC(N)C(O1)OC1C(N)CC(N)C(OC2OCC(C)(O)C(NC)C2O)C1O
|
| Smiles String Isomeric |
Fluorometholone에 대한 Smiles_String_isomeric 정보
C[C@H]1C[C@H]2[C@@H]3CC[C@](O)(C(C)=O)[C@@]3(C)C[C@H](O)[C@]2(F)[C@@]2(C)C=CC(=O)C=C12
Gentamicin에 대한 Smiles_String_isomeric 정보
CN[C@H](C)[C@@H]1CC[C@@H](N)[C@@H](O1)O[C@H]1[C@H](N)C[C@H](N)[C@@H](O[C@@H]2OC[C@@](C)(O)[C@H](NC)[C@H]2O)[C@@H]1O
|
| InChI Identifier |
Fluorometholone에 대한 InChI_Identifier 정보
InChI=1/C22H29FO4/c1-12-9-17-15-6-8-21(27,13(2)24)20(15,4)11-18(26)22(17,23)19(3)7-5-14(25)10-16(12)19/h5,7,10,12,15,17-18,26-27H,6,8-9,11H2,1-4H3/t12-,15-,17-,18-,19-,20-,21-,22-/m0/s1
Gentamicin에 대한 InChI_Identifier 정보
InChI=1/C21H43N5O7/c1-9(25-3)13-6-5-10(22)19(31-13)32-16-11(23)7-12(24)17(14(16)27)33-20-15(28)18(26-4)21(2,29)8-30-20/h9-20,25-29H,5-8,22-24H2,1-4H3
|
| Chemical IUPAC Name |
Fluorometholone에 대한 Chemical_IUPAC_Name 정보
(6S,8S,9R,10S,11S,13S,14S,17R)-17-acetyl-9-fluoro-11,17-dihydroxy-6,10,13-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one
Gentamicin에 대한 Chemical_IUPAC_Name 정보
2-[4,6-diamino-3-[3-amino-6-(1-methylaminoethyl)oxan-2-yl]oxy-2-hydroxycyclohexyl]oxy-5-methyl-4-methylaminooxane-3,5-diol
|
| Drug-Induced Toxicity Related Proteins |
GENTAMICIN 의 Drug-Induced Toxicity Related Protein정보
Replated Protein:Phospholipase A
Drug:gentamicin
Toxicity:aminoglycoside toxicity.
[바로가기]
Replated Protein:phospholipases C
Drug:gentamicin
Toxicity:aminoglycoside toxicity.
[바로가기]
Replated Protein:Angiotensinase A
Drug:gentamicin
Toxicity:important consequences upon renal function and metabolism.
[바로가기]
Replated Protein:Dipeptidylpeptidase IV
Drug:gentamicin
Toxicity:important consequences upon renal function and metabolism.
[바로가기]
Replated Protein:Sodium/potassium-transporting ATPase
Drug:Gentamicin
Toxicity:necrosis.
[바로가기]
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2025-11-03
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
|
|
|
|
전문/일반
