| |
|
|
|
|
|
 |
| |
|
ÇÁ·¹³ë¸°400mcgºÐ¸»ÈíÀÔÁ¦(¹ÌºÐȺε¥¼Ò´Ïµå) 100ȸ PRENORINE400§¶INHALATION POWDER(100dose/bottle)
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
659700820[E06080452]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/100ȸ/Åë(2012.05.01)(ÇöÀç¾à°¡)
\18,162 ¿ø/100ȸ/Åë(2009.08.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»öÀÇ ºÐ¸»À» ÀÏÁ¤·®¾¿ ÈíÀÔÇÒ ¼ö ÀÖ°Ô °í¾ÈµÈ ÈíÀÔÁ¦ÀÌ´Ù. [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
100ȸ/Åë |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 40¹Ð¸®±×·¥ |
1 °³ |
Åë |
8806597008205 |
8806597008212 |
100ȸ¿ë |
|
| ÁÖ¼ººÐÄÚµå |
119505CSI
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
±â°üÁöõ½Ä
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
½ÉÇÑ Ãµ½Ä±â°£ÀÇ Ä¡·á¿ä¹ýÀ¸·Î¼ ÄÚÆ¼ÄÚ½ºÅ×·ÎÀ̵åÀÇ ÈíÀÔ Åõ¿©¸¦ ½ÃÀÛÇÒ ¶§ ±×¸®°í °æ±¸ ½ºÅ×·ÎÀ̵带 °¨·®Çϰųª Áß´ÜÇϰíÀÚ ÇÒ ¶§ÀÇ ¿ë¹ýÀº ´ÙÀ½°ú °°½À´Ï´Ù.
1. ¼ºÀÎ(12¼¼ÀÌ»ó)
: 1ÀÏ 200 ¢¦ 1600 §¶ÀÇ ¿ë·®À» 2 ¢¦ 4ȸ ºÐÇÒ Åõ¿©ÇÕ´Ï´Ù.
°æÁõ 1ÀÏ 200 ¢¦ 800 §¶, ÁßÁõ 1ÀÏ 800 ¢¦1600 §¶
´Ü, À¯Áö¿ë·®ÀÌ 1ÀÏ 800 §¶ÀÎ °æ¿ì 1ÀÏ 1ȸ Åõ¿©µµ °¡´ÉÇÕ´Ï´Ù.
2. ¼Ò¾Æ(5 ¢¦ 12¼¼ ÀÌÇÏ)
: 1ÀÏ 200 ¢¦ 800 §¶ÀÇ ¿ë·®À» 2 ¢¦ 4ȸ ºÐÇÒ Åõ¿©ÇÕ´Ï´Ù.
ÁßÁõ õ½ÄÀÇ °æ¿ì 1ÀÏ Åõ¿©·®Àº 800 §¶±îÁö Áõ·®ÇÒ ¼ö ÀÖ½À´Ï´Ù.
´Ü, À¯Áö¿ë·®ÀÌ 1ÀÏ 400 §¶ÀÎ °æ¿ì 1ÀÏ 1ȸ Åõ¿©µµ °¡´ÉÇÕ´Ï´Ù
Ä¡·áÈ¿°ú¸¦ ÁõÁø½Ã۰íÀÚ Çϴ ȯÀÚ¿¡°Ô´Â °æ±¸ ÄÚÆ¼ÄÚ½ºÅ×·ÎÀ̵åÁ¦¿ÍÀÇ º´¿ë¿ä¹ýº¸´Ù´Â ÀϹÝÀûÀ¸·Î º»Á¦ÀÇ ¿ë·®À» Áõ°¡½ÃŰ´Â °ÍÀÌ Àü½ÅÀû ºÎÀÛ¿ëÀÇ À§ÇèÀÌ ÀûÀ¸¹Ç·Î ´õ¿í ¹Ù¶÷Á÷ÇÕ´Ï´Ù.
°æ±¸½ºÅ×·ÎÀ̵忡 ºñÀÇÁ¸ÀûÀΠȯÀÚ
: Ä¡·áÈ¿°ú´Â Åë»ó 10ÀÏ À̳»¿¡ ³ªÅ¸³³´Ï´Ù. ±â°üÁö¿¡ °úÀ×ÀÇ Á¡¾×ºÐºñ°¡ Àִ ȯÀÚ¿¡°Ô´Â Ãʱ⿡ °æ±¸ ½ºÅ×·ÎÀ̵åÁ¦¿Í ÇÔ²² ´Ü±â°£ Åõ¿©ÇÒ ¼öµµ ÀÖ½À´Ï´Ù.
°æ±¸ ½ºÅ×·ÎÀ̵忡 ÀÇÁ¸¼ºÀΠȯÀÚ
: °æ±¸ ½ºÅ×·ÎÀ̵åÁ¦¿¡¼ ¿ÀºÎÄÚÆ® ½ºÀ®Çï·¯·Î ÀüȯÇϰíÀÚ ÇÒ ¶§¿¡´Â ȯÀÚ´Â ºñ±³Àû ¾ÈÁ¤µÈ »óÅ¿©¾ß ÇÕ´Ï´Ù. °í¿ë·®ÀÇ ¿ÀºÎÄÚÆ® ½ºÀ®Çï·¯¸¦ ¾à 10ÀÏ ÀÌ»ó ÀÌÀü¿¡ »ç¿ëÇÑ °æ±¸½ºÅ×·ÎÀ̵å¿Í º´¿ëÇÏ¿© Åõ¿©ÇÕ´Ï´Ù.
ÀÌÈÄ·Î °æ±¸¿ë·®Àº °¡´ÉÇÑ ÇÑ ÃÖ¼Ò·®¿¡ À̸¦ ¶§±îÁö, ¿¹ÄÁ´ë prednisolonÀÇ °æ¿ì ¸Å¿ù 2.5 mg¾¿ ¶Ç´Â ÀÌ¿Í µ¿µîÇÑ ¾çÀ¸·Î Á¡Â÷ °¨¼Ò½Ãŵ´Ï´Ù.
°æ±¸ ½ºÅ×·ÎÀ̵åÁ¦¸¦ ¿ÀºÎÄÚÆ® ½ºÀ®Çï·¯·Î ¿ÏÀüÈ÷ ´ëüÇÒ ¼ö ÀÖ½À´Ï´Ù.
|
| ±Ý±â |
ºÎµ¥¼Ò´Ïµå¿¡ °ú¹ÎÁõÀΠȯÀÚ |
| ½ÅÁßÅõ¿© |
Æó°áÇ٠ȯÀÚ, Áø±Õ ¹× ¹ÙÀÌ·¯½º¿¡ ÀÇÇÑ ±âµµ °¨¿° ȯÀÚÀÇ °æ¿ì °¢º°È÷ ÁÖÀǰ¡ ÇÊ¿äÇÕ´Ï ´Ù. |
| ÀÌ»ó¹ÝÀÀ |
1) ÀÎÈÄÀÇ °æ¹ÌÇÑ Àڱرâħ ¸ñÀÌ ½¬´Â °æ¿ì°¡ º¸°íµÈ ¹Ù ÀÖ½À´Ï´Ù.
2) ±¸°Àεο¡ ĵð´Ù °¨¿°ÁõÀÌ ¶§¶§·Î º¸°íµÈ ¹Ù ÀÖ½À´Ï´Ù.
3) ºñƯÀÌÀû ¹ÝÀÀÀ¸·Î µå¹°°Ô ±â°üÁö °æ·ÃÀ» ÀÏÀ¸Å³ ¼ö ÀÖÁö¸¸ ÇöÀç±îÁö º»Á¦ÀÇ »ç¿ëÀ¸ ·Î ³ªÅ¸³ °æ¿ì´Â ¾ø½À´Ï´Ù.
4) ÈçÇÏÁö ¾Ê°Ô ½Ã¾ßÈ帲ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Bµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Budesonide¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ The exact mechanism of action of budesonide in the treatment of Crohn's disease is not fully understood. However, being a glucocorticosteroid, budesonide has a high local anti-inflammatory effect.
|
| Pharmacology |
Budesonide¿¡ ´ëÇÑ Pharmacology Á¤º¸ Budesonide is a synthetic corticosteroid used in Crohn's disease to decrease the symptoms and inflammation associated with the disease, especially at times of flare up. Budesonide has a high topical glucocorticosteroid (GCS) activity and a substantial first pass elimination. The formulation contains granules which are coated to protect dissolution in gastric juice, but which dissolve at pH >5.5, ie, normally when the granules reach the duodenum. Thereafter, a matrix of ethylcellulose with budesonide controls the release of the drug into the intestinal lumen in a time-dependent manner.
|
| Metabolism |
Budesonide¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 3A4 (CYP3A4)
|
| Absorption |
Budesonide¿¡ ´ëÇÑ Absorption Á¤º¸ Absorption is complete following oral administration.
|
| Toxicity |
Budesonide¿¡ ´ëÇÑ Toxicity Á¤º¸ Single oral doses of 200 and 400 mg/kg were lethal in female and male mice, respectively. The signs of acute toxicity were decreased motor activity, piloerection and generalized edema.
|
| Drug Interactions |
Budesonide¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Itraconazole The imidazole increases levels/effect of budesonideKetoconazole The imidazole increases levels/effect of budesonide
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Budesonide¿¡ ´ëÇÑ Food Interaction Á¤º¸ A mean delay in time to peak concentration of 2.5 hours is observed with the intake of a high-fat meal, with no significant differences in AUC.
|
| Drug Target |
[Drug Target]
|
| SNP Á¤º¸ |
Name:Budesonide (DB01222)
Interacting Gene/Enzyme:T-box transcription factor TBX21 (Gene symbol = TBX21) Swissprot Q9UL17
SNP(s):rs2240017 (C Allele)
Effect:Improved response for long-term asthma treatment
Reference(s):Tantisira KG, Hwang ES, Raby BA, Silverman ES, Lake SL, Richter BG, Peng SL, Drazen JM, Glimcher LH, Weiss ST: TBX21: a functional variant predicts improvement in asthma with the use of inhaled corticosteroids. Proc Natl Acad Sci U S A. 2004 Dec 28;101(52):18099-104. Epub 2004 Dec 16. [PubMed]
|
| Description |
Budesonide¿¡ ´ëÇÑ Description Á¤º¸ A glucocorticoid used in the management of asthma, the treatment of various skin disorders, and allergic rhinitis. [PubChem]
|
| Dosage Form |
Budesonide¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Aerosol, metered NasalAerosol, metered Respiratory (inhalation)Capsule, extended release OralSuspension NasalSuspension Respiratory (inhalation)
|
| Drug Category |
Budesonide¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-inflammatory AgentsBronchodilator AgentsCorticosteroidsGlucocorticoids
|
| Smiles String Canonical |
Budesonide¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CCCC1OC2CC3C4CCC5=CC(=O)C=CC5(C)C4C(O)CC3(C)C2(O1)C(=O)CO
|
| Smiles String Isomeric |
Budesonide¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CCC[C@H]1O[C@@H]2C[C@H]3[C@@H]4CCC5=CC(=O)C=C[C@]5(C)[C@H]4[C@@H](O)C[C@]3(C)[C@@]2(O1)C(=O)CO
|
| InChI Identifier |
Budesonide¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C25H34O6/c1-4-5-21-30-20-11-17-16-7-6-14-10-15(27)8-9-23(14,2)22(16)18(28)12-24(17,3)25(20,31-21)19(29)13-26/h8-10,16-18,20-22,26,28H,4-7,11-13H2,1-3H3/t16-,17-,18-,20+,21-,22+,23-,24-,25+/m0/s1
|
| Chemical IUPAC Name |
Budesonide¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ Not Available
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2021-12-09
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|