|   | 
                  
                       | 
                      | 
                    
                        
                            
                                | 
                                  
                                 | 
                             
                             |  
                            
                                
                                    
                                        
  
    
	  | 
   
  
    
        
          |   | 
          
              
                | 
                    º¸³ë¿¡ÀÌÁÖ10mL(°¡µµµð¾Æ¸¶À̵å)  VONO A INJ.10ml  
                    
                 | 
               
              
                | 
                     Àü¹®ÀǾàǰ | »èÁ¦  
                        
                    	
                    
                 | 
               
              
                | 
					  
                  
				  
                 | 
               
              
              
              
              
              |   |  
              
                
                    
                        | 
                      ¾Ë¸²:  | 
                      µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. | 
                     
                    | 
               
            
              
                
                   
                   
                   
                   
		   
                 | 
               
              
                | 
                  
                  
                 | 
               
              | 
            | 
         
       
       | 
   
    |  
  
    | 
      
     | 
     
  |                   
                                        | 
                                             | 
                                         
                            
                                
                            
                            
                              
                                                        
                              
                                                
                            
 |   
    | 
      
     | 
 
 |  
    
   
    | 
       
        À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
        ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
        À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
        ·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
       
     | 
   
  
     | 
   
  
  
    
      
  
    
       |  
      
        
          
            
                | Çã°¡Á¤º¸ | 
             
           
         | 
       
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
  
   
    | ¾ÈÀü¼º ¼ÇÑ | 
    
      
        [ÀǾàǰ ¾ÈÀü¼º ¼ÇÑ Á¶È¸]
     | 
   
  
  
  
   
    û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå  »óÇÑ±Ý¾× | 
    
      
      
        
        645103300[A02756241]  
	    
	    
            [º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸] 
          
        
        
        
              \0 ¿ø/10ml/º´(2011.11.01)(ÇöÀç¾à°¡)
            
                \27,136 ¿ø/10ml/º´(2009.05.01)(º¯°æÀü¾à°¡)
                  
	 
	   
	   
       
      
       
       
     
      
      
     
      
    
    
    
      
     [»óº´ÄÚµåÁ¶È¸]
      
      [Áúº´ÄÚµåÁ¶È¸]
     
     | 
   
   
    | ºü¸¥Á¶È¸ | 
    
      
     |   
   
  
  
  
   
    | Á¦Ç°¼º»ó | 
    ÀÌ ¾àÀº ¹«»öÅõ¸íÇÑ À¯¸® ¶Ç´Â Æú¸®ÇÁ·ÎÇÊ·»¿ë±â¿¡ µç ¹«»ö ³»Áö ¹ÌȲ»öÀÇ Åõ¸íÇÑ ¾×ÀÌ´Ù.  [Á¦ÇüÁ¤º¸ È®ÀÎ] |   
   
  
  
  
  
  
  
  
   
    | Æ÷À塤ÄÚµå´ÜÀ§ | 
    
        
        
            | ¾àǰ±Ô°Ý | 
            ´ÜÀ§ | 
            Æ÷ÀåÇüÅ | 
            ´ëÇ¥ÄÚµå | 
            Ç¥ÁØÄÚµå | 
            ºñ°í | 
	     
        
        
            | 10¹Ð¸®¸®ÅÍ | 
            1 °³ | 
            Vial | 
            8806451033008 | 
            8806451033015 | 
            Çѱۻóǰ¸í ¼öÁ¤ | 
	     
        
         
     | 
   
      
  
  	
   
    | ÁÖ¼ººÐÄÚµå | 
    
      466701BIJ  
      
	  [µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
     | 
   
  
  
  
 
  
  
    
  
  
  
  
  
  
  
  
  
  
 
  
  
  
 
  
  
  
  
  
  
   
    | Çã°¡»çÇ× ¿ø¹®Á¶È¸ | 
    
      
	    [Çã°¡»çÇ× ¿ø¹®Á¶È¸] 
     | 
   
  
  
  
  
     
  
  
  
   
    | È¿´ÉÈ¿°ú | 
    
    [ÀûÀÀÁõ º° °Ë»ö] 
      
    
     
	 
      1. µÎ°³ ¹× ôÃßÀÇ ÀÚ±â°ø¸í¿µ»ó(MRI) Á¶¿µÁ¦  
2. MR Ç÷°üÁ¶¿µÀ» Æ÷ÇÔÇÑ Àü½ÅÀÇ ÀÚ±â°ø¸í¿µ»ó(MRI) Á¶¿µÁ¦  
      
     | 
   
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
    
  
  
  
  
  
   
    | ¿ë¹ý¿ë·® | 
    
      * Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù. 
    
     
      
      
      [󹿾à¾î] 
      [ÁÖ¼ººÐÄÚµå:466701BIJ ¿¡ µû¸¥ ½É»çÁöħ¿¶÷] 
¡Û µÎ°³ ¹× ôÃßÀÇ ÀÚ±â°ø¸í¿µ»ó  
¼ºÀÎ ¹× ¼Ò¾Æ(¿µ¡¤À¯¾Æ Æ÷ÇÔ) : üÁß 100kg±îÁö´Â 0.1mmol/kg(0.2ml/kg¿¡ ÇØ´ç)À» »ç¿ëÇϸç, üÁß 100kg ÀÌ»óÀº 20ml¸¦ Åõ¿©Çϸé Áø´ÜÇÐÀûÀ¸·Î ÀûÀýÇÑ Á¶¿µÀ» ¾ò´Âµ¥ ÃæºÐÇÏ´Ù.  
¼ºÀο¡ ÇÑÇÏ¿© ³úÀüÀ̾ÏÀÌ ÀǽɵǴ °æ¿ì üÁß 100kg±îÁö´Â 0.3mmol/kg(0.6ml/kg)ÀÇ ¿ë·®À» Åõ¿©ÇÒ ¼ö ÀÖÀ¸¸ç, üÁß 100kg ÀÌ»óÀº ÃÑ 60ml·Îµµ Áø´ÜÇÐÀûÀ¸·Î ÀûÀýÇÑ Á¶¿µÀ» ¾ò´Âµ¥ ÃæºÐÇÏ´Ù. ÀÌ ¿ë·®(0.3mmol/kg)À» Åõ¿©ÇÒ ¶§ bolus Á¤¸ÆÁֻ絵 °¡´ÉÇÏ´Ù. 0.1mmol/kgÀÇ ¿ë·®À» Åõ¿©ÇÏ°íµµ Áø´ÜÀÌ Àǽɽº·¯¿î °æ¿ì¿¡´Â 20ºÐÀ̳»¿¡ 0.2mmol/kgÀ» 2Â÷·Î bolus ÁÖ»çÇÔÀ¸·Î½á Áø´ÜÈ¿°ú¸¦ ³ôÀÏ ¼ö ÀÖ´Ù. 
  
¡Û Àü½ÅÀÇ ÀÚ±â°ø¸í¿µ»ó(MR Ç÷°üÁ¶¿µ Æ÷ÇÔ)  
¼ºÀÎ : üÁß 100kg±îÁö´Â ÀϹÝÀûÀ¸·Î 0.1mmol/kg(0.2ml/kg) ¶Ç´Â °æ¿ì¿¡ µû¶ó 0.3mmol/kg (0.6ml/kg)ÀÌ ÃßõµÈ´Ù. üÁß 100kgÀÌ»óÀº 20ml ¶Ç´Â °æ¿ì¿¡ µû¶ó 60ml¸¦ Åõ¿©Çϸé Áø´ÜÇÐÀûÀ¸·Î ÀûÀýÇÑ Á¶¿µÀ» ¾ò´Âµ¥ ÃæºÐÇÏ´Ù.  
6°³¿ù ÀÌ»óÀÇ ¼Ò¾Æ : Ãßõ¿ë·®Àº 0.1mmol/kg(0.2ml/kg) 
  
- ÇÊ¿ä¿ë·®À» 1ȸ Á¤¸ÆÁÖ»çÇÑ´Ù.  
- Á¶¿µÁ¦¸¦ ¿ÏÀüÈ÷ ÁÖ»çÇϱâ À§ÇØ 0.9%ÀÇ »ý¸®½Ä¿°¼ö 5ml·Î ij´¼¶ó¸¦ ¾Ä¾î³»¸°´Ù.  
- »ç¿ëÇÑ pulse sequence ¹× °Ë»ç¹æ¹ý¿¡ µû¶ó ´Ù¸£Áö¸¸ Á¶¿µÁ¦ Åõ¿©ÈÄ Áï½Ã MRI °Ë»ç¸¦ ½ÃÀÛÇÑ´Ù. °¡Àå ÁÁÀº Á¶¿µÁõ°Àº Åõ¿©ÈÄ Ãʱ⠼öºÐ³»¿¡ ³ªÅ¸³´Ù(½Ã°£´ë´Â º´º¯À̳ª Á¶Á÷¿¡ µû¶ó ´Ù¸£´Ù). Á¶¿µÁõ°Àº Á¶¿µÁ¦ Åõ¿©ÈÄ 45ºÐ°£ À¯ÁöµÈ´Ù.  
- ÀÌ ¾àÀ» ½á¼ ´ëÁ¶µµ Áõ° ½ÃÇèÀ» ÇÒ¶§´Â T1 °Á¶ °Ë»ç¹ýÀÌ Æ¯È÷ ¾Ë¸Â´Ù. 0.15-1.5 Tesla »çÀÌ¿¡¼´Â »ó´ëÀû ¿µ»ó ´ëÁ¶µµ°¡ ÀÚÀåÀÇ °µµ¿Í ¹«°üÇÑ °ÍÀ¸·Î ³ªÅ¸³µ´Ù  
     
      	
     | 
   
  
  
  
  
  
  
  
  
  
  
  
  
  
  
  
   
    | ±Ý±â | 
    1) ÀÌ ¾àÀ̳ª ÀÌ ¾àÀÇ ¼ººÐ¿¡ ´ëÇÏ¿© °ú¹ÎÁõ»óÀ» º¸ÀÎ °æ·ÂÀÌ Àִ ȯÀÚ  
2) ½ÉÇÑ ½ÅÀåÇØ°¡ Àִ ȯÀÚ(ÁÖµÈ ¹è¼³°æ·Î°¡ ½ÅÀåÀ̰í½Å±â´ÉÀúÇÏ È¯ÀÚ¿¡¼´Â ¹è¼³Áö¿¬À̳ª ±Þ¼º½ÅºÎÀü µîÀÇ Áõ»óÀÌ ¾Ç鵃 ¿ì·Á°¡ ÀÖ´Ù.)  
3) ±ØµµÀÇ ¼è¾à ȯÀÚ  
4) ±â°üÁöõ½Ä ȯÀÚ(ÇØ¿Ü¿¡¼ ¼ï ¹ßÇöÀÇ Áõ·Ê°¡ º¸°íµÈ¹Ù ÀÖÀ½)  
5) ½ÉÇÑ °£ÀåÇØ°¡ Àִ ȯÀÚ(°£±â´É¿¡ ¿µÇâÀ» ¹ÌÄ¥¿ì·Á°¡ ÀÖÀ½)  
 | 
   
  
  
  
  
   
    | ½ÅÁßÅõ¿© | 
    1) ±â°üÁöõ½Ä ¶Ç´Â °ú¹Î¹ÝÀÀÀÇ °¡Á··ÂÀÌ Àִ ȯÀÚ  
2) °æ·Ã, °£ÁúÀÇ ±â¿Õ·Â ¶Ç´Â ÀÌ·¯ÇÑ ¼ÒÁúÀÌ ÀÖ´ÂȯÀÚ(ÇØ¿Ü¿¡¼ °æ·ÃÀÌ º¸°íµÈ ¹Ù ÀÖÀ½)  
3) °í·ÉÀÚ  
 | 
   
  
    
  
  
  
  
  
   
    | ÀÌ»ó¹ÝÀÀ | 
    
      1) ¿Ü±¹ÀÇ ½ÃÆÇ ÈÄ ÀÌ»ó¹ÝÀÀ º¸°í·ÎºÎÅÍ °¡µ¹¸®´½ Á¶¿µÁ¦ÀÇ 1ȸ Åõ¿© ¹× ¹Ýº¹ Åõ¿© ¸ðµÎ¿¡¼ NSF°¡ ¹ß»ýÇßÀ½ÀÌ È®ÀεǾú´Ù. º¸°íµÈ NSF »ç·Ê ¸ðµÎ¿¡¼ ƯÁ¤ Á¶¿µÁ¦ÀÇ Åõ¿©°¡ È®ÀÎµÈ °ÍÀº ¾Æ´Ï¾ú´Ù. Á¶¿µÁ¦°¡ È®ÀÎµÈ »ç·Ê Áß¿¡´Â °¡µµµð¾Æ¸¶À̵尡 °¡Àå ¸¹¾Ò°í, ±× ´ÙÀ½À¸·Î°¡µµÆæÅׯ¾»êµð¸Þ±Û·ç¹Î, °¡µµº£¸£¼¼Å¸¹Ìµå ¼øÀ̾ú´Ù. ¶ÇÇÑ °¡µµµð¾Æ¸¶À̵å¿Í°¡µµº£³×ÀÌÆ®µð¸Þ±Û·ç¹ÎÀ» ¼øÂ÷ÀûÀ¸·Î »ç¿ëÇÑ °æ¿ì¿Í °¡µµµð¾Æ¸¶À̵å¿Í °¡µµÅ׸®µ¹À» ¼øÂ÷ÀûÀ¸·Î »ç¿ëÇÑ °æ¿ì¿¡ NSF°¡¹ß»ýÇÑ »ç·Êµµ ÀÖ´Ù. °¢ °¡µ¹¸®´½ Á¶¿µÁ¦ÀÇ NSF º¸°í¿¹¼ö°¡´Ù¾çÇÑ °ÍÀº ¿©·¯ ¿äÀÎÀÌ º¹ÇÕµÈ °ÍÀÏ ¼ö ÀÖ´Ù. ÀÌ ¿äÀε鿡´Â ÀϺΠ°¡µ¹¸®´½Á¶¿µÁ¦ÀÇ Á¦ÇÑÀû »ç¿ë, NSF »ç·ÊÀÇ °ú¼Òº¸°í(under-reporting), Á¶¿µÁ¦ÀÇÆ¯¼º, ȯÀÚ¿¡ ´ëÇÑ ÀüüÀûÀÎ °¡µ¹¸®´½ Á¶¿µÁ¦ »ç¿ëÀÌ·ÂÀÇ ºÎÁ· µîÀÌ Æ÷Ç﵃ ¼ö ÀÖ´Ù.  
2) NSFÀÇ Áõ»óÀº ´ÙÀ½°ú °°´Ù:  
   ÇǺΠ: ÀÛ¿°¨, °¡·Á¿ò, Àû»ö ¶Ç´Â ¾îµÎ¿î ¹ÝÁ¡ ÇÇºÎ ÆØÀ±(swelling), °æÈ, °Á÷(tightening)  
   ´« : ´«ÈòÀÚÀ§¿¡ Ȳ»ö ¹ÝÁ¡  
   »À, °üÀý, ±ÙÀ° : °üÀý °Á÷(stiffness);ÆÈ, ¼Õ, ´Ù¸®, ¹ß µîÀÇ ¿òÁ÷ÀÓ Àå¾Ö µÐºÎ »À ¶Ç´Â ´Á°ñÀÇ ½ÉºÎÅë, ±Ù¹«·ÂÁõ  
3) ¼ï ¶Ç´Â ¾Æ³ªÇʶô½Ã¾ç ¹ÝÀÀÀÌ ÀϾ ¼ö ÀÖÀ¸¹Ç·Î Åõ¿©ÈÄ °üÂûÀ» ÃæºÐÈ÷ ÇÑ´Ù. ÀÌ»óÀÌ È®ÀεǸé ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù.  
4) ¶§¶§·Î Àü½ÅÀûÀÎ ¿Â¿°¨, ³Ã°¨ ¶Ç´Â ÁÖ»çºÎÀ§ÀDZ¹ºÎ¼º ¾Ð¹Ú°¨ ¶Ç´Â ÅëÁõÀÌ ³ªÅ¸³µ´Ù.  
5) Çö±âÁõ, ±¸¿ª,µÎÅë, ¸ÀÀ̳ª ³¿»õÀÇ º¯È°¡ µå¹°°Ô ³ªÅ¸³µ´Ù.  
6) µå¹°°Ô ±¸Åä, Á¹À½, Áö°¢ÀÌ»ó, ½Ã°¢Àå¾Ö, ¼³»ç, ºÒ¾È°¨, È£Èí°ï¶õ, ÈäÅë, ºó¸Æ, ÀüÀ², °üÀýÅë¹× µÎµå·¯±â, °¡·Á¿ò ¶Ç´Â ¸ñÀÇ Àڱذ¨°ú °°Àº ¾Ë·¯Áö¼º Áõ»óÀÌ ³ªÅ¸³µ´Ù.  
7) ´Ù¸¥ MRI Á¶¿µÁ¦ÀÇ °æ¿ì¿¡¼¿Í ¸¶Âù°¡Áö·Î ¸Å¿ìµå¹°°Ô ÀÌ ¾àÀÇ Åõ¿©·Î °æ·ÃÀÌ ³ªÅ¸³µÀ¸³ª ¾à¹°°úÀÇ °ü·Ã¼ºÀº È®ÀεÇÁö ¾Ê¾Ò´Ù.  
8) ÀÓ»ó½ÃÇè¿¡ Âü¿©ÇÑ È¯ÀÚÁß 1¸í¿¡¼ ÀϽÃÀûÀÎ ½ÅºÎÀüÀ̳ªÅ¸³µ´Ù. ÀÌ È¯ÀÚ´Â ÀÌ ¾àÀ» ÁÖ»çÇϱâ 22½Ã°£ Àü¿¡ ô¼ö°Á¶¿µ¼úÀ» À§ÇÑ X¼± Á¶¿µÁ¦¸¦ Åõ¿©¹Þ¾Ò´Ù. ¾à¹°°úÀÇ °ü·Ã¼ºÀºÈ®ÀεÇÁö ¾Ê¾Ò´Ù.  
      
     | 
   
        
  
  
  
    
  
  
       	
  
     
  
  
  
  
  
   
    | Related FDA Approved Drug | 
    
      
      ±âÁØ ¼ººÐ: GADODIAMIDEOMNISCAN (GADODIAMIDE) 
        
     | 
      
  
  
  |  
     
   
  
    
       |  
      
        
          
            
                | Á¤º¸¿ä¾à |         
             
           
         | 
             	    
       |  
      | 
  
    µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
    
  
  
    
  
   |  
     
   
  
    
       |  
      
        
          
            
                | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |         
             
           
         | 
             	    
       |  
      | 	 |  
     
   
  
    
       |  
      
        
          
            
                | Á¦Ç°Á¤º¸ |            
             
           
         | 
             	  
       |  
       |  
     
   
  
    
       |  
      
        
          
            
                | º¹¾àÁ¤º¸ |            
             
           
         | 
             	  
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
   
    | LACTmed ¹Ù·Î°¡±â | 
    
      
        [¹Ù·Î°¡±â]
     | 
     
  
  
   
    | ¾à¸®ÀÛ¿ë | 
    
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
       
     | 
     
  
  
       
  
  
   
    | º¹¾àÁöµµ | 
    
     
    À¯·áÁ¤º¸ÀÔ´Ï´Ù.
    
     | 
   
                                                          															
  
   
  
  
   
    | ÀӺο¡´ëÇÑÅõ¿© | 
    
      
      
        
	      
	      
	        | *  | 
	        
	          ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù. 
	         | 
	         
	       
	       | 
	   
	  
	    |   | 
	   
	  
	    
	      FDA : Cµî±Þ 
				        	
					  
					
	   | 
	  
	  
	  
	     
	     
	     
	     
	     
	     
	   | 
	 
	
	  
	      
	      
	        | *  | 
	        
	          »ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
	         | 
	         
	      
	        | *  | 
	        
	          ¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
	         | 
	         
	       
	   | 
	 
       
     | 
   
  
  
  	   
  
  	   
  
  	   
  
  
     
      | Pharmacokinetics | 
      
       
      À¯·áÁ¤º¸ÀÔ´Ï´Ù.
      
       |   
     
  
  
  
  
  
  
  	
  
  
  
   
    | º¹¾à¶óº§ | 
    
    
    
      | À̹ÌÁö | 
      º¹¾à¼³¸í | 
     
    
    
        | 
      ¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. | 
     
    
       | 
     
    
     |  
    
      
	
	  
            | *  | 
	    º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. | 
	   
	  
            | *  | 
	    º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. | 
	   
	  
            | *  | 
	    ±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. | 
	   
	   
     |   
     | 
   
  	
  
  
  
   
    | º¸°ü»ó ÁÖÀÇ | 
    
      
    	
     | 
   
  
  
   
    | Á¶Á¦½Ã ÁÖÀÇ | 
    
      
    	
     | 
      
 
 |  
     
   
  
    
       |  
      
        
          
            
                | ½É»çÁ¤º¸ |            
             
           
         | 
             	  
       |  
       |  
     
     
  
    
       |  
      
        
          
            
                | ÇмúÁ¤º¸ |          
             
           
         | 
             	  
       |  
      
  
    | Ç׸ñ | 
    ³»¿ë | 
   
  
    | DUR (ÀǾàǰ»ç¿ëÆò°¡) | 
    º´¿ë±Ý±â :
     
	 °í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
	 
	  [»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]										
	  ¿¬·É´ë±Ý±â :
      °í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
      
       [¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
       
       
        
        
     | 
   
  
   
    | Mechanism of Action | 
    
       Gadodiamide¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Based on the behavior of protons when placed in a strong magnetic field, which is interpreted and transformed into images by magnetic resonance (MR) instruments. Paramagnetic agents have unpaired electrons that generate a magnetic field about 700 times larger than the proton's field, thus disturbing the proton's local magnetic field. When the local magnetic field around a proton is disturbed, its relaxation process is altered. MR images are based on proton density and proton relaxation dynamics. MR instruments can record 2 different relaxation processes, the T1 (spin-lattice or longitudinal relaxation time) and the T2 (spin-spin or transverse relaxation time). In magnetic resonance imaging (MRI), visualization of normal and pathological brain tissue depends in part on variations in the radiofrequency signal intensity that occur with changes in proton density, alteration of the T1, and variation in the T2. When placed in a magnetic field, gadodiamide shortens both the T1 and the T2 relaxation times in tissues where it accumulates. At clinical doses, gadodiamide primarily affects the T1 relaxation time, thus producing an increase in signal intensity. Gadodiamide does not cross the intact blood-brain barrier; therefore, it does not accumulate in normal brain tissue or in central nervous system (CNS) lesions that have not caused an abnormal blood-brain barrier (e.g., cysts, mature post-operative scars). Abnormal vascularity or disruption of the blood-brain barrier allows accumulation of gadodiamide in lesions such as neoplasms, abscesses, and subacute infarcts. 
     | 
   
  
   
    | Pharmacology | 
     
       Gadodiamide¿¡ ´ëÇÑ Pharmacology Á¤º¸ Not Available 
     | 
   
  
   
    | Absorption | 
    
       Gadodiamide¿¡ ´ëÇÑ Absorption Á¤º¸ Not Available 
     | 
   
  
   
    | Pharmacokinetics | 
    
       GadodiamideÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á 
- Èí¼ö 
 
1)onset : Åõ¿©ÈÄ ¹Ù·Î ¹ÝÀÀÀÌ ³ªÅ¸³² 
2)duration : 1ȸ¿ë·® ÁÖ»ç ÈÄ ¾à 4½Ã°£ À¯Áö  
 - ºÐÆ÷ 
 
1)Á¶Á÷À¸·ÎÀÇ ºÐÆ÷´Â ¸Å¿ì ³·À¸¸ç °ÅÀÇ 100% ¼¼Æ÷¿Ü¾×À¸·Î ºÐÆ÷ 
2)¹Ý°¨±â : 37ºÐ 
3)ºÐÆ÷¿ëÀû : 200ml/kg·Î ¼¼Æ÷¿Ü¾Ö°ú °ÅÀÇ µ¿ÀÏ 
 - ´ë»ç : °ÅÀÇ ´ë»çµÇÁö ¾Ê°í ¼Òº¯À¸·Î ¹Ìº¯Èü ¹è¼³
 
 - ¹è¼³ 
 
1)½Å¹è¼³ : 95%ÀÌ»ó (24½Ã°£À̳»¿¡ °ÅÀÇ ¸ðµÎ ¹è¼³, 95-99%) 
2)¹Ý°¨±â : 77.8ºÐ(¸ðÈÇÕ¹°) 
´Ü, ½Å±â´É ÀúÇÏȯÀÚ¿¡¼ ¹è¼³ ¹Ý°¨±â´Â 34.3½Ã°£±îÁö ¿¬ÀåµÇ¸ç ȯÀÚ¸¶´Ù ´Ù¾ç 
3)feces : 0.4% 
4)¸ðÀ¯ : ¾Ë·ÁÁöÁö ¾ÊÀ½  
     | 
   
  
   
    | Toxicity | 
    
       Gadodiamide¿¡ ´ëÇÑ Toxicity Á¤º¸ Not Available 
     | 
   
  
   
    | Drug Interactions | 
    
       Gadodiamide¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Alprazolam	The protease inhibitor increases the effect of the benzodiazepineChlordiazepoxide	The protease inhibitor increases the effect of the benzodiazepineClonazepam	The protease inhibitor increases the effect of the benzodiazepineClorazepate	The protease inhibitor increases the effect of the benzodiazepineDiazepam	The protease inhibitor increases the effect of the benzodiazepineEstazolam	The protease inhibitor increases the effect of the benzodiazepineFlurazepam	The protease inhibitor increases the effect of the benzodiazepineHalazepam	The protease inhibitor increases the effect of the benzodiazepineMidazolam	The protease inhibitor increases the effect of the benzodiazepinePrazepam	The protease inhibitor increases the effect of the benzodiazepineQuazepam	The protease inhibitor increases the effect of the benzodiazepineTriazolam	The protease inhibitor increases the effect of the benzodiazepineWarfarin	The protease inhibitor increases the anticoagulant effectAcenocoumarol	The protease inhibitor increases the anticoagulant effectDicumarol	The protease inhibitor increases the anticoagulant effectAnisindione	The protease inhibitor increases the anticoagulant effectVardenafil	The protease inhibitor increases the effect and toxicity of vardenafilCyclosporine	The protease inhibitor increases the effect of cyclosporineFentanyl	The protease inhibitor increases the effect and toxicity of fentanylPimozide	The protease inhibitor increases the effect and toxicity of pimozideSildenafil	The protease inhibitor increases the effect and toxicity of sildenafilVitamin C	Vitamin C decreases indinavir levelsTrazodone	This strong CYP3A4 inhibitor increases the effect and toxicity of trazodoneTerfenadine	Increased risk of cardiotoxicity and arrhythmiasAstemizole	Increased risk of cardiotoxicity and arrhythmiasCisapride	Increased risk of cardiotoxicity and arrhythmiasDelavirdine	Delavirdine increases the effect of indinavirClarithromycin	Clarithromycin increases the effect and toxicity of indinavirCarbamazepine	Indinavir increases the effect and toxicity of carbamazepineAtorvastatin	Increases the effect and toxicity of atorvastatinAmiodarone	Indinavir increases the effect and toxicity of amiodaroneEfavirenz	Efavirenz decreases the effect of indinavirErlotinib	This CYP3A4 inhibitor increases levels/toxicity of erlotinibEsomeprazole	Omeprazole decreases the absorption of indinavirOmeprazole	Omeprazole decreases the absorption of indinavirLansoprazole	Omeprazole decreases the absorption of indinavirPantoprazole	Omeprazole decreases the absorption of indinavirRabeprazole	Omeprazole decreases the absorption of indinavirFusidic Acid	Increases the effect and toxicity of fusidic acidKetoconazole	Ketoconazole increases the efefct of indinavirRanolazine	Increased levels of ranolazine - risk of toxicity Rifabutin	Rifabutin decreases the effect of indinavirRifampin	Rifampin decreases the effect of indinavirSt. John's Wort	St. John's Wort decreases the effect of indinavirSunitinib	Possible increase in sunitinib levelsTacrolimus	Increases the effect and toxicity of tacrolimusSaquinavir	Possible antagonism of actionRisperidone	Increased risk of extrapyramidal symptomsQuinupristin	This combination presents an increased risk of toxicityAluminium	The antacid decreases the absorption of indinavirAtazanavir	Increased risk of hyperbilirubinemia with this associationBismuth	The antacid decreases the absorption of indinavirCalcium	The antacid decreases the absorption of indinavirMagnesium oxide	The antacid decreases the absorption of indinavirMagnesium	The antacid decreases the absorption of indinavirErgotamine	Increases the effect and toxicity of the ergot derivativeDihydroergotamine	Increases the effect and toxicity of the ergot derivative 
     | 
   
  
   
    CYP450  Drug Interaction | 
    
      [CYP450 TableÁ÷Á¢Á¶È¸] 
     | 
   
  
   
    | Description | 
    
       Gadodiamide¿¡ ´ëÇÑ Description Á¤º¸ Gadodiamide is a gadolinium based contrast agent used in MR imaging procedures to assist in the visualization of blood vessels. It is commonly marketed under the trade name Omniscan. [Wikipedia] 
     | 
   
  
   
    | Dosage Form | 
    
       Gadodiamide¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Solution	Intravenous 
     | 
   
  
   
    | Drug Category | 
    
       Gadodiamide¿¡ ´ëÇÑ Drug_Category Á¤º¸ Contrast Media 
     | 
   
  
   
    | Smiles String Canonical | 
    
       Gadodiamide¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ O.[Gd+3].CNC(=O)CN(CCN(CCN(CC([O-])=O)CC(=O)NC)CC([O-])=O)CC([O-])=O 
     | 
   
  
   
    | Smiles String Isomeric | 
    
       Gadodiamide¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ O.[Gd+3].CNC(=O)CN(CCN(CCN(CC([O-])=O)CC(=O)NC)CC([O-])=O)CC([O-])=O 
     | 
   
  
   
    | InChI Identifier | 
    
       Gadodiamide¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C16H29N5O8.Gd.H2O/c1-17-12(22)7-20(10-15(26)27)5-3-19(9-14(24)25)4-6-21(11-16(28)29)8-13(23)18-2;;/h3-11H2,1-2H3,(H,17,22)(H,18,23)(H,24,25)(H,26,27)(H,28,29);;1H2/q;+3;/p-3/fC16H26N5O8.Gd.H2O/h17-18H;;/q-3;m; 
     | 
   
  
   
    | Chemical IUPAC Name | 
    
       Gadodiamide¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 2-[bis[2-[(2-methylamino-2-oxoethyl)-(2-oxido-2-oxoethyl)amino]ethyl]amino]acetate; gadolinium(+3) cation; hydrate 
     | 
   
    
  |  
     
     
  
    
       |  
      
        
          
            
                | »ç¿ëÀÚÄÁÅÙÃ÷ |           
             
           
         | 
             	  
       |  
       |  
     
         
 
     | 
   
   
     | 
   
  
    
      
        
          
            
              - 
                ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2021-12-09
              
 
              - 
                
                 º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
                
              
     
             
         |                 
       
     |       
          
                
                    
                       ¾Ë¸² | 
                       
                      »ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù.  | 
                    
                    | 
               
      
      
                
                    
                       °æ°í | 
                     
                      µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù. 
                          Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â 
                          Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
                            ¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
                          ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
 | 
  
                    | 
               
  
 
  
    ¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é 
    ¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
   
  
 
  º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
 
  
  |  
                           
                         | 
                       
                      | 
                   |