| |
|
|
|
|
|
 |
| |
|
리바콤연질캅셀 LIVACOM SOFTCAP.[고량강 , Aloe , Gentiana dried extract , L-cysteine , Orotic acid]
|
|
일반의약품 | 비급여
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
비급여
[상병코드조회]
[질병코드조회]
|
| 빠른조회 |
|
| 제품성상 |
황갈색의 유상물질이 들어 있는 한면 적색,이면 쵸코색의 타원형연질캅셀 [제형정보 확인] |
| 효능효과 |
[적응증 별 검색]
다음 질환의 치료보조 : 간질환, 담낭질환, 간인성 위장장애 및 변비
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
성인 1회 1캅셀, 1일 1-3회 식후 복용한다.
연령 및 증상에 따라 적절히 증감한다.
|
| 금기 |
- 중증 간기능장애 환자
- 담도폐쇄환자
- 담낭농양환자
- 장폐쇄증환자
- 임신부
|
| 이상반응 |
- 단백뇨, 혈뇨, 장근신경총의 손상이 일어날 수 있다.
- 설사를 일으킬 수 있으므로 이러한 증상이 나타나는 경우에는 투여량을 줄이거나 투여를 중지한다.
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| 항목 |
내용 |
| BIT 약효분류 |
담즙산분비촉진제 & 간보호제 (Cholelitholitics & Hepatic Protectors)
|
| ATC 코드 |
BILE AND LIVER THERAPY / A05
[코드분류상세설명]
[ATC코드예측]
|
| 복지부분류코드 |
391 (간장질환용제 )
|
| Drugs By Indication |
[전체보기]
|
| Drugs By Classification |
[전체보기]
|
|
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| Pharmacokinetics |
유료정보입니다.
|
| 병용금기 및 연령대금기 근거조회 |
[병용금기 및 연령대금기 근거조회]
|
| 복약라벨 |
| 이미지 |
복약설명 |
 |
임산부 또는 임신계획중 복용금지 |
|
|
| * |
복약이미지는 모든 복약지도 사항을 표시한것은 아니며, 추가적으로 업데이트되거나 수정될 수 있습니다. |
| * |
복약이미지의 표시여부는 실제 약물복용시 중요도에 따른것은 아니며 단순히 허가정보상 키워드를 기준으로 등록되었습니다. |
| * |
귀하가 복약이미지 정보를 신뢰함은 전적으로 귀하의 책임입니다. 드럭인포는 이에 대한 어떠한 보증도 하지 않습니다. |
|
|
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| Mechanism of Action |
L-cysteine에 대한 Mechanism_Of_Action 정보
Although classified as a non-essential amino acid cysteine may be essential for infants, the elderly, and individuals with certain metabolic disease or who suffer from malabsorption syndromes. Cysteine can usually be synthesized by the human body under normal physiological conditions if a sufficient quantity of methionine is available. Due to the ability of thiols to undergo redox reactions, cysteine has antioxidant properties. Cysteine's antioxidant properties are typically expressed in the tripeptide glutathione, which occurs in humans as well as other organisms. The systemic availability of oral glutathione (GSH) is negligible; so it must be biosynthesized from its constituent amino acids, cysteine, glycine, and glutamic acid. Glutamic acid and glycine are readily available in the diets of most industrialized countries, but the availability of cysteine can be the limiting substrate. Cysteine is also an important source of sulfide in human metabolism. The sulfide in iron-sulfur clusters and in nitrogenase is extracted from cysteine, which is converted to alanine in the process. In a 1994 report released by five top cigarette companies, cysteine is one of the 599 additives to cigarettes. Its use or purpose, however, is unknown, like most cigarette additives. Its inclusion in cigarettes could offer two benefits: Acting as an expectorant, since smoking increases mucus production in the lungs; and increasing the beneficial antioxidant glutathione (which is diminished in smokers).
|
| Pharmacology |
L-cysteine에 대한 Pharmacology 정보
Due to this ability to undergo redox reactions, cysteine has antioxidant properties. Cysteine is an important source of sulfur in human metabolism, and although it is classified as a non-essential amino acid, cysteine may be essential for infants, the elderly, and individuals with certain metabolic disease or who suffer from malabsorption syndromes. Cysteine may at some point be recognized as an essential or conditionally essential amino acid.
|
| Metabolism |
L-cysteine에 대한 Metabolism 정보
# Phase_1_Metabolizing_Enzyme:Not Available
|
| Pharmacokinetics |
Aloe의 약물동력학자료
- 완하효과 발현시간 : 경구 : 대개 6-12 시간 이내
- 흡수 :
- 경구 투여시 소장에서는 소량만이 흡수된다.
- 대장에서 장관세균총의 효소에 의하여 glycosides의 대부분이 가수분해되어 약리활성을 지닌 유리형 anthraquinones으로 변환된다.
- 대사 : 흡수된 약물은 간에서 대사된다.
- 소실 : 뇨, 담즙, 대변을 통해 부분적으로 배설된다.
|
| Biotransformation |
L-cysteine에 대한 Biotransformation 정보
Not Available
|
| Toxicity |
L-cysteine에 대한 Toxicity 정보
Not Available
|
| Drug Interactions |
L-cysteine에 대한 Drug_Interactions 정보
Not Available
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Drug Target |
[Drug Target]
|
| Description |
L-cysteine에 대한 Description 정보
A thiol-containing non-essential amino acid that is oxidized to form cystine. [PubChem]
|
| Dosage Form |
L-cysteine에 대한 Dosage_Form 정보
Not Available
|
| Drug Category |
L-cysteine에 대한 Drug_Category 정보
Dietary supplementNutritional Supplement
|
| Smiles String Canonical |
L-cysteine에 대한 Smiles_String_canonical 정보
NC(CS)C(O)=O
|
| Smiles String Isomeric |
L-cysteine에 대한 Smiles_String_isomeric 정보
N[C@@H](CS)C(O)=O
|
| InChI Identifier |
L-cysteine에 대한 InChI_Identifier 정보
InChI=1/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1/f/h5H
|
| Chemical IUPAC Name |
L-cysteine에 대한 Chemical_IUPAC_Name 정보
(2R)-2-amino-3-sulfanylpropanoic acid
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2012-03-02
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
|
|
|
|
전문/일반
