| |
|
|
|
|
|
 |
| |
|
·¹Å©³ëÀΰÖ0.025% RECKNOIN GEL[Tretinoin]
|
|
ÀϹÝÀǾàǰ | ºñ±Þ¿©
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
ºñ±Þ¿©
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
ƯÀÌÃë°¡ Àִ ȸ¹é»öÀÇ ¿¬°íÁ¦ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
6G, 25G |
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
½É»ó¼º¿©µå¸§(º¸Åë¿©µå¸§)
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
1ÀÏ 1ȸ(Ãëħ½Ã) ¶Ç´Â 2ȸ Àû´ç·®À» ȯºÎ¿¡ ¹Ù¸¥´Ù. ¹Î°¨ÇÑ ÇǺÎÀÇ Ä¡·á½Ã¿¡´Â 1ÀÏ 1ȸ ¶Ç´Â ÀÌÆ²¿¡ ÇÑ ¹ø¾¿ Àû¿ëÇÑ´Ù. Áõ»ó¿¡ µû¶ó ÀûÀýÈ÷ Áõ°¨ÇÑ´Ù.
|
| ±Ý±â |
- ÀÌ ¾à ¹× ÀÌ ¾à ¼ººÐ¿¡ °ú¹ÎÁõ ¶Ç´Â ±× º´·ÂÀÌ Àִ ȯÀÚ
- ÇǺΠ»óÇÇÁ¾ ¹× ±× º´·Â ¶Ç´Â °¡Á··ÂÀÌ Àִ ȯÀÚ
- ½ÀÁø, Àý»ó, Âû°ú»ó ȯÀÚ
- ž籤¼±¿¡ ź ȯÀÚ(ž籤¼±¿¡ ´ëÇÑ °¨¼ö¼ºÀÌ Áõ°¡µÉ ¼ö ÀÖÀ¸¹Ç·Î ¿ÏÀüÈ÷ ȸº¹µÉ ¶§±îÁö ÀÌ ¾àÀ» »ç¿ëÇÏÁö ¾Ê´Â´Ù)
- ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀÎ ¹× ¼öÀ¯ºÎ
- ±Þ¼º ÇǺο° ¹× ÁÖ»ç(rosacea) ȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
- °³Àο¡ µû¶ó ¹Î°¨ÇÑ ÇǺδ ¹ßÀû, ºÎÁ¾, Æ÷Áø ¶Ç´Â °¡Çǰ¡ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¸ç ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â ÀÌ ¾àÀÇ »ç¿ëÀ» Á¶ÀýÇϰųª ÁßÁöÇÑ´Ù.
- ÇǺΰÇÁ¶, ÀÛ¿°¨, Âñ¸° »óó, ¿Â°¨(è®Êï), È«¹Ý, °¡·Á¿ò, ¹ßÁø, ¹Ú¸®, ž籤¼±¿¡ ź °Í°ú °°Àº ÇǺÎÀÇ ÀÚ±ØÀÌ Á¸ÀçÇÏ´Â °æ¿ì¿¡´Â ÀÌ·¯ÇÑ Áõ»óµéÀÌ »ç¶óÁø ÈÄ¿¡ ÀÌ ¾àÀ¸·Î Ä¡·á¸¦ ½ÃÀÛÇϰųª Àç°³ÇÏ´Â °ÍÀÌ ¹Ù¶÷Á÷ÇÏ´Ù.
- µå¹°°Ô Á¢Ã˼º ¾Ë·¹¸£±â µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
- ¿¬¿ëÇÒ °æ¿ì ÀϽÃÀûÀÎ °ú´Ù ¶Ç´Â °ú¼Ò »ö¼ÒÄ§ÂøÀÌ ³ªÅ¸³´Ù´Â º¸°í°¡ ÀÖ´Ù.
- ž籤¼±¿¡ ´ëÇÑ °¨¼ö¼ºÀÌ Áõ°¡ÇÒ ¼ö ÀÖ´Ù.
- ¹Ù¶÷À̳ª ÃßÀ§, ³·Àº ½Àµµ µî ±ØÇÑ ³¯¾¾°¡ ÀÌ ¾àÀ» Àû¿ëÇϴ ȯÀÚ¿¡°Ô ÀÚ±ØÀÌ µÉ ¼ö ÀÖÀ¸¸ç °ÇÁ¶°¨À» Áõ°¡½Ãų ¼ö ÀÖ´Ù.
- ÀÌ ¾à Åõ¿©¿¡ ÀÇÇÑ È°¹ßÇÑ Ä¡·á È¿°ú¸¦ ÀǹÌÇÏ´Â °æÁõÀÇ È«¹Ý, ¹ÚÆí, ¹Ú¸®¿Í °°Àº ±â´ëµÇ´Â ÇǺÎÀÇ º¯È°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
- Ä¡·á¸¦ ½ÃÀÛÇÑÁö 1-5ÁÖ À̳»¿¡ °æ¹ÌÇÑ ÇǺιßÀûÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¸ç °ÇÑ ÇǺÎÀڱذ¨ÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â Åõ¿©°£°ÝÀ» ´ÃÀ̰ųª Á¦Á¦ÀÇ ³óµµ¸¦ Á¶ÀýÇÑ´Ù.
- ÁßÁõ ¶Ç´Â Áö¼ÓÀûÀÎ ÀÚ±Ø Áõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¸ç ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »óÀÇÇÑ´Ù.
|
| »óÈ£ÀÛ¿ë |
- ¼³ÆÄÁ¦, ·¹¼Ò¸£½Ã³î, °ú»êȺ¥Á¶ÀÏ, »ì¸®½Ç»ê µî°ú º´¿ëÇÒ °æ¿ì »óÈ£ÀÛ¿ëÀÌ ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù. ¶ÇÇÑ °¢Áú¿ëÇØÁ¦¸¦ »ç¿ëÇÑ È¯ÀÚ´Â ±× ¾àÀÇ È¿°ú°¡ ¾ø¾îÁø ÈÄ ÀÌ ¾àÀ» »ç¿ëÇÑ´Ù.
- ¾à¿ëºñ´©, ¿¬¸¶ºñ´©, ¼¼Ã´Á¦ ¹× °·ÂÇÑ °ÇÁ¶ÀÛ¿ëÀ» °¡Áö°í ÀÖ´Â ÈÀåǰ, °í³óµµÀÇ ¾ËÄÚ¿ÃÀ» ÇÔÀ¯ÇÑ Á¦Á¦ ¶Ç´Â ¼ö·ÅÁ¦, Çâ½Å·á ¶Ç´Â ¼®È¸ µîÀº ÀÌ ¾à°ú »óÈ£ÀÛ¿ëÀ» ÀÏÀ¸Å³ ¼ö ÀÖÀ¸¹Ç·Î ÁÖÀÇÇÑ´Ù.
- UV ¶Ç´Â X¼± Á¶»ç´Â ÇǺÎÀÚ±ØÀ» Áõ°¡½Ãų ¼ö ÀÖ´Ù.
- ÄÚ¸£Æ¼ÄÚÀ̵å¿ÍÀÇ Àå±â°£ º´¿ëÅõ¿©½Ã ¿©µå¸§ÀÌ ³ªÅ¸³ª±â ½¬¿ì¹Ç·Î ±ÇÀåµÇÁö ¾Ê´Â´Ù.
- ´Ù¸¥ ±¹¼Ò Àû¿ë ¾à¹°¿¡ ´ëÇÑ Åõ°ú¼ºÀÌ Áõ°¡ÇÒ ¼ö ÀÖ´Ù.
|
| Off-label Usage |
[Á¶È¸]
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
(tretinoin topical. )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
ÀÓ»êºÎ ¶Ç´Â ÀӽŰèȹÁß º¹¿ë±ÝÁö |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Tretinoin¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Tretinoin binds to alpha, beta, and gamma retinoic acid receptors (RARs). RAR-alpha and RAR-beta have been associated with the development of acute promyelocytic leukemia and squamous cell cancers, respectively. RAR-gamma is associated with retinoid effects on mucocutaneous tissues and bone. Although the exact mechanism of action of tretinoin is unknown, current evidence suggests that the effectiveness of tretinoin in acne is due primarily to its ability to modify abnormal follicular keratinization. Comedones form in follicles with an excess of keratinized epithelial cells. Tretinoin promotes detachment of cornified cells and the enhanced shedding of corneocytes from the follicle. By increasing the mitotic activity of follicular epithelia, tretinoin also increases the turnover rate of thin, loosely-adherent corneocytes. Through these actions, the comedo contents are extruded and the formation of the microcomedo, the precursor lesion of acne vulgaris, is reduced. Tretinoin is not a cytolytic agent but instead induces cytodifferentiation and decreased proliferation of APL cells in culture and in vivo. When Tretinoin is given systemically to APL patients, tretinoin treatment produces an initial maturation of the primitive promyelocytes derived from the leukemic clone, followed by a repopulation of the bone marrow and peripheral blood by normal, polyclonal hematopoietic cells in patients achieving complete remission (CR). The exact mechanism of action of tretinoin in APL is unknown.
|
| Pharmacology |
Tretinoin¿¡ ´ëÇÑ Pharmacology Á¤º¸ Tretinoin, also known as all-trans-retinoic acid (ATRA), is a naturally occurring derivative of vitamin A (retinol). Retinoids such as tretinoin are important regulators of cell reproduction, proliferation, and differentiation and are used to treat acne and photodamaged skin and to manage keratinization disorders such as ichthyosis and keratosis follicularis. Tretinoin also represents the class of anticancer drugs called differentiating agents and is used in the treatment of acute promyelocytic leukemia (APL).
|
| Metabolism |
Tretinoin¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 2C8 (CYP2C8)
|
| Protein Binding |
Tretinoin¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ > 95%
|
| Half-life |
Tretinoin¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 0.5-2 hours
|
| Absorption |
Tretinoin¿¡ ´ëÇÑ Absorption Á¤º¸ 1-31% (topical)
|
| Pharmacokinetics |
TretinoinÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ÀÛ¿ë¹ßÇö½Ã°£ : ¿©µå¸§ : ±¹¼ÒÀû¿ë : 2-3ÁÖ
- ÃÖ´ëÈ¿°ú ¹ßÇö½Ã°£ : ¿©µå¸§ : ±¹¼ÒÀû¿ë : 6ÁÖ ÀÌ»ó
- Èí¼ö : ±¹¼Ò Àû¿ë : Àü½Å Èí¼ö´Â Àû´Ù.
- ´ë»ç : Àü½ÅÀûÀ¸·Î Èí¼öµÈ ¼Ò·®Àº °£¿¡¼ ´ë»çµÈ´Ù.
- ¼Ò½Ç : ¼Òº¯, ´ãÁóÀ» ÅëÇØ ¹è¼³µÈ´Ù.
|
| Biotransformation |
Tretinoin¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic
|
| Toxicity |
Tretinoin¿¡ ´ëÇÑ Toxicity Á¤º¸ Not Available
|
| Drug Interactions |
Tretinoin¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Tretinoin¿¡ ´ëÇÑ Description Á¤º¸ Tretinoin, also known as all-trans-retinoic acid (ATRA), is a naturally occurring derivative of vitamin A (retinol). Retinoids such as tretinoin are important regulators of cell reproduction, proliferation, and differentiation and are used to treat acne and photodamaged skin and to manage keratinization disorders such as ichthyosis and keratosis follicularis. Tretinoin also represents the class of anticancer drugs called differentiating agents and is used in the treatment of acute promyelocytic leukemia (APL).
|
| Dosage Form |
Tretinoin¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Capsule OralCream TopicalGel TopicalLiquid Topical
|
| Drug Category |
Tretinoin¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antineoplastic AgentsCell Stimulants and ProliferantsKeratolytic Agents
|
| Smiles String Canonical |
Tretinoin¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(O)=O
|
| Smiles String Isomeric |
Tretinoin¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CC(\C=C\C1=C(C)CCCC1(C)C)=C/C=C/C(C)=C/C(O)=O
|
| InChI Identifier |
Tretinoin¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C20H28O2/c1-15(8-6-9-16(2)14-19(21)22)11-12-18-17(3)10-7-13-20(18,4)5/h6,8-9,11-12,14H,7,10,13H2,1-5H3,(H,21,22)/f/h21H
|
| Chemical IUPAC Name |
Tretinoin¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexenyl)nona-2,4,6,8-tetraenoic acid
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2024-09-07
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|