|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
649603100[A05403220]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1Á¤(2006.11.01)(ÇöÀç¾à°¡)
\21 ¿ø/1Á¤(2005.10.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¿¬ÇÑ °¥»öÀÇ ¿øÇü Á¤Á¦ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
20Á¤, 180Á¤ |
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
À§¤ý½ÊÀÌÁöÀå±Ë¾ç, À§»ê°ú´Ù, À§¿°
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
¼ºÀÎ 1ȸ 2Á¤, 1ÀÏ 3ȸ ½Ä°£ ¹× Ãëħ½Ã¿¡ º¹¿ëÇÑ´Ù
|
| ±Ý±â |
´ÙÀ½ ȯÀÚ¿¡´Â Åõ¿©ÇÏÁö ¸» °Í.
1) ÁßÁõ ±Ù¹«·ÂÁõ ȯÀÚ
2) ±Þ¼º Çù¿ì°¢ ³ì³»Àå ȯÀÚ
3) ÀÌ ¾à¿¡ °ú¹ÎÁõ ȯÀÚ
|
| ½ÅÁßÅõ¿© |
´ÙÀ½ ȯÀÚ¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÒ °Í.
1) °í·ÉÀÚ
2) À¯¤ý¼Ò¾Æ
3) ÀӺΠ¹× °¡ÀÓºÎ
4) ¾àÀ¸·Î ¾Ë·¹¸£±â Áõ»ó(¹ßÁø, ¹ßÀû, °¡·Á¿òµî)À» ÀÏÀ¸Å² ÀÏÀÌ Àִ ȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
1) º¯ºñ, Çö±â, ±¸°¥ µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
2) ÀÌ ¾àÀ» Åõ¿©ÇÔÀ¸·Î½á ¾Ë·¹¸£±âÁõ»ó(¹ßÁø, °¡·Á¿òµî)ÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÏ°í ¾à»ç ¶Ç´Â ÀÇ»ç¿Í »óÀÇÇÑ´Ù.
|
| »óÈ£ÀÛ¿ë |
À§ÀåÁøÅëÁø°æÁ¦¿Í º´¿ëÅõ¿©ÇÏÁö ¾Ê´Â´Ù.
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| ¼ººÐÄÚµå |
M080221/½ºÄÚÆú¸®¾Æ¿¢½º 10¹Ð¸®±×·¥ /
M051574/Å׸¶Á¦ÆÊ 2.4¹Ð¸®±×·¥ /
M050753/¼öÅ©¶öÆäÀÌÆ® 400¹Ð¸®±×·¥ /
|
| ´ëÇ¥ÄÚµå |
8806496031007 |
| BIT ¾àÈ¿ºÐ·ù |
±Ë¾çÄ¡·áÁ¦ (Antiulcerants)
|
| ATC ÄÚµå |
Other drugs for peptic ulcer and gastro-oesophageal reflux disease (GORD) / A02BX
[ÄÚµåºÐ·ù»ó¼¼¼³¸í]
[ATCÄÚµå¿¹Ãø]
|
| º¹ÁöºÎºÐ·ùÄÚµå |
232 (¼Òȼº±Ë¾ç¿ëÁ¦ )
|
| ÀǾàǰ ¹ÙÄÚµåÁ¤º¸ |
³»¿ëº¸±â
8806105005603//º´//1 ´ÜÀ§/¼ö·®: 1000 8806105005610//PTP//1 ´ÜÀ§/¼ö·®: 180 8806105005634//PTP//1 ´ÜÀ§/¼ö·®: 10 8806105005658//PTP//1 ´ÜÀ§/¼ö·®: 20 8806105005627//PTP//10 ´ÜÀ§/¼ö·®: 1800 8806105005641//PTP//50 ´ÜÀ§/¼ö·®: 500 8806105005665//PTP//50 ´ÜÀ§/¼ö·®: 1000
|
| Drugs By Indication |
[Àüüº¸±â]
|
| Drugs By Classification |
[Àüüº¸±â]
|
|
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Xµî±Þ
(temazepam; )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Sucralfate¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Although sucralfate's mechanism is not entirely understood, there are several factors that most likely contribute to its action. Sucralfate, with its strong negative charge, binds to exposed positively-charged proteins at the base of ulcers. In this way, it coats the ulcer and forms a physical barrier that protects the ulcer surface from further injury by acid and pepsin. It directly inhibits pepsin (an enzyme that breaks apart proteins) in the presence of stomach acid and binds bile salts coming from the liver via the bile thus protecting the stomach lining from injury caused by the bile acids. Sucralfate may increase prostaglandin production, and prostaglandins are known to protect the lining of the stomach and may also bind epithelial growth factor and fibroblast growth factor, both of which enhance the growth and repair mechanism of the stomach lining.
Temazepam¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Benzodiazepines bind nonspecifically to benzodiazepine receptors, which affects muscle relaxation, anticonvulsant activity, motor coordination, and memory. As benzodiazepine receptors are thought to be coupled to gamma-aminobutyric acid-A (GABAA) receptors, this enhances the effects of GABA by increasing GABA affinity for the GABA receptor. Binding of the inhibitory neurotransmitter GABA to the site opens the chloride channel, resulting in a hyperpolarized cell membrane that prevents further excitation of the cell.
|
| Pharmacology |
Sucralfate¿¡ ´ëÇÑ Pharmacology Á¤º¸ Sucralfate is a prescription medication used to treat peptic ulcers. The current clinical uses of sucralfate are limited. It is effective for the healing of duodenal ulcers, but it is not frequently used for this since more effective drugs (e.g. proton pump inhibitors) have been developed. Although the mechanism of sucralfate's ability to accelerate healing of duodenal ulcers remains to be fully defined, it is known that it exerts its effect through a local, rather than systemic, action. Chemically, sucralfate is a complex of the disaccharide sugar, sucrose, combined with sulfate and aluminum. In acidic solutions (e.g. gastric acid) it forms a thick paste that has a strong negative charge.
Temazepam¿¡ ´ëÇÑ Pharmacology Á¤º¸ Temazepam is a benzodiazepine used as a hypnotic agent in the management of insomnia. Temazepam produces CNS depression at limbic, thalamic, and hypothalamic levels of the CNS. Temazepam increases the affinity of the neurotransmitter gamma-aminobutyric acid (GABA) for GABA receptors by binding to benzodiazepine receptors. Results are sedation, hypnosis, skeletal muscle relaxation, anticonvulsant activity, and anxiolytic action.
|
| Metabolism |
Sucralfate¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Not Available
Temazepam¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 2C19 (CYP2C19)
|
| Absorption |
Sucralfate¿¡ ´ëÇÑ Absorption Á¤º¸ Minimally absorbed from the gastrointestinal tract (up to 5% of the disaccharide component and less than 0.02% of aluminum).
Temazepam¿¡ ´ëÇÑ Absorption Á¤º¸ Well absorbed, minimal first-pass metabolism.
|
| Toxicity |
Sucralfate¿¡ ´ëÇÑ Toxicity Á¤º¸ Acute oral toxicity (LD50) in mice is >8000 mg/kg. There is limited experience in humans with overdosage of sucralfate. Sucralfate is only minimally absorbed from the gastrointestinal tract and thus risks associated with acute overdosage should be minimal. In rare reports describing sucralfate overdose, most patients remained asymptomatic.
|
| Drug Interactions |
Sucralfate¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
Temazepam¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Pioglitazone Increased risk of edemaRosiglitazone Increased risk of edema
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Sucralfate¿¡ ´ëÇÑ Food Interaction Á¤º¸ Avoid alcohol.Take on empty stomach: 1 hour before or 2 hours after meals.Take with a full glass of water.Do not take calcium, aluminum, magnesium or Iron supplements within 2 hours of taking this medication.
Temazepam¿¡ ´ëÇÑ Food Interaction Á¤º¸ Avoid alcohol.Avoid excessive quantities of coffee or tea (Caffeine).Avoid avocado.
|
| Drug Target |
[Drug Target]
|
| Description |
Sucralfate¿¡ ´ëÇÑ Description Á¤º¸ A basic aluminum complex of sulfated sucrose. [PubChem]
Temazepam¿¡ ´ëÇÑ Description Á¤º¸ A benzodiazepine that acts as a gamma-aminobutyric acid modulator and anti-anxiety agent. [PubChem]
|
| Dosage Form |
Sucralfate¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Suspension OralTablet Oral
|
| Drug Category |
Sucralfate¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Ulcer Agents
Temazepam¿¡ ´ëÇÑ Drug_Category Á¤º¸ Adjuvants, AnesthesiaAnti-anxiety AgentsBenzodiazepinesGABA ModulatorsHypnotics and Sedatives
|
| Smiles String Canonical |
Sucralfate¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.[Al].[Al].[Al].[Al].[Al].[Al].[Al].[Al].[Al].OS(=O)(=O)OCC1OC(OC2(COS(O)(=O)=O)OC(OS(O)(=O)=O)C(OS(O)(=O)=O)C2OS(O)(=O)=O)C(OS(O)(=O)=O)C(OS(O)(=O)=O)C1OS(O)(=O)=O
Temazepam¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CN1C(=O)C(O)N=C(C2=CC=CC=C2)C2=C1C=CC(Cl)=C2
|
| Smiles String Isomeric |
Sucralfate¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.O.[Al].[Al].[Al].[Al].[Al].[Al].[Al].[Al].[Al].OS(=O)(=O)OC[C@H]1O[C@@H](O[C@]2(COS(O)(=O)=O)O[C@H](OS(O)(=O)=O)[C@@H](OS(O)(=O)=O)[C@@H]2OS(O)(=O)=O)[C@H](OS(O)(=O)=O)[C@@H](OS(O)(=O)=O)[C@@H]1OS(O)(=O)=O
Temazepam¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CN1C(=O)[C@@H](O)N=C(C2=CC=CC=C2)C2=C1C=CC(Cl)=C2
|
| InChI Identifier |
Sucralfate¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C11H20O35S8.9Al.20H2O/c12-47(13,14)36-1-3-4(41-49(18,19)20)5(42-50(21,22)23)6(43-51(24,25)26)9(38-3)39-11(2-37-48(15,16)17)8(45-53(30,31)32)7(44-52(27,28)29)10(40-11)46-54(33,34)35;;;;;;;;;;;;;;;;;;;;;;;;;;;;;/h3-10H,1-2H2,(H,12,13,14)(H,15,16,17)(H,18,19,20)(H,21,22,23)(H,24,25,26)(H,27,28,29)(H,30,31,32)(H,33,34,35);;;;;;;;;;20*1H2/t3-,4-,5+,6-,7+,8+,9+,10-,11-;;;;;;;;;;;;;;;;;;;;;;;;;;;;;/m1............................./s1/f/h12,15,18,21,24,27,30,33H;;;;;;;;;;;;;;;;;;;;;;;;;;;;;
Temazepam¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C16H13ClN2O2/c1-19-13-8-7-11(17)9-12(13)14(18-15(20)16(19)21)10-5-3-2-4-6-10/h2-9,15,20H,1H3
|
| Chemical IUPAC Name |
Sucralfate¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ aluminum; [(2R,3S,4S,5R)-4,5-disulfooxy-2-(sulfooxymethyl)-2-[(2S,3R,4S,5R,6R)-3,4,5-trisulfooxy-6-(sulfooxymethyl)oxan-2-yl]oxyoxolan-3-yl] hydrogen sulfate; icosahydrate
Temazepam¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 7-chloro-3-hydroxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2015-03-19
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|