| |
|
|
|
|
|
 |
| |
|
산라크민정 SANLACMIN TAB.[Biotin , Lactobacillus sporogenes , Takadiastase N1]
|
|
일반의약품 | 비급여
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| |
|
| 제품정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
[A01002621]
[보험코드에 따른 약품기본정보 직접조회]
\0 원/1정(2002.04.01)(최신약가)
[상병코드조회]
[질병코드집 다운로드]
|
| 제품성상 |
회갈색의 정제
[제형정보 확인]
|
| 포장·유통단위 |
250정 |
| Brandname 정보 |
Biotin
Brand Names/SynonymsNot Available
Brand Name MixturesNot Available
Chemical IUPAC Name5-(2-OXO-HEXAHYDRO-THIENO[3,4-D]IMIDAZOL-6-YL)-PENTANOIC ACID (4-NITRO-PHENYL)-AMIDE
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| Pharmacokinetics |
유료정보입니다.
|
| 병용금기 및 연령대금기 근거조회 |
[병용금기 및 연령대금기 근거조회]
|
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| 독성정보 |
Biotin에 대한 독성정보 : 정보보기
출처: 국립독성과학원 독성물질정보DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Biotin에 대한 Mechanism_Of_Action 정보
Biotin is necessary for the proper functioning of enzymes that transport carboxyl units and fix carbon dioxide, and is required for various metabolic functions, including gluconeogenesis, lipogenesis, fatty acid biosynthesis, propionate metabolism, and catabolism of branched-chain amino acids.
|
| Pharmacology |
Biotin에 대한 Pharmacology 정보
Biotin is a water-soluble B-complex vitamin which is composed of an ureido ring fused with a tetrahydrothiophene ring. A valeric acid substituent is attached to one of the carbon atoms of the tetrahydrothiophene ring. Biotin is used in cell growth, the production of fatty acids, metabolism of fats, and amino acids. It plays a role in the Kreb cycle, which is the process in which energy is released from food. Biotin not only assists in various metabolic chemical conversions, but also helps with the transfer of carbon dioxide. Biotin is also helpful in maintaining a steady blood sugar level. Biotin is often recommended for strengthening hair and nails. Consequenty, it is found in many cosmetic and health products for the hair and skin. Biotin deficiency is a rare nutritional disorder caused by a deficiency of biotin. Initial symptoms of biotin deficiency include: Dry skin, Seborrheic dermatitis, Fungal infections, rashes including erythematous periorofacial macular rash, fine and brittle hair, and hair loss or total alopecia. If left untreated, neurological symptoms can develop, including mild depression, which may progress to profound lassitude and, eventually, to somnolence; changes in mental status, generalized muscular pains (myalgias), hyperesthesias and paresthesias. The treatment for biotin deficiency is to simply start taking some biotin supplements. A lack of biotin in infants will lead to a condition called seborrheic dermatitis or "cradle cap". Biotin deficiencies are extremely rare in adults but if it does occur, it will lead to anemia, depression, hair loss, high blood sugar levels, muscle pain, nausea, loss of appetite and inflamed mucous membranes.
|
| Absorption |
Biotin에 대한 Absorption 정보
Systemic - approximately 50%
|
| Pharmacokinetics |
Biotin의 약물동력학자료
- 흡수 : 위장관에서 신속히 흡수됨
- 단백결합 : 높음, avidin에 결합하면 불활성화됨
- 분포 : 유즙분비됨
- 배설 : 과도하게 투여된 경우 biotin 자체 또는 대사체로 뇨배설됨
Lactobacillus sporogenes의 약물동력학자료
- 흡수 : 경구로 흡수되지 않는다.
- 분포 : 주로 대장에만 국소적으로 분포
- 소실 : 변으로 소실
|
| Biotransformation |
Biotin에 대한 Biotransformation 정보
Not Available
|
| Toxicity |
Biotin에 대한 Toxicity 정보
Prolonged skin contact may cause irritation.
|
| Drug Interactions |
Biotin에 대한 Drug_Interactions 정보
Not Available
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Drug Target |
[Drug Target]
|
| Description |
Biotin에 대한 Description 정보
A water-soluble, enzyme co-factor present in minute amounts in every living cell. It occurs mainly bound to proteins or polypeptides and is abundant in liver, kidney, pancreas, yeast, and milk. [PubChem]
|
| Dosage Form |
Biotin에 대한 Dosage_Form 정보
Powder, for solution OralTablet Oral
|
| Drug Category |
Biotin에 대한 Drug_Category 정보
Dietary supplementMicronutrientVitamin B ComplexVitamins (Vitamin B Complex)
|
| Smiles String Canonical |
Biotin에 대한 Smiles_String_canonical 정보
OC(=O)CCCCC1SCC2NC(=O)NC12
|
| Smiles String Isomeric |
Biotin에 대한 Smiles_String_isomeric 정보
OC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@H]12
|
| InChI Identifier |
Biotin에 대한 InChI_Identifier 정보
InChI=1/C10H16N2O3S/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15)/t6-,7-,9-/m0/s1/f/h11-13H
|
| Chemical IUPAC Name |
Biotin에 대한 Chemical_IUPAC_Name 정보
5-[(3aR,6S,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-6-yl]pentanoic acid
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2020-05-08
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
[의약품병용/연령대금기 고시근거로 바로가기] 제목 없음
2008년 8월 1일 약가화일상 8월달 신규등재 및 삭제되는 품목 포함한 병용연령 금기 품목리스트 기준
1. 현재 검색한 제품에 대한 병용금기 제품 존재여부 및 검색
현재 이제품에 대한 병용금기에 해당하는 청구코드별 제품내역 공지내용이 없습니다
2. 연령대금기 존재여부
현재 이제품에 대한 연령금기에 해당하는 청구코드별 공지내용이 없습니다
|
|
|
|
전문/일반
