| |
|
|
|
|
|
 |
| |
|
칼레스민연질캅셀 CALESMIN SOFT CAPSULE[Cholecalciferol , Oyster shell powder]
|
|
일반의약품 | 삭제
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| 항목 |
내용 |
| BIT 약효분류 |
칼슘 제제 / 비타민을 포함하는 칼슘 제제 (Calcium / with Vitamins)
|
| ATC 코드 |
Calcium, combinations with vitamin D and/or other drugs / A12AX
[코드분류상세설명]
[ATC코드예측]
|
| 복지부분류코드 |
321 (칼슘제 )
|
주성분코드 분석 및
중복처방 검토 |
[주성분코드 분석 및 중복처방 검토]
|
| Drugs By Indication |
[전체보기]
|
| Drugs By Classification |
[전체보기]
|
|
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 축약복약지도 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| Pharmacokinetics |
유료정보입니다.
|
| 병용금기 및 연령대금기 근거조회 |
[병용금기 및 연령대금기 근거조회]
|
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| Mechanism of Action |
Cholecalciferol에 대한 Mechanism_Of_Action 정보
The first step involved in the activation of vitamin D3 is a 25-hydroxylation which is catalysed by the 25-hydroxylase in the liver and then by other enzymes. The mitochondrial sterol 27-hydroxylase catalyses the first reaction in the oxidation of the side chain of sterol intermediates. The active form of vitamin D3 (calcitriol) binds to intracellular receptors that then function as transcription factors to modulate gene expression. Like the receptors for other steroid hormones and thyroid hormones, the vitamin D receptor has hormone-binding and DNA-binding domains. The vitamin D receptor forms a complex with another intracellular receptor, the retinoid-X receptor, and that heterodimer is what binds to DNA. In most cases studied, the effect is to activate transcription, but situations are also known in which vitamin D suppresses transcription. Calcitriol increases the serum calcium concentrations by: increasing GI absorption of phosphorus and calcium, increasing osteoclastic resorption, and increasing distal renal tubular reabsorption of calcium. Calcitriol appears to promote intestinal absorption of calcium through binding to the vitamin D receptor in the mucosal cytoplasm of the intestine. Subsequently, calcium is absorbed through formation of a calcium-binding protein.
|
| Pharmacology |
Cholecalciferol에 대한 Pharmacology 정보
Cholecalciferol (vitamin D3) is a steroid hormone that has long been known for its important role in regulating body levels of calcium and phosphorus, in mineralization of bone, and for the assimilation of Vitamin A. The classical manifestations of vitamin D deficiency is rickets, which is seen in children and results in bony deformaties including bowed long bones. Deficiency in adults leads to the disease osteomalacia. Both rickets and osteomalacia reflect impaired mineralization of newly synthesized bone matrix, and usually result from a combination of inadequate exposure to sunlight and decreased dietary intake of vitamin D. Common causes of vitamin D deficiency include genetic defects in the vitamin D receptor, severe liver or kidney disease, and insufficient exposure to sunlight. Vitamin D plays an important role in maintaining calcium balance and in the regulation of parathyroid hormone (PTH). It promotes renal reabsorption of calcium, increases intestinal absorption of calcium and phosphorus, and increases calcium and phosphorus mobilization from bone to plasma.
|
| Metabolism |
Cholecalciferol에 대한 Metabolism 정보
# Phase_1_Metabolizing_Enzyme:Cytochrome P450 24A1 (CYP24A1)Cytochrome P450 11A1 (CYP11A1)
|
| Protein Binding |
Cholecalciferol에 대한 단백결합 정보
50% to 80%
|
| Half-life |
Cholecalciferol에 대한 반감기 정보
Several weeks
|
| Absorption |
Cholecalciferol에 대한 Absorption 정보
Readily absorbed
|
| Pharmacokinetics |
Cholecalciferol의 약물동력학자료
- 흡수 : 위장관으로부터 잘 흡수된다.
- 분포 : 흡수 후 chylomicrons을 통해 혈중으로 수송되며, 주로 간에 저장되고 기타 지방, 근육, 피부 및 골 조직 등에도 존재한다.
- 단백결합 : 주로 vitamin D-binding α-globulin에 결합하며 albumin과도 결합한다.
- 대사 : 간에서 vitamin D 25-hydroxylase에 의해 25-[OH] D로 대사된 후, 신장에서 vitamin D 1-hydroxylase에 의해 활성형인 1,25-[OH]2 D로 대사된다.
- 반감기 : vitamin D : 혈장 내에서 19-25 시간
- 소실 : 주로 담즙 및 대변을 통해 배설되며 소량은 뇨를 통해 배설된다.
|
| Biotransformation |
Cholecalciferol에 대한 Biotransformation 정보
Within the liver, cholecalciferal is hydroxylated to calcidiol (25-hydroxycholecalciferol) by the enzyme 25-hydroxylase. Within the kidney, calcidiol serves as a substrate for 1-alpha-hydroxylase, yielding calcitriol (1,25-dihydroxycholecalciferol), the biologically active form of vitamin D3.
|
| Toxicity |
Cholecalciferol에 대한 Toxicity 정보
Hypercalcemia - Early symptoms of hypercalcemia, include nausea and vomiting, weakness, headache, somnolence, dry mouth, constipation, metallic taste, muscle pain and bone pain. Late symptoms and signs of hypercalcemia, include polyuria, polydipsia, anorexia, weight loss, nocturia, conjunctivitis, pancreatitis, photophobia, rhinorrhea, pruritis, hyperthermia, decreased libido, elevated BUN, albuminuria, hypercholesterolemia, elevated ALT (SGPT) and AST (SGOT), ectopic calcification, nephrocalcinosis, hypertension and cardiac arrhythmias.
|
| Drug Interactions |
Cholecalciferol에 대한 Drug_Interactions 정보
Not Available
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Drug Target |
[Drug Target]
|
| Description |
Cholecalciferol에 대한 Description 정보
Derivative of 7-dehydroxycholesterol formed by ultraviolet rays breaking of the C9-C10 bond. It differs from ergocalciferol in having a single bond between C22 and C23 and lacking a methyl group at C24. [PubChem]
|
| Dosage Form |
Cholecalciferol에 대한 Dosage_Form 정보
Capsule OralTablet Oral
|
| Drug Category |
Cholecalciferol에 대한 Drug_Category 정보
Antihypocalcemic AgentsAntihypoparathyroid AgentsBone Density Conservation AgentsEssential VitaminVitaminsVitamins (Vitamin D)
|
| Smiles String Canonical |
Cholecalciferol에 대한 Smiles_String_canonical 정보
CC(C)CCCC(C)C1CCC2C(CCCC12C)=CC=C1CC(O)CCC1=C
|
| Smiles String Isomeric |
Cholecalciferol에 대한 Smiles_String_isomeric 정보
CC(C)CCC[C@@H](C)[C@H]1CC[C@@H]2[C@]1(C)CCC\C2=C/C=C1\C[C@@H](O)CCC1=C
|
| InChI Identifier |
Cholecalciferol에 대한 InChI_Identifier 정보
InChI=1/C27H44O/c1-19(2)8-6-9-21(4)25-15-16-26-22(10-7-17-27(25,26)5)12-13-23-18-24(28)14-11-20(23)3/h12-13,19,21,24-26,28H,3,6-11,14-18H2,1-2,4-5H3/t21-,24+,25-,26+,27-/m1/s1
|
| Chemical IUPAC Name |
Cholecalciferol에 대한 Chemical_IUPAC_Name 정보
(1S)-3-[2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2018-02-24
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
[의약품병용/연령대금기 고시근거로 바로가기] 제목 없음
2008년 8월 1일 약가화일상 8월달 신규등재 및 삭제되는 품목 포함한 병용연령 금기 품목리스트 기준
1. 현재 검색한 제품에 대한 병용금기 제품 존재여부 및 검색
현재 이제품에 대한 병용금기에 해당하는 청구코드별 제품내역 공지내용이 없습니다
2. 연령대금기 존재여부
현재 이제품에 대한 연령금기에 해당하는 청구코드별 공지내용이 없습니다
|
|
|
|
전문/일반
