| |
|
|
|
|
|
 |
| |
|
피고셉액 PIGOSEPT SOLN[Alkyl diaminoethyl glycine hydrochloride , Isopropanol]
|
|
일반의약품 | 비급여
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
비급여
[상병코드조회]
[질병코드조회]
|
| 빠른조회 |
|
| 제품성상 |
미황색의 투명한 액을 흡착시킨 스폰지이다
[제형정보 확인] |
| 포장·유통단위 |
160G, 160G, 20 |
| 효능효과 |
[적응증 별 검색]
손, 피부소독, 수술부위의 소독, 수술부위의 점막소독, 피부점막의 소독, 창상부위의 소독
[Drugbank 의 성분정보열람]
[Glycine]
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
소독부위를 탈지면으로 닦아낸다.
|
| 이상반응 |
드물게 발진, 가려움증 등의 과민증상이 나타날 수 있으므로 이러한 경우에는 사용을 중지한다.
|
| Off-label Usage |
[조회]
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| 항목 |
내용 |
| BIT 약효분류 |
살균소독제 (Disinfectants)
|
| ATC 코드 |
Isopropanol / D08AX05
[코드분류상세설명]
[ATC코드예측]
|
| 복지부분류코드 |
261 (외피용살균소독제 )
|
| Drugs By Indication |
[전체보기]
|
| Drugs By Classification |
[전체보기]
|
|
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| Mechanism of Action |
glycine에 대한 Mechanism_Of_Action 정보
In the CNS, there exist strychnine-sensitive glycine binding sites as well as strychnine-insensitive glycine binding sites. The strychnine-insensitive glycine-binding site is located on the NMDA receptor complex. The strychnine-sensitive glycine receptor complex is comprised of a chloride channel and is a member of the ligand-gated ion channel superfamily. The putative antispastic activity of supplemental glycine could be mediated by glycine's binding to strychnine-sensitive binding sites in the spinal cord. This would result in increased chloride conductance and consequent enhancement of inhibitory neurotransmission. The ability of glycine to potentiate NMDA receptor-mediated neurotransmission raised the possibility of its use in the management of neuroleptic-resistant negative symptoms in schizophrenia.
Animal studies indicate that supplemental glycine protects against endotoxin-induced lethality, hypoxia-reperfusion injury after liver transplantation, and D-galactosamine-mediated liver injury. Neutrophils are thought to participate in these pathologic processes via invasion of tissue and releasing such reactive oxygen species as superoxide. In vitro studies have shown that neutrophils contain a glycine-gated chloride channel that can attenuate increases in intracellular calcium and diminsh neutrophil oxidant production. This research is ealy-stage, but suggests that supplementary glycine may turn out to be useful in processes where neutrophil infiltration contributes to toxicity, such as ARDS.
|
| Pharmacology |
glycine에 대한 Pharmacology 정보
Helps trigger the release of oxygen to the energy requiring cell-making process; Important in the manufacturing of hormones responsible for a strong immune system.
|
| Absorption |
glycine에 대한 Absorption 정보
Absorbed from the small intestine via an active transport mechanism.
|
| Pharmacokinetics |
Isopropanol의 약물동력학자료
- 흡수 : 위장관계로부터 신속하게 흡수되나 피부로부터는 거의 흡수되지 않는다.
- 대사 : ethyl alcohol보다 서서히 대사되며, 흡수된 약물의 약 15%는 acetone으로 대사된다.
|
| Biotransformation |
glycine에 대한 Biotransformation 정보
Hepatic
|
| Toxicity |
glycine에 대한 Toxicity 정보
ORL-RAT LD50 7930 mg/kg, SCU-RAT LD50 5200 mg/kg, IVN-RAT LD50 2600 mg/kg, ORL-MUS LD50 4920 mg/kg; Doses of 1 gram daily are very well tolerated. Mild gastrointestinal symptoms are infrequently noted. In one study doses of 90 grams daily were also well tole.
|
| Drug Interactions |
glycine에 대한 Drug_Interactions 정보
Not Available
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Drug Target |
[Drug Target]
|
| Description |
glycine에 대한 Description 정보
A non-essential amino acid. It is found primarily in gelatin and silk fibroin and used therapeutically as a nutrient. It is also a fast inhibitory neurotransmitter. [PubChem]
|
| Dosage Form |
glycine에 대한 Dosage_Form 정보
Liquid IrrigationSolution Intraperitoneal
|
| Drug Category |
glycine에 대한 Drug_Category 정보
Dietary supplementGlycine AgentsMicronutrientNon-Essential Amino Acids
|
| Smiles String Canonical |
glycine에 대한 Smiles_String_canonical 정보
NCC(O)=O
|
| Smiles String Isomeric |
glycine에 대한 Smiles_String_isomeric 정보
NCC(O)=O
|
| InChI Identifier |
glycine에 대한 InChI_Identifier 정보
InChI=1/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)/f/h4H
|
| Chemical IUPAC Name |
glycine에 대한 Chemical_IUPAC_Name 정보
2-aminoacetic acid
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2024-09-27
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
|
|
|
|
전문/일반
