| |
|
|
|
|
|
 |
| |
|
¼³°£±¸±¸¿¬°í SULGAN 99 OINTMENT
|
|
ÀϹÝÀǾàǰ | ºñ±Þ¿©
|
|
¼öÀÔÀǾàǰ
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
657200360[E01190021]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1g(2006.11.01)(ÇöÀç¾à°¡)
\174 ¿ø/1g(2004.10.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
ÀüÁú±ÕµîÇÑ ¹é»ö³»Áö ¹ÌȲ»öÀÇ ¿¬°íÁ¦
[Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
30±×¶÷/tube |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 30±×·¥ |
1 °³ |
Æ©ºê |
8806572003607 |
8806572003614 |
|
|
| ÁÖ¼ººÐÄÚµå |
337300COM
[µ¿ÀÏÇÑ ÁÖ¼ººÐÄڵ带 °¡Áø ¿À¸®Áö³¯ ¶Ç´Â Á¦³×¸¯ ÀǾàǰ Á¶È¸]
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
´ÙÀ½ °æ¿ìÀÇ ÀϽÃÀû ¿ÏÈ : Ä¡¿, Ä¡ÇÙ
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
1ÀÏ 2-3ȸ Àû·®À» ȯºÎ¿¡ Á÷Á¢ ¹Ù¸£°Å³ª Á÷Àå³» ÁÖÀÔÇÏ¿© »ç¿ëÇÕ´Ï´Ù.
Á÷Àå³» »ç¿ëÇÒ °æ¿ì µ¿ºÀÇÑ ºÎÂø¿ë±â¸¦ Æ©ºê¿¡ ¿¬°áÇØ¼ ¿ë±â°¡ Âû ¶§±îÁö Æ©ºê¸¦ § ÈÄ¿¡ »ðÀÔÇÕ´Ï´Ù.
|
| ±Ý±â |
30°³¿ù ÀÌÇÏÀÇ À¯¾Æ
|
| ½ÅÁßÅõ¿© |
1) ÀӺΠ¶Ç´Â ÀÓ½ÅÇϰí ÀÖÀ» °¡´É¼ºÀÌ ÀÖ´Â ºÎÀÎ
2) ÀÇ»çÀÇ Ä¡·á¸¦ ¹Þ°íÀִ ȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
1) ÀÌ ¾à »ç¿ë¿¡ ÀÇÇØ ¹ßÀû(ÃæÇ÷µÇ¾î ºÓ¾îÁü), ºÎÁ¾(ºÎ±â), Àڱذ¨ µîÀÇ Áõ»óÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â »ç¿ëÀ» ÁßÁöÇϰí ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »óÀÇÇÑ´Ù
2) ÀÌ ¾à »ç¿ë¿¡ ÀÇÇØ ¾Ë·¹¸£±âÁõ»ó(¹ßÁø, ¹ßÀû(ÃæÇ÷µÇ¾î ºÓ¾îÁü), °¡·Á¿ò µî)ÀÌ ³ªÅ¸³¯ °æ¿ì¿¡´Â »ç¿ëÀ» ÁßÁöÇϰí ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »óÀÇÇÑ´Ù
|
| »óÈ£ÀÛ¿ë |
Ç÷¾Ð°ÇÏÁ¦, Ç׿ì¿ï¾àÀ» Åõ¿©ÁßÀÎ °æ¿ì »ç¿ëÀü ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »óÀÇÇÑ´Ù.
|
| Related FDA Approved Drug |
±âÁØ ¼ººÐ: MENTHOLSALONPAS (MENTHOL; METHYL SALICYLATE)
±âÁØ ¼ººÐ: HAMAMELIS WATER±âÁØ ¼ººÐ: CAMPHOR±âÁØ ¼ººÐ: BENZOCAINE
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Á¦Çüº° º¹¾àÁöµµ |
[¿¬°í] |
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| µ¶¼ºÁ¤º¸ |
Benzocaine¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Camphor¿¡ ´ëÇÑ µ¶¼ºÁ¤º¸ : Á¤º¸º¸±â
Ãâó: ±¹¸³µ¶¼º°úÇпø µ¶¼º¹°ÁúÁ¤º¸DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Benzocaine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Benzocaine binds to sodium channel and reversibly stabilizes the neuronal membrane which decreases its permeability to sodium ions. Depolarization of the neuronal membrane is inhibited thereby blocking the initiation and conduction of nerve impulses.
Menthol¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Menthol is classified as a calcium channel blocker. Calcium channel blockers are a class of drugs with effects on many excitable cells of the body, like the muscle of the heart, smooth muscles of the vessels or neuron cells. Calcium channel blockers work by blocking voltage-sensitive calcium channels in the heart and in the blood vessels. This prevents calcium levels from increasing as much in the cells when stimulated, leading to less contraction.
|
| Pharmacology |
Benzocaine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Benzocaine is a local anesthetic commonly used as a topical pain reliever. It is the active ingredient in many over-the-counter analgesic ointments. It is also indicated for general use as a lubricant and topical anesthetic on intratracheal catheters and pharyngeal and nasal airways to obtund the pharyngeal and tracheal reflexes; on nasogastric and endoscopic tubes; urinary catheters; laryngoscopes; proctoscopes; sigmoidoscopes and vaginal specula.
Menthol¿¡ ´ëÇÑ Pharmacology Á¤º¸ Menthol is a covalent organic compound made synthetically or obtained from peppermint or other mint oils. Menthol's ability to chemically trigger cold-sensitive receptors in the skin is responsible for the well known cooling sensation that it provokes when inhalated, eaten, or applied to the skin. It should be noted that menthol does not cause an actual drop in temperature.
|
| Metabolism |
Benzocaine¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Not Available
|
| Protein Binding |
Menthol¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Not Available
|
| Half-life |
Benzocaine¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ Not Available
Menthol¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ Not Available
|
| Absorption |
Benzocaine¿¡ ´ëÇÑ Absorption Á¤º¸ Not Available
Menthol¿¡ ´ëÇÑ Absorption Á¤º¸ Not Available
|
| Pharmacokinetics |
MentholÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ¼Ò½Ç : Èí¼öµÈ ¾à¹°Àº glucuronide Æ÷ÇÕü·Î¼ ¼Òº¯ ¹× ´ãÁóÀ» ÅëÇØ ¹è¼³µÈ´Ù.
BenzocaineÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö
- ¿Ü¿ë : ¼Õ»óµÇÁö ¾ÊÀº ÇǺο¡ Àû¿ë½Ã Èí¼ö´Â ¸Å¿ì ÀûÁö¸¸, Á¡¸·À̳ª ¼Õ»óµÈ ÇǺηκÎÅÍ´Â Àß Èí¼öµÈ´Ù.
- ´ë»ç : Ç÷Àå°ú ÀϺΠ°£¿¡¼ cholinesterase¿¡ ÀÇÇØ °¡¼öºÐÇØµÈ´Ù.
- ¼Ò½Ç : ´ë»çü·Î ½Å¹è¼³
|
| Biotransformation |
Benzocaine¿¡ ´ëÇÑ Biotransformation Á¤º¸ Not Available
|
| Toxicity |
Benzocaine¿¡ ´ëÇÑ Toxicity Á¤º¸ LD50=3040 mg/kg (rat, oral)
Menthol¿¡ ´ëÇÑ Toxicity Á¤º¸ Menthol, DL: ORAL (LD50): Acute: 2900 mg/kg [Rat], 3100 mg/kg [Mouse]. DERMAL (LD50): Acute: 5001 mg/kg [Rabbit].
|
| Drug Interactions |
Benzocaine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
Menthol¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Drug Target |
[Drug Target]
|
| Description |
Benzocaine¿¡ ´ëÇÑ Description Á¤º¸ A surface anesthetic that acts by preventing transmission of impulses along nerve fibers and at nerve endings. [PubChem]
Camphor¿¡ ´ëÇÑ Description Á¤º¸ A bicyclic monoterpene ketone found widely in plants, especially cinnamomum camphora. It is used topically as a skin antipruritic and as an anti-infective agent. [PubChem]
Menthol¿¡ ´ëÇÑ Description Á¤º¸ Menthol is a covalent organic compound made synthetically or obtained from peppermint or other mint oils. It is a waxy, crystalline substance, clear or white in color, which is solid at room temperature and melts slightly above. The main form of menthol occurring in nature is (-)-menthol, which is assigned the (1R,2S,5R) configuration. Menthol has local anesthetic and counterirritant qualities, and it is widely used to relieve minor throat irritation.
|
| Drug Category |
Benzocaine¿¡ ´ëÇÑ Drug_Category Á¤º¸ AnestheticsAnesthetics, LocalAntipruriticsLocal Anesthetics
Camphor¿¡ ´ëÇÑ Drug_Category Á¤º¸ Anti-Infective Agents, Local
Menthol¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antipruritics
|
| Smiles String Canonical |
Benzocaine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CCOC(=O)C1=CC=C(N)C=C1
Camphor¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC1(C)C2CCC1(C)C(=O)C2
Menthol¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CC(C)C1CCC(C)CC1O
|
| Smiles String Isomeric |
Benzocaine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CCOC(=O)C1=CC=C(N)C=C1
Camphor¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CC1(C)[C@H]2CC[C@]1(C)C(=O)C2
Menthol¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O
|
| InChI Identifier |
Benzocaine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C9H11NO2/c1-2-12-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3
Camphor¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C10H16O/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7H,4-6H2,1-3H3
Menthol¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10-/m1/s1
|
| Chemical IUPAC Name |
Benzocaine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ ethyl 4-aminobenzoate
Camphor¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 1,7,7-trimethylbicyclo[2.2.1]heptan-2-one
Menthol¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-ol
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2025-11-03
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
|
|
|
|