| |
|
|
|
|
|
 |
| |
|
ÇÁ¸®ÆÊÁ¤500mg FREEPAM TAB. 500mg[Pralidoxime Chloride]
|
|
Àü¹®ÀǾàǰ | ºñ±Þ¿©
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
[A29550131]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1Á¤(2002.05.11)(ÇöÀç¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Æ÷À塤À¯Åë´ÜÀ§ |
50Á¤ |
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
À¯±âÀÎ Á¦Á¦ÀÇ Áßµ¶
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
*±¤¸í, ´ëÇÑ, Áß¿Ü, Çѱ¹À¯³ªÀÌÆ¼µå
¡Û ¼ºÀÎ : ¿°ÈÇÁ¶ö¸®µ¶½ÉÀ¸·Î¼ 1ÀÏ 1ȸ 1-2gÀ» »ý¸®½Ä¿°ÁÖ»ç¾× 100mL¿¡ ¿ëÇØ½ÃÄÑ 15-30ºÐ ÀÌ»ó¿¡ °ÉÃÄ Á¡ÀûÁ¤¸ÆÁÖ»çÇÑ´Ù. Çʿ信 µû¶ó 1½Ã°£ ÈÄ 1-2gÀ» ¹Ýº¹ÁÖ»çÇÒ ¼ö ÀÖ´Ù. Á¤Á¦ÀÇ °æ¿ì 1ÀÏ 1ȸ 1-2gÀ» °æ±¸Åõ¿©ÇÑ´Ù.
¡Û ¼Ò¾Æ : óÀ½ ÁÖÀԽà ÇÁ¶ö¸®µ¶½ÉÀ¸·Î¼ üÁß kg´ç 20-40mgÀ» »ý¸®½Ä¿°ÁÖ»ç¾×À¸·Î 5%¿ë¾×À» ¸¸µé¾î 30ºÐ ÀÌ»ó¿¡ °ÉÃÄ Á¡ÀûÁ¤¸ÆÁÖ»çÇÑ´Ù. Áßµ¶ÀÇ ½É°¢¼º°ú Ä¡·á¹ÝÀÀÀ» »ìÆì Åõ¿©Çϰí, ÇÊ¿äÇÑ °æ¿ì 1½Ã°£¿¡ Æò±Õ üÁß kg´ç 10mgÀÇ ¾çÀ» À¯ÁöÇÑ´Ù.
|
| ±Ý±â |
´ÙÀ½ ȯÀÚ¿¡´Â Åõ¿©ÇÏÁö ¸» °Í.
1) ÀÌ ¾à ¹× ±¸¼º¼ººÐ¿¡ °ú¹ÎÁõ ȯÀÚ
2) 40kg ¹Ì¸¸ÀÇ ¾î¸°ÀÌ
|
| ½ÅÁßÅõ¿© |
´ÙÀ½ ȯÀÚ¿¡´Â ½ÅÁßÈ÷ Åõ¿©ÇÒ °Í.
1) ±Ù¹«·ÂÁõ ȯÀÚ(±Ù¹«·ÂÁõÀ» ÃËÁø½Ãų ¼ö ÀÖ´Ù.)
2) ½ÅÀå¾Ö ȯÀÚ(¿ä·Î ¹è¼³µÇ¹Ç·Î ½ÅÀå¾Ö°¡ Àִ ȯÀÚ¿¡ Åõ¿© ½Ã Ç÷Áß³óµµ°¡ ³ô¾ÆÁú ¼ö ÀÖÀ¸¹Ç·Î °¨·®ÇÑ´Ù.)
|
| ÀÌ»ó¹ÝÀÀ |
Èå·Áº¸ÀÓ, º¹½Ã, Á¶ÀýÀå¾Ö, ¾îÁö·¯¿ò, µÎÅë, Á¹À½, ±¸³»°í¹Ì°¨, ±¸¿ª, Ç÷°üÀÇ ¼öÃà ¹× È®Àå, ºÎÁ¤¸Æ, ºü¸¥¸Æ(ºó¸Æ), ¼öÃà±â À̿ϱâ Ç÷¾Ð»ó½Â, °úµµÈ£Èí, ±Ù¹«·ÂÁõÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| »óÈ£ÀÛ¿ë |
1) ¾ÆÆ®·ÎÇɰú º´¿ë½Ã ¾ÆÆ®·ÎÇÉÈ(È«Á¶, µ¿°øÈ®´ë, ºü¸¥¸Æ(ºó¸Æ), ÄÚ¿Í ±¸°°ÇÁ¶)ÀÇ Â¡Èİ¡ ¾ÆÆ®·ÎÇÉ ´Üµ¶Åõ¿©½Ãº¸´Ù »¡¸® ³ªÅ¸³¯ ¼ö ÀÖÀ¸¹Ç·Î ¾ÆÆ®·ÎÇÉ Ã³Ä¡°¡ ³¡³ ÈÄ ¾àÀ» Åõ¿©ÇÑ´Ù.
2) ÀÌ ¾à »ç¿ë°ú Á÷Á¢Àû °ü·ÃÀº ¾øÁö¸¸ ¹Ù¸£ºñÃò·¹ÀÌÆ®´Â Ç×Äݸ°¿¡½ºÅ×¶ó¾ÆÁ¦¿¡ ÀÇÇØ ¾àÈ¿°¡ Áõ°¡µÇ¹Ç·Î, °æ·ÃÄ¡·á¿¡ ½ÅÁßÇÏ°Ô »ç¿ëÇÑ´Ù.
3) À¯±âÀÎÁßµ¶È¯ÀÚ¿¡°Ô ¸ð¸£ÇÉ, Å׿ÀÇʸ°, ¾Æ¹Ì³ëÇʸ°, ¼®½Ã´ÒÄݸ°, ·¹¼¼¸£ÇÉ, Æä³ëÄ¡¾ÆÁø°è ÁøÁ¤Á¦ Åõ¿©´Â ÇÇÇÑ´Ù.
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Pralidoxime¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Pralidoxime is an antidote to organophosphate pesticides and chemicals. Organophosphates bind to the esteratic site of acetylcholinesterase, which results initially in reversible inactivation of the enzyme. If given within 24 hours,after organophosphate exposure, pralidoxime reactivates the enzyme cholinesterase by cleaving the phosphate-ester bond formed between the organophosphate and acetylcholinesterase.
|
| Pharmacology |
Pralidoxime¿¡ ´ëÇÑ Pharmacology Á¤º¸ Pralidoxime is to reactivate cholinesterase (mainly outside of the central nervous system) which has been inactivated by phosphorylation due to an organophosphate pesticide or related compound. The destruction of accumulated acetylcholine can then proceed, and neuromuscular junctions will again function normally. Pralidoxime also slows the process of "aging" of phosphorylated cholinesterase to a nonreactivatable form, and detoxifies certain organophosphates by direct chemical reaction. The drug has its most critical effect in relieving paralysis of the muscles of respiration. Because pralidoxime is less effective in relieving depression of the respiratory center, atropine is always required concomitantly to block the effect of accumulated acetylcholine at this site. Pralidoxime relieves muscarinic signs and symptoms, salivation, bronchospasm, etc., but this action is relatively unimportant since atropine is adequate for this purpose.
|
| Metabolism |
Pralidoxime¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cholinesterase
|
| Protein Binding |
Pralidoxime¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ No binding to plasma proteins
|
| Half-life |
Pralidoxime¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 74-77 minutes
|
| Pharmacokinetics |
Pralidoxime ChlorideÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : À§Àå°ü¿¡¼ ¼¼È÷ Èí¼öµÊ
- ºÐÆ÷ : ¼¼Æ÷¿Ü¾×¿¡ ³Î¸® ºÐÆ÷Çϸç, ÁßÃ߽Űæ°è·Î´Â ½±°Ô ºÐÆ÷ÇÏÁö ¸øÇÔ
- ´Ü¹é°áÇÕ : Ç÷Áߴܹé°ú °áÇÕÇÏÁö ¾ÊÀ½
- ´ë»ç : °£´ë»ç
- ¹Ý°¨±â : 0.8-2.7 ½Ã°£
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : Á¤¸ÆÁÖ»ç : 5-15ºÐ À̳»
- ¼Ò½Ç : ´ë»çü¿Í ¹Ìº¯Èü·Î 80-90%°¡ ½Å¼ÓÈ÷ ½Å¹è¼³µÊ
|
| Biotransformation |
Pralidoxime¿¡ ´ëÇÑ Biotransformation Á¤º¸ Hepatic
|
| Toxicity |
Pralidoxime¿¡ ´ëÇÑ Toxicity Á¤º¸ Not Available
|
| Drug Interactions |
Pralidoxime¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Description |
Pralidoxime¿¡ ´ëÇÑ Description Á¤º¸ Pralidoxime is an antidote to organophosphate pesticides and chemicals. Organophosphates bind to the esteratic site of acetylcholinesterase, which results initially in reversible inactivation of the enzyme. If given within 24 hours,after organophosphate exposure, pralidoxime reactivates the enzyme cholinesterase by cleaving the phosphate-ester bond formed between the organophosphate and acetylcholinesterase.
|
| Dosage Form |
Pralidoxime¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Powder, for solution Intramuscular
|
| Drug Category |
Pralidoxime¿¡ ´ëÇÑ Drug_Category Á¤º¸ AntidotesCholinesterase Reactivators
|
| Smiles String Canonical |
Pralidoxime¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CN1C=CC=CC1=C[NH+]=O
|
| Smiles String Isomeric |
Pralidoxime¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CN1C=CC=C\C1=C/[NH+]=O
|
| InChI Identifier |
Pralidoxime¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C7H8N2O/c1-9-5-3-2-4-7(9)6-8-10/h2-6H,1H3/p+1/b7-6+/fC7H9N2O/h8H/q+1
|
| Chemical IUPAC Name |
Pralidoxime¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ [(E)-(1-methylpyridin-2-ylidene)methyl]-oxoazanium
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2014-10-28
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|