| |
|
|
|
|
|
 |
| |
|
¸¶Ãß¶õݼ¿50mg MATULANE CAPS.[Procarbazine HCl]
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
¼öÀÔÀǾàǰ
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
648000120[W01510011]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1ݼ¿(2007.11.15)(ÇöÀç¾à°¡)
\1,030 ¿ø/1ݼ¿(2003.01.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»öºÐ¸»ÀÌ µç ¹ÌȲ»ö ݼ¿ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
100CAPS |
| Æ÷À塤ÄÚµå´ÜÀ§ |
| ¾àǰ±Ô°Ý |
´ÜÀ§ |
Æ÷ÀåÇüÅ |
´ëÇ¥ÄÚµå |
Ç¥ÁØÄÚµå |
ºñ°í |
| 50¹Ð¸®±×·¥ |
100 ĸ½¶ |
º´ |
8806480001207 |
8806480001214 |
|
|
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
¾Ç¼º ÀÓÆÄÁ¾(À°Á¾, ÀÓÆÄÁ¾)
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
[ÁÖ¼ººÐÄÚµå:358101ACH ¿¡ µû¸¥ ½É»çÁöħ¿¶÷]
ÇÁ·ÎÄ«¹ÙÁøÀ¸·Î 1ÀÏ 50-100§·À» 1-2ȸ ºÐº¹À» ½ÃÀÛÀ¸·Î ±×Èķδ 1ÁÖÀϰ£ À̳» Á¡Â÷ Áõ°¡½ÃÄÑ 1ÀÏ 150-300§· 3ȸ ºÐº¹ÇÑ´Ù.
|
| ±Ý±â |
º»Á¦¿¡ ´ëÇØ °ú¹ÎÁõÀÇ ±â¿Õ·ÂÀÌ Àִ ȯÀÚ |
| ½ÅÁßÅõ¿© |
- ½ÅÀåÀåÇØ°¡ Àִ ȯÀÚ
- °£ÀåÇØ°¡ Àִ ȯÀÚ
- °ñ¼ö±â´É¾ïÁ¦°¡ Àִ ȯÀÚ
- °¨¿°ÁõÀ» ÇÕº´Çϰí Àִ ȯÀÚ
- ¼öµÎȯÀÚ(Ä¡¸íÀû Àü½ÅÀå¾Ö°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.)
- ¼Ò¾Æ
|
| ÀÌ»ó¹ÝÀÀ |
Ç÷¾×: ¹éÇ÷±¸ °¨¼Ò, Ç÷¼ÒÆÇ °¨»ç, °¡²û ÃâÇ÷, ºóÇ÷µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
°£Àå: °£ÀåÇØ°¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
½ÅÀå: °¡²û BUN»ó½ÂÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
¼Òȱâ: ½Ä¿åºÎÁø, ¿À½É, ±¸Åä, Çϸ®, °¡²ûº¯ºñ, º¹Åë, ±¸°¥, ±¸³»¿°µîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
ÇǺÎ: Å»¸ð, ¹ßÁø, °¡²ûÈ«¹Ý, »ö¼ÒÄ§Âø, ¼Ò¾ç, ÇǺκñÈĵîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
Á¤½Å½Å°æ°è: °¨°¢ÀÌ»ó, °Ç¹Ý»çÀúÇÏ, Á¹À½, ±Çۨ, ÁöÀü, µÎÅë, ÇöÈÆ, ½Å°æ°ú¹Î, ´ÙÇàÁõ, °æ·Ã, ¹ßÀÛ, È¥¼öµîÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
È£Èí±â: °£Áú¼º Æó·ÅÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
±âŸ: °¡²û ½É°èÇ×Áø, ¹ß¿, ±Ù·ÂÀúÇÏ, ±ÙÀ°ÅëÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| »óÈ£ÀÛ¿ë |
´ÙÀ½¾àǰ°ú º´¿ë½Ã ÀÛ¿ëÀÌ Áõ°µÇ±â ¶§¹®¿¡ º´¿ëÇÒ °æ¿ì ½ÅÁßÈ÷ Åõ¿©ÇÏ¿©¾ß ÇÑ´Ù.
- ¹Ù¸£ºñÅ»»ê À¯µµÃ¼, Æä³ëƼ¾ÆÁø À¯µµÃ¼, »ïȯ°è Ç׿ì¿ïÁ¦. ±³°¨½Å°æÈïºÐÁ¦
- ¾ËÄÝ¿¡ ´ëÇÏ¿©´Â ³»¼ºÀÌ ÀúÇϵǴ °æ¿ì°¡ ÀÖÀ¸¹Ç·Î Åõ¾àÁß ¾ËÄÝÀÇ ¼·Ã븦 ±ÝÇÏ¿©¾ß ÇÑ´Ù.
|
| Related FDA Approved Drug |
±âÁØ ¼ººÐ: PROCARBAZINE HYDROCHLORIDEMATULANE (PROCARBAZINE HYDROCHLORIDE)
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Dµî±Þ
(ÀӽŠ1±â Åõ¿© ±Ý±â )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
º¯ºñ°¡ »ý±æ¼ö ÀÖ½À´Ï´Ù. |
|
 |
¾îÁö·¯¿òÀÌ ÀÖÀ»¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Procarbazine¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ The precise mode of cytotoxic action of procarbazine has not been clearly defined. There is evidence that the drug may act by inhibition of protein, RNA and DNA synthesis. Studies have suggested that procarbazine may inhibit transmethylation of methyl groups of methionine into t-RNA. The absence of functional t-RNA could cause the cessation of protein synthesis and consequently DNA and RNA synthesis. In addition, procarbazine may directly damage DNA. Hydrogen peroxide, formed during the auto-oxidation of the drug, may attack protein sulfhydryl groups contained in residual protein which is tightly bound to DNA.
|
| Pharmacology |
Procarbazine¿¡ ´ëÇÑ Pharmacology Á¤º¸ Procarbazine is an antineoplastic in the class of alkylating agents and is used to treat various forms of cancer. Alkylating agents are so named because of their ability to add alkyl groups to many electronegative groups under conditions present in cells. They stop tumor growth by cross-linking guanine bases in DNA double-helix strands - directly attacking DNA. This makes the strands unable to uncoil and separate. As this is necessary in DNA replication, the cells can no longer divide. In addition, these drugs add methyl or other alkyl groups onto molecules where they do not belong which in turn inhibits their correct utilization by base pairing and causes a miscoding of DNA. Procarbazine is cell-phase specific for the S phase of cell division.
|
| Metabolism |
Procarbazine¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Xanthine dehydrogenase/oxidase
|
| Protein Binding |
Procarbazine¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ Not Available
|
| Half-life |
Procarbazine¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 10 minutes
|
| Absorption |
Procarbazine¿¡ ´ëÇÑ Absorption Á¤º¸ Procarbazine is rapidly and completely absorbed.
|
| Pharmacokinetics |
Procarbazine HClÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- Èí¼ö : °æ±¸·Î ºü¸£°í ¿ÏÀüÇÏ°Ô Èí¼öµÊ
- ºÐÆ÷ : ³úÇ÷°ü À庮(BBB)¸¦ Åë°úÇÏ¿© CSF·Î ºÐÆ÷
- ´ë»ç : °£°ú ½ÅÀå¿¡¼ ´ë»ç
- ¹è¼³ : ¼Òº¯°ú È£Èí±â¸¦ ÅëÇØ ¹è¼³µÇ¸ç 70%°¡ ´ë»çü·Î ¹è¼³µÊ
|
| Biotransformation |
Procarbazine¿¡ ´ëÇÑ Biotransformation Á¤º¸ Procarbazine is metabolized primarily in the liver and kidneys. The drug appears to be auto-oxidized to the azo derivative with the release of hydrogen peroxide. The azo derivative isomerizes to the hydrazone, and following hydrolysis splits into a benzylaldehyde derivative and methylhydrazine. The methylhydrazine is further degraded to CO2 and CH4 and possibly hydrazine, whereas the aldehyde is oxidized to N-isopropylterephthalamic acid, which is excreted in the urine.
|
| Toxicity |
Procarbazine¿¡ ´ëÇÑ Toxicity Á¤º¸ LD50=785 mg/kg (orally in rats)
|
| Drug Interactions |
Procarbazine¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Not Available
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Procarbazine¿¡ ´ëÇÑ Food Interaction Á¤º¸ Not Available
|
| Drug Target |
[Drug Target]
|
| Description |
Procarbazine¿¡ ´ëÇÑ Description Á¤º¸ An antineoplastic agent used primarily in combination with mechlorethamine, vincristine, and prednisone (the MOPP protocol) in the treatment of Hodgkin&
|
| Dosage Form |
Procarbazine¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Capsule Oral
|
| Drug Category |
Procarbazine¿¡ ´ëÇÑ Drug_Category Á¤º¸ Antineoplastic Agents
|
| Smiles String Canonical |
Procarbazine¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CNNCC1=CC=C(C=C1)C(=O)NC(C)C
|
| Smiles String Isomeric |
Procarbazine¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CNNCC1=CC=C(C=C1)C(=O)NC(C)C
|
| InChI Identifier |
Procarbazine¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C12H19N3O/c1-9(2)15-12(16)11-6-4-10(5-7-11)8-14-13-3/h4-7,9,13-14H,8H2,1-3H3,(H,15,16)/f/h15H
|
| Chemical IUPAC Name |
Procarbazine¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 4-[(2-methylhydrazinyl)methyl]-N-propan-2-ylbenzamide
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2021-12-09
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
The database contains the following fields: The generic name of each chemical For module A10 (liver enzyme composite module): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the number of active and marginally active scores for each compound at the five individual endpoints (see research article for full description of method) Number of endpoints at which each compound is marginally active (M) Number of endpoints at which each compound is active (A) For modules A11 to A15 (alkaline phosphatase increased, SGOT increased, SGPT increased, LDH increased, and GGT increased, respectively): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the RI and ADR values (see the research article for full description of method) Number of ADR reports for each compound, given as <4 or ¡Ã4 Reporting Index value for each compound, except where no shipping units were available (NSU) Group 1 comprises of compounds for which ADR data were available for the first five years of marketing, so when no ADR reports were listed during this period the compounds were evaluated as inactive. Group 2 comprises of compounds for which a 'steady state' period of ADR data were available (1992-1996). In cases where no ADR reports were filed during this period, the compounds were scored as 'NA' (data not available) since they may have had one or more ADR reports during their first five years of marketing which should not be negated by a lack of ADR reports during the steady-state period. PROCARBAZINE[GGT Increase][Composite Activity](Score) NA(Marginal) 0(Active) 0[Alkaline Phosphatase Increase](Activity Score) NA(Number of Rpts) NA(Index value) NA[SGOT Increase](Activity Score) NA(Number of Rpts) NA(Index value) NA[SGPT Increase](Activity Score) NA(Number of Rpts) NA(Index value) NA[LDH Increase](Activity Score) NA(Number of Rpts) NA(Index value) NA[GGT Increase](Activity Score) NA(Number of Rpts) NA(Index value) NA
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|