| |
|
|
|
|
|
 |
| |
|
마추란캅셀50mg MATULANE CAPS.[Procarbazine HCl]
|
|
전문의약품 | 삭제
|
|
수입의약품
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
648000120[W01510011]
[보험코드에 따른 약품기본정보 직접조회]
\0 원/1캅셀(2007.11.15)(현재약가)
\1,030 원/1캅셀(2003.01.01)(변경전약가)
[상병코드조회]
[질병코드조회]
|
| 빠른조회 |
|
| 제품성상 |
백색분말이 든 미황색 캅셀 [제형정보 확인] |
| 포장·유통단위 |
100CAPS |
| 포장·코드단위 |
| 약품규격 |
단위 |
포장형태 |
대표코드 |
표준코드 |
비고 |
| 50밀리그램 |
100 캡슐 |
병 |
8806480001207 |
8806480001214 |
|
|
| 허가사항 원문조회 |
[허가사항 원문조회]
|
| 효능효과 |
[적응증 별 검색]
악성 임파종(육종, 임파종)
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
[주성분코드:358101ACH 에 따른 심사지침열람]
프로카바진으로 1일 50-100㎎을 1-2회 분복을 시작으로 그후로는 1주일간 이내 점차 증가시켜 1일 150-300㎎ 3회 분복한다.
|
| 금기 |
본제에 대해 과민증의 기왕력이 있는 환자 |
| 신중투여 |
- 신장장해가 있는 환자
- 간장해가 있는 환자
- 골수기능억제가 있는 환자
- 감염증을 합병하고 있는 환자
- 수두환자(치명적 전신장애가 나타날 수 있다.)
- 소아
|
| 이상반응 |
혈액: 백혈구 감소, 혈소판 감사, 가끔 출혈, 빈혈등이 나타날 수 있다.
간장: 간장해가 나타날 수 있다.
신장: 가끔 BUN상승이 나타날 수 있다.
소화기: 식욕부진, 오심, 구토, 하리, 가끔변비, 복통, 구갈, 구내염등이 나타날 수 있다.
피부: 탈모, 발진, 가끔홍반, 색소침착, 소양, 피부비후등이 나타날 수 있다.
정신신경계: 감각이상, 건반사저하, 졸음, 권태감, 지전, 두통, 현훈, 신경과민, 다행증, 경련, 발작, 혼수등이 나타날 수 있다.
호흡기: 간질성 폐렴이 나타날 수 있다.
기타: 가끔 심계항진, 발열, 근력저하, 근육통이 나타날 수 있다.
|
| 상호작용 |
다음약품과 병용시 작용이 증강되기 때문에 병용할 경우 신중히 투여하여야 한다.
- 바르비탈산 유도체, 페노티아진 유도체, 삼환계 항우울제. 교감신경흥분제
- 알콜에 대하여는 내성이 저하되는 경우가 있으므로 투약중 알콜의 섭취를 금하여야 한다.
|
| Related FDA Approved Drug |
기준 성분: PROCARBAZINE HYDROCHLORIDEMATULANE (PROCARBAZINE HYDROCHLORIDE)
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| 항목 |
내용 |
| 대표코드 |
8806480001207 |
| BIT 약효분류 |
세포독성 항암제(Cytotoxic agents)
|
| ATC 코드 |
Procarbazine / L01XB01
[코드분류상세설명]
[ATC코드예측]
|
| 복지부분류코드 |
421 (항악성종양제 )
|
| 의약품 바코드정보 |
내용보기
마추란캅셀50밀리그람/ W01510011
제품규격: 50밀리그램/제품수량: 100/제형: 캡슐
폼목기준코드: 199504159 /대표코드: 8806480001207/표준코드: 8806480001214
구바코드: -/비고:-
|
주성분코드 분석 및
중복처방 검토 |
[주성분코드 분석 및 중복처방 검토]
|
| Drugs By Indication |
[전체보기]
|
| Drugs By Classification |
[전체보기]
|
|
|
| 제품정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
648000120[W01510011]
[보험코드에 따른 약품기본정보 직접조회]
\0 원/1캅셀(2007.11.15)(최신약가)
\1,030 원/1캅셀(2003.01.01)(변경전약가)
[상병코드조회]
[질병코드집 다운로드]
|
| 제품성상 |
백색분말이 든 미황색 캅셀
[제형정보 확인]
|
| 포장·유통단위 |
100CAPS |
| 보관방법 |
밀폐용기, 차광, 실온보관 |
동일주성분코드
검색순위 |
유료정보입니다.
|
특수관리의약품
부가정보 |
유료정보입니다.
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : D등급
(임신 1기 투여 금기 )
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
| Pharmacokinetics |
유료정보입니다.
|
| 병용금기 및 연령대금기 근거조회 |
[병용금기 및 연령대금기 근거조회]
|
| 복약라벨 |
| 이미지 |
복약설명 |
 |
변비가 생길수 있습니다. |
|
 |
어지러움이 있을수 있습니다. |
|
|
| * |
복약이미지는 모든 복약지도 사항을 표시한것은 아니며, 추가적으로 업데이트되거나 수정될 수 있습니다. |
| * |
복약이미지의 표시여부는 실제 약물복용시 중요도에 따른것은 아니며 단순히 허가정보상 키워드를 기준으로 등록되었습니다. |
| * |
귀하가 복약이미지 정보를 신뢰함은 전적으로 귀하의 책임입니다. 드럭인포는 이에 대한 어떠한 보증도 하지 않습니다. |
|
|
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| Mechanism of Action |
Procarbazine에 대한 Mechanism_Of_Action 정보
The precise mode of cytotoxic action of procarbazine has not been clearly defined. There is evidence that the drug may act by inhibition of protein, RNA and DNA synthesis. Studies have suggested that procarbazine may inhibit transmethylation of methyl groups of methionine into t-RNA. The absence of functional t-RNA could cause the cessation of protein synthesis and consequently DNA and RNA synthesis. In addition, procarbazine may directly damage DNA. Hydrogen peroxide, formed during the auto-oxidation of the drug, may attack protein sulfhydryl groups contained in residual protein which is tightly bound to DNA.
|
| Pharmacology |
Procarbazine에 대한 Pharmacology 정보
Procarbazine is an antineoplastic in the class of alkylating agents and is used to treat various forms of cancer. Alkylating agents are so named because of their ability to add alkyl groups to many electronegative groups under conditions present in cells. They stop tumor growth by cross-linking guanine bases in DNA double-helix strands - directly attacking DNA. This makes the strands unable to uncoil and separate. As this is necessary in DNA replication, the cells can no longer divide. In addition, these drugs add methyl or other alkyl groups onto molecules where they do not belong which in turn inhibits their correct utilization by base pairing and causes a miscoding of DNA. Procarbazine is cell-phase specific for the S phase of cell division.
|
| Metabolism |
Procarbazine에 대한 Metabolism 정보
# Phase_1_Metabolizing_Enzyme:Xanthine dehydrogenase/oxidase
|
| Protein Binding |
Procarbazine에 대한 단백결합 정보
Not Available
|
| Half-life |
Procarbazine에 대한 반감기 정보
10 minutes
|
| Absorption |
Procarbazine에 대한 Absorption 정보
Procarbazine is rapidly and completely absorbed.
|
| Pharmacokinetics |
Procarbazine HCl의 약물동력학자료
- 흡수 : 경구로 빠르고 완전하게 흡수됨
- 분포 : 뇌혈관 장벽(BBB)를 통과하여 CSF로 분포
- 대사 : 간과 신장에서 대사
- 배설 : 소변과 호흡기를 통해 배설되며 70%가 대사체로 배설됨
|
| Biotransformation |
Procarbazine에 대한 Biotransformation 정보
Procarbazine is metabolized primarily in the liver and kidneys. The drug appears to be auto-oxidized to the azo derivative with the release of hydrogen peroxide. The azo derivative isomerizes to the hydrazone, and following hydrolysis splits into a benzylaldehyde derivative and methylhydrazine. The methylhydrazine is further degraded to CO2 and CH4 and possibly hydrazine, whereas the aldehyde is oxidized to N-isopropylterephthalamic acid, which is excreted in the urine.
|
| Toxicity |
Procarbazine에 대한 Toxicity 정보
LD50=785 mg/kg (orally in rats)
|
| Drug Interactions |
Procarbazine에 대한 Drug_Interactions 정보
Not Available
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Food Interaction |
Procarbazine에 대한 Food Interaction 정보
Not Available
|
| Drug Target |
[Drug Target]
|
| Description |
Procarbazine에 대한 Description 정보
An antineoplastic agent used primarily in combination with mechlorethamine, vincristine, and prednisone (the MOPP protocol) in the treatment of Hodgkin&
|
| Dosage Form |
Procarbazine에 대한 Dosage_Form 정보
Capsule Oral
|
| Drug Category |
Procarbazine에 대한 Drug_Category 정보
Antineoplastic Agents
|
| Smiles String Canonical |
Procarbazine에 대한 Smiles_String_canonical 정보
CNNCC1=CC=C(C=C1)C(=O)NC(C)C
|
| Smiles String Isomeric |
Procarbazine에 대한 Smiles_String_isomeric 정보
CNNCC1=CC=C(C=C1)C(=O)NC(C)C
|
| InChI Identifier |
Procarbazine에 대한 InChI_Identifier 정보
InChI=1/C12H19N3O/c1-9(2)15-12(16)11-6-4-10(5-7-11)8-14-13-3/h4-7,9,13-14H,8H2,1-3H3,(H,15,16)/f/h15H
|
| Chemical IUPAC Name |
Procarbazine에 대한 Chemical_IUPAC_Name 정보
4-[(2-methylhydrazinyl)methyl]-N-propan-2-ylbenzamide
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2021-12-09
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
The database contains the following fields: The generic name of each chemical For module A10 (liver enzyme composite module): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the number of active and marginally active scores for each compound at the five individual endpoints (see research article for full description of method) Number of endpoints at which each compound is marginally active (M) Number of endpoints at which each compound is active (A) For modules A11 to A15 (alkaline phosphatase increased, SGOT increased, SGPT increased, LDH increased, and GGT increased, respectively): Overall activity category for each compound (A for active, M for marginally active, or I for inactive) based on the RI and ADR values (see the research article for full description of method) Number of ADR reports for each compound, given as <4 or ≥4 Reporting Index value for each compound, except where no shipping units were available (NSU) Group 1 comprises of compounds for which ADR data were available for the first five years of marketing, so when no ADR reports were listed during this period the compounds were evaluated as inactive. Group 2 comprises of compounds for which a 'steady state' period of ADR data were available (1992-1996). In cases where no ADR reports were filed during this period, the compounds were scored as 'NA' (data not available) since they may have had one or more ADR reports during their first five years of marketing which should not be negated by a lack of ADR reports during the steady-state period. PROCARBAZINE[GGT Increase][Composite Activity](Score) NA(Marginal) 0(Active) 0[Alkaline Phosphatase Increase](Activity Score) NA(Number of Rpts) NA(Index value) NA[SGOT Increase](Activity Score) NA(Number of Rpts) NA(Index value) NA[SGPT Increase](Activity Score) NA(Number of Rpts) NA(Index value) NA[LDH Increase](Activity Score) NA(Number of Rpts) NA(Index value) NA[GGT Increase](Activity Score) NA(Number of Rpts) NA(Index value) NA
병용금기 및 특정연령대 금기 성분
[의약품병용/연령대금기 고시근거로 바로가기] 제목 없음
2008년 8월 1일 약가화일상 8월달 신규등재 및 삭제되는 품목 포함한 병용연령 금기 품목리스트 기준
1. 현재 검색한 제품에 대한 병용금기 제품 존재여부 및 검색
현재 이제품에 대한 병용금기에 해당하는 청구코드별 제품내역 공지내용이 없습니다
2. 연령대금기 존재여부
현재 이제품에 대한 연령금기에 해당하는 청구코드별 공지내용이 없습니다
|
|
|
|
전문/일반
