| |
|
|
|
|
|
 |
| |
|
카타파프 CATAPLASTER[Camphor , Menthol , Methyl Salicylate , Thymol]
|
|
일반의약품 | 비급여
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
[A10900391]
[보험코드에 따른 약품기본정보 직접조회]
\0 원/㎠/1매(2002.04.01)(현재약가)
[상병코드조회]
[질병코드조회]
|
| 빠른조회 |
|
| 효능효과 |
[적응증 별 검색]
진통,소염 : 염좌, 타박, 근육통, 관절통, 골절통요통, 견통, 신경통, 류마티통
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
[주성분코드:341200CPO 에 따른 심사지침열람]
1일 1∼2회 환부에 붙인다
|
| 금기 |
30개월이하의 유아 |
| 신중투여 |
- 약이나 화장품 등에 의한 알레르기 증상(발진, 발적, 가려움증 옻 등에 의한 피부염등이 나타난 적이 있는 사람
- 습윤이나 진무름이 심한 사람
- 의사의 치료를 받고 있는 사람
|
| Related FDA Approved Drug |
기준 성분: METHYL SALICYLATESALONPAS (MENTHOL; METHYL SALICYLATE)
기준 성분: MENTHOL기준 성분: CAMPHOR
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| 항목 |
내용 |
| BIT 약효분류 |
외용 소염진통제 (NSAIDs : Skin & Mucous Membrane)
|
| ATC 코드 |
Preparations with salicylic acid derivatives / M02AC
[코드분류상세설명]
[ATC코드예측]
|
| 복지부분류코드 |
264 (진통·진양·수렴·소염제 )
|
주성분코드 분석 및
중복처방 검토 |
[주성분코드 분석 및 중복처방 검토]
|
| Drugs By Indication |
[전체보기]
|
| Drugs By Classification |
[전체보기]
|
|
|
| 제품정보 |
|
|
|
|
| 복약정보 |
|
|
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| 독성정보 |
Camphor에 대한 독성정보 : 정보보기
출처: 국립독성과학원 독성물질정보DB : http://www.nitr.go.kr/nitr/contents/m134200/view.do |
| Mechanism of Action |
Menthol에 대한 Mechanism_Of_Action 정보
Menthol is classified as a calcium channel blocker. Calcium channel blockers are a class of drugs with effects on many excitable cells of the body, like the muscle of the heart, smooth muscles of the vessels or neuron cells. Calcium channel blockers work by blocking voltage-sensitive calcium channels in the heart and in the blood vessels. This prevents calcium levels from increasing as much in the cells when stimulated, leading to less contraction.
|
| Pharmacology |
Menthol에 대한 Pharmacology 정보
Menthol is a covalent organic compound made synthetically or obtained from peppermint or other mint oils. Menthol's ability to chemically trigger cold-sensitive receptors in the skin is responsible for the well known cooling sensation that it provokes when inhalated, eaten, or applied to the skin. It should be noted that menthol does not cause an actual drop in temperature.
|
| Protein Binding |
Menthol에 대한 단백결합 정보
Not Available
|
| Half-life |
Menthol에 대한 반감기 정보
Not Available
|
| Absorption |
Menthol에 대한 Absorption 정보
Not Available
|
| Pharmacokinetics |
Methyl Salicylate의 약물동력학자료
- 흡수 :
- 위장관으로부터 잘 흡수된다.
- 벗겨진 피부를 통해서도 흡수될 수 있다.
Menthol의 약물동력학자료
- 소실 : 흡수된 약물은 glucuronide 포합체로서 소변 및 담즙을 통해 배설된다.
|
| Toxicity |
Menthol에 대한 Toxicity 정보
Menthol, DL: ORAL (LD50): Acute: 2900 mg/kg [Rat], 3100 mg/kg [Mouse]. DERMAL (LD50): Acute: 5001 mg/kg [Rabbit].
|
| Drug Interactions |
Menthol에 대한 Drug_Interactions 정보
Not Available
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
|
| Drug Target |
[Drug Target]
|
| Description |
Camphor에 대한 Description 정보
A bicyclic monoterpene ketone found widely in plants, especially cinnamomum camphora. It is used topically as a skin antipruritic and as an anti-infective agent. [PubChem]
Menthol에 대한 Description 정보
Menthol is a covalent organic compound made synthetically or obtained from peppermint or other mint oils. It is a waxy, crystalline substance, clear or white in color, which is solid at room temperature and melts slightly above. The main form of menthol occurring in nature is (-)-menthol, which is assigned the (1R,2S,5R) configuration. Menthol has local anesthetic and counterirritant qualities, and it is widely used to relieve minor throat irritation.
|
| Dosage Form |
Menthol에 대한 Dosage_Form 정보
Cream TopicalGel TopicalLiquid NasalLiquid OralLiquid TopicalLozenge OralOintment TopicalPatch TopicalPowder TopicalSolution / drops OralSpray Topical
|
| Drug Category |
Camphor에 대한 Drug_Category 정보
Anti-Infective Agents, Local
Menthol에 대한 Drug_Category 정보
Antipruritics
|
| Smiles String Canonical |
Camphor에 대한 Smiles_String_canonical 정보
CC1(C)C2CCC1(C)C(=O)C2
Menthol에 대한 Smiles_String_canonical 정보
CC(C)C1CCC(C)CC1O
|
| Smiles String Isomeric |
Camphor에 대한 Smiles_String_isomeric 정보
CC1(C)[C@H]2CC[C@]1(C)C(=O)C2
Menthol에 대한 Smiles_String_isomeric 정보
CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O
|
| InChI Identifier |
Camphor에 대한 InChI_Identifier 정보
InChI=1/C10H16O/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7H,4-6H2,1-3H3
Menthol에 대한 InChI_Identifier 정보
InChI=1/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10-/m1/s1
|
| Chemical IUPAC Name |
Camphor에 대한 Chemical_IUPAC_Name 정보
1,7,7-trimethylbicyclo[2.2.1]heptan-2-one
Menthol에 대한 Chemical_IUPAC_Name 정보
(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-ol
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2015-02-04
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
[의약품병용/연령대금기 고시근거로 바로가기] 제목 없음
2008년 8월 1일 약가화일상 8월달 신규등재 및 삭제되는 품목 포함한 병용연령 금기 품목리스트 기준
1. 현재 검색한 제품에 대한 병용금기 제품 존재여부 및 검색
현재 이제품에 대한 병용금기에 해당하는 청구코드별 제품내역 공지내용이 없습니다
2. 연령대금기 존재여부
현재 이제품에 대한 연령금기에 해당하는 청구코드별 공지내용이 없습니다
|
|
|
|
전문/일반
