| |
|
|
|
|
|
 |
| |
|
¸ÞŬ¶óÁ¦Á¤ MECLASE TABS.[Metoclopramide , Simethicone , S-lase]
|
|
Àü¹®ÀǾàǰ | »èÁ¦
|
|
|
| |
 |
¾Ë¸²: |
µå·°ÀÎÆ÷¿¡¼´Â ÀǾàǰ ÀÎÅÍ³Ý ÆÇ¸Å¸¦ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
À¯·áȸ¿ø °áÀç½Ã¿¡´Â º¸´Ù ´Ù¾çÇÑ ¾à¹°Á¤º¸¸¦
ÀÌ¿ëÇÏ½Ç ¼ö ÀÖ½À´Ï´Ù.
À¯·áÁ¤º¸¸ñ·ÏÀº Àü¹®È¸¿øÀ¸·Î
·Î±×ÀÎ ÇϽøé È®ÀÎ °¡´ÉÇÕ´Ï´Ù.
|
|
|
 | Çã°¡Á¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
û±¸ÄÚµå(KDÄÚµå) ºñ±Þ¿©Á¡°ËÄÚµå »óÇÑ±Ý¾× |
645603300[A67350831]
[º¸ÇèÄڵ忡 µû¸¥ ¾àǰ±âº»Á¤º¸ Á÷Á¢Á¶È¸]
\0 ¿ø/1Á¤(2008.01.01)(ÇöÀç¾à°¡)
\0 ¿ø/1Á¤(2007.08.01)(º¯°æÀü¾à°¡)
[»óº´ÄÚµåÁ¶È¸]
[Áúº´ÄÚµåÁ¶È¸]
|
| ºü¸¥Á¶È¸ |
|
| Á¦Ç°¼º»ó |
¹é»öÀÇ ¿øÇü ´çÀÇÁ¤ [Á¦ÇüÁ¤º¸ È®ÀÎ] |
| Æ÷À塤À¯Åë´ÜÀ§ |
200,1000TABS |
| Çã°¡»çÇ× ¿ø¹®Á¶È¸ |
[Çã°¡»çÇ× ¿ø¹®Á¶È¸]
|
| È¿´ÉÈ¿°ú |
[ÀûÀÀÁõ º° °Ë»ö]
½Ä¿å°¨Åð(½Ä¿åºÎÁø), À§ºÎÆØ¸¸°¨, ¼ÒȺҷ®, °ú½Ä, ½Äü(À§Ã¼), ±¸¿ª, ±¸Åä, ¼ÒÈÃËÁø
|
| ¿ë¹ý¿ë·® |
* Àý´ë ÀÓÀǺ¹¿ëÇÏÁö ¸¶½Ã°í ¹Ýµå½Ã ÀÇ»ç ¶Ç´Â ¾à»ç¿Í »ó´ãÇϽñ⠹ٶø´Ï´Ù.
[󹿾à¾î]
[ÁÖ¼ººÐÄÚµå:295000ATB ¿¡ µû¸¥ ½É»çÁöħ¿¶÷]
¼ºÀÎ 1ȸ 1Á¤, 1ÀÏ 3ȸ ½ÄÈÄ¿¡ º¹¿ëÇÑ´Ù.
|
| ±Ý±â |
- ģũ·Ò¼º¼¼Æ÷Á¾ ȯÀÚ
- °¥»ö ¼¼Æ÷Á¾ÀÇ ÀǽÉÀÌ Àִ ȯÀÚ(±Þ°ÝÇÑ ½Â¾Ð¹ßÀÛÀ» ÀÏÀ¸Å³ ¿ì·Á°¡ ÀÖ´Ù.)
- ÀÌ ¾à¿¡ °ú¹Î¼ºÀ̳ª ºÒ³»¼ºÀ» ³ªÅ¸³»´Â ȯÀÚ
- À§Àå°ü ÃâÇ÷, ±â°èÀûÆó»öÁõ, õ°ø µî À§Àå°ü ¿îµ¿ ÀÚ±ØÀÌ À§ÇèÇÒ ¶§
|
| ½ÅÁßÅõ¿© |
- ¼Ò¾Æ(Ãßü¿Ü·ÎÁõ»óÀÌ ¹ßÇöµÇ±â ½±±â ¶§¹®¿¡ °ú·® Åõ¿©ÇÏÁö ¾Êµµ·Ï ÁÖÀÇÇÑ´Ù. ƯÈ÷ Å»¼ö»óÅÂ, ¹ß¿½Ã µî¿¡´Â ÁÖÀÇÇÑ´Ù.)
- °í·ÉÀÚ
- ½ÅÀå¾Ö ȯÀÚ
|
| ÀÌ»ó¹ÝÀÀ |
- ¸»¸°ÁõÈıº(¾Ç¼º½Å°æ¸¶ºñÁõÈıº):
¿îµ¿¸¶ºñ, ½ÉÇÑ ±ÙÀ°°Á÷, ¿¬Çϰï¶õ, ½Ç¾îÁõ, ºó¸Æ, Ç÷¾Ð º¯ÈµîÀÌ ³ªÅ¸³ª¸ç ¹ß¿ÀÌ ³ªÅ¸³ª´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇϰí ü³Ã°¢°ú ¼öºÐº¸±Þ µîÀÇ Àü½Å°ü¸®¿Í ÇÔ²² ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù. ÀÌ Áõ»óÀÇ ¹ßÇö½Ã¿¡´Â ¹éÇ÷±¸ Áõ°¡, Ç÷û CPKÄ¡ »ó½ÂÀÌ ÀÚÁÖ ³ªÅ¸³ª°í ¹Ì¿À±Û·Îºó´¢ÁõÀ» ¼ö¹ÝÇÏ´Â ½Å±â´É ÀúÇϰ¡ ³ªÅ¸³¯ ¼ö ÀÖ´Ù. ¶ÇÇÑ °í¿ÀÌ Áö¼ÓµÇ°í ÀÇ½Ä Àå¾Ö, È£Èí°ï¶õ, ¼øÈ¯ÇãÅ»°ú Å»¼ö Áõ»ó, ±Þ¼º½ÅºÎÀüÀ¸·Î ¹ßÀüÇØ¼ »ç¸ÁÇß´Ù´Â º¸°í°¡ ÀÖ´Ù.
³»ºÐºñ°è: µå¹°°Ô °£³úÀÇ ³»ºÐºñ ±â´ÉÁ¶ÀýÀÌ»ó(¼º¼±ÀÚ±ØÈ£¸£¸ó ¹× ÇÁ·Î¶ôƾ ºÐºñÀÌ»ó)¿¡ À¯·¡ÇÑ´Ù°í ÃßÁ¤µÇ´Â ¹«¿ù°æ, Áö¼Ó¼º À¯Áó ´©Ãâ ¹× ¿©¼ºÇü À¯¹æµîÀÌ ³ªÅ¸³ª´Â °æ¿ì°¡ ÀÖÀ¸¹Ç·Î ÃæºÐÈ÷ °üÂûÇϰí ÀÌ»óÀÌ ÀÎÁ¤µÇ´Â °æ¿ì Åõ¿©¸¦ ÁßÁöÇÑ´Ù.
Ãßü¿Ü·ÎÁõ»ó: µå¹°°Ô ¼öÁöÁøÀü, ±Ù°æÁ÷, °æ¡¤¾ÈºÎÀÇ ¿¬Ãà, ¾È±¸È¸Àü¹ßÀÛ, ÃÊÁ¶°¨ µîÀÇ Áõ»óÀÌ ¹ßÇöµÇ´Â °æ¿ì°¡ ÀÖÀ¸¹Ç·Î ÀÌ·¯ÇÑ Áõ»óÀÌ ³ªÅ¸³ª´Â °æ¿ì¿¡´Â Åõ¿©¸¦ ÁßÁöÇÑ´Ù. ¶ÇÇÑ ÀÌ·¯ÇÑ Áõ»óÀÌ °ÇÑ °æ¿ì¿¡´Â ÇׯÄŲ½¼Á¦ Åõ¿©µîÀÇ ÀûÀýÇÑ Ã³Ä¡¸¦ ÇÑ´Ù. ¶Ç, Àå±âÅõ¿©¿¡ ÀÇÇØ¼ µå¹°°Ô ÀÔÁÖÀÇ µîÀÇ ºÒ¼öÀǿÀÌ ³ªÅ¸³ª°í Åõ¿©ÁßÁö ÈÄ¿¡µµ Áö¼ÓµÇ´Â °æ¿ì°¡ ÀÖ´Ù.
¼Òȱâ°è: ¶§¶§·Î À§ÀÇ ±äÀå Áõ°¡, º¹Åë, ¼³»ç, º¯ºñÅëÀÇ Áõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
¼øÈ¯±â°è: µå¹°°Ô Ç÷¾Ð°ÇÏ, ºó¸Æ, ºÎÁ¤¸Æ µîÀÇ Áõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
Á¤½Å½Å°æ°è: ¶§¶§·Î µÎÅë, µÎÁß µå¹°°Ô È˺Ð, ºÒ¾È°¨ µîÀÇ Áõ»óÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
±âŸ: ¶§¶§·Î ±Çۨ ¶ÇÇÑ µå¹°°Ô ¹ßÁø, ºÎÁ¾ÀÌ ³ªÅ¸³¯ ¼ö ÀÖ´Ù.
|
| »óÈ£ÀÛ¿ë |
- ´ÙÀ½ ¾à¹°°úÀÇ º´¿ë¿¡ ÀÇÇØ ³»ºÐºñ ±â´É Á¶ÀýÀÌ»ó ¶Ç´Â Ãßü¿Ü·Î Áõ»óÀÌ ³ªÅ¸³ª±â ½¬¿öÁö¹Ç·Î À̵é°ú º´¿ëÇÒ °æ¿ì¿¡´Â ÃæºÐÈ÷ °üÂûÇÏ°í ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
: ´Ù¸¥ º¥Áî¾Æ¹Ìµå°è ¾à¹°(¼³ÇǸ®µå, Ƽ¾ÆÇÁ¸®µå µî), Æä³ëÄ¡¾ÆÁø°è Á¦Á¦(ÇÁ·ÎŬ·Î¸£Æä¶óÁø, Ŭ·Î¸£ÇÁ·Î¸¶Áø, µð¿¡Ä¥Æä¶óÁø µî), ºÎƼ·ÎÆä³í°è Á¦Á¦(ÇÒ·ÎÆä¸®µ¹ µî), ¶ó¿ì¿ïÇǾƾËÄ®·ÎÀ̵å Á¦Á¦(·¹¼¼¸£ÇÉ µî)
- µð±âÅ»¸®½ºÁ¦ Æ÷Ƚà ÁöÇ¥·Î µÇ´Â ±¸¿ª, ±¸Åä, ½Ä¿åºÎÁø Áõ»óÀ» ÀºÆóÇÒ ¼ö ÀÖÀ¸¹Ç·Î µð±âÅ»¸®½ºÁ¦ Åõ¿©ÁßÀΠȯÀÚÀÇ °æ¿ì¿¡´Â ÃæºÐÈ÷ °üÂûÇÏ°í ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
- Ä«¸£¹Ù¸¶Á¦ÇÉÀÇ Ç÷Á߳󵵸¦ ±Þ¼ÓÈ÷ »ó½Â½ÃŰ´Â °æ¿ì°¡ ÀÖÀ¸¹Ç·Î º´¿ëÇÏ´Â °æ¿ì¿¡´Â ÃæºÐÈ÷ °üÂûÇÏ°í ½ÅÁßÈ÷ Åõ¿©ÇÑ´Ù.
- À§Àå°ü ¿îµ¿¿¡ ´ëÇÑ ÀÌ ¾àÀÇ È¿°ú´Â Ç×Äݸ°Á¦ ¹× ¸¶¾à¼º ÁøÅëÁ¦ÂØ ÀÇÇØ ±æÇ׵ȴÙ. ÀÌ ¾àÀ» ¾ËÄÚ¿Ã, ÁøÁ¤Á¦, ÃÖ¸éÁ¦, ¸¶¾à, ½Å°æ¾ÈÁ¤Á¦¿Í º´¿ë½Ã ÁøÁ¤È¿°ú°¡ Áõ°¡µÈ´Ù.
|
| Related FDA Approved Drug |
|
|
|
 | Á¤º¸¿ä¾à |
|
|
|
µå·°ÀÎÆ÷ ÀǾàǰ ¿ä¾à/»ó¼¼Á¤º¸
|
|
 | ÄÚµå ¹× ºÐ·ùÁ¤º¸ |
|
|
| |
|
 | Á¦Ç°Á¤º¸ |
|
|
|
|
 | º¹¾àÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| LACTmed ¹Ù·Î°¡±â |
[¹Ù·Î°¡±â]
|
| ¾à¸®ÀÛ¿ë |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Ãà¾àº¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º¹¾àÁöµµ |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| ÀӺο¡´ëÇÑÅõ¿© |
| * |
ÀüüÀӽŠ±â°£º°·Î ¿©·¯µî±ÞÀÌ Á¸ÀçÇÒ ¼ö ÀÖÀ¸¸ç °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ º¸¿©Áý´Ï´Ù. ´Ü, º¹ÇÕÁ¦ÀÇ °æ¿ì ¸ðµç º¹ÇÕÁ¦¼ººÐ¿¡ ´ëÇÑ ÀÓºÎÅõ¿©µî±ÞÀÌ Ç¥½ÃµÈ°ÍÀº Àý´ë ¾Æ´Ï¸ç Ç¥½ÃµÈ°ÍÁß¿¡ °¡Àå À§Çèµµ°¡ ³ôÀº Á¤º¸¸¸ ³ªÅ¸³³´Ï´Ù.
|
|
|   |
 FDA : Cµî±Þ
(simethicone )
|
|
| * |
»ó±â ÀÓºÎÅõ¿©¿¡ ´ëÇÑ Á¤º¸´Â Àü»êó¸® µÇ¸é¼ ÀÔ·Â ¿À·ù °¡´É¼ºÀÌ Á¸ÀçÇÕ´Ï´Ù. ¿À·ù °¡´É¼ºÀ» ÃÖ¼ÒÈÇϱâ À§ÇÏ¿© ¸¹Àº ³ë·ÂÀ» ±â¿ïÀ̰í ÀÖÀ¸³ª, ±× Á¤È®¼º¿¡ ´ëÇÏ¿© È®½ÅÀ» µå¸± ¼ö ¾ø½À´Ï´Ù. ÀÌ¿¡ ´ëÇØ ȸ»ç´Â Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù.
|
| * |
¹Ýµå½Ã °ø½Å·Â ÀÖ´Â ¹®ÇåÀ» ´Ù½Ã Çѹø Âü°í ÇϽñ⠹ٶó¸ç ÀÇ»ç ¶Ç´Â ¾à»çÀÇ ÆÇ´Ü¿¡ µû¶ó Åõ¿©¿©ºÎ°¡ °áÁ¤µÇ¾î¾ß ÇÕ´Ï´Ù.
|
|
|
½ÅÀå¾Ö, °£Àå¾Ö½Ã ¿ë·®Á¶Àý |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| Pharmacokinetics |
À¯·áÁ¤º¸ÀÔ´Ï´Ù.
|
| º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸ |
[º´¿ë±Ý±â ¹× ¿¬·É´ë±Ý±â ±Ù°ÅÁ¶È¸]
|
| º¹¾à¶óº§ |
| À̹ÌÁö |
º¹¾à¼³¸í |
 |
º¯ºñ°¡ »ý±æ¼ö ÀÖ½À´Ï´Ù. |
|
|
| * |
º¹¾àÀ̹ÌÁö´Â ¸ðµç º¹¾àÁöµµ »çÇ×À» Ç¥½ÃÇѰÍÀº ¾Æ´Ï¸ç, Ãß°¡ÀûÀ¸·Î ¾÷µ¥ÀÌÆ®µÇ°Å³ª ¼öÁ¤µÉ ¼ö ÀÖ½À´Ï´Ù. |
| * |
º¹¾àÀ̹ÌÁöÀÇ Ç¥½Ã¿©ºÎ´Â ½ÇÁ¦ ¾à¹°º¹¿ë½Ã Á߿䵵¿¡ µû¸¥°ÍÀº ¾Æ´Ï¸ç ´Ü¼øÈ÷ Çã°¡Á¤º¸»ó Ű¿öµå¸¦ ±âÁØÀ¸·Î µî·ÏµÇ¾ú½À´Ï´Ù. |
| * |
±ÍÇϰ¡ º¹¾àÀ̹ÌÁö Á¤º¸¸¦ ½Å·ÚÇÔÀº ÀüÀûÀ¸·Î ±ÍÇÏÀÇ Ã¥ÀÓÀÔ´Ï´Ù. µå·°ÀÎÆ÷´Â ÀÌ¿¡ ´ëÇÑ ¾î¶°ÇÑ º¸Áõµµ ÇÏÁö ¾Ê½À´Ï´Ù. |
|
|
| º¸°ü»ó ÁÖÀÇ |
|
| Á¶Á¦½Ã ÁÖÀÇ |
|
|
|
 | ½É»çÁ¤º¸ |
|
|
|
|
 | ÇмúÁ¤º¸ |
|
|
| Ç׸ñ |
³»¿ë |
| DUR (ÀǾàǰ»ç¿ëÆò°¡) |
º´¿ë±Ý±â :
°í½ÃµÈ º´¿ë±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[»óÈ£ÀÛ¿ë/º´¿ë±Ý±â°Ë»ö]
¿¬·É´ë±Ý±â :
°í½ÃµÈ ¿¬·É±Ý±â ³»¿ëÀº ¾ø½À´Ï´Ù.
[¿¬·É´ë±Ý±â»ó¼¼°Ë»ö]
|
| Mechanism of Action |
Metoclopramide¿¡ ´ëÇÑ Mechanism_Of_Action Á¤º¸ Metoclopramide inhibits gastric smooth muscle relaxation produced by dopamine, therefore increasing cholinergic response of the gastrointestinal smooth muscle. It accelerates intestinal transit and gastric emptying by preventing relaxation of gastric body and increasing the phasic activity of antrum. Simultaneously, this action is accompanied by relaxation of the upper small intestine, resulting in an improved coordination between the body and antrum of the stomach and the upper small intestine. Metoclopramide also decreases reflux into the esophagus by increasing the resting pressure of the lower esophageal sphincter and improves acid clearance from the esophagus by increasing amplitude of esophageal peristaltic contractions. Metoclopramide's dopamine antagonist action raises the threshold of activity in the chemoreceptor trigger zone and decreases the input from afferent visceral nerves. Studies have also shown that high doses of metoclopramide can antagonize 5-hydroxytryptamine (5-HT) receptors in the peripheral nervous system in animals.
|
| Pharmacology |
Metoclopramide¿¡ ´ëÇÑ Pharmacology Á¤º¸ Metoclopramide, although chemically related to procainamide, does not possess local anesthetic or antiarrhythmic properties. Metoclopramide is used to enhance GI motility, to treat diabetic gastroparesis, as an antinauseant, and to facilitate intubation of the small bowel during radiologic examination. Metoclopramide may be used to treat chemotherapy-induced emesis and as a radiosensitizing agents in the treatment of non-small cell lung carcinoma and glioblastomas in the future.
|
| Metabolism |
Metoclopramide¿¡ ´ëÇÑ Metabolism Á¤º¸ # Phase_1_Metabolizing_Enzyme:Cytochrome P450 2D6 (CYP2D6)
|
| Protein Binding |
Metoclopramide¿¡ ´ëÇÑ ´Ü¹é°áÇÕ Á¤º¸ 30%
|
| Half-life |
Metoclopramide¿¡ ´ëÇÑ ¹Ý°¨±â Á¤º¸ 5-6 hr
|
| Absorption |
Metoclopramide¿¡ ´ëÇÑ Absorption Á¤º¸ Rapidly and well absorbed (oral bioavailability 80¡¾15.5%).
|
| Pharmacokinetics |
MetoclopramideÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ÀÛ¿ë¹ßÇö½Ã°£ :
- °æ±¸ : 0.5-1 ½Ã°£ À̳»
- Á¤¸ÆÁÖ»ç : 1-3ºÐ À̳»
- ÀÛ¿ëÁö¼Ó½Ã°£ : °æ±¸, ±ÙÀ°ÁÖ»ç, Á¤¸ÆÁÖ»ç : 1-2 ½Ã°£
- Èí¼ö : °æ±¸ : ½Å¼ÓÇÏ°Ô Àß Èí¼öµÊ
- »ýü³»ÀÌ¿ë·ü : Æò±Õ 80%
- ºÐÆ÷ : ÅÂ¹Ý Åë°ú, À¯Áó ºÐºñ
- ºÐÆ÷¿ëÀû : 3.5 L/kg
- ´Ü¹é°áÇÕ : 30%
- ¹Ý°¨±â : Á¤»ó ½Å±â´É : 4-7 ½Ã°£
- Ç÷ÁßÃÖ°í³óµµ µµ´Þ½Ã°£ : °æ±¸ : 1-2 ½Ã°£
- ¼Ò½Ç : ¹Ìº¯Èü ¹× ´ë»çü·Î¼ ´ëºÎºÐ ´¢¸¦ ÅëÇØ ¹è¼³µÊ (72½Ã°£ À̳»¿¡´Â ¾à 85%)
SimethiconeÀÇ ¾à¹°µ¿·ÂÇÐÀÚ·á
- ¼Ò½Ç : ¹Ìº¯Èü·Î º¯¹è¼³µÈ´Ù.
|
| Toxicity |
Metoclopramide¿¡ ´ëÇÑ Toxicity Á¤º¸ Oral, mouse LD50: 280 mg/kg. Signs of overdose include drowsiness, disorientation, and extrapyramidal reactions.
|
| Drug Interactions |
Metoclopramide¿¡ ´ëÇÑ Drug_Interactions Á¤º¸ Atovaquone The agent decreases the effect of atovaquoneCyclosporine Metoclopramide increases serum levels of cyclosporineLevodopa Levodopa decreases the effect of metoclopramideSuccinylcholine The agent increases the effect of succinylcholineVenlafaxine Possible serotoninergic syndrome with this combination
|
CYP450 Drug Interaction |
[CYP450 TableÁ÷Á¢Á¶È¸]
|
| Food Interaction |
Metoclopramide¿¡ ´ëÇÑ Food Interaction Á¤º¸ Food reduces availability, take 30 minutes before meals. Avoid alcohol.
|
| Drug Target |
[Drug Target]
|
| Description |
Metoclopramide¿¡ ´ëÇÑ Description Á¤º¸ A dopamine D2 antagonist that is used as an antiemetic. [PubChem]
|
| Dosage Form |
Metoclopramide¿¡ ´ëÇÑ Dosage_Form Á¤º¸ Liquid IntramuscularLiquid IntravenousLiquid OralTablet Oral
|
| Drug Category |
Metoclopramide¿¡ ´ëÇÑ Drug_Category Á¤º¸ AntiemeticsDopamine AntagonistsProkinetic Agents
|
| Smiles String Canonical |
Metoclopramide¿¡ ´ëÇÑ Smiles_String_canonical Á¤º¸ CCN(CC)CCNC(=O)C1=CC(Cl)=C(N)C=C1OC
|
| Smiles String Isomeric |
Metoclopramide¿¡ ´ëÇÑ Smiles_String_isomeric Á¤º¸ CCN(CC)CCNC(=O)C1=CC(Cl)=C(N)C=C1OC
|
| InChI Identifier |
Metoclopramide¿¡ ´ëÇÑ InChI_Identifier Á¤º¸ InChI=1/C14H22ClN3O2/c1-4-18(5-2)7-6-17-14(19)10-8-11(15)12(16)9-13(10)20-3/h8-9H,4-7,16H2,1-3H3,(H,17,19)/f/h17H
|
| Chemical IUPAC Name |
Metoclopramide¿¡ ´ëÇÑ Chemical_IUPAC_Name Á¤º¸ 4-amino-5-chloro-N-(2-diethylaminoethyl)-2-methoxybenzamide
|
|
|
 | »ç¿ëÀÚÄÁÅÙÃ÷ |
|
|
|
|
|
-
ÃÖ±ÙÁ¤º¸¼öÁ¤ÀÏ 2021-12-09
-
º» ¼öÁ¤ÀÏ Á¤º¸´Â Çã°¡Á¤º¸ ÀÌ¿ÜÀÇ ±âŸÁ¤º¸ ¼öÁ¤ÀÏÀ» ÀǹÌÇϹǷÎ, Çã°¡Á¤º¸¼öÁ¤ÀÏÀº º»¹®¿¡ Ç¥±âµÈ ³¯Â¥¸¦ ÂüÁ¶ÇϽñ⠹ٶø´Ï´Ù.
|
|
¾Ë¸² |
»ó¼¼Á¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×À» Åä´ë·Î ÀÛ¼ºµÇ¾úÀ¸¸ç ¿ä¾àÁ¤º¸´Â »ó¼¼Á¤º¸ ¹× ±âŸ¹®ÇåÀ» ±â¹ÝÀ¸·Î µå·°ÀÎÆ÷¿¡¼ ÆíÁýÇÑ ³»¿ëÀÔ´Ï´Ù. Á¦Ç°Çã°¡»çÇ×ÀÇ ¸ñÂ÷¿Í ´Ù¼Ò »óÀÌÇÒ ¼ö ÀÖ½À´Ï´Ù. |
|
°æ°í |
µå·°ÀÎÆ÷ ÀǾàÇмúÁ¤º¸´Â ½ÄǰÀǾàǰ¾ÈÀüóÀÇ Á¦Ç°Çã°¡»çÇ×, Çмú¹®Çå, Á¦¾àȸ»ç Á¦°øÁ¤º¸ µîÀ» ±Ù°Å·Î ÀÛ¼ºµÈ Âü°í Á¤º¸ÀÔ´Ï´Ù.
Á¤º¸ÀÇ Á¤È®¼ºÀ» À§ÇØ ³ë·ÂÇϰí ÀÖÀ¸³ª ÆíÁý»óÀÇ ¿À·ù, Çã°¡»çÇ× º¯°æ, Ãß°¡ÀûÀÎ Çмú¿¬±¸ ¶Ç´Â Àӻ󿬱¸ ¹ßÇ¥ µîÀ¸·Î ÀÎÇØ ¹ß»ýÇÏ´Â ¹®Á¦¿¡ ´ëÇØ µå·°ÀÎÆ÷´Â
Ã¥ÀÓÀ» ÁöÁö ¾Ê½À´Ï´Ù. ÀÚ¼¼ÇÑ ³»¿ëÀº ¡°Ã¥ÀÓÀÇ ÇÑ°è ¹× ¹ýÀû°íÁö¡±¸¦ ÂüÁ¶ÇØ ÁֽʽÿÀ.
¹Ýµå½Ã Á¦Á¶¡¤¼öÀÔ»ç, ÆÇ¸Å»ç, ÀÇ»ç, ¾à»ç¿¡°Ô ÃÖÁ¾ÀûÀ¸·Î È®ÀÎÇϽñ⠹ٶø´Ï´Ù.
ÀüÈ: 02-3486-1061 ¤Ó À̸ÞÀÏ: webmaster@druginfo.co.kr
|
|
¾Æ·¡ÀÇ ³»¿ëÀ» Æ÷ÇÔÇÑ Àüü µ¥ÀÌÅ͸¦ º¸½Ã·Á¸é
¿©±â·Î À̵¿ÇϽñ⠹ٶø´Ï´Ù.
º´¿ë±Ý±â ¹× ƯÁ¤¿¬·É´ë ±Ý±â ¼ººÐ
[ÀǾàǰº´¿ë/¿¬·É´ë±Ý±â °í½Ã±Ù°Å·Î ¹Ù·Î°¡±â] Á¦¸ñ ¾øÀ½
2008³â 8¿ù 1ÀÏ ¾à°¡ÈÀÏ»ó 8¿ù´Þ ½Å±ÔµîÀç ¹× »èÁ¦µÇ´Â ǰ¸ñ Æ÷ÇÔÇÑ º´¿ë¿¬·É ±Ý±â ǰ¸ñ¸®½ºÆ® ±âÁØ
1. ÇöÀç °Ë»öÇÑ Á¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â Á¦Ç° Á¸Àç¿©ºÎ ¹× °Ë»ö
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ º´¿ë±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 Á¦Ç°³»¿ª °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
2. ¿¬·É´ë±Ý±â Á¸Àç¿©ºÎ
ÇöÀç ÀÌÁ¦Ç°¿¡ ´ëÇÑ ¿¬·É±Ý±â¿¡ ÇØ´çÇϴ û±¸Äڵ庰 °øÁö³»¿ëÀÌ ¾ø½À´Ï´Ù
|
|
|
|