| |
|
|
|
|
|
 |
| |
|
무르페패취(피록시캄) MURUPE PATCH.[Piroxicam]
|
|
일반의약품 | 삭제
|
|
|
| |
 |
알림: |
드럭인포에서는 의약품 인터넷 판매를 하지 않습니다. |
|
|
|
|
|
|
|
 |
|
|
|
|
|
|
|
|
|
|
유료회원 결재시에는 보다 다양한 약물정보를
이용하실 수 있습니다.
유료정보목록은 전문회원으로
로그인 하시면 확인 가능합니다.
|
|
|
 | 허가정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
645400340[A04204081]
[보험코드에 따른 약품기본정보 직접조회]
\0 원/1매(2019.11.07)(현재약가)
\619 원/1매(2017.02.01)(변경전약가)
[상병코드조회]
[질병코드조회]
|
| 빠른조회 |
|
| 제품성상 |
갈색의 타원형점착성 폴리우레탄필름에 무색 투명한 폴리에스터 필름이 부착된 패취제 [제형정보 확인] |
| 포장·유통단위 |
48mg/매×3EA, 7EA |
| 포장·코드단위 |
| 약품규격 |
단위 |
포장형태 |
대표코드 |
표준코드 |
비고 |
| 48밀리그램 |
1 매 |
팩 |
8806454003404 |
8806454003435 |
|
| 48밀리그램 |
7 매 |
팩 |
8806454003404 |
8806454003428 |
|
| 48밀리그램 |
3 매 |
팩 |
8806454003404 |
8806454003411 |
|
|
| 주성분코드 |
214005CPC
[동일한 주성분코드를 가진 오리지날 또는 제네릭 의약품 조회]
|
| 허가사항 원문조회 |
[허가사항 원문조회]
|
| 효능효과 |
[적응증 별 검색]
퇴행성관절염(골(뼈)관절염), 건초염(힘줄윤활막염), 근육통, 골(뼈)관절통, 외상(상처) 후 동통(통증) 및 골절치유후의 동통(통증) 완화
|
| 약물음식간 상호작용 |
[조회]
|
| 용법용량 |
* 절대 임의복용하지 마시고 반드시 의사 또는 약사와 상담하시기 바랍니다.
[처방약어]
환부(질환 부위)에 2일마다 1매씩 부착한다.
단 목욕이나 샤워 후 또는 땀이 날 경우에는 1일 1매씩 부착할 수 있다.
환부(질환 부위)를 깨끗이 하고 건조시킨다. 약면의 박리지를 떼어낸 후 피부에 견고하게 부착시키고 손바닥으로 잘 눌러준다. 특히 패취 가장자리 부분이 잘 붙었는지 확인한다.
|
| 주요약물 상호작용 |
[조회]
|
| 금기 |
1) 이 약 또는 기타의 피록시캄 제제에 과민증의 병력이 있는 환자
2) 아스피린 천식(비스테로이드성 소염진통제 등에 의한 천식발작 유발) 또는 그 병력이 있는 환자 (중증 천식발작을 일으킬 수 있다.)
3)아스피린 또는 기타의 비스테로이드성 소염진통제에 두드러기, 비염 및 맥관부종을 일으킨 환자
4)14세 이하의 소아
|
| 신중투여 |
기관지 천식 환자(중증 천식발작을 일으킬 수 있다)
|
| 이상반응 |
1) 피부 : 때때로 국소의 가려움, 발적(충혈되어 붉어짐), 발진, 인설(비늘, 껍질), 습진·피부염, 접촉피부염, 홍반(붉은 반점), 드물게 광과민증이 나타날 수 있다. 이러한 증상이 심할 경우에는 사용을 중지한다.
2) 장기간 또는 과량투여시 전신이상반응으로 구역, 위장관 불쾌감, 호흡곤란, 신부전 및 신증후군 환자에서의 급성 간질성 신염(신장염)이 나타날 수 있다.
|
| Related FDA Approved Drug |
|
|
|
| 정보요약 |
|
|
|
드럭인포 의약품 요약/상세정보
|
|
| 코드 및 분류정보 |
|
|
| |
|
| 제품정보 |
|
|
| 항목 |
내용 |
청구코드(KD코드)
비급여점검코드
상한금액 |
645400340[A04204081]
[보험코드에 따른 약품기본정보 직접조회]
\0 원/1매(2019.11.07)(최신약가)
\619 원/1매(2017.02.01)(변경전약가)
[상병코드조회]
[질병코드집 다운로드]
|
| 제품성상 |
갈색의 타원형점착성 폴리우레탄필름에 무색 투명한 폴리에스터 필름이 부착된 패취제
[제형정보 확인]
|
| 포장·유통단위 |
48mg/매×3EA, 7EA |
| 보관방법 |
기밀용기, 실온(1-30℃)보관 |
동일주성분코드
검색순위 |
유료정보입니다.
|
|
|
| 복약정보 |
|
|
| 항목 |
내용 |
| LACTmed 바로가기 |
[바로가기]
|
| 약리작용 |
유료정보입니다.
|
| 축약복약지도 |
유료정보입니다.
|
| 복약지도 |
유료정보입니다.
|
| 임부에대한투여 |
| * |
전체임신 기간별로 여러등급이 존재할 수 있으며 가장 위험도가 높은 정보만 보여집니다. 단, 복합제의 경우 모든 복합제성분에 대한 임부투여등급이 표시된것은 절대 아니며 표시된것중에 가장 위험도가 높은 정보만 나타납니다.
|
|
| |
FDA : D등급
(임신 3기 혹은 출산이 가까운 시점에 투여될 경우 )
|
|
| * |
상기 임부투여에 대한 정보는 전산처리 되면서 입력 오류 가능성이 존재합니다. 오류 가능성을 최소화하기 위하여 많은 노력을 기울이고 있으나, 그 정확성에 대하여 확신을 드릴 수 없습니다. 이에 대해 회사는 책임을 지지 않습니다.
|
| * |
반드시 공신력 있는 문헌을 다시 한번 참고 하시기 바라며 의사 또는 약사의 판단에 따라 투여여부가 결정되어야 합니다.
|
|
|
신장애, 간장애시
용량조절 |
유료정보입니다.
|
| Pharmacokinetics |
유료정보입니다.
|
| 병용금기 및 연령대금기 근거조회 |
[병용금기 및 연령대금기 근거조회]
|
| 제형별 복약지도 |
[패취] |
| 보관상 주의 |
|
| 조제시 주의 |
|
|
|
| 심사정보 |
|
|
|
|
| 학술정보 |
|
|
| 항목 |
내용 |
| DUR (의약품사용평가) |
병용금기 :
고시된 병용금기 내용은 없습니다.
[상호작용/병용금기검색]
연령대금기 :
고시된 연령금기 내용은 없습니다.
[연령대금기상세검색]
|
| Mechanism of Action |
Piroxicam에 대한 Mechanism_Of_Action 정보
The antiinflammatory effect of Piroxicam may result from the reversible inhibition of cyclooxygenase, causing the peripheral inhibition of prostaglandin synthesis. The prostaglandins are produced by an enzyme called Cox-1. Piroxicam blocks the Cox-1 enzyme, resulting into the disruption of production of prostaglandins. Piroxicam also inhibits the migration of leukocytes into sites of inflammation and prevents the formation of thromboxane A2, an aggregating agent, by the platelets.
|
| Pharmacology |
Piroxicam에 대한 Pharmacology 정보
Piroxicam is in a class of drugs called nonsteroidal anti-inflammatory drugs (NSAIDs). Piroxicam works by reducing hormones that cause inflammation and pain in the body. Piroxicam is used to reduce the pain, inflammation, and stiffness caused by rheumatoid arthritis and osteoarthritis.
|
| Metabolism |
Piroxicam에 대한 Metabolism 정보
# Phase_1_Metabolizing_Enzyme:Not Available
|
| Half-life |
Piroxicam에 대한 반감기 정보
30 to 86 hours
|
| Absorption |
Piroxicam에 대한 Absorption 정보
Well absorbed following oral administration.
|
| Pharmacokinetics |
Piroxicam의 약물동력학자료
- 진통효과 발현시간 : 경구 : 1시간 이내
- 최대효과 발현시간 : 3-5 시간
- 단백결합 : 99%
- 대사 : 간대사
- 반감기 : 45-50 시간
- 소실 : 미변화체(5%) 및 대사체로서 주로 뇨를 통해, 소량은 대변으로 배설됨
|
| Biotransformation |
Piroxicam에 대한 Biotransformation 정보
Renal
|
| Toxicity |
Piroxicam에 대한 Toxicity 정보
Symptoms of overdose include drowsiness, nausea, stomach pain, and/or vomiting.
|
| Drug Interactions |
Piroxicam에 대한 Drug_Interactions 정보
Acebutolol Risk of inhibition of renal prostaglandinsAtenolol Risk of inhibition of renal prostaglandinsBetaxolol Risk of inhibition of renal prostaglandinsBevantolol Risk of inhibition of renal prostaglandinsBisoprolol Risk of inhibition of renal prostaglandinsCarteolol Risk of inhibition of renal prostaglandinsCarvedilol Risk of inhibition of renal prostaglandinsEsmolol Risk of inhibition of renal prostaglandinsLabetalol Risk of inhibition of renal prostaglandinsMetoprolol Risk of inhibition of renal prostaglandinsNadolol Risk of inhibition of renal prostaglandinsOxprenolol Risk of inhibition of renal prostaglandinsPenbutolol Risk of inhibition of renal prostaglandinsPindolol Risk of inhibition of renal prostaglandinsPractolol Risk of inhibition of renal prostaglandinsPropranolol Risk of inhibition of renal prostaglandinsSotalol Risk of inhibition of renal prostaglandinsTimolol Risk of inhibition of renal prostaglandinsRitonavir Ritonavir increases the toxicity of piroxicamWarfarin The NSAID increases the anticoagulant effectAcenocoumarol The NSAID increases the anticoagulant effectDicumarol The NSAID increases the anticoagulant effectAnisindione The NSAID increases the anticoagulant effectLithium The NSAID increases serum levels of lithiumMethotrexate The NSAID increases the effect and toxicity of methotrexateCyclosporine Monitor for nephrotoxicityAlendronate Increased risk of gastric toxicity
|
CYP450
Drug Interaction |
[CYP450 Table직접조회]
Piroxicam에 대한 P450 table
SUBSTRATES
CYP 2C9
NSAIDs:
diclofenac
ibuprofen
**piroxicam**
Oral Hypoglycemic Agents:
tolbutamide
glipizide
Angiotensin II Blockers:
NOT candesartan
irbesartan
losartan
NOT valsartan
celecoxib
fluvastatin naproxen
phenytoin
sulfamethoxazole
tamoxifen
tolbutamide
torsemide
warfarin
INHIBITORS
CYP 2C9
amiodarone
fluconazole
isoniazid
INDUCERS
CYP 2C9
rifampin
secobarbital
|
| Food Interaction |
Piroxicam에 대한 Food Interaction 정보
Take with food. Avoid alcohol.
|
| Drug Target |
[Drug Target]
|
| Description |
Piroxicam에 대한 Description 정보
A cyclooxygenase inhibiting, non-steroidal anti-inflammatory agent (NSAID) that is well established in treating rheumatoid arthritis and osteoarthritis and used for musculoskeletal disorders, dysmenorrhea, and postoperative pain. Its long half-life enables it to be administered once daily. [PubChem]
|
| Dosage Form |
Piroxicam에 대한 Dosage_Form 정보
Capsule OralSuppository RectalTablet Oral
|
| Drug Category |
Piroxicam에 대한 Drug_Category 정보
Anti-Inflammatory Agents, Non-SteroidalCyclooxygenase Inhibitors
|
| Smiles String Canonical |
Piroxicam에 대한 Smiles_String_canonical 정보
CN1S(=O)(=O)C2=CC=CC=C2C(=O)C1=C(O)NC1=CC=CC=N1
|
| Smiles String Isomeric |
Piroxicam에 대한 Smiles_String_isomeric 정보
CN1S(=O)(=O)C2=CC=CC=C2C(=O)\C1=C(/O)NC1=CC=CC=N1
|
| InChI Identifier |
Piroxicam에 대한 InChI_Identifier 정보
InChI=1/C15H13N3O4S/c1-18-13(15(20)17-12-8-4-5-9-16-12)14(19)10-6-2-3-7-11(10)23(18,21)22/h2-9,20H,1H3,(H,16,17)/b15-13+/f/h17H
|
| Chemical IUPAC Name |
Piroxicam에 대한 Chemical_IUPAC_Name 정보
(3E)-3-[hydroxy-(pyridin-2-ylamino)methylidene]-2-methyl-1,1-dioxobenzo[e]thiazin-4-one
|
| Drug-Induced Toxicity Related Proteins |
PIROXICAM 의 Drug-Induced Toxicity Related Protein정보
Replated Protein:Glycogen synthase
Drug:piroxicam
Toxicity:impairment into glycogen metabolism. liver unable to maintain glucose homeostasis.
[바로가기]
|
|
|
| 사용자컨텐츠 |
|
|
|
|
|
-
최근정보수정일 2024-07-25
-
본 수정일 정보는 허가정보 이외의 기타정보 수정일을 의미하므로, 허가정보수정일은 본문에 표기된 날짜를 참조하시기 바랍니다.
|
|
| 알림 |
상세정보는 식품의약품안전처의 제품허가사항을 토대로 작성되었으며 요약정보는 상세정보 및 기타문헌을 기반으로 드럭인포에서 편집한 내용입니다. 제품허가사항의 목차와 다소 상이할 수 있습니다. |
|
| 경고 |
드럭인포 의약학술정보는 식품의약품안전처의 제품허가사항, 학술문헌, 제약회사 제공정보 등을 근거로 작성된 참고 정보입니다.
정보의 정확성을 위해 노력하고 있으나 편집상의 오류, 허가사항 변경, 추가적인 학술연구 또는 임상연구 발표 등으로 인해 발생하는 문제에 대해 드럭인포는
책임을 지지 않습니다. 자세한 내용은 “책임의 한계 및 법적고지”를 참조해 주십시오.
반드시 제조·수입사, 판매사, 의사, 약사에게 최종적으로 확인하시기 바랍니다.
전화: 02-3486-1061 ㅣ 이메일: webmaster@druginfo.co.kr
|
|
아래의 내용을 포함한 전체 데이터를 보시려면
여기로 이동하시기 바랍니다.
병용금기 및 특정연령대 금기 성분
[의약품병용/연령대금기 고시근거로 바로가기] 제목 없음
2008년 8월 1일 약가화일상 8월달 신규등재 및 삭제되는 품목 포함한 병용연령 금기 품목리스트 기준
1. 현재 검색한 제품에 대한 병용금기 제품 존재여부 및 검색
현재 이제품에 대한 병용금기에 해당하는 청구코드별 제품내역 공지내용이 없습니다
2. 연령대금기 존재여부
현재 이제품에 대한 연령금기에 해당하는 청구코드별 공지내용이 없습니다
|
|
|
|
전문/일반
내용보기
